![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| zodiac.wav | 2016-02-22 14:36 | 4.7M | |
| zimmermansurveillanc..> | 2012-04-01 15:33 | 8.5M | |
| wwpc_150430_160006_S..> | 2015-04-30 17:00 | 562M | |
| wwpc_150423_160002_S..> | 2015-04-23 17:00 | 563M | |
| wwpc_150416_160002_S..> | 2015-04-16 17:00 | 562M | |
| wwpc_150409_160238_S..> | 2015-04-09 17:02 | 539M | |
| wwpc_150402_160016_S..> | 2015-04-02 17:00 | 564M | |
| wordsandthings_intro..> | 2015-06-26 12:45 | 4.3M | |
| words_150816_190747_..> | 2015-08-16 20:07 | 535M | |
| words_150628_190007_..> | 2015-06-28 20:00 | 558M | |
| wordnthings_150626_1..> | 2015-06-26 12:22 | 2.7M | |
| wordnthings_150626_1..> | 2015-06-26 12:21 | 8.3M | |
| wordnthings_150626_1..> | 2015-06-26 12:20 | 11M | |
| wordnthings_150626_1..> | 2015-06-26 12:19 | 7.5M | |
| wordnthings_150626_1..> | 2015-06-26 12:19 | 8.8M | |
| wordnthings_150626_1..> | 2015-06-26 12:18 | 3.8M | |
| witchfinding.wav | 2013-09-20 18:06 | 687K | |
| windhand-dots-110120..> | 2014-11-05 22:10 | 138M | |
| wilt.wav | 2012-03-03 18:47 | 6.8M | |
| whoosh.wav | 2000-05-25 06:38 | 21K | |
| whengoodactressesgob..> | 2013-04-29 09:48 | 5.0M | |
| wendell.WAV | 2011-06-30 22:38 | 80M | |
| weird satanatic guy ..> | 2016-05-03 16:19 | 5.7M | |
| weedeater-dots-11012..> | 2014-11-05 22:02 | 59M | |
| weebattle_150417_090..> | 2015-04-17 10:00 | 504M | |
| weebattle_150320_081..> | 2015-03-20 09:11 | 439M | |
| warning.wav | 2003-12-13 15:19 | 42K | |
| warfestxfactorjoebob..> | 2013-05-01 11:06 | 2.0M | |
| warfestxfactor1_1304..> | 2013-05-01 11:06 | 1.4M | |
| warfesttaproot_13042..> | 2013-05-01 11:06 | 2.3M | |
| warfestsunflowerdead..> | 2013-05-01 11:06 | 1.2M | |
| warfeststaroffmachin..> | 2013-05-01 11:06 | 1.6M | |
| warfestequinoxx_1304..> | 2013-05-01 11:06 | 743K | |
| warfestcore10_130428..> | 2013-05-01 11:06 | 1.5M | |
| warfestboyhitscar_13..> | 2013-05-01 11:06 | 2.4M | |
| vrr_clips_150304_112..> | 2015-03-04 12:27 | 20M | |
| vrr_clips_150304_112..> | 2015-03-04 11:21 | 50M | |
| vrr_clips_150304_111..> | 2015-03-04 12:29 | 26M | |
| vrr_clips_150304_111..> | 2015-03-04 12:29 | 41M | |
| vrr_clips_150304_111..> | 2015-03-04 12:29 | 41M | |
| vrr_clips_150304_110..> | 2015-03-04 11:05 | 43M | |
| vrr_clips_150304_110..> | 2015-03-04 11:04 | 3.5M | |
| vrr_150429_190004_SR..> | 2015-04-29 20:00 | 612M | |
| vrr_150408_190004_SR..> | 2015-04-08 20:00 | 563M | |
| vrr_150318_190001_SR..> | 2015-03-18 20:00 | 560M | |
| vrr_150304_200005_SR..> | 2015-03-04 20:00 | 576M | |
| vrr_150225_200005_SR..> | 2015-02-25 20:00 | 561M | |
| vortexradio_131227_1..> | 2013-12-27 18:00 | 558M | |
| vortexradio_131220_1..> | 2013-12-20 18:00 | 585M | |
| vortexradio_131129_1..> | 2013-11-29 18:03 | 587M | |
| vortexradio_131122_1..> | 2013-11-22 18:07 | 527M | |
| vortexradio_131115_1..> | 2013-11-15 18:00 | 711M | |
| vortexradio_131108_1..> | 2013-11-08 17:59 | 506M | |
| vortexradio_131101_1..> | 2013-11-01 17:59 | 480M | |
| vortexradio_131025_1..> | 2013-10-25 17:59 | 466M | |
| vojp_150315_180537_S..> | 2015-03-15 19:05 | 511M | |
| voice crap.wav | 2012-01-04 21:35 | 21M | |
| vm queue dump 1.wav | 2011-09-25 16:12 | 4.9M | |
| vm general 1.wav | 2011-09-25 16:10 | 2.9M | |
| verymanic_promo_1309..> | 2013-09-09 18:58 | 5.8M | |
| verymanic_160623_180..> | 2016-06-23 19:01 | 1.0G | |
| verymanic_160621_184..> | 2016-06-21 19:49 | 1.2G | |
| verymanic_160614_185..> | 2016-06-14 19:55 | 1.2G | |
| verymanic_160607_183..> | 2016-06-07 19:36 | 1.4G | |
| verymanic_160531_184..> | 2016-05-31 19:46 | 1.2G | |
| verymanic_160525_140..> | 2016-05-25 15:01 | 1.1G | |
| verymanic_160524_185..> | 2016-05-24 19:54 | 1.4G | |
| verymanic_160517_185..> | 2016-05-17 19:54 | 1.3G | |
| verymanic_160503_185..> | 2016-05-03 19:55 | 1.4G | |
| verymanic_160426_185..> | 2016-04-26 19:55 | 1.2G | |
| verymanic_160419_185..> | 2016-04-19 19:55 | 1.3G | |
| verymanic_160412_185..> | 2016-04-12 19:57 | 1.3G | |
| verymanic_160405_185..> | 2016-04-05 19:55 | 1.5G | |
| verymanic_160329_185..> | 2016-03-29 19:56 | 1.3G | |
| verymanic_160322_185..> | 2016-03-22 19:56 | 1.2G | |
| verymanic_160320_160..> | 2016-03-20 17:06 | 1.4G | |
| verymanic_160315_185..> | 2016-03-15 19:56 | 1.3G | |
| verymanic_160308_195..> | 2016-03-08 19:55 | 1.3G | |
| verymanic_160301_195..> | 2016-03-01 19:56 | 1.4G | |
| verymanic_160222_195..> | 2016-02-22 19:56 | 1.5G | |
| verymanic_160216_200..> | 2016-02-16 20:04 | 1.3G | |
| verymanic_160216_195..> | 2016-02-16 19:57 | 43M | |
| verymanic_160209_195..> | 2016-02-09 19:57 | 1.2G | |
| verymanic_160202_195..> | 2016-02-02 19:57 | 1.2G | |
| verymanic_160126_195..> | 2016-01-26 19:57 | 1.3G | |
| verymanic_160120_212..> | 2016-01-20 21:21 | 1.3G | |
| verymanic_160112_195..> | 2016-01-12 19:57 | 1.2G | |
| verymanic_160105_195..> | 2016-01-05 19:58 | 1.2G | |
| verymanic_151229_200..> | 2015-12-29 20:03 | 1.4G | |
| verymanic_151222_200..> | 2015-12-22 20:04 | 1.1G | |
| verymanic_151215_195..> | 2015-12-15 19:59 | 1.4G | |
| verymanic_140511_120..> | 2014-05-11 13:00 | 1.7G | |
| verymanic_140504_115..> | 2014-05-04 12:59 | 1.7G | |
| verymanic_140427_120..> | 2014-04-27 13:00 | 1.7G | |
| verymanic_140420_120..> | 2014-04-20 13:00 | 1.7G | |
| verymanic_140413_120..> | 2014-04-13 13:00 | 1.6G | |
| verymanic_140406_120..> | 2014-04-06 13:00 | 1.7G | |
| verymanic_140330_120..> | 2014-03-30 13:00 | 1.7G | |
| verymanic_140323_120..> | 2014-03-23 13:00 | 1.6G | |
| verymanic_140316_120..> | 2014-03-16 13:03 | 1.7G | |
| verymanic_140309_120..> | 2014-03-09 13:00 | 1.8G | |
| verymanic_140302_130..> | 2014-03-02 13:00 | 1.8G | |
| verymanic_140223_125..> | 2014-02-23 12:59 | 1.9G | |
| verymanic_140216_130..> | 2014-02-16 13:00 | 1.8G | |
| verymanic_140213_083..> | 2014-02-13 08:31 | 3.4M | |
| verymanic_140213_081..> | 2014-02-13 08:10 | 2.7M | |
| verymanic_140209_130..> | 2014-02-09 13:00 | 1.8G | |
| varietytalk_140308_1..> | 2014-03-08 14:07 | 582M | |
| varietytalk_140308_1..> | 2014-03-08 13:40 | 21M | |
| v.a spending.wav | 2015-03-04 12:29 | 26M | |
| v.a housing.wav | 2015-03-04 11:21 | 50M | |
| urban chaos bumper.wav | 2011-03-28 00:30 | 2.7M | |
| unkalbean_141128_201..> | 2014-11-28 20:19 | 427M | |
| unkalbean_141031_190..> | 2014-10-31 20:08 | 484M | |
| unkalbean_141024_190..> | 2014-10-24 20:04 | 536M | |
| unkalbean_141017_190..> | 2014-10-17 20:01 | 572M | |
| unkalbean_141010_190..> | 2014-10-10 20:07 | 513M | |
| unkalbean_141003_191..> | 2014-10-03 20:12 | 572M | |
| unkalbean_140926_190..> | 2014-09-26 20:04 | 522M | |
| unkalbean_140919_190..> | 2014-09-19 20:01 | 554M | |
| twwuad2.wav | 2012-07-18 09:42 | 5.0M | |
| tweetlife_151008_150..> | 2015-10-08 16:06 | 492M | |
| tweetlife_151001_151..> | 2015-10-01 16:16 | 523M | |
| tweetlife_151001_150..> | 2015-10-01 16:04 | 6.0M | |
| twbm-dots-11012014.wav | 2014-11-05 22:12 | 98M | |
| trump abortion.wav | 2016-04-05 15:06 | 16M | |
| trump 3.wav | 2016-04-05 15:14 | 6.6M | |
| trialbytvshow10.wav | 2012-04-01 18:46 | 20M | |
| trialbytvshow.wav | 2012-04-01 15:33 | 20M | |
| trayvonmartin.wav | 2012-03-25 11:49 | 17M | |
| track-20.wav | 2004-03-19 23:10 | 15M | |
| track-19.wav | 2004-06-13 19:28 | 30M | |
| track-18.wav | 2004-06-13 19:28 | 16M | |
| track-17.wav | 2004-06-13 19:28 | 29M | |
| track-16.wav | 2004-06-13 19:28 | 36M | |
| track-15.wav | 2004-06-13 19:28 | 39M | |
| track-14.wav | 2004-06-13 19:28 | 35M | |
| track-13.wav | 2004-06-13 19:28 | 36M | |
| track-12.wav | 2004-06-13 19:27 | 36M | |
| track-11.wav | 2004-06-13 19:27 | 47M | |
| track-10.wav | 2004-06-13 19:27 | 26M | |
| track-09.wav | 2004-06-13 19:27 | 31M | |
| track-08.wav | 2004-06-13 19:27 | 35M | |
| track-07.wav | 2004-06-13 19:27 | 30M | |
| track-06.wav | 2004-06-13 19:27 | 36M | |
| track-05.wav | 2004-06-13 19:26 | 45M | |
| track-04.wav | 2004-06-13 19:26 | 34M | |
| track-03.wav | 2004-06-13 19:26 | 39M | |
| track-02.wav | 2004-06-13 19:26 | 35M | |
| track-01.wav | 2004-06-13 19:26 | 36M | |
| toulouseshooter.wav | 2012-03-25 11:50 | 7.8M | |
| toofatfucks_121111_1..> | 2012-11-11 13:00 | 316M | |
| toofatfucks_121028_1..> | 2012-10-28 13:01 | 865M | |
| toofatfucks_121021_1..> | 2012-10-21 13:06 | 926M | |
| tony whitfield call ..> | 2011-05-11 22:51 | 6.5M | |
| tnr_160127_185809_WP..> | 2016-01-27 18:58 | 561M | |
| tnr_160120_185902_WP..> | 2016-01-20 18:59 | 549M | |
| tnr_160120_185627_WP..> | 2016-01-20 18:56 | 3.4M | |
| tnr_160113_185825_WP..> | 2016-01-13 18:58 | 552M | |
| tloae_outro.wav | 2013-10-15 03:35 | 2.4M | |
| tink.wav | 2000-06-13 05:47 | 2.7K | |
| timeoutcoach_140516_..> | 2014-05-16 21:59 | 1.2G | |
| timeoutcoach_140509_..> | 2014-05-09 22:00 | 1.2G | |
| timeoutcoach_140502_..> | 2014-05-02 22:04 | 1.2G | |
| timeoutcoach_140425_..> | 2014-04-25 21:59 | 1.3G | |
| timeoutcoach_140418_..> | 2014-04-18 21:59 | 1.2G | |
| timeoutcoach_140411_..> | 2014-04-11 22:00 | 1.2G | |
| timeoutcoach_140404_..> | 2014-04-04 22:01 | 1.3G | |
| timeoutcoach_140328_..> | 2014-03-28 22:03 | 1.2G | |
| timeoutcoach_140321_..> | 2014-03-21 21:59 | 1.2G | |
| timeoutcoach_140314_..> | 2014-03-14 21:59 | 1.2G | |
| timeoutcoach_140307_..> | 2014-03-07 21:59 | 1.2G | |
| timeoutcoach_140228_..> | 2014-02-28 22:00 | 1.2G | |
| timeoutcoach_140221_..> | 2014-02-21 22:00 | 1.2G | |
| timeoutcoach_140214_..> | 2014-02-14 22:03 | 1.2G | |
| timeoutcoach_140207_..> | 2014-02-07 21:59 | 1.2G | |
| timeout_promo_130921..> | 2013-09-21 13:43 | 262M | |
| timeout_promo_130921..> | 2013-09-21 13:17 | 35M | |
| timeout_promo_130921..> | 2013-09-21 13:14 | 9.5M | |
| timeout_promo_130921..> | 2013-09-21 13:12 | 8.2M | |
| timeout_promo_130921..> | 2013-09-21 13:09 | 17M | |
| timeout_promo_130921..> | 2013-09-21 12:59 | 93M | |
| timeout_130921_15572..> | 2013-09-21 15:57 | 80M | |
| thewrapparty_130615_..> | 2013-06-15 20:00 | 557M | |
| thewrapparty_130601_..> | 2013-06-01 20:00 | 553M | |
| thewrapparty_130518_..> | 2013-05-20 19:52 | 556M | |
| thewrapparty_130518_..> | 2013-05-18 20:02 | 556M | |
| thewrapparty_130511_..> | 2013-05-11 20:00 | 564M | |
| thewrapparty_130504_..> | 2013-05-04 20:03 | 29M | |
| thewrapparty_130504_..> | 2013-05-06 04:41 | 574M | |
| thewrapparty_130427_..> | 2013-04-27 19:59 | 552M | |
| thewrapparty_130420_..> | 2013-04-20 20:05 | 559M | |
| thewrapparty_130413_..> | 2013-04-13 19:59 | 549M | |
| thewhipappeal_131022..> | 2013-10-22 11:57 | 313K | |
| theweeklywrapup_1305..> | 2013-05-06 16:55 | 5.0M | |
| theweeklywrapup_1305..> | 2013-04-29 09:23 | 5.0M | |
| theweeklywrapup_1305..> | 2013-05-04 15:00 | 608M | |
| theweeklywrapup_1304..> | 2013-04-22 09:17 | 5.0M | |
| theweeklywrapup_1304..> | 2013-04-27 15:10 | 607M | |
| theweeklywrapup_1304..> | 2013-04-27 15:00 | 98M | |
| theweeklywrapup_1304..> | 2013-04-15 10:55 | 5.0M | |
| theweeklywrapup_1304..> | 2013-04-20 15:00 | 607M | |
| theweeklywrapup_1304..> | 2013-04-08 14:23 | 5.0M | |
| theweeklywrapup_1304..> | 2013-04-13 15:09 | 606M | |
| theweeklywrapup_1304..> | 2013-04-03 10:18 | 5.0M | |
| theweeklywrapup_1304..> | 2013-04-06 15:01 | 606M | |
| theweeklywrapup_1303..> | 2013-03-25 16:46 | 5.0M | |
| theweeklywrapup_1303..> | 2013-03-18 20:34 | 5.0M | |
| theweeklywrapup_1303..> | 2013-03-23 15:09 | 606M | |
| theweeklywrapup_1303..> | 2013-03-11 19:32 | 5.0M | |
| theweeklywrapup_1303..> | 2013-03-16 15:07 | 606M | |
| theweeklywrapup_1303..> | 2013-03-05 10:26 | 5.0M | |
| theweeklywrapup_1303..> | 2013-03-09 15:06 | 606M | |
| theweeklywrapup_1303..> | 2013-02-25 20:02 | 5.0M | |
| theweeklywrapup_1303..> | 2013-03-02 15:07 | 606M | |
| theweeklywrapup_1302..> | 2013-02-18 22:41 | 5.0M | |
| theweeklywrapup_1302..> | 2013-02-23 15:34 | 607M | |
| theweeklywrapup_1302..> | 2013-02-12 16:49 | 5.0M | |
| theweeklywrapup_1302..> | 2013-02-16 15:05 | 604M | |
| theweeklywrapup_1302..> | 2013-02-05 20:13 | 5.0M | |
| theweeklywrapup_1302..> | 2013-02-09 15:04 | 606M | |
| theweeklywrapup_1302..> | 2013-01-31 22:32 | 5.0M | |
| theweeklywrapup_1302..> | 2013-02-02 15:07 | 605M | |
| theweeklywrapup_1301..> | 2013-01-26 15:06 | 606M | |
| theweeklywrapup_1301..> | 2013-01-20 16:00 | 606M | |
| theweeklywrapup_1301..> | 2013-01-13 20:00 | 559M | |
| theweeklywrapup_1301..> | 2013-01-13 15:59 | 606M | |
| theweeklywrapup_1301..> | 2013-01-07 10:13 | 1.1M | |
| theweeklywrapup_1301..> | 2013-01-06 16:00 | 606M | |
| theweeklywrapup_1212..> | 2012-12-30 16:00 | 606M | |
| theweeklywrapup_1212..> | 2012-12-17 12:47 | 817K | |
| theweeklywrapup_1212..> | 2012-12-16 16:02 | 606M | |
| theweeklywrapup_1212..> | 2012-12-09 16:00 | 607M | |
| theweeklywrapup_1212..> | 2012-12-02 16:00 | 608M | |
| theweeklywrapup_1211..> | 2012-11-25 16:03 | 554M | |
| theweeklywrapup_1211..> | 2012-11-18 16:00 | 609M | |
| theweeklywrapup_1211..> | 2012-11-11 16:00 | 607M | |
| theweeklywrapup_1211..> | 2012-11-04 17:00 | 35M | |
| theweeklywrapup_1210..> | 2012-10-28 16:04 | 595M | |
| theweeklywrapup_1210..> | 2012-10-21 16:02 | 607M | |
| theweeklywrapup_1210..> | 2012-10-14 16:00 | 561M | |
| theweeklywrapup_1210..> | 2012-10-07 16:24 | 2.5M | |
| theweeklywrapup_1210..> | 2012-10-07 16:22 | 2.4M | |
| theweeklywrapup_1210..> | 2012-10-07 16:16 | 3.0M | |
| theweeklywrapup_1210..> | 2012-10-07 16:08 | 11M | |
| theweeklywrapup_1209..> | 2012-09-30 16:00 | 583M | |
| theweeklywrapup_1209..> | 2012-09-23 16:00 | 590M | |
| theweeklywrapup_1209..> | 2012-09-16 16:00 | 600M | |
| theweeklywrapup_1209..> | 2012-09-09 16:00 | 596M | |
| theweeklywrapup_1209..> | 2012-09-02 16:00 | 596M | |
| theweeklywrapup_1208..> | 2012-08-26 16:00 | 596M | |
| theweeklywrapup_1208..> | 2012-08-19 16:00 | 596M | |
| theweeklywrapup_1208..> | 2012-08-12 16:00 | 596M | |
| theweeklywrapup_1208..> | 2012-08-05 16:00 | 596M | |
| theweeklywrapup_1207..> | 2012-07-29 19:12 | 596M | |
| theweeklywrapup_1207..> | 2012-07-22 16:00 | 596M | |
| theweeklywrapup_1207..> | 2012-07-15 16:00 | 596M | |
| theweeklywrapup_1207..> | 2012-07-08 16:00 | 596M | |
| theweeklywrapup_1207..> | 2012-07-01 16:00 | 596M | |
| theweeklywrapup_1206..> | 2012-06-24 16:00 | 596M | |
| theweeklywrapup_1206..> | 2012-06-17 16:00 | 596M | |
| theweeklywrapup_1206..> | 2012-06-10 16:00 | 596M | |
| theweeklywrapup_1206..> | 2012-06-03 16:00 | 596M | |
| theweeklywrapup_1205..> | 2012-05-27 16:00 | 596M | |
| theweeklywrapup_1205..> | 2012-05-20 16:00 | 596M | |
| theweeklywrapup_1205..> | 2012-05-13 16:00 | 596M | |
| theweeklywrapup_1205..> | 2012-05-06 16:00 | 596M | |
| theweeklywrapup_1204..> | 2012-04-29 16:00 | 596M | |
| thesweetrelease_prom..> | 2014-01-21 19:48 | 214M | |
| thesweetrelease_prom..> | 2014-01-21 19:39 | 35M | |
| thequmranreport_1510..> | 2015-10-12 20:01 | 565M | |
| thequmranreport_1510..> | 2015-10-05 19:59 | 560M | |
| thequmranreport_1509..> | 2015-09-28 19:59 | 559M | |
| thequmranreport_1509..> | 2015-09-21 19:59 | 571M | |
| thequmranreport_1509..> | 2015-09-14 20:03 | 567M | |
| thequmranreport_1509..> | 2015-09-07 20:00 | 502M | |
| thequmranreport_1508..> | 2015-08-31 20:00 | 565M | |
| thequmranreport_1508..> | 2015-08-24 20:03 | 558M | |
| thequmranreport_1508..> | 2015-08-17 20:08 | 557M | |
| thequmranreport_1508..> | 2015-08-10 20:08 | 572M | |
| thequmranreport_1507..> | 2015-07-27 20:00 | 565M | |
| thequmranreport_1507..> | 2015-07-20 20:01 | 564M | |
| thequmranreport_1507..> | 2015-07-13 20:02 | 535M | |
| thequmranreport_1507..> | 2015-07-06 20:00 | 582M | |
| thequmranreport_1506..> | 2015-06-29 20:02 | 556M | |
| thequmranreport_1506..> | 2015-06-22 20:02 | 577M | |
| thequmranreport_1506..> | 2015-06-15 20:00 | 589M | |
| thequmranreport_1506..> | 2015-06-08 20:00 | 563M | |
| thequmranreport_1506..> | 2015-06-01 20:00 | 564M | |
| thequmranreport_1505..> | 2015-05-25 20:01 | 565M | |
| thequmranreport_1505..> | 2015-05-18 20:00 | 579M | |
| thequmranreport_1505..> | 2015-05-11 20:00 | 559M | |
| thequmranreport_1505..> | 2015-05-04 20:00 | 561M | |
| thequmranreport_1504..> | 2015-04-27 20:00 | 566M | |
| thequmranreport_1504..> | 2015-04-20 20:00 | 556M | |
| thequmranreport_1504..> | 2015-04-13 20:00 | 564M | |
| thequmranreport_1504..> | 2015-04-06 20:00 | 556M | |
| thequmranreport_1503..> | 2015-03-30 20:03 | 530M | |
| thequmranreport_1503..> | 2015-03-23 20:00 | 566M | |
| thequmranreport_1503..> | 2015-03-16 20:00 | 568M | |
| thequmranreport_1503..> | 2015-03-09 20:00 | 569M | |
| thequmranreport_1503..> | 2015-03-02 20:10 | 562M | |
| thequmranreport_1502..> | 2015-02-23 20:00 | 566M | |
| thequmranreport_1502..> | 2015-02-16 20:00 | 549M | |
| thequmranreport_1502..> | 2015-02-09 20:00 | 571M | |
| thequmranreport_1502..> | 2015-02-02 20:01 | 556M | |
| thequmranreport_1501..> | 2015-01-26 20:02 | 537M | |
| thequmranreport_1501..> | 2015-01-19 20:00 | 569M | |
| thequmranreport_1501..> | 2015-01-16 15:08 | 575M | |
| thequmranreport_1501..> | 2015-01-12 20:00 | 588M | |
| thequmranreport_1501..> | 2015-01-05 20:02 | 566M | |
| thequmranreport_1412..> | 2014-12-29 20:00 | 568M | |
| thequmranreport_1412..> | 2014-12-15 20:00 | 576M | |
| thequmranreport_1412..> | 2014-12-08 20:00 | 588M | |
| thequmranreport_1411..> | 2014-11-24 20:00 | 596M | |
| thequmranreport_1411..> | 2014-11-17 20:43 | 128M | |
| thequmranreport_1411..> | 2014-11-17 20:01 | 374M | |
| thequmranreport_1411..> | 2014-11-10 20:00 | 572M | |
| thequmranreport_1411..> | 2014-11-03 20:00 | 573M | |
| thequmranreport_1410..> | 2014-10-27 19:59 | 606M | |
| thequmranreport_1410..> | 2014-10-20 20:01 | 591M | |
| thequmranreport_1410..> | 2014-10-13 20:02 | 552M | |
| thequmranreport_1410..> | 2014-10-06 20:02 | 577M | |
| thequmranreport_1409..> | 2014-09-29 20:01 | 571M | |
| thequmranreport_1409..> | 2014-09-22 20:00 | 586M | |
| thequmranreport_1409..> | 2014-09-15 20:01 | 582M | |
| thequmranreport_1409..> | 2014-09-08 20:01 | 577M | |
| thequmranreport_1408..> | 2014-08-25 20:01 | 587M | |
| thequmranreport_1408..> | 2014-08-18 20:00 | 601M | |
| thequmranreport_1408..> | 2014-08-04 20:01 | 571M | |
| thequmranreport_1407..> | 2014-07-28 20:01 | 630M | |
| thequmranreport_1407..> | 2014-07-21 20:00 | 563M | |
| thequmranreport_1407..> | 2014-07-14 20:01 | 560M | |
| thequmranreport_1407..> | 2014-07-07 20:00 | 583M | |
| thequmranreport_1406..> | 2014-06-30 20:00 | 574M | |
| thequmranreport_1406..> | 2014-06-23 20:01 | 593M | |
| thequmranreport_1406..> | 2014-06-16 20:00 | 576M | |
| thequmranreport_1406..> | 2014-06-09 20:00 | 557M | |
| thequmranreport_1406..> | 2014-06-02 20:00 | 597M | |
| thequmranreport_1405..> | 2014-05-26 20:00 | 616M | |
| thequmranreport_1405..> | 2014-05-19 20:01 | 587M | |
| thequmranreport_1405..> | 2014-05-12 20:00 | 580M | |
| thequmranreport_1405..> | 2014-05-05 20:00 | 568M | |
| thequmranreport_1404..> | 2014-04-28 20:00 | 599M | |
| thequmranreport_1404..> | 2014-04-14 20:03 | 535M | |
| thequmranreport_1404..> | 2014-04-07 20:00 | 570M | |
| thequmranreport_1403..> | 2014-03-31 19:59 | 580M | |
| thequmranreport_1403..> | 2014-03-24 20:00 | 590M | |
| thequmranreport_1403..> | 2014-03-17 20:00 | 586M | |
| thequmranreport_1403..> | 2014-03-10 20:00 | 571M | |
| thequmranreport_1403..> | 2014-03-03 20:00 | 595M | |
| thequmranreport_1402..> | 2014-02-24 20:00 | 581M | |
| thequmranreport_1402..> | 2014-02-17 20:01 | 582M | |
| thequmranreport_1402..> | 2014-02-03 20:00 | 597M | |
| thequmranreport_1401..> | 2014-01-27 20:03 | 582M | |
| thequmranreport_1401..> | 2014-01-20 20:03 | 583M | |
| thequmranreport_1401..> | 2014-01-13 20:01 | 589M | |
| thequmranreport_1401..> | 2014-01-06 20:00 | 613M | |
| thequmranreport_1312..> | 2013-12-16 20:01 | 590M | |
| thequmranreport_1312..> | 2013-12-09 20:03 | 597M | |
| thequmranreport_1312..> | 2013-12-04 15:48 | 15M | |
| thequmranreport_1312..> | 2013-12-04 15:34 | 3.1M | |
| thequmranreport_1312..> | 2013-12-04 15:29 | 3.6M | |
| thequmranreport_1312..> | 2013-12-04 15:27 | 7.5M | |
| thequmranreport_1312..> | 2013-12-04 03:38 | 15M | |
| thequmranreport_1312..> | 2013-12-02 20:01 | 581M | |
| thequmranreport_1311..> | 2013-11-25 20:00 | 604M | |
| thequmranreport_1311..> | 2013-11-18 20:00 | 616M | |
| thequmranreport_1311..> | 2013-11-11 20:01 | 603M | |
| thequmranreport_1311..> | 2013-11-04 20:03 | 575M | |
| thequmranreport_1310..> | 2013-10-28 20:00 | 658M | |
| thequmranreport_1310..> | 2013-10-21 20:02 | 594M | |
| thequmranreport_1310..> | 2013-10-14 20:03 | 590M | |
| thequmranreport_1310..> | 2013-10-07 20:00 | 658M | |
| thequmranreport_1309..> | 2013-09-30 20:01 | 585M | |
| thequmranreport_1309..> | 2013-09-23 19:59 | 625M | |
| thequmranreport_1309..> | 2013-09-16 20:03 | 579M | |
| thequmranreport_1309..> | 2013-09-09 20:01 | 597M | |
| thequmranreport_1309..> | 2013-09-02 20:01 | 609M | |
| thequmranreport_1308..> | 2013-08-26 20:00 | 569M | |
| thequmranreport_1308..> | 2013-08-19 20:00 | 573M | |
| thequmranreport_1308..> | 2013-08-12 20:00 | 637M | |
| thequmranreport_1308..> | 2013-08-05 19:59 | 622M | |
| thequmranreport_1307..> | 2013-07-29 20:02 | 604M | |
| thequmranreport_1307..> | 2013-07-22 20:03 | 591M | |
| thequmranreport_1307..> | 2013-07-15 20:03 | 575M | |
| thequmranreport_1307..> | 2013-07-08 19:59 | 566M | |
| thequmranreport_1306..> | 2013-06-24 20:00 | 560M | |
| thequmranreport_1306..> | 2013-06-17 20:00 | 558M | |
| thequmranreport_1306..> | 2013-06-10 20:03 | 568M | |
| thequmranreport_1306..> | 2013-06-03 19:59 | 579M | |
| thequmranreport_1305..> | 2013-05-27 19:59 | 566M | |
| thequmranreport_1305..> | 2013-05-20 20:01 | 568M | |
| thequmranreport_1305..> | 2013-05-13 20:00 | 558M | |
| thequmranreport_1305..> | 2013-05-06 20:00 | 566M | |
| thequmranreport_1304..> | 2013-04-23 14:27 | 561M | |
| thequmranreport_1304..> | 2013-04-15 20:04 | 566M | |
| thequmranreport_1304..> | 2013-04-08 20:00 | 574M | |
| thequmranreport_1303..> | 2013-03-18 20:00 | 582M | |
| thequmranreport_1303..> | 2013-03-11 20:00 | 563M | |
| thequmranreport_1303..> | 2013-03-04 20:00 | 572M | |
| thequmranreport_1302..> | 2013-02-25 20:00 | 567M | |
| thequmranreport_1302..> | 2013-02-18 20:00 | 560M | |
| thequmranreport_1302..> | 2013-02-11 20:00 | 604M | |
| thequmranreport_1302..> | 2013-02-04 20:00 | 1.5M | |
| thequmranreport_1301..> | 2013-01-28 20:00 | 597M | |
| thequmranreport_1301..> | 2013-01-21 19:59 | 563M | |
| thequmranreport_1212..> | 2012-12-17 20:00 | 3.9M | |
| thequmranreport_1212..> | 2012-12-10 20:00 | 556M | |
| thequmranreport_1212..> | 2012-12-03 20:00 | 556M | |
| thequmranreport_1211..> | 2012-11-26 20:00 | 551M | |
| thequmranreport_1211..> | 2012-11-19 20:00 | 553M | |
| thequmranreport_1211..> | 2012-11-12 20:00 | 558M | |
| thequmranreport_1211..> | 2012-11-05 20:01 | 557M | |
| thequmranreport_1210..> | 2012-10-29 20:00 | 601M | |
| thequmranreport_1210..> | 2012-10-22 20:00 | 573M | |
| thequmranreport_1210..> | 2012-10-15 20:00 | 567M | |
| thequmranreport_1210..> | 2012-10-08 20:01 | 558M | |
| thequmranreport_1210..> | 2012-10-01 20:00 | 597M | |
| thequmranreport_1209..> | 2012-09-24 20:00 | 587M | |
| thequmranreport_1209..> | 2012-09-17 20:00 | 608M | |
| thequmranreport_1209..> | 2012-09-10 20:00 | 595M | |
| thequmranreport_1209..> | 2012-09-03 20:00 | 595M | |
| thequmranreport_1208..> | 2012-08-27 20:00 | 595M | |
| thequmranreport_1208..> | 2012-08-20 20:00 | 595M | |
| thequmranreport_1208..> | 2012-08-13 20:00 | 595M | |
| thequmranreport_1208..> | 2012-08-06 20:00 | 595M | |
| thequmranreport_1207..> | 2012-07-30 20:00 | 595M | |
| thequmranreport_1207..> | 2012-07-23 20:00 | 595M | |
| thequmranreport_1207..> | 2012-07-16 20:00 | 596M | |
| thequmranreport_1207..> | 2012-07-09 20:00 | 596M | |
| thequmranreport_1207..> | 2012-07-02 20:00 | 595M | |
| thequmranreport_1206..> | 2012-06-25 20:00 | 595M | |
| thequmranreport_1206..> | 2012-06-11 20:00 | 595M | |
| thequmranreport_1206..> | 2012-06-04 20:00 | 595M | |
| thequmranreport_1205..> | 2012-05-28 20:00 | 596M | |
| thequmranreport_1205..> | 2012-05-21 20:00 | 595M | |
| thequmranreport_1205..> | 2012-05-14 20:00 | 596M | |
| thequmranreport_1205..> | 2012-05-07 20:00 | 595M | |
| thequmranreport_1204..> | 2012-04-30 20:00 | 595M | |
| thenormanreport_1408..> | 2014-08-19 21:00 | 540M | |
| thenormanreport_1408..> | 2014-08-05 21:01 | 550M | |
| thenormanreport_1407..> | 2014-07-29 21:01 | 553M | |
| thenormanreport_1407..> | 2014-07-22 21:00 | 564M | |
| thenormanreport_1407..> | 2014-07-15 21:00 | 556M | |
| the motion.wav | 2015-03-04 12:27 | 20M | |
| thelovebitekink_1207..> | 2012-07-29 19:54 | 595M | |
| thelovebite_130331_1..> | 2013-03-31 15:00 | 564M | |
| thelovebite_130324_1..> | 2013-03-24 15:00 | 556M | |
| thelovebite_130314_2..> | 2013-03-14 21:15 | 560M | |
| thelovebite_130307_2..> | 2013-03-07 20:34 | 559M | |
| thelovebite_130303_1..> | 2013-03-03 15:00 | 559M | |
| thelovebite_130224_1..> | 2013-02-24 15:00 | 562M | |
| thelovebite_130217_1..> | 2013-02-17 15:01 | 558M | |
| thelovebite_130120_1..> | 2013-01-20 15:00 | 555M | |
| thelovebite_130109_2..> | 2013-01-09 21:56 | 555M | |
| thelovebite_130106_1..> | 2013-01-06 14:59 | 560M | |
| thelovebite_121223_1..> | 2012-12-23 15:00 | 605M | |
| thelovebite_121216_1..> | 2012-12-16 15:00 | 564M | |
| thelovebite_121209_1..> | 2012-12-09 15:00 | 559M | |
| thelovebite_121202_1..> | 2012-12-02 15:00 | 557M | |
| thelovebite_121125_1..> | 2012-11-25 15:02 | 562M | |
| thelovebite_121118_1..> | 2012-11-18 15:00 | 575M | |
| thelovebite_121111_1..> | 2012-11-11 15:00 | 565M | |
| thelovebite_121028_1..> | 2012-10-28 15:00 | 616M | |
| thelovebite_121021_1..> | 2012-10-21 15:00 | 556M | |
| thelovebite_121014_1..> | 2012-10-14 15:00 | 581M | |
| thelovebite_121007_1..> | 2012-10-08 14:36 | 556M | |
| thelovebite_120930_1..> | 2012-09-30 15:02 | 538M | |
| thelovebite_120923_1..> | 2012-09-23 15:02 | 536M | |
| thelovebite_120916_1..> | 2012-09-16 15:00 | 586M | |
| thelovebite_120909_1..> | 2012-09-09 15:00 | 595M | |
| thelovebite_120902_1..> | 2012-09-02 15:00 | 595M | |
| thelovebite_120826_1..> | 2012-08-26 15:00 | 595M | |
| thelovebite_120819_1..> | 2012-08-19 15:00 | 595M | |
| thelovebite_120812_1..> | 2012-08-12 15:00 | 595M | |
| thelovebite_120805_1..> | 2012-08-05 15:00 | 595M | |
| thelovebite_120729_1..> | 2012-07-29 19:39 | 596M | |
| thelovebite_120722_1..> | 2012-07-22 15:00 | 595M | |
| thelovebite_120715_1..> | 2012-07-15 15:00 | 596M | |
| thelovebite_120708_1..> | 2012-07-08 15:00 | 595M | |
| thelovebite_120701_1..> | 2012-07-01 15:00 | 595M | |
| thelovebite_120624_1..> | 2012-06-24 15:00 | 595M | |
| thelovebite_120617_1..> | 2012-06-17 15:00 | 595M | |
| thelovebite_120610_1..> | 2012-06-10 15:00 | 596M | |
| thelovebite_120603_1..> | 2012-06-03 15:00 | 595M | |
| thelovebite_120527_1..> | 2012-05-27 15:00 | 595M | |
| thelovebite_120520_1..> | 2012-05-20 15:00 | 595M | |
| thelovebite_120513_1..> | 2012-05-13 15:00 | 595M | |
| thelovebite_120506_1..> | 2012-05-06 15:00 | 596M | |
| thelovebite_120429_1..> | 2012-04-29 15:00 | 595M | |
| thekenaugustshow_130..> | 2013-02-18 14:42 | 611M | |
| thekenaugustshow_130..> | 2013-02-18 18:50 | 572M | |
| thekenaugustshow_130..> | 2013-02-18 13:42 | 605M | |
| thekenaugustshow_130..> | 2013-02-18 12:42 | 606M | |
| thekenaugustshow_130..> | 2013-02-14 18:15 | 598M | |
| thekenaugustshow_130..> | 2013-02-12 17:50 | 457K | |
| thekenaugustshow_130..> | 2013-02-12 13:20 | 527M | |
| thekenaugustshow_130..> | 2013-02-12 12:36 | 418M | |
| thekenaugustshow_130..> | 2013-02-12 12:20 | 157M | |
| thehotboxpromo_12092..> | 2012-09-25 22:27 | 13M | |
| thehotbox_130326_210..> | 2013-03-26 21:02 | 556M | |
| thehotbox_130319_210..> | 2013-03-19 21:02 | 568M | |
| thehotbox_130305_220..> | 2013-03-05 21:02 | 565M | |
| thehotbox_130226_220..> | 2013-02-26 21:02 | 560M | |
| thehotbox_130219_221..> | 2013-02-19 21:13 | 561M | |
| thehotbox_130212_220..> | 2013-02-12 21:00 | 562M | |
| thehotbox_130205_221..> | 2013-02-05 21:10 | 563M | |
| thehotbox_130129_220..> | 2013-01-29 21:00 | 557M | |
| thehotbox_130122_220..> | 2013-01-22 21:02 | 563M | |
| thehotbox_130115_220..> | 2013-01-15 21:03 | 558M | |
| thehotbox_130108_220..> | 2013-01-08 21:02 | 532M | |
| thehotbox_130101_215..> | 2013-01-01 20:59 | 559M | |
| thehotbox_121218_220..> | 2012-12-18 21:00 | 560M | |
| thehotbox_121211_220..> | 2012-12-11 21:02 | 560M | |
| thehotbox_121204_220..> | 2012-12-04 21:00 | 635M | |
| thehotbox_121127_220..> | 2012-11-27 21:04 | 571M | |
| thehotbox_121127_215..> | 2012-11-27 20:59 | 23M | |
| thehotbox_121120_220..> | 2012-11-20 21:04 | 575M | |
| thehotbox_121113_220..> | 2012-11-13 21:00 | 596M | |
| thehotbox_121106_215..> | 2012-11-06 20:59 | 606M | |
| thehotbox_121030_210..> | 2012-10-30 21:02 | 570M | |
| thehotbox_121023_210..> | 2012-10-23 21:01 | 555M | |
| thehotbox_121016_210..> | 2012-10-16 21:02 | 563M | |
| thehotbox_121009_210..> | 2012-10-09 21:01 | 556M | |
| thehotbox_121002_210..> | 2012-10-02 21:00 | 552M | |
| thehotbox_120925_210..> | 2012-09-25 21:09 | 572M | |
| thehotbox_120925_185..> | 2012-09-25 18:52 | 9.2M | |
| thehotbox_120925_185..> | 2012-09-25 18:51 | 265K | |
| thehotbox_120925_181..> | 2012-09-25 18:13 | 22M | |
| thehotbox_120925_181..> | 2012-09-25 18:12 | 6.8M | |
| thehotbox_120925_180..> | 2012-09-25 18:09 | 13M | |
| thehotbox_120925_180..> | 2012-09-25 18:05 | 2.9M | |
| thehotbox_120925_180..> | 2012-09-25 18:00 | 10M | |
| thehotbox_120925_175..> | 2012-09-25 17:58 | 7.0M | |
| thehotbox_120925_175..> | 2012-09-25 17:57 | 4.2M | |
| thehotbox_120925_175..> | 2012-09-25 17:56 | 3.1M | |
| thehotbox_120925_175..> | 2012-09-25 17:54 | 6.2M | |
| thehotbox_120919_210..> | 2012-09-19 21:00 | 554M | |
| thehotbox_120918_220..> | 2012-09-18 22:09 | 5.1M | |
| thehotbox_120918_220..> | 2012-09-18 22:05 | 17M | |
| thehotbox_120918_220..> | 2012-09-18 22:04 | 2.5M | |
| thehotbox_120918_210..> | 2012-09-18 21:04 | 516M | |
| thehotbox_120911_210..> | 2012-09-11 21:00 | 595M | |
| thehotbox_120904_210..> | 2012-09-04 21:00 | 595M | |
| thehealinghourintro_..> | 2013-09-03 20:01 | 2.9M | |
| thehealinghourintro_..> | 2013-09-03 20:01 | 2.7M | |
| thehealinghourintro-..> | 2013-09-03 20:14 | 2.7M | |
| thehealinghourintro-..> | 2013-06-10 15:29 | 9.8M | |
| thehealinghour_13100..> | 2013-10-01 20:10 | 591M | |
| thehealinghour_13090..> | 2013-09-03 20:11 | 39M | |
| thehealinghour_13090..> | 2013-09-03 19:59 | 6.0M | |
| thehealinghour_13082..> | 2013-08-27 20:00 | 1.4M | |
| thehealinghour_13082..> | 2013-08-31 11:57 | 1.1G | |
| thehealinghour_13062..> | 2013-06-25 20:29 | 15M | |
| thehealinghour_13062..> | 2013-06-25 20:25 | 40M | |
| thehealinghour_13062..> | 2013-06-25 20:18 | 313K | |
| thehealinghour_13062..> | 2013-06-25 20:17 | 12M | |
| thehealinghour_13061..> | 2013-06-16 22:51 | 950M | |
| thehealinghour_13060..> | 2013-06-10 12:47 | 1.3M | |
| thehealinghour_13060..> | 2013-06-01 21:09 | 565M | |
| thehealinghour_13052..> | 2013-05-22 11:31 | 578M | |
| theestaticage_130224..> | 2013-02-24 22:13 | 552M | |
| theestaticage_130217..> | 2013-02-17 22:07 | 567M | |
| the end.wav | 2016-02-08 22:15 | 2.2M | |
| thedevilsinthedetail..> | 2013-03-29 14:08 | 557M | |
| thedevilsinthedetail..> | 2013-03-22 14:06 | 565M | |
| thedevilsinthedetail..> | 2013-03-15 14:08 | 559M | |
| thedevilsinthedetail..> | 2013-03-08 14:05 | 556M | |
| thedevilsinthedetail..> | 2013-03-01 14:08 | 662M | |
| thedevilsinthedetail..> | 2013-02-22 14:30 | 556M | |
| thedevilsinthedetail..> | 2013-02-22 14:25 | 50M | |
| thedevilsinthedetail..> | 2013-02-15 14:08 | 555M | |
| thedevilsinthedetail..> | 2013-02-08 14:05 | 559M | |
| thedevilsinthedetail..> | 2013-02-01 14:09 | 555M | |
| thedevilsinthedetail..> | 2013-01-25 14:03 | 555M | |
| thedevilsinthedetail..> | 2013-01-18 14:05 | 557M | |
| thedevilsinthedetail..> | 2013-01-11 14:10 | 613M | |
| thedevilsinthedetail..> | 2013-01-04 14:14 | 548M | |
| thedevilsinthedetail..> | 2012-12-28 14:00 | 551M | |
| thedevilsinthedetail..> | 2012-12-21 14:00 | 614M | |
| thedevilsinthedetail..> | 2012-12-14 15:07 | 569M | |
| thedevilsinthedetail..> | 2012-12-07 15:32 | 554M | |
| the curse.wav | 2016-04-12 15:51 | 12M | |
| thecallsheet_130406_..> | 2013-04-06 20:00 | 558M | |
| thecallsheet_130330_..> | 2013-03-30 20:01 | 559M | |
| thecallsheet_130323_..> | 2013-03-23 20:02 | 559M | |
| thecallsheet_130316_..> | 2013-03-16 20:00 | 559M | |
| thecallsheet_130309_..> | 2013-03-09 20:00 | 560M | |
| thecallsheet_130302_..> | 2013-03-02 19:59 | 561M | |
| thecallsheet_130223_..> | 2013-02-23 20:05 | 560M | |
| thecallsheet_130217_..> | 2013-02-16 23:40 | 178M | |
| thecallsheet_130209_..> | 2013-02-09 20:02 | 561M | |
| thecallsheet_130119_..> | 2013-01-19 21:00 | 555M | |
| thecallsheet_130119_..> | 2013-01-19 20:00 | 558M | |
| thecallsheet_130112_..> | 2013-01-12 20:03 | 573M | |
| thecallsheet_130105_..> | 2013-01-05 20:11 | 490M | |
| thecallsheet_121215_..> | 2012-12-15 20:12 | 478M | |
| thecallsheet_121208_..> | 2012-12-08 20:01 | 598M | |
| thecallsheet_121124_..> | 2012-11-24 20:00 | 606M | |
| thecallsheet_121110_..> | 2012-11-10 20:01 | 610M | |
| thecallsheet_121103_..> | 2012-11-03 20:02 | 586M | |
| thecallsheet_121027_..> | 2012-10-27 20:01 | 599M | |
| thecallsheet_121020_..> | 2012-10-20 20:02 | 588M | |
| thecallsheet_120908_..> | 2012-09-08 20:00 | 595M | |
| thecallsheet_120901_..> | 2012-09-01 20:00 | 595M | |
| thecallsheet_120825_..> | 2012-08-25 20:00 | 595M | |
| thecallsheet_120818_..> | 2012-08-18 20:00 | 596M | |
| thecallsheet_120811_..> | 2012-08-11 20:00 | 596M | |
| thecallsheet_120804_..> | 2012-08-04 20:00 | 595M | |
| thecallsheet_120728_..> | 2012-07-29 19:00 | 595M | |
| thecallsheet_120721_..> | 2012-07-21 20:00 | 596M | |
| thecallsheet_120714_..> | 2012-07-14 20:00 | 595M | |
| thecallsheet_120707_..> | 2012-07-07 20:00 | 595M | |
| thecallsheet_120630_..> | 2012-06-30 20:00 | 595M | |
| thecallsheet_120623_..> | 2012-06-23 20:00 | 595M | |
| thecallsheet_120616_..> | 2012-06-16 20:00 | 595M | |
| thecallsheet_120609_..> | 2012-06-09 20:00 | 595M | |
| thecallsheet_120602_..> | 2012-06-02 20:00 | 595M | |
| thecallsheet_120526_..> | 2012-05-26 20:00 | 595M | |
| thecallsheet_120519_..> | 2012-05-19 20:00 | 595M | |
| thecallsheet_120512_..> | 2012-05-12 20:00 | 596M | |
| thecallsheet_120428_..> | 2012-04-28 20:00 | 595M | |
| theadamopodcast_1208..> | 2012-08-28 20:00 | 596M | |
| theadamopodcast_1208..> | 2012-08-21 20:00 | 595M | |
| theadamopodcast_1208..> | 2012-08-14 20:00 | 595M | |
| theadamopodcast_1208..> | 2012-08-07 20:00 | 595M | |
| theadamopodcast_1207..> | 2012-08-01 17:36 | 622M | |
| theadamopodcast_1207..> | 2012-07-31 20:00 | 595M | |
| theadamopodcast_1207..> | 2012-07-24 20:00 | 595M | |
| theadamopodcast_1207..> | 2012-07-17 20:00 | 595M | |
| theadamopodcast_1207..> | 2012-07-10 20:00 | 596M | |
| theadamopodcast_1207..> | 2012-07-03 20:00 | 595M | |
| theadamopodcast_1206..> | 2012-06-26 20:00 | 595M | |
| theadamopodcast_1206..> | 2012-06-12 20:00 | 595M | |
| theadamopodcast_1206..> | 2012-06-05 20:00 | 595M | |
| theadamopodcast_1205..> | 2012-05-29 20:00 | 595M | |
| theadamopodcast_1205..> | 2012-05-22 20:00 | 595M | |
| theadamopodcast_1205..> | 2012-05-15 20:00 | 595M | |
| theadamopodcast_1205..> | 2012-05-08 20:00 | 595M | |
| theadamopodcast_1205..> | 2012-05-01 20:00 | 596M | |
| the Killers.wav | 2016-02-22 14:21 | 8.8M | |
| testing_120911_20493..> | 2012-09-11 20:49 | 8.0M | |
| testing_120911_20473..> | 2012-09-11 20:47 | 8.6M | |
| testing_120909_20091..> | 2012-09-09 20:09 | 2.8M | |
| testing_120909_20074..> | 2012-09-09 20:07 | 3.1M | |
| testing_120909_20054..> | 2012-09-09 20:05 | 1.1M | |
| testing_120908_23041..> | 2012-09-08 23:04 | 219M | |
| testing_120908_13544..> | 2012-09-08 13:54 | 1.0M | |
| techtalk_20150304.wav | 2015-03-05 13:11 | 1.1G | |
| tebowsexcited10.wav | 2012-04-01 18:43 | 6.9M | |
| tebowsexcited.wav | 2012-04-01 15:34 | 6.9M | |
| tdt_150709_111027_SR..> | 2015-07-09 12:10 | 1.0G | |
| tdt_150709_110004_SR..> | 2015-07-09 12:00 | 4.5M | |
| tdt_150625_111453_SR..> | 2015-06-25 12:14 | 649M | |
| tdt_150608_110036_SR..> | 2015-06-08 12:00 | 552M | |
| tdt_150518_133624_SR..> | 2015-05-18 14:36 | 840M | |
| tdt_150518_132330_SR..> | 2015-05-18 14:23 | 11M | |
| tdt_150517_111341_SR..> | 2015-05-17 12:13 | 524M | |
| sydneysilver_150405_..> | 2015-04-05 18:15 | 618M | |
| sydneysilver_150405_..> | 2015-04-05 18:00 | 7.0M | |
| sydneysilver_150304_..> | 2015-03-04 18:30 | 297M | |
| sydneysilver_150304_..> | 2015-03-04 18:00 | 296M | |
| sydneysilver_150125_..> | 2015-01-25 20:02 | 293M | |
| sydneysilver_150125_..> | 2015-01-25 18:30 | 294M | |
| sydneysilver_141219_..> | 2014-12-19 21:18 | 298M | |
| sydneysilver_141219_..> | 2014-12-19 20:38 | 297M | |
| sydneysilver_141219_..> | 2014-12-19 20:37 | 7.9M | |
| sydneysilver_141121_..> | 2014-11-21 20:48 | 297M | |
| sydneysilver_141121_..> | 2014-11-21 20:14 | 297M | |
| sydneysilver_140827_..> | 2014-08-27 20:01 | 427M | |
| sydneysilver_140820_..> | 2014-08-20 20:34 | 292M | |
| sydneysilver_140820_..> | 2014-08-20 20:00 | 295M | |
| sweetrelease_140302_..> | 2014-03-02 18:00 | 520M | |
| sweetrelease_140216_..> | 2014-02-16 18:01 | 531M | |
| sweetrelease_140209_..> | 2014-02-09 18:00 | 595M | |
| sweetrelease_140202_..> | 2014-02-02 18:01 | 548M | |
| sweetrelease_140126_..> | 2014-01-26 17:35 | 180M | |
| sweetrelease_140126_..> | 2014-01-26 17:33 | 15M | |
| sweetrelease_140121_..> | 2014-01-21 20:59 | 7.7M | |
| sweetrelease_140121_..> | 2014-01-21 20:57 | 7.5M | |
| sweetrelease_140121_..> | 2014-01-21 20:56 | 3.7M | |
| sweetrelease_140121_..> | 2014-01-21 20:55 | 5.2M | |
| swagtalk_150531_1503..> | 2015-05-31 16:03 | 514M | |
| swagtalk_150315_1505..> | 2015-03-15 16:05 | 514M | |
| swagtalk_150222_1600..> | 2015-02-22 16:00 | 573M | |
| swagtalk_150215_1600..> | 2015-02-15 16:00 | 545M | |
| swagtalk_150208_1602..> | 2015-02-08 16:02 | 553M | |
| swagtalk_150118_1610..> | 2015-01-18 16:10 | 459M | |
| swagtalk_150111_1600..> | 2015-01-11 16:00 | 559M | |
| stereo_combined.wav | 2015-12-28 23:09 | 199M | |
| starsky and hutch we..> | 2016-02-08 22:02 | 1.7M | |
| stab_city_promos.wav | 2011-05-13 01:17 | 24M | |
| spotlight_on_books_i..> | 2013-09-21 16:17 | 6.8M | |
| spotlight_130921_162..> | 2013-09-21 16:25 | 14M | |
| speakenglish.wav | 2012-03-18 15:32 | 9.3M | |
| southbeachsmoke.com-..> | 2013-02-14 17:56 | 4.8M | |
| soundcloud_131107_21..> | 2013-11-07 20:16 | 47M | |
| soundcloud_131107_21..> | 2013-11-07 20:02 | 385K | |
| soundcloud_131107_21..> | 2013-11-07 20:02 | 3.7M | |
| sonnydonator_120506_..> | 2012-05-11 02:53 | 327M | |
| sns_clips-04182013.wav | 2013-04-18 02:38 | 19M | |
| smb_world_clear.wav | 2012-02-20 21:13 | 271K | |
| smb_warning.wav | 2012-02-20 21:13 | 127K | |
| smb_stage_clear.wav | 2012-02-20 21:13 | 244K | |
| smb_mariodie.wav | 2012-02-20 21:13 | 118K | |
| smb_gameover.wav | 2012-02-20 21:13 | 163K | |
| smb_fireworks.wav | 2012-02-20 21:14 | 19K | |
| smb_1-up.wav | 2012-02-20 21:14 | 38K | |
| skidrowstudios_13072..> | 2013-07-28 14:09 | 710M | |
| skidrowstudios_13072..> | 2013-07-27 18:15 | 796M | |
| skidrowstudios_13072..> | 2013-07-21 20:19 | 214M | |
| skidrowstudios_13011..> | 2013-01-19 13:53 | 769K | |
| skidrowstudios_13011..> | 2013-01-19 13:32 | 1.7M | |
| skidrowstudios_12122..> | 2012-12-28 18:35 | 525M | |
| skidrowstudios_12122..> | 2012-12-28 17:55 | 345M | |
| skidrowstudios_12122..> | 2012-12-28 17:50 | 35M | |
| silence_30s.wav | 2015-12-17 16:36 | 5.0M | |
| show offer 5.wav | 2011-09-25 16:36 | 1.0M | |
| show offer 4.wav | 2011-09-25 16:34 | 1.3M | |
| show offer 3.wav | 2011-09-25 16:30 | 1.2M | |
| show offer 2.wav | 2011-09-25 16:28 | 1.4M | |
| show offer 1.wav | 2011-09-25 16:25 | 1.4M | |
| show introo 3.wav | 2011-09-25 16:32 | 1.4M | |
| show intro 5.wav | 2011-09-25 16:37 | 1.1M | |
| show intro 4.wav | 2011-09-25 16:35 | 1.2M | |
| show intro 3.wav | 2011-09-25 16:32 | 1.4M | |
| show intro 2.wav | 2011-09-25 16:30 | 1.2M | |
| show intro 1.wav | 2011-09-25 16:26 | 1.5M | |
| shelly movie imperso..> | 2011-05-11 22:21 | 23M | |
| shelly call in 2.wav | 2011-05-11 23:04 | 1.9M | |
| shelly best promo.wav | 2011-05-11 23:02 | 3.9M | |
| sfr_150508_171451_SR..> | 2015-05-08 18:14 | 494M | |
| sfr_150424_170038_SR..> | 2015-04-24 18:00 | 620M | |
| sexytimetalk_120905_..> | 2012-09-05 21:00 | 595M | |
| sexytimetalk_120829_..> | 2012-08-29 21:00 | 595M | |
| sexytimetalk_120822_..> | 2012-08-22 21:00 | 596M | |
| sexytimetalk_120815_..> | 2012-08-15 21:00 | 596M | |
| sexytimetalk_120808_..> | 2012-08-08 21:00 | 595M | |
| sexytimetalk_120801_..> | 2012-08-01 21:00 | 596M | |
| sexytimetalk_120725_..> | 2012-07-29 20:05 | 595M | |
| sexytimetalk_120718_..> | 2012-07-18 21:00 | 595M | |
| sexytimetalk_120711_..> | 2012-07-11 21:00 | 596M | |
| sexytimetalk_120704_..> | 2012-07-04 21:00 | 595M | |
| sexytimetalk_120627_..> | 2012-06-27 21:00 | 596M | |
| sexytimetalk_120620_..> | 2012-06-20 21:00 | 595M | |
| sexytimetalk_120613_..> | 2012-06-13 21:00 | 596M | |
| sexytimetalk_120606_..> | 2012-06-06 21:00 | 596M | |
| sexytimetalk_120530_..> | 2012-05-30 21:00 | 596M | |
| sexytimetalk_120523_..> | 2012-05-23 21:00 | 595M | |
| sexytimetalk_120516_..> | 2012-05-16 21:00 | 596M | |
| sexytimetalk_120509_..> | 2012-05-09 21:00 | 596M | |
| sexytimetalk_120502_..> | 2012-05-02 21:00 | 595M | |
| sexendipity_140504_1..> | 2014-05-04 17:00 | 581M | |
| sexendipity_140427_1..> | 2014-04-27 16:59 | 554M | |
| sexendipity_140420_1..> | 2014-04-20 17:00 | 577M | |
| sexendipity_140406_1..> | 2014-04-06 17:00 | 561M | |
| sexendipity_140330_1..> | 2014-03-30 17:00 | 569M | |
| sexendipity_140323_1..> | 2014-03-23 17:04 | 551M | |
| sexendipity_140316_1..> | 2014-03-16 17:02 | 564M | |
| sexendipity_140309_1..> | 2014-03-09 17:01 | 575M | |
| sexendipity_140309_1..> | 2014-03-09 17:00 | 697K | |
| sexendipity_140307_1..> | 2014-03-07 11:01 | 567M | |
| sexendipity_140302_2..> | 2014-03-02 20:00 | 584M | |
| sexendipity_140223_2..> | 2014-02-23 20:00 | 591M | |
| sexendipity_140209_2..> | 2014-02-09 20:00 | 580M | |
| sexendipity_140202_1..> | 2014-02-02 19:59 | 592M | |
| sexendipity_140126_2..> | 2014-01-26 20:00 | 580M | |
| sexendipity_140126_1..> | 2014-01-26 18:02 | 572M | |
| sexendipity_140121_2..> | 2014-01-21 20:50 | 7.2M | |
| sexendipity_140121_2..> | 2014-01-21 20:49 | 9.4M | |
| sexendipity_140121_2..> | 2014-01-21 20:47 | 8.1M | |
| sexendipity_140121_2..> | 2014-01-21 20:46 | 5.5M | |
| sexendipity_140121_2..> | 2014-01-21 20:43 | 9.0M | |
| sexendipity_140121_2..> | 2014-01-21 20:42 | 6.7M | |
| sexendipity_140119_2..> | 2014-01-19 20:00 | 576M | |
| sexendipity_140112_2..> | 2014-01-12 20:01 | 559M | |
| sexendipity_140105_2..> | 2014-01-05 20:03 | 516M | |
| service.wav | 2000-05-25 06:38 | 29K | |
| select show intro.wav | 2011-09-25 16:02 | 1.8M | |
| select-show-intro.wav | 2011-09-27 12:01 | 1.9M | |
| screen intro 1.wav | 2011-09-27 12:15 | 1.7M | |
| screen direct 1.wav | 2011-09-25 16:14 | 1.1M | |
| scoutsclip2.wav | 2013-04-23 11:04 | 2.6M | |
| scoreboard_media.wav | 2013-09-21 15:16 | 8.6M | |
| schmidt.wav | 2012-03-18 15:32 | 8.7M | |
| schedule_testing_120..> | 2012-03-04 16:05 | 20M | |
| saudiclip.wav | 2013-04-15 11:51 | 8.4M | |
| saudi911.wav | 2012-03-03 18:47 | 12M | |
| satanvsUS.wav | 2012-03-03 18:47 | 3.6M | |
| satanic lola.wav | 2011-04-07 16:34 | 2.9M | |
| sassafras_promo.wav | 2011-07-28 23:54 | 26M | |
| sarcasticnews_140604..> | 2014-06-04 20:00 | 563M | |
| sarcasticnews_140528..> | 2014-05-28 20:00 | 567M | |
| sarcasticnews_140521..> | 2014-05-21 20:00 | 564M | |
| sarcasticnews_140507..> | 2014-05-07 20:00 | 560M | |
| sarcasticnews_140430..> | 2014-04-30 20:00 | 560M | |
| sarcasticnews_140423..> | 2014-04-23 20:00 | 583M | |
| sarcasticnews_140409..> | 2014-04-09 20:05 | 523M | |
| sarcasticnews_140402..> | 2014-04-02 20:02 | 550M | |
| sarcasticnews_140326..> | 2014-03-26 20:00 | 561M | |
| sarcasticnews_140312..> | 2014-03-12 20:00 | 564M | |
| sarcasticnews_140305..> | 2014-03-05 20:02 | 559M | |
| sarcasticnews_140226..> | 2014-02-26 20:02 | 555M | |
| sarcasticnews_140219..> | 2014-02-19 23:32 | 143M | |
| sarcasticnews_140219..> | 2014-02-19 20:02 | 556M | |
| sarcasticnews_140212..> | 2014-02-12 20:02 | 492M | |
| sarcasticnews_140205..> | 2014-02-05 20:01 | 556M | |
| sarcasticnews_140129..> | 2014-01-29 20:03 | 566M | |
| sarcasticnews_140122..> | 2014-01-22 20:09 | 472M | |
| sarcasticnews_140115..> | 2014-01-15 20:00 | 557M | |
| sarcasticnews_131218..> | 2013-12-18 20:00 | 555M | |
| sarcasticnews_131211..> | 2013-12-11 20:00 | 558M | |
| sarcasticnews_131204..> | 2013-12-04 20:00 | 555M | |
| sarcasticnews_131127..> | 2013-11-27 21:29 | 192M | |
| sarcasticnews_131120..> | 2013-11-20 20:00 | 560M | |
| sarcasticnews_131113..> | 2013-11-13 20:00 | 561M | |
| sarcasticnews_131030..> | 2013-10-30 20:04 | 563M | |
| sarcasticnews_131023..> | 2013-10-23 20:00 | 557M | |
| sarcasticnews_131016..> | 2013-10-16 20:09 | 495M | |
| sarcasticnews_131009..> | 2013-10-09 20:02 | 541M | |
| sarcasticnews_131002..> | 2013-10-02 20:00 | 556M | |
| sarcasticnews_130925..> | 2013-09-25 20:06 | 550M | |
| sarcasticnews_130918..> | 2013-09-18 20:01 | 558M | |
| sarcasticnews_130911..> | 2013-09-11 20:03 | 558M | |
| sarcasticnews_130904..> | 2013-09-04 20:05 | 558M | |
| sarcasticnews_130821..> | 2013-08-21 20:03 | 564M | |
| sarcasticnews_130814..> | 2013-08-14 20:03 | 564M | |
| sarcasticnews_130807..> | 2013-08-07 20:03 | 561M | |
| sarcasticnews_130731..> | 2013-07-31 20:01 | 558M | |
| sarcasticnews_130724..> | 2013-07-24 20:06 | 555M | |
| sarcasticnews_130717..> | 2013-07-17 20:02 | 571M | |
| sarcasticnews_130711..> | 2013-07-11 19:33 | 457K | |
| sarcasticnews_130627..> | 2013-06-27 19:33 | 610M | |
| sarcasticnews_130620..> | 2013-06-20 19:32 | 565M | |
| sarcasticnews_130613..> | 2013-06-13 19:30 | 605M | |
| sarcasticnews_130606..> | 2013-06-06 19:29 | 589M | |
| sarcasticnews_130530..> | 2013-05-30 19:33 | 610M | |
| sarcasticnews_130523..> | 2013-05-23 19:30 | 568M | |
| sarcasticnews_130516..> | 2013-05-16 19:31 | 562M | |
| sarcasticnews_130509..> | 2013-05-09 19:29 | 640M | |
| sarcasticnews_130502..> | 2013-05-02 19:29 | 609M | |
| sarcasticnews_130425..> | 2013-04-25 19:30 | 564M | |
| sarcasticnews_130418..> | 2013-04-18 19:29 | 564M | |
| sarcasticnews_130411..> | 2013-04-11 19:28 | 560M | |
| sarcasticnews_130404..> | 2013-04-04 19:29 | 560M | |
| sarcasticnews-promo-..> | 2013-05-20 15:41 | 13M | |
| sample2.wav | 2001-12-31 10:38 | 33K | |
| rubpr_131026.wav | 2013-10-26 16:17 | 6.7M | |
| rubberband.wav | 2000-06-13 05:47 | 9.7K | |
| ronjeremy.wav | 2013-02-05 20:59 | 7.4M | |
| romneystruggles.wav | 2012-03-18 15:32 | 10M | |
| response to my quest..> | 2014-03-20 19:25 | 323K | |
| registeredearoffende..> | 2013-04-10 12:10 | 5.0M | |
| registeredearoffende..> | 2013-04-12 13:00 | 606M | |
| registeredearoffende..> | 2013-04-03 20:33 | 5.0M | |
| registeredearoffende..> | 2013-04-05 12:59 | 606M | |
| registeredearoffende..> | 2013-03-27 21:31 | 5.0M | |
| registeredearoffende..> | 2013-03-29 13:04 | 606M | |
| registeredearoffende..> | 2013-03-20 20:34 | 5.0M | |
| registeredearoffende..> | 2013-03-22 12:59 | 605M | |
| registeredearoffende..> | 2013-03-13 16:52 | 5.0M | |
| registeredearoffende..> | 2013-03-15 13:00 | 606M | |
| registeredearoffende..> | 2013-03-05 20:27 | 5.0M | |
| registeredearoffende..> | 2013-03-08 13:00 | 606M | |
| registeredearoffende..> | 2013-02-27 17:35 | 5.0M | |
| registeredearoffende..> | 2013-03-01 13:00 | 606M | |
| registeredearoffende..> | 2013-02-19 21:52 | 5.0M | |
| registeredearoffende..> | 2013-02-22 13:05 | 606M | |
| registeredearoffende..> | 2013-02-13 19:20 | 5.0M | |
| registeredearoffende..> | 2013-02-15 13:04 | 606M | |
| registeredearoffende..> | 2013-02-05 21:59 | 5.0M | |
| registeredearoffende..> | 2013-02-08 13:00 | 606M | |
| registeredearoffende..> | 2013-02-01 13:05 | 606M | |
| registeredearoffende..> | 2013-01-25 12:59 | 606M | |
| registeredearoffende..> | 2013-01-18 13:00 | 607M | |
| registeredearoffende..> | 2013-01-11 13:00 | 607M | |
| registeredearoffende..> | 2013-01-04 21:15 | 606M | |
| registeredearoffende..> | 2012-12-14 14:04 | 606M | |
| registeredearoffende..> | 2012-12-14 13:00 | 556M | |
| registeredearoffende..> | 2012-12-07 14:12 | 607M | |
| registeredearoffende..> | 2012-12-07 13:00 | 561M | |
| registeredearoffende..> | 2012-11-30 13:16 | 623M | |
| registeredearoffende..> | 2012-11-23 13:00 | 609M | |
| registeredearoffende..> | 2012-11-16 13:07 | 582M | |
| registeredearoffende..> | 2012-11-09 13:00 | 607M | |
| registeredearoffende..> | 2012-11-02 13:00 | 594M | |
| registeredearoffende..> | 2012-10-26 13:02 | 596M | |
| registeredearoffende..> | 2012-10-19 13:00 | 590M | |
| registeredearoffende..> | 2012-10-12 13:00 | 587M | |
| registeredearoffende..> | 2012-10-05 13:00 | 591M | |
| registeredearoffende..> | 2012-09-28 14:27 | 11M | |
| registeredearoffende..> | 2012-09-28 14:23 | 28M | |
| registeredearoffende..> | 2012-09-28 14:18 | 44M | |
| registeredearoffende..> | 2012-09-28 13:00 | 591M | |
| registeredearoffende..> | 2012-09-21 13:00 | 598M | |
| registeredearoffende..> | 2012-09-14 13:00 | 595M | |
| registeredearoffende..> | 2012-09-07 13:00 | 595M | |
| registeredearoffende..> | 2012-08-31 13:00 | 595M | |
| registeredearoffende..> | 2012-08-24 13:00 | 595M | |
| registeredearoffende..> | 2012-08-17 13:00 | 595M | |
| registeredearoffende..> | 2012-08-10 13:00 | 595M | |
| registeredearoffende..> | 2012-08-05 21:20 | 595M | |
| reasonable force.wav | 2016-04-26 15:22 | 9.4M | |
| razorback_150810_171..> | 2015-08-10 18:10 | 418M | |
| rar_150503_140234_SR..> | 2015-05-03 15:02 | 1.1G | |
| rap_outro.wav | 2013-09-21 14:38 | 10M | |
| rap_mid_two.wav | 2013-09-21 14:42 | 9.4M | |
| rap_mid_one.wav | 2013-09-21 14:41 | 4.8M | |
| rap_first.wav | 2013-09-21 14:48 | 6.8M | |
| questions4audience.WAV | 2011-08-04 14:22 | 116M | |
| pysch1on1-intro.wav | 2013-10-07 18:48 | 4.9M | |
| psychopaths.wav | 2011-09-26 17:22 | 9.3M | |
| psychiceveryday_1404..> | 2014-04-18 12:00 | 560M | |
| psychiceveryday_1404..> | 2014-04-09 19:00 | 561M | |
| psychiceveryday_1404..> | 2014-04-02 19:00 | 559M | |
| psychiceveryday_1403..> | 2014-03-26 19:00 | 568M | |
| psychiceveryday_1403..> | 2014-03-19 19:00 | 561M | |
| psychiceveryday_1403..> | 2014-03-12 19:00 | 570M | |
| psychiceveryday_1403..> | 2014-03-05 19:00 | 559M | |
| psychiceveryday_1402..> | 2014-02-26 19:00 | 576M | |
| psychiceveryday_1402..> | 2014-02-19 19:00 | 557M | |
| psychiceveryday_1402..> | 2014-02-12 18:59 | 556M | |
| psychiceveryday_1402..> | 2014-02-05 18:59 | 558M | |
| psychiceveryday_1401..> | 2014-01-29 18:59 | 558M | |
| psychiceveryday_1401..> | 2014-01-22 19:00 | 555M | |
| psychiceveryday_1401..> | 2014-01-15 18:59 | 555M | |
| psychiceveryday_1401..> | 2014-01-08 19:00 | 575M | |
| psychiceveryday_1312..> | 2013-12-18 19:00 | 557M | |
| psychiceveryday_1312..> | 2013-12-11 18:59 | 556M | |
| psychiceveryday_1312..> | 2013-12-02 16:11 | 576M | |
| psychiceveryday_1312..> | 2013-12-02 15:10 | 561M | |
| psychiceveryday_1311..> | 2013-11-27 19:00 | 556M | |
| psychiceveryday_1311..> | 2013-11-20 19:00 | 561M | |
| psychiceveryday_1311..> | 2013-11-06 19:00 | 577M | |
| psychiceveryday_1310..> | 2013-10-30 18:59 | 557M | |
| psychiceveryday_1310..> | 2013-10-23 18:59 | 558M | |
| psychiceveryday_1310..> | 2013-10-16 19:00 | 556M | |
| psychiceveryday_1310..> | 2013-10-04 12:26 | 556M | |
| psychiceveryday_1310..> | 2013-10-02 18:59 | 555M | |
| psychiceveryday_1309..> | 2013-09-25 19:00 | 556M | |
| psychiceveryday_1309..> | 2013-09-18 18:59 | 557M | |
| psychiceveryday_1309..> | 2013-09-11 19:00 | 557M | |
| psychiceveryday_1309..> | 2013-09-04 19:00 | 556M | |
| psychiceveryday_1308..> | 2013-08-28 19:00 | 557M | |
| psychiceveryday_1308..> | 2013-08-21 19:00 | 559M | |
| psychiceveryday_1308..> | 2013-08-14 18:59 | 555M | |
| psychiceveryday_1308..> | 2013-08-07 18:59 | 555M | |
| psychiceveryday_1307..> | 2013-07-31 18:59 | 556M | |
| psychiceveryday_1307..> | 2013-07-24 18:59 | 557M | |
| psychiceveryday_1307..> | 2013-07-10 19:01 | 555M | |
| psychiceveryday_1307..> | 2013-07-03 18:59 | 556M | |
| psychiceveryday_1306..> | 2013-06-26 19:00 | 556M | |
| psychiceveryday_1306..> | 2013-06-19 18:59 | 553M | |
| psychiceveryday_1306..> | 2013-06-12 19:00 | 556M | |
| psychiceveryday_1306..> | 2013-06-05 18:59 | 555M | |
| psychiceveryday_1305..> | 2013-05-29 19:00 | 556M | |
| psychiceveryday_1305..> | 2013-05-23 11:53 | 552M | |
| psychiceveryday_1305..> | 2013-05-15 19:01 | 557M | |
| psychiceveryday_1305..> | 2013-05-08 19:00 | 554M | |
| psychiceveryday_1305..> | 2013-05-01 19:00 | 553M | |
| psychiceveryday_1304..> | 2013-04-24 19:00 | 553M | |
| psychiceveryday_1304..> | 2013-04-10 18:59 | 868M | |
| psychiceveryday_1304..> | 2013-04-03 18:59 | 555M | |
| psychiceveryday_1303..> | 2013-03-28 16:29 | 550M | |
| psychiceveryday_1303..> | 2013-03-28 15:19 | 556M | |
| psychiceveryday_1303..> | 2013-03-28 14:59 | 1.8M | |
| psychiceveryday_1303..> | 2013-03-27 18:59 | 555M | |
| psychiceveryday_1303..> | 2013-03-20 18:59 | 558M | |
| psychiceveryday_1303..> | 2013-03-13 18:59 | 556M | |
| psychiceveryday_1303..> | 2013-03-07 20:10 | 556M | |
| psychiceveryday_1302..> | 2013-02-27 19:00 | 573M | |
| psychiceveryday_1302..> | 2013-02-20 18:59 | 556M | |
| psychiceveryday-prom..> | 2013-05-16 02:15 | 5.9M | |
| psych1on1_teaser.wav | 2015-11-21 00:54 | 5.6M | |
| psych1on1_promo_1309..> | 2013-09-20 12:33 | 8.6M | |
| psych1on1_promo_1309..> | 2013-09-20 12:30 | 2.1M | |
| psych1on1_promo_1309..> | 2013-09-20 12:29 | 12M | |
| psych1on1_promo_1309..> | 2013-09-20 12:27 | 16M | |
| psych1on1_promo_1309..> | 2013-09-20 12:17 | 13M | |
| psych1on1_promo_1309..> | 2013-09-20 12:15 | 24M | |
| psych1on1_promo_1309..> | 2013-09-20 12:13 | 16M | |
| psych1on1_160627_180..> | 2016-06-27 19:01 | 577M | |
| psych1on1_160613_175..> | 2016-06-13 18:54 | 575M | |
| psych1on1_160502_174..> | 2016-05-02 18:46 | 566M | |
| psych1on1_160425_174..> | 2016-04-25 18:44 | 559M | |
| psych1on1_160421_170..> | 2016-04-21 18:07 | 564M | |
| psych1on1_160404_175..> | 2016-04-04 18:56 | 578M | |
| psych1on1_160321_180..> | 2016-03-21 19:00 | 565M | |
| psych1on1_160321_175..> | 2016-03-21 18:55 | 13M | |
| psych1on1_160229_190..> | 2016-02-29 19:00 | 574M | |
| psych1on1_160215_185..> | 2016-02-15 18:56 | 558M | |
| psych1on1_160208_190..> | 2016-02-08 19:02 | 491M | |
| psych1on1_160208_185..> | 2016-02-08 18:56 | 33M | |
| psych1on1_160104_185..> | 2016-01-04 18:58 | 573M | |
| psych1on1_151222_185..> | 2015-12-22 18:57 | 586M | |
| psych1on1_151207_184..> | 2015-12-07 18:45 | 556M | |
| psych1on1_151116_190..> | 2015-11-16 19:01 | 584M | |
| psych1on1_151116_145..> | 2015-11-16 14:57 | 89M | |
| psych1on1_150914_175..> | 2015-09-14 18:59 | 556M | |
| psych1on1_150824_180..> | 2015-08-24 19:01 | 560M | |
| psych1on1_150810_180..> | 2015-08-10 19:00 | 568M | |
| psych1on1_150713_180..> | 2015-07-13 19:00 | 559M | |
| psych1on1_150622_180..> | 2015-06-22 19:00 | 562M | |
| psych1on1_150601_180..> | 2015-06-01 19:02 | 538M | |
| psych1on1_150518_180..> | 2015-05-18 19:00 | 557M | |
| psych1on1_150427_180..> | 2015-04-27 19:00 | 554M | |
| psych1on1_150408_140..> | 2015-04-08 15:01 | 563M | |
| psych1on1_150330_180..> | 2015-03-30 19:00 | 566M | |
| psych1on1_150316_180..> | 2015-03-16 19:00 | 541M | |
| psych1on1_150302_190..> | 2015-03-02 19:04 | 553M | |
| psych1on1_150302_190..> | 2015-03-02 19:00 | 17M | |
| psych1on1_150204_200..> | 2015-02-04 20:00 | 562M | |
| psych1on1_150202_190..> | 2015-02-02 19:00 | 568M | |
| psych1on1_150105_190..> | 2015-01-05 19:00 | 560M | |
| psych1on1_141222_185..> | 2014-12-22 18:59 | 557M | |
| psych1on1_141209_190..> | 2014-12-09 19:00 | 564M | |
| psych1on1_141123_200..> | 2014-11-23 20:03 | 557M | |
| psych1on1_141118_185..> | 2014-11-18 18:59 | 564M | |
| psych1on1_141111_190..> | 2014-11-11 19:02 | 571M | |
| psych1on1_141104_190..> | 2014-11-04 19:00 | 556M | |
| psych1on1_141028_180..> | 2014-10-28 19:04 | 559M | |
| psych1on1_141020_180..> | 2014-10-20 19:02 | 559M | |
| psych1on1_141013_180..> | 2014-10-13 19:01 | 549M | |
| psych1on1_141006_180..> | 2014-10-06 19:01 | 565M | |
| psych1on1_140929_180..> | 2014-09-29 19:00 | 569M | |
| psych1on1_140915_180..> | 2014-09-15 19:01 | 542M | |
| psych1on1_140825_180..> | 2014-08-25 19:00 | 561M | |
| psych1on1_140818_180..> | 2014-08-18 19:00 | 557M | |
| psych1on1_140805_170..> | 2014-08-05 18:08 | 499M | |
| psych1on1_140805_170..> | 2014-08-05 18:03 | 2.1M | |
| psych1on1_140728_180..> | 2014-07-28 19:01 | 563M | |
| psych1on1_140721_180..> | 2014-07-21 19:00 | 562M | |
| psych1on1_140714_180..> | 2014-07-14 19:00 | 567M | |
| psych1on1_140709_005..> | 2014-07-09 01:56 | 8.6M | |
| psych1on1_140630_180..> | 2014-06-30 19:00 | 558M | |
| psych1on1_140623_180..> | 2014-06-23 19:04 | 525M | |
| psych1on1_140609_180..> | 2014-06-09 19:00 | 566M | |
| psych1on1_140602_180..> | 2014-06-02 19:00 | 552M | |
| psych1on1_140519_180..> | 2014-05-19 19:00 | 571M | |
| psych1on1_140512_180..> | 2014-05-12 19:00 | 555M | |
| psych1on1_140505_180..> | 2014-05-05 19:00 | 559M | |
| psych1on1_140428_180..> | 2014-04-28 19:00 | 550M | |
| psych1on1_140421_180..> | 2014-04-21 19:00 | 560M | |
| psych1on1_140414_180..> | 2014-04-14 19:00 | 567M | |
| psych1on1_140317_180..> | 2014-03-17 19:00 | 557M | |
| psych1on1_140310_180..> | 2014-03-10 19:00 | 560M | |
| psych1on1_140303_190..> | 2014-03-03 19:00 | 554M | |
| psych1on1_140224_190..> | 2014-02-24 19:00 | 562M | |
| psych1on1_140217_190..> | 2014-02-17 19:03 | 537M | |
| psych1on1_140210_190..> | 2014-02-10 19:00 | 532M | |
| psych1on1_140127_190..> | 2014-01-27 19:00 | 561M | |
| psych1on1_140120_190..> | 2014-01-20 19:00 | 559M | |
| psych1on1_140113_190..> | 2014-01-13 19:00 | 562M | |
| psych1on1_140106_190..> | 2014-01-06 19:00 | 564M | |
| psych1on1_131230_190..> | 2013-12-30 19:00 | 563M | |
| psych1on1_131222_004..> | 2013-12-22 00:45 | 3.4M | |
| psych1on1_131222_003..> | 2013-12-22 00:33 | 7.5M | |
| psych1on1_131222_003..> | 2013-12-22 00:30 | 16M | |
| psych1on1_131216_200..> | 2013-12-16 19:00 | 572M | |
| psych1on1_131209_200..> | 2013-12-09 19:00 | 563M | |
| psych1on1_131202_200..> | 2013-12-02 19:00 | 562M | |
| psych1on1_131115_142..> | 2013-11-15 13:20 | 565M | |
| psych1on1_131111_200..> | 2013-11-11 19:00 | 562M | |
| psych1on1_131104_200..> | 2013-11-04 19:00 | 553M | |
| psych1on1_131021_190..> | 2013-10-21 19:00 | 552M | |
| psych1on1_131014_185..> | 2013-10-14 18:59 | 563M | |
| psych1on1_131007_190..> | 2013-10-07 19:00 | 450M | |
| psych1on1_130920_180..> | 2013-09-20 18:02 | 562M | |
| psych1on1_130916_185..> | 2013-09-16 18:59 | 593M | |
| psych1on1_130826_185..> | 2013-08-26 18:59 | 568M | |
| psych1on1_130722_190..> | 2013-07-22 19:00 | 565M | |
| psych1on1_130715_190..> | 2013-07-15 19:00 | 568M | |
| psych1on1_130706_132..> | 2013-07-06 13:27 | 563M | |
| psych1on1_130701_185..> | 2013-07-01 18:59 | 565M | |
| psych1on1_130624_185..> | 2013-06-24 18:59 | 567M | |
| psych1on1_130615_123..> | 2013-06-15 12:32 | 569M | |
| psych1on1_130610_185..> | 2013-06-10 18:59 | 570M | |
| psych1on1_130530_161..> | 2013-05-30 16:16 | 559M | |
| psych1on1_130520_190..> | 2013-05-20 19:00 | 568M | |
| psych1on1_130517_150..> | 2013-05-17 15:00 | 569M | |
| psych1on1_130513_190..> | 2013-05-13 19:00 | 568M | |
| psych1on1_130506_190..> | 2013-05-06 19:00 | 572M | |
| psych1on1_130429_190..> | 2013-04-29 19:00 | 568M | |
| psych1on1_130422_190..> | 2013-04-23 14:28 | 565M | |
| psych1on1_130415_190..> | 2013-04-15 19:00 | 569M | |
| psych1on1_130408_185..> | 2013-04-08 18:59 | 552M | |
| psych1on1-promo1.wav | 2013-05-15 15:11 | 12M | |
| psych1on1-outro.wav | 2013-10-07 18:52 | 3.4M | |
| presentation.WAV | 2011-06-29 15:08 | 783M | |
| positive_150913_1600..> | 2015-09-13 17:00 | 1.1G | |
| positive_150830_1609..> | 2015-08-30 17:09 | 1.1G | |
| positive_150823_1602..> | 2015-08-23 17:02 | 555M | |
| positive_150816_1601..> | 2015-08-16 17:01 | 565M | |
| positive_150712_1704..> | 2015-07-12 18:04 | 519M | |
| positive_150712_1601..> | 2015-07-12 17:01 | 586M | |
| positive_150621_1600..> | 2015-06-21 17:00 | 565M | |
| positive_150614_1559..> | 2015-06-14 16:59 | 555M | |
| positive_150607_1600..> | 2015-06-07 17:00 | 561M | |
| positive_150531_1600..> | 2015-05-31 17:00 | 564M | |
| positive_150517_1600..> | 2015-05-17 17:00 | 562M | |
| positive_150503_1600..> | 2015-05-03 17:00 | 564M | |
| positive_150426_1600..> | 2015-04-26 17:00 | 556M | |
| positive_150419_1559..> | 2015-04-19 16:59 | 563M | |
| positive_150412_1600..> | 2015-04-12 17:00 | 562M | |
| positive_150322_1600..> | 2015-03-22 17:00 | 598M | |
| positive_150315_1600..> | 2015-03-15 17:00 | 563M | |
| positive_150308_1600..> | 2015-03-08 17:00 | 562M | |
| positive_150301_1659..> | 2015-03-01 16:59 | 563M | |
| positive_150222_1702..> | 2015-02-22 17:02 | 569M | |
| positive_150215_1700..> | 2015-02-15 17:00 | 570M | |
| positive_150208_1702..> | 2015-02-08 17:02 | 568M | |
| positive_150125_1700..> | 2015-01-25 17:00 | 574M | |
| positive_150118_1701..> | 2015-01-18 17:01 | 557M | |
| positive_150111_1701..> | 2015-01-11 17:01 | 573M | |
| positive_141221_1700..> | 2014-12-21 17:00 | 562M | |
| positive_141214_1700..> | 2014-12-14 17:00 | 580M | |
| positive_141207_1700..> | 2014-12-07 17:00 | 569M | |
| positive_141130_1700..> | 2014-11-30 17:00 | 565M | |
| positive_141116_1700..> | 2014-11-16 17:00 | 567M | |
| positive_141109_1700..> | 2014-11-09 17:00 | 568M | |
| positive_141102_1700..> | 2014-11-02 17:00 | 568M | |
| positive_141026_1601..> | 2014-10-26 17:01 | 567M | |
| positive_141019_1600..> | 2014-10-19 17:00 | 567M | |
| positive_141012_1601..> | 2014-10-12 17:01 | 15M | |
| positive_141005_1600..> | 2014-10-05 17:00 | 571M | |
| positive_140928_1559..> | 2014-09-28 16:59 | 306M | |
| positive_140921_1603..> | 2014-09-21 17:03 | 523M | |
| positive_140921_1601..> | 2014-09-21 17:01 | 2.7M | |
| positive_140914_1604..> | 2014-09-14 17:04 | 556M | |
| portman.wav | 2013-03-29 12:24 | 12M | |
| pornagain_160525_170..> | 2016-05-25 18:05 | 576M | |
| pornagain_160516_145..> | 2016-05-16 15:53 | 585M | |
| pornagain_160516_145..> | 2016-05-16 15:50 | 12M | |
| pornagain_160505_170..> | 2016-05-05 18:00 | 604M | |
| pornagain_160413_174..> | 2016-04-13 18:41 | 560M | |
| pornagain_160412_175..> | 2016-04-12 18:54 | 563M | |
| pornagain_160411_160..> | 2016-04-11 17:09 | 605M | |
| pornagain_160411_160..> | 2016-04-11 17:07 | 15M | |
| pornagain_160404_190..> | 2016-04-04 20:05 | 566M | |
| pornagain_160330_190..> | 2016-03-30 20:02 | 564M | |
| pornagain_160330_175..> | 2016-03-30 18:59 | 572M | |
| pornagain_160323_185..> | 2016-03-23 19:59 | 563M | |
| pornagain_160323_185..> | 2016-03-23 19:56 | 17M | |
| pornagain_160323_175..> | 2016-03-23 18:56 | 560M | |
| pornagain_160223_201..> | 2016-02-23 20:17 | 383M | |
| ping.wav | 2016-01-12 21:07 | 16K | |
| pinatahour_120829_19..> | 2012-08-29 19:00 | 1.2G | |
| pinatahour_120822_19..> | 2012-08-22 19:00 | 1.2G | |
| pinatahour_120815_19..> | 2012-08-15 19:00 | 1.2G | |
| pinatahour_120808_19..> | 2012-08-08 19:00 | 1.2G | |
| pinatahour_120801_19..> | 2012-08-01 19:00 | 1.2G | |
| pinatahour_120725_19..> | 2012-07-25 19:00 | 1.2G | |
| pinatahour_120718_19..> | 2012-07-18 19:00 | 1.2G | |
| pinatahour_120711_19..> | 2012-07-11 19:00 | 1.2G | |
| pinatahour_120704_19..> | 2012-07-04 19:00 | 1.2G | |
| pinatahour_120627_19..> | 2012-06-27 19:00 | 1.2G | |
| pinatahour_120620_19..> | 2012-06-20 19:00 | 1.2G | |
| pinatahour_120613_19..> | 2012-06-13 19:00 | 1.2G | |
| pinatahour_120606_19..> | 2012-06-06 19:00 | 1.2G | |
| pinatahour_120530_19..> | 2012-05-30 19:00 | 1.2G | |
| pinatahour_120523_19..> | 2012-05-23 19:00 | 1.2G | |
| pinatahour_120516_19..> | 2012-05-16 19:00 | 1.2G | |
| pinatahour_120509_19..> | 2012-05-09 19:00 | 1.2G | |
| pinatahour_120502_19..> | 2012-05-02 19:00 | 1.2G | |
| phantasm funeral.wav | 2016-01-12 13:07 | 421K | |
| peytonreleased.wav | 2012-03-11 14:33 | 7.1M | |
| pd2.wav | 2013-05-07 09:21 | 8.0M | |
| patti_b.WAV | 2011-08-10 20:55 | 42M | |
| palinonGC.wav | 2012-03-18 15:32 | 2.2M | |
| palin2012.wav | 2012-03-11 14:33 | 4.4M | |
| output.wav | 2015-12-28 22:50 | 10M | |
| orthodoxcreep.wav | 2013-01-30 00:20 | 6.0M | |
| oldtimecandy-ad.wav | 2013-02-14 17:58 | 5.0M | |
| old-phone-ring11.wav | 2019-11-03 04:09 | 6.6K | |
| occupyskidrow_141107..> | 2014-11-07 20:11 | 522M | |
| occupyskidrow_140826..> | 2014-08-26 20:04 | 571M | |
| occupyskidrow_140826..> | 2014-08-26 20:01 | 13M | |
| occupyskidrow_140819..> | 2014-08-19 20:00 | 584M | |
| occupyskidrow_140805..> | 2014-08-05 20:02 | 566M | |
| occupyskidrow_140729..> | 2014-07-29 20:01 | 565M | |
| occupyskidrow_140722..> | 2014-07-22 20:00 | 560M | |
| occupyskidrow_140715..> | 2014-07-15 20:00 | 576M | |
| occupyskidrow_140629..> | 2014-06-29 20:03 | 589M | |
| obamacarecase.wav | 2012-04-01 15:34 | 10M | |
| nrr_150927_190142_SR..> | 2015-09-27 20:01 | 562M | |
| nrr_150823_180332_SR..> | 2015-08-23 19:03 | 561M | |
| npr_sample1.wav | 2015-12-09 02:58 | 11M | |
| npr_160523_180734_WP..> | 2016-05-23 19:07 | 603M | |
| npr_160523_180540_WP..> | 2016-05-23 19:05 | 15M | |
| npr_160512_180002_WP..> | 2016-05-12 19:00 | 613M | |
| npr_160428_190609_WP..> | 2016-04-28 20:06 | 622M | |
| npr_160324_185602_WP..> | 2016-03-24 19:56 | 569M | |
| npr_160218_175649_WP..> | 2016-02-18 17:56 | 581M | |
| npr_160211_200446_WP..> | 2016-02-11 20:04 | 613M | |
| npr_160204_180151_WP..> | 2016-02-04 18:01 | 522M | |
| npr_160128_203246_WP..> | 2016-01-28 20:32 | 654M | |
| npr_160121_200048_WP..> | 2016-01-21 20:00 | 680M | |
| npr_160107_175816_WP..> | 2016-01-07 17:58 | 580M | |
| npr_151217_212432_WP..> | 2015-12-17 21:24 | 606M | |
| npr_151210_204043_WP..> | 2015-12-10 20:40 | 514M | |
| npr_151109_220454_WP..> | 2015-11-09 22:04 | 21M | |
| npr_151015_200604_SR..> | 2015-10-15 21:06 | 776M | |
| npr_151008_200007_SR..> | 2015-10-08 21:00 | 777M | |
| npr_150924_200157_SR..> | 2015-09-24 21:01 | 658M | |
| npr_150917_200210_SR..> | 2015-09-17 21:02 | 673M | |
| npr_150917_200028_SR..> | 2015-09-17 21:00 | 11M | |
| npr_150910_195934_SR..> | 2015-09-10 20:59 | 614M | |
| npr_150903_200040_SR..> | 2015-09-03 21:00 | 595M | |
| npr_150820_195926_SR..> | 2015-08-20 20:59 | 682M | |
| npr_150813_201354_SR..> | 2015-08-13 21:13 | 588M | |
| npr_150813_200828_SR..> | 2015-08-13 21:08 | 26M | |
| npr_150723_201321_SR..> | 2015-07-23 21:13 | 631M | |
| npr_150716_200506_SR..> | 2015-07-16 21:05 | 566M | |
| npr_150702_200329_SR..> | 2015-07-02 21:03 | 560M | |
| npr_150625_200534_SR..> | 2015-06-25 21:05 | 597M | |
| npr_150604_200626_SR..> | 2015-06-04 21:06 | 532M | |
| npr_150528_200633_SR..> | 2015-05-28 21:06 | 553M | |
| npr_150521_200451_SR..> | 2015-05-21 21:04 | 602M | |
| npr_150514_200442_SR..> | 2015-05-14 21:04 | 561M | |
| npr_150507_200236_SR..> | 2015-05-07 21:02 | 591M | |
| npr_150423_200138_SR..> | 2015-04-23 21:01 | 582M | |
| npr_150416_200014_SR..> | 2015-04-16 21:00 | 617M | |
| npr_150409_200145_SR..> | 2015-04-09 21:01 | 591M | |
| npr_150326_200106_SR..> | 2015-03-26 21:01 | 624M | |
| npr_150319_201226_SR..> | 2015-03-19 21:12 | 573M | |
| npr_150226_210308_SR..> | 2015-02-26 21:03 | 586M | |
| npr_150219_210338_SR..> | 2015-02-19 21:03 | 602M | |
| npr_150212_210222_SR..> | 2015-02-12 21:02 | 545M | |
| npr_150205_210905_SR..> | 2015-02-05 21:09 | 554M | |
| npr_150129_210332_SR..> | 2015-01-29 21:03 | 573M | |
| npr_150122_210414_SR..> | 2015-01-22 21:04 | 596M | |
| npr_141218_210614_SR..> | 2014-12-18 21:06 | 597M | |
| npr_141204_210102_SR..> | 2014-12-04 21:01 | 638M | |
| npr_141120_211608_SR..> | 2014-11-20 21:16 | 471M | |
| npr_141030_200425_SR..> | 2014-10-30 21:04 | 574M | |
| npr_141023_200243_SR..> | 2014-10-23 21:02 | 583M | |
| npr_141016_200339_SR..> | 2014-10-16 21:03 | 643M | |
| npr_141002_201007_SR..> | 2014-10-02 21:10 | 606M | |
| npr_140918_200234_SR..> | 2014-09-18 21:02 | 586M | |
| npr_140911_200128_SR..> | 2014-09-11 21:01 | 582M | |
| npr_140904_200038_SR..> | 2014-09-04 21:00 | 566M | |
| npr_140821_200620_SR..> | 2014-08-21 21:06 | 520M | |
| npr_140731_200301_SR..> | 2014-07-31 21:03 | 548M | |
| npr_140724_200039_SR..> | 2014-07-24 21:00 | 564M | |
| npr_140717_200210_SR..> | 2014-07-17 21:02 | 568M | |
| npr_140710_201443_SR..> | 2014-07-10 21:14 | 585M | |
| npr_140703_200009_SR..> | 2014-07-03 21:00 | 571M | |
| npr_140626_200123_SR..> | 2014-06-26 21:01 | 576M | |
| npr_140619_200410_SR..> | 2014-06-19 21:04 | 575M | |
| npr_140612_200311_SR..> | 2014-06-12 21:03 | 591M | |
| npr_140605_200420_SR..> | 2014-06-05 21:04 | 569M | |
| npr_140529_200159_SR..> | 2014-05-29 21:01 | 565M | |
| npr_140522_200331_SR..> | 2014-05-22 21:03 | 558M | |
| npr_140515_200720_SR..> | 2014-05-15 21:07 | 561M | |
| npr_140508_200129_SR..> | 2014-05-08 21:01 | 561M | |
| npr_140501_200036_SR..> | 2014-05-01 21:00 | 558M | |
| npr_140424_200026_SR..> | 2014-04-24 21:00 | 560M | |
| npr_140417_200005_SR..> | 2014-04-17 21:00 | 563M | |
| npr_140410_200148_SR..> | 2014-04-10 21:01 | 529M | |
| npr_140313_200238_SR..> | 2014-03-13 21:02 | 550M | |
| npr_140306_210236_SR..> | 2014-03-06 21:02 | 591M | |
| npr_140227_210221_SR..> | 2014-02-27 21:02 | 563M | |
| npr_140220_210625_SR..> | 2014-02-20 21:06 | 568M | |
| npr_140213_210336_SR..> | 2014-02-13 21:03 | 560M | |
| npr_140206_210414_SR..> | 2014-02-06 21:04 | 578M | |
| npr_140130_210013_SR..> | 2014-01-30 21:00 | 599M | |
| npr_140123_210158_SR..> | 2014-01-23 21:01 | 569M | |
| npr_140116_210634_SR..> | 2014-01-16 21:06 | 585M | |
| npr_140109_210843_SR..> | 2014-01-09 21:08 | 570M | |
| npr_131212_220036_SR..> | 2013-12-12 21:00 | 569M | |
| npr_131212_215818_SR..> | 2013-12-12 20:58 | 8.8M | |
| npr_131205_221253_SR..> | 2013-12-05 21:12 | 613M | |
| npr_131121_221604_SR..> | 2013-11-21 21:16 | 664M | |
| npr_131114_221951_SR..> | 2013-11-14 21:19 | 794M | |
| npr_131107_222921_SR..> | 2013-11-07 21:29 | 634M | |
| npr_131031_210817_SR..> | 2013-10-31 21:08 | 694M | |
| npr_131017_210331_SR..> | 2013-10-17 21:03 | 785M | |
| npr_130919_211409_SR..> | 2013-09-19 21:14 | 704M | |
| npr_130912_210916_SR..> | 2013-09-12 21:09 | 756M | |
| npr_130829_212309_SR..> | 2013-08-29 21:23 | 895M | |
| npr_130829_211728_SR..> | 2013-08-29 21:17 | 2.6M | |
| npr_130815_212655_SR..> | 2013-08-15 21:26 | 565M | |
| npr_130808_211026_SR..> | 2013-08-08 21:10 | 688M | |
| npr_130725_210011_SR..> | 2013-07-25 21:00 | 772M | |
| npr_130613_215657_SR..> | 2013-06-13 21:56 | 816M | |
| npr_130606_223242_SR..> | 2013-06-06 22:32 | 668M | |
| npr_130606_210200_SR..> | 2013-06-06 21:02 | 706M | |
| npr_130530_205939_SR..> | 2013-05-30 20:59 | 617M | |
| npr_130523_205947_SR..> | 2013-05-23 20:59 | 617M | |
| npr_130516_210020_SR..> | 2013-05-16 21:00 | 646M | |
| npr_130507_141008_SR..> | 2013-05-07 14:10 | 669M | |
| npr_130507_130007_SR..> | 2013-05-07 13:00 | 600M | |
| npr_130502_210814_SR..> | 2013-05-02 21:08 | 643M | |
| npr_130425_210017_SR..> | 2013-04-25 21:00 | 609M | |
| npr_130418_210007_SR..> | 2013-04-18 21:00 | 609M | |
| npr_130411_205937_SR..> | 2013-04-17 12:51 | 570M | |
| npr-promo-1.wav | 2013-05-20 16:02 | 11M | |
| no response warning ..> | 2011-09-27 13:06 | 2.3M | |
| no response goodbye ..> | 2011-09-27 13:05 | 1.9M | |
| nlr_promo_130908_215..> | 2013-09-08 21:59 | 745K | |
| nlr_promo_130908_215..> | 2013-09-08 21:57 | 9.2M | |
| nlr_151015_175845_SR..> | 2015-10-15 18:58 | 539M | |
| nlr_151008_190738_SR..> | 2015-10-08 20:07 | 286M | |
| nlr_151008_175856_SR..> | 2015-10-08 18:58 | 549M | |
| nlr_151001_175913_SR..> | 2015-10-01 18:59 | 542M | |
| nlr_150924_175912_SR..> | 2015-09-24 18:59 | 541M | |
| nlr_150917_180009_SR..> | 2015-09-17 19:00 | 554M | |
| nlr_150917_175921_SR..> | 2015-09-17 18:59 | 6.1M | |
| nlr_150910_175932_SR..> | 2015-09-10 18:59 | 551M | |
| nlr_150903_180341_SR..> | 2015-09-03 19:03 | 541M | |
| nlr_150903_180246_SR..> | 2015-09-03 19:02 | 5.2M | |
| nlr_150827_180110_SR..> | 2015-08-27 19:01 | 549M | |
| nlr_150827_175958_SR..> | 2015-08-27 18:59 | 1.3M | |
| nlr_150820_175949_SR..> | 2015-08-20 18:59 | 548M | |
| nlr_150813_175942_SR..> | 2015-08-13 18:59 | 547M | |
| nlr_150806_175956_SR..> | 2015-08-06 18:59 | 553M | |
| nlr_150730_180005_SR..> | 2015-07-30 19:00 | 544M | |
| nlr_150723_180305_SR..> | 2015-07-23 19:03 | 547M | |
| nlr_150723_180159_SR..> | 2015-07-23 19:01 | 11M | |
| nlr_150716_180219_SR..> | 2015-07-16 19:02 | 544M | |
| nlr_150716_180037_SR..> | 2015-07-16 19:00 | 3.8M | |
| nlr_150709_180131_SR..> | 2015-07-09 19:01 | 542M | |
| nlr_150709_180008_SR..> | 2015-07-09 19:00 | 1.7M | |
| nlr_150702_175958_SR..> | 2015-07-02 18:59 | 543M | |
| nlr_150625_180015_SR..> | 2015-06-25 19:00 | 543M | |
| nlr_150618_180233_SR..> | 2015-06-18 19:02 | 548M | |
| nlr_150618_180002_SR..> | 2015-06-18 19:00 | 4.6M | |
| nlr_150611_181058_SR..> | 2015-06-11 19:10 | 518M | |
| nlr_150611_181001_SR..> | 2015-06-11 19:10 | 2.7M | |
| nlr_150611_180816_SR..> | 2015-06-11 19:08 | 18M | |
| nlr_150611_180125_SR..> | 2015-06-11 19:01 | 2.9M | |
| nlr_150604_180007_SR..> | 2015-06-04 19:00 | 551M | |
| nlr_150528_175958_SR..> | 2015-05-28 18:59 | 553M | |
| nlr_150514_180418_SR..> | 2015-05-14 19:04 | 557M | |
| nlr_150507_180052_SR..> | 2015-05-07 19:00 | 549M | |
| nlr_150430_180053_SR..> | 2015-04-30 19:00 | 550M | |
| nlr_150423_180003_SR..> | 2015-04-23 19:00 | 554M | |
| nlr_150416_180029_SR..> | 2015-04-16 19:00 | 555M | |
| nlr_150409_180002_SR..> | 2015-04-09 19:00 | 553M | |
| nlr_150326_180231_SR..> | 2015-03-26 19:02 | 549M | |
| nlr_150319_180105_SR..> | 2015-03-19 19:01 | 552M | |
| nlr_150305_190048_SR..> | 2015-03-05 19:00 | 547M | |
| nlr_150226_190047_SR..> | 2015-02-26 19:00 | 548M | |
| nlr_150219_190326_SR..> | 2015-02-19 19:03 | 553M | |
| nlr_150212_190052_SR..> | 2015-02-12 19:00 | 562M | |
| nlr_150205_190333_SR..> | 2015-02-05 19:03 | 549M | |
| nlr_150129_190035_SR..> | 2015-01-29 19:00 | 550M | |
| nlr_150122_190109_SR..> | 2015-01-22 19:01 | 565M | |
| nlr_150115_190100_SR..> | 2015-01-15 19:01 | 553M | |
| nlr_150108_190002_SR..> | 2015-01-08 19:00 | 540M | |
| nlr_141218_185958_SR..> | 2014-12-18 18:59 | 552M | |
| nlr_141204_190041_SR..> | 2014-12-04 19:00 | 551M | |
| nlr_141120_190004_SR..> | 2014-11-20 19:00 | 552M | |
| nlr_141113_190005_SR..> | 2014-11-13 19:00 | 548M | |
| nlr_141106_190002_SR..> | 2014-11-06 19:00 | 536M | |
| nlr_141030_180012_SR..> | 2014-10-30 19:00 | 552M | |
| nlr_141023_180059_SR..> | 2014-10-23 19:00 | 544M | |
| nlr_141009_180110_SR..> | 2014-10-09 19:01 | 551M | |
| nlr_141002_180049_SR..> | 2014-10-02 19:00 | 551M | |
| nlr_140918_180143_SR..> | 2014-09-18 19:01 | 551M | |
| nlr_140911_180057_SR..> | 2014-09-11 19:00 | 551M | |
| nlr_140904_180010_SR..> | 2014-09-04 19:00 | 551M | |
| nlr_140828_180114_SR..> | 2014-08-28 19:01 | 547M | |
| nlr_140821_180037_SR..> | 2014-08-21 19:00 | 556M | |
| nlr_140814_180250_SR..> | 2014-08-14 19:02 | 549M | |
| nlr_140807_180206_SR..> | 2014-08-07 19:02 | 550M | |
| nlr_140731_180122_SR..> | 2014-07-31 19:01 | 554M | |
| nlr_140724_180038_SR..> | 2014-07-24 19:00 | 553M | |
| nlr_140717_180052_SR..> | 2014-07-17 19:00 | 551M | |
| nlr_140710_180019_SR..> | 2014-07-11 05:07 | 553M | |
| nlr_140626_180005_SR..> | 2014-06-26 19:00 | 552M | |
| nlr_140619_180006_SR..> | 2014-06-19 19:00 | 553M | |
| nlr_140612_180002_SR..> | 2014-06-12 19:00 | 553M | |
| nlr_140605_180003_SR..> | 2014-06-05 19:00 | 505M | |
| nlr_140529_180300_SR..> | 2014-05-29 19:03 | 562M | |
| nlr_140522_180004_SR..> | 2014-05-22 19:00 | 541M | |
| nlr_140515_180016_SR..> | 2014-05-15 19:00 | 549M | |
| nlr_140508_180023_SR..> | 2014-05-08 19:00 | 555M | |
| nlr_140501_180008_SR..> | 2014-05-01 19:00 | 561M | |
| nlr_140424_180030_SR..> | 2014-04-24 19:00 | 557M | |
| nlr_140417_175955_SR..> | 2014-04-17 18:59 | 557M | |
| nlr_140410_180027_SR..> | 2014-04-10 19:00 | 551M | |
| nlr_140403_180004_SR..> | 2014-04-03 19:00 | 547M | |
| nlr_140327_180002_SR..> | 2014-03-27 19:00 | 555M | |
| nlr_140320_180101_SR..> | 2014-03-20 19:01 | 559M | |
| nlr_140313_180005_SR..> | 2014-03-13 19:00 | 556M | |
| nlr_140306_190001_SR..> | 2014-03-06 19:00 | 557M | |
| nlr_140227_190017_SR..> | 2014-02-27 19:00 | 556M | |
| nlr_140220_190004_SR..> | 2014-02-20 19:00 | 560M | |
| nlr_140213_190034_SR..> | 2014-02-13 19:00 | 547M | |
| nlr_140206_190004_SR..> | 2014-02-06 19:00 | 550M | |
| nlr_140130_190026_SR..> | 2014-01-30 19:00 | 552M | |
| nlr_140123_190005_SR..> | 2014-01-23 19:00 | 552M | |
| nlr_140116_185959_SR..> | 2014-01-16 18:59 | 554M | |
| nlr_140109_185956_SR..> | 2014-01-09 18:59 | 557M | |
| nlr_140102_190007_SR..> | 2014-01-02 19:00 | 548M | |
| nlr_131226_192137_SR..> | 2013-12-26 19:21 | 559M | |
| nlr_131226_190649_SR..> | 2013-12-26 19:06 | 11M | |
| nlr_131224_123226_SR..> | 2013-12-24 12:32 | 251M | |
| nlr_131219_190009_SR..> | 2013-12-19 19:00 | 559M | |
| nlr_131212_200038_SR..> | 2013-12-12 19:00 | 574M | |
| nlr_131208_215959_SR..> | 2013-12-08 20:59 | 560M | |
| nlr_131124_220050_SR..> | 2013-11-24 21:00 | 555M | |
| nlr_131117_220113_SR..> | 2013-11-17 21:01 | 555M | |
| nlr_131110_220022_SR..> | 2013-11-10 21:00 | 557M | |
| nlr_131103_220007_SR..> | 2013-11-03 21:00 | 553M | |
| nlr_131027_210034_SR..> | 2013-10-27 21:00 | 575M | |
| nlr_131020_210003_SR..> | 2013-10-20 21:00 | 565M | |
| nlr_131013_210111_SR..> | 2013-10-13 21:01 | 563M | |
| nlr_131013_205914_SR..> | 2013-10-13 20:59 | 18M | |
| nlr_131006_205958_SR..> | 2013-10-06 20:59 | 559M | |
| nlr_130929_205854_SR..> | 2013-09-29 20:58 | 567M | |
| nlr_130922_210249_SR..> | 2013-09-22 21:02 | 571M | |
| nlr_130914_124122_SR..> | 2013-09-14 12:41 | 588M | |
| nlr_130914_122845_SR..> | 2013-09-14 12:28 | 91M | |
| nlr_130908_205905_SR..> | 2013-09-08 20:59 | 575M | |
| nlr_130901_205952_SR..> | 2013-09-01 20:59 | 575M | |
| nlr_130825_210018_SR..> | 2013-08-25 21:00 | 572M | |
| nlr_130818_210142_SR..> | 2013-08-18 21:01 | 565M | |
| nlr_130804_210004_SR..> | 2013-08-04 21:00 | 573M | |
| nlr_130728_205928_SR..> | 2013-07-28 20:59 | 570M | |
| nlr_130721_210019_SR..> | 2013-07-21 21:00 | 561M | |
| nlr_130714_205955_SR..> | 2013-07-14 20:59 | 563M | |
| nlr_130707_205911_SR..> | 2013-07-07 20:59 | 558M | |
| nlr_130630_205938_SR..> | 2013-06-30 20:59 | 552M | |
| nlr_130623_210709_SR..> | 2013-06-23 21:07 | 554M | |
| nlr_130616_210105_SR..> | 2013-06-16 21:01 | 554M | |
| nlr_130609_205935_SR..> | 2013-06-09 20:59 | 564M | |
| nlr_130602_205923_SR..> | 2013-06-02 20:59 | 571M | |
| nlr_130526_210515_SR..> | 2013-05-26 21:05 | 561M | |
| nlr_130519_205955_SR..> | 2013-05-20 16:09 | 556M | |
| nlr_130512_210041_SR..> | 2013-05-12 21:00 | 555M | |
| nlr_130512_204010_SR..> | 2013-05-12 20:40 | 12M | |
| nlr_130505_210015_SR..> | 2013-05-05 21:00 | 567M | |
| nlr_130428_210002_SR..> | 2013-04-28 21:00 | 585M | |
| nlr_130421_210050_SR..> | 2013-04-21 21:00 | 579M | |
| nlr_130414_210010_SR..> | 2013-04-14 21:00 | 566M | |
| nlr-promo-2.wav | 2013-12-26 21:24 | 5.4M | |
| nlr-promo-1.wav | 2013-06-24 19:28 | 7.1M | |
| nflbounty.wav | 2012-03-11 14:33 | 4.2M | |
| newtmeetsmitt.wav | 2012-04-01 15:33 | 10M | |
| newgenpromo17.wav | 2013-01-07 17:53 | 5.0M | |
| netfound.wav | 2001-08-03 17:33 | 21K | |
| netenyahubummer.wav | 2012-03-11 14:33 | 4.7M | |
| ncaaclip.wav | 2013-04-07 09:56 | 1.4M | |
| naskill.wav | 2013-04-21 09:42 | 1.5M | |
| nakedkunis_131005_20..> | 2013-10-05 20:37 | 413M | |
| nakedkunis_131005_19..> | 2013-10-05 19:35 | 29M | |
| msg0280.WAV | 2015-12-28 22:45 | 68K | |
| msg0279.WAV | 2015-12-28 22:45 | 101K | |
| msg0278.WAV | 2015-12-28 22:44 | 78K | |
| msg0277.WAV | 2015-12-28 22:44 | 100K | |
| msg0276.WAV | 2015-12-28 22:44 | 97K | |
| msg0275.WAV | 2015-12-28 22:44 | 63K | |
| msg0274.WAV | 2015-12-28 22:44 | 59K | |
| msg0273.WAV | 2015-12-28 22:44 | 118K | |
| msg0272.WAV | 2015-12-28 22:44 | 65K | |
| msg0271.WAV | 2015-12-28 22:44 | 72K | |
| msg0270.WAV | 2015-12-28 22:44 | 106K | |
| msg0269.WAV | 2015-12-28 22:44 | 95K | |
| msg0268.WAV | 2015-12-28 22:43 | 81K | |
| msg0267.WAV | 2015-12-28 22:43 | 101K | |
| msg0266.WAV | 2015-12-28 22:43 | 56K | |
| msg0265.WAV | 2015-12-28 22:43 | 63K | |
| msg0264.WAV | 2015-12-28 22:43 | 59K | |
| msg0263.WAV | 2015-12-28 22:43 | 66K | |
| msg0262.WAV | 2015-12-28 22:43 | 164K | |
| msg0261.WAV | 2015-12-28 22:43 | 65K | |
| msg0260.WAV | 2015-12-28 22:43 | 126K | |
| msg0259.WAV | 2015-12-28 22:43 | 108K | |
| msg0258.WAV | 2015-12-28 22:42 | 208K | |
| msg0257.WAV | 2015-12-28 22:42 | 62K | |
| msg0256.WAV | 2015-12-28 22:42 | 85K | |
| msg0255.WAV | 2015-12-28 22:42 | 67K | |
| msg0254.WAV | 2015-12-28 22:42 | 50K | |
| msg0253.WAV | 2015-12-28 22:42 | 139K | |
| msg0252.WAV | 2015-12-28 22:42 | 148K | |
| msg0251.WAV | 2015-12-28 22:42 | 83K | |
| msg0250.WAV | 2015-12-28 22:42 | 163K | |
| msg0249.WAV | 2015-12-28 22:41 | 426K | |
| msg0248.WAV | 2015-12-28 22:41 | 25K | |
| msg0247.WAV | 2015-12-28 22:41 | 148K | |
| msg0246.WAV | 2015-12-28 22:41 | 39K | |
| msg0245.WAV | 2015-12-28 22:41 | 632K | |
| msg0244.WAV | 2015-12-28 22:41 | 92K | |
| msg0243.WAV | 2015-12-28 22:41 | 148K | |
| msg0242.WAV | 2015-12-28 22:41 | 304K | |
| msg0241.WAV | 2015-12-28 22:41 | 79K | |
| msg0240.WAV | 2015-12-28 22:41 | 91K | |
| msg0239.WAV | 2015-12-28 22:40 | 52K | |
| msg0238.WAV | 2015-12-28 22:40 | 61K | |
| msg0237.WAV | 2015-12-28 22:40 | 64K | |
| msg0236.WAV | 2015-12-28 22:40 | 22K | |
| msg0235.WAV | 2015-12-28 22:40 | 89K | |
| msg0234.WAV | 2015-12-28 22:40 | 44K | |
| msg0233.WAV | 2015-12-28 22:40 | 186K | |
| msg0232.WAV | 2015-12-28 22:40 | 100K | |
| msg0231.WAV | 2015-12-28 22:40 | 24K | |
| msg0230.WAV | 2015-12-28 22:40 | 177K | |
| msg0229.WAV | 2015-12-28 22:39 | 57K | |
| msg0228.WAV | 2015-12-28 22:39 | 99K | |
| msg0227.WAV | 2015-12-28 22:39 | 651K | |
| msg0226.WAV | 2015-12-28 22:39 | 294K | |
| msg0225.WAV | 2015-12-28 22:39 | 25K | |
| msg0224.WAV | 2015-12-28 22:39 | 405K | |
| msg0223.WAV | 2015-12-28 22:39 | 71K | |
| msg0222.WAV | 2015-12-28 22:39 | 315K | |
| msg0221.WAV | 2015-12-28 22:39 | 112K | |
| msg0220.WAV | 2015-12-28 22:38 | 229K | |
| msg0219.WAV | 2015-12-28 22:38 | 87K | |
| msg0218.WAV | 2015-12-28 22:38 | 43K | |
| msg0217.WAV | 2015-12-28 22:38 | 60K | |
| msg0216.WAV | 2015-12-28 22:38 | 44K | |
| msg0215.WAV | 2015-12-28 22:38 | 47K | |
| msg0214.WAV | 2015-12-28 22:38 | 35K | |
| msg0213.WAV | 2015-12-28 22:38 | 106K | |
| msg0212.WAV | 2015-12-28 22:38 | 260K | |
| msg0211.WAV | 2015-12-28 22:37 | 96K | |
| msg0210.WAV | 2015-12-28 22:37 | 213K | |
| msg0209.WAV | 2015-12-28 22:37 | 21K | |
| msg0208.WAV | 2015-12-28 22:37 | 60K | |
| msg0207.WAV | 2015-12-28 22:37 | 54K | |
| msg0206.WAV | 2015-12-28 22:37 | 60K | |
| msg0205.WAV | 2015-12-28 22:37 | 88K | |
| msg0204.WAV | 2015-12-28 22:37 | 114K | |
| msg0203.WAV | 2015-12-28 22:37 | 321K | |
| msg0202.WAV | 2015-12-28 22:36 | 81K | |
| msg0201.WAV | 2015-12-28 22:36 | 150K | |
| msg0200.WAV | 2015-12-28 22:36 | 110K | |
| msg0199.WAV | 2015-12-28 22:34 | 59K | |
| msg0198.WAV | 2015-12-28 22:46 | 131K | |
| msg0197.WAV | 2015-12-28 22:46 | 61K | |
| msg0196.WAV | 2015-12-22 00:12 | 49K | |
| msg0195.WAV | 2015-12-21 23:46 | 48K | |
| msg0194.WAV | 2015-12-21 23:46 | 43K | |
| msg0193.WAV | 2015-12-21 23:46 | 33K | |
| msg0192.WAV | 2015-12-21 23:47 | 57K | |
| msg0191.WAV | 2015-12-21 23:47 | 17K | |
| msg0190.WAV | 2015-12-21 23:47 | 13K | |
| msg0189.WAV | 2015-12-21 23:47 | 8.6K | |
| msg0188.WAV | 2015-12-21 23:47 | 21K | |
| msg0187.WAV | 2015-12-21 23:47 | 24K | |
| msg0186.WAV | 2015-12-21 23:47 | 42K | |
| msg0185.WAV | 2015-12-21 23:48 | 48K | |
| msg0184.WAV | 2015-12-21 23:48 | 51K | |
| msg0183.WAV | 2015-12-21 23:48 | 52K | |
| msg0182.WAV | 2015-12-21 23:48 | 134K | |
| msg0181.WAV | 2015-12-21 23:48 | 138K | |
| msg0178.WAV | 2015-12-03 19:44 | 47K | |
| msg0099.WAV | 2014-04-11 23:54 | 87K | |
| msg0098.WAV | 2014-04-11 23:54 | 89K | |
| msg0097.WAV | 2014-04-11 23:54 | 83K | |
| msg0096.WAV | 2014-04-11 23:54 | 105K | |
| msg0095.WAV | 2014-04-11 23:54 | 54K | |
| msg0094.WAV | 2014-04-11 23:54 | 47K | |
| msg0093.WAV | 2014-04-11 23:54 | 47K | |
| msg0092.WAV | 2014-04-11 23:53 | 119K | |
| msg0091.WAV | 2014-04-11 23:53 | 176K | |
| msg0090.WAV | 2014-04-11 23:53 | 420K | |
| msg0047.WAV | 2015-12-28 22:37 | 59K | |
| msg0027.WAV | 2014-04-11 23:55 | 66K | |
| mrbeer-ad.wav | 2013-02-14 18:01 | 4.3M | |
| mormusicradiopod_130..> | 2013-01-31 22:26 | 13M | |
| mormusicradiopod_130..> | 2013-01-17 22:08 | 4.9M | |
| mormusicradiopod_130..> | 2013-01-03 22:33 | 14M | |
| mormusicradiopod_121..> | 2012-12-27 22:05 | 622M | |
| mormusicradiopod_120..> | 2012-09-20 22:17 | 1.0G | |
| mormusicradiopod_120..> | 2012-09-14 14:55 | 2.0M | |
| mormusicradiopod_120..> | 2012-09-14 14:54 | 2.1M | |
| mormusicradiopod_120..> | 2012-09-14 14:20 | 123M | |
| mormusicradiopod_120..> | 2012-09-13 22:30 | 1.2G | |
| mormusicradiopod_120..> | 2012-09-06 22:00 | 1.2G | |
| mormusicradiopod_120..> | 2012-08-30 22:00 | 1.2G | |
| mormusicradiopod_120..> | 2012-08-23 22:00 | 1.2G | |
| mormusicradiopod_120..> | 2012-08-16 22:00 | 1.2G | |
| mormusicradiopod_120..> | 2012-08-09 22:00 | 1.2G | |
| mormusicradiopod_120..> | 2012-08-02 22:00 | 1.2G | |
| mormusicradiopod_120..> | 2012-07-29 20:34 | 1.2G | |
| mormusicradiopod_120..> | 2012-07-19 22:00 | 1.2G | |
| mormusicradiopod_120..> | 2012-07-12 22:00 | 1.2G | |
| mormusicradiopod_120..> | 2012-07-05 22:00 | 1.2G | |
| mormusicradiopod_120..> | 2012-06-28 22:00 | 1.2G | |
| mormusicradiopod_120..> | 2012-06-21 22:00 | 1.2G | |
| mormusicradiopod_120..> | 2012-06-14 22:00 | 1.2G | |
| mormusicradiopod_120..> | 2012-06-07 22:00 | 1.2G | |
| mormusicradiopod_120..> | 2012-05-31 22:00 | 1.2G | |
| mormusicradiopod_120..> | 2012-05-24 22:00 | 1.2G | |
| mormusicradiopod_120..> | 2012-05-22 10:32 | 1.2G | |
| mormusicradiopod_120..> | 2012-05-10 22:08 | 1.1G | |
| mormusicradiopod_120..> | 2012-05-03 22:00 | 1.2G | |
| mormusic radio intro..> | 2011-04-07 16:33 | 2.7M | |
| mormusic_bumper.wav | 2011-03-28 00:16 | 2.7M | |
| mmm radio promo.wav | 2011-04-28 21:49 | 1.4M | |
| mmm_promo1.wav | 2011-04-22 01:46 | 106M | |
| mittflop copy.wav | 2012-03-25 11:49 | 7.2M | |
| mittflop.wav | 2012-03-03 18:47 | 7.2M | |
| mistressc_intro_1310..> | 2013-10-19 14:37 | 25M | |
| missile.wav | 2000-05-25 06:38 | 12K | |
| michele_la_mascota_b..> | 2013-04-17 13:32 | 1.4M | |
| michael monogan prom..> | 2011-05-11 23:05 | 1.4M | |
| mentionedrealignment..> | 2011-09-18 09:07 | 55M | |
| medicus_promo1.wav | 2013-09-21 13:35 | 7.8M | |
| mediamattersad.wav | 2012-03-25 11:49 | 10M | |
| mayor 2.wav | 2016-04-26 15:30 | 6.3M | |
| mattimeradio_120708_..> | 2012-07-08 18:00 | 595M | |
| mattimeradio_120701_..> | 2012-07-01 18:00 | 595M | |
| mattimeradio_120624_..> | 2012-06-24 18:00 | 595M | |
| mattimeradio_120610_..> | 2012-06-10 18:00 | 595M | |
| mattimeradio_120603_..> | 2012-06-03 18:00 | 595M | |
| mattimeradio_120527_..> | 2012-05-27 18:00 | 596M | |
| mattimeradio_120520_..> | 2012-05-20 18:00 | 595M | |
| mattimeradio_120513_..> | 2012-05-13 18:00 | 596M | |
| mattimeradio_120429_..> | 2012-04-29 18:00 | 595M | |
| mastersplayground_15..> | 2015-06-11 18:00 | 568M | |
| mastersplayground_15..> | 2015-06-04 17:59 | 575M | |
| mastersplayground_15..> | 2015-05-28 18:00 | 568M | |
| mastersplayground_15..> | 2015-05-21 18:00 | 617M | |
| mastersplayground_15..> | 2015-05-14 18:05 | 581M | |
| mastersplayground_15..> | 2015-05-07 18:00 | 575M | |
| mastersplayground_15..> | 2015-04-30 18:00 | 579M | |
| mastersplayground_15..> | 2015-04-16 18:00 | 568M | |
| mastersplayground_15..> | 2015-04-09 18:00 | 568M | |
| mastersplayground_15..> | 2015-04-02 18:02 | 598M | |
| mastersplayground_15..> | 2015-03-26 18:01 | 598M | |
| mastersplayground_15..> | 2015-03-19 18:05 | 516M | |
| mastersplayground_15..> | 2015-03-12 18:00 | 598M | |
| mastersplayground_15..> | 2015-03-05 18:00 | 579M | |
| mastersplayground_15..> | 2015-02-26 17:59 | 576M | |
| mastersplayground_15..> | 2015-02-19 18:02 | 596M | |
| mastersplayground_15..> | 2015-02-12 18:00 | 582M | |
| mastersplayground_15..> | 2015-02-05 18:06 | 550M | |
| mastersplayground_15..> | 2015-01-29 18:00 | 580M | |
| mastersplayground_15..> | 2015-01-22 18:03 | 560M | |
| mastersplayground_15..> | 2015-01-15 18:00 | 589M | |
| mastersplayground_15..> | 2015-01-08 18:00 | 568M | |
| mastersplayground_14..> | 2014-12-26 17:59 | 577M | |
| mastersplayground_14..> | 2014-12-19 18:00 | 581M | |
| mastersplayground_14..> | 2014-12-12 18:01 | 626M | |
| mastersplayground_14..> | 2014-12-05 18:02 | 637M | |
| mastersplayground_14..> | 2014-11-28 18:00 | 591M | |
| mastersplayground_14..> | 2014-11-21 18:04 | 543M | |
| mastersplayground_14..> | 2014-11-14 18:03 | 582M | |
| mastersplayground_14..> | 2014-11-07 18:00 | 574M | |
| mastersplayground_14..> | 2014-10-31 18:00 | 622M | |
| mastersplayground_14..> | 2014-10-24 18:01 | 566M | |
| mastersplayground_14..> | 2014-10-10 18:01 | 575M | |
| mastersplayground_14..> | 2014-10-03 18:00 | 567M | |
| mastersplayground_14..> | 2014-09-26 18:00 | 576M | |
| mastersplayground_14..> | 2014-09-19 18:00 | 565M | |
| mastersplayground_14..> | 2014-09-05 18:00 | 559M | |
| mastersplayground_14..> | 2014-08-29 18:02 | 619M | |
| mastersplayground_14..> | 2014-08-22 18:00 | 600M | |
| mastersplayground_14..> | 2014-08-15 18:04 | 569M | |
| mastersplayground_14..> | 2014-08-08 18:02 | 592M | |
| mastersplayground_14..> | 2014-08-01 18:01 | 586M | |
| mastersplayground_14..> | 2014-07-25 18:00 | 595M | |
| mastersplayground_14..> | 2014-07-18 18:00 | 585M | |
| mastersplayground_14..> | 2014-07-11 18:01 | 582M | |
| mastersplayground_14..> | 2014-06-27 18:11 | 618M | |
| mastersplayground_14..> | 2014-06-27 18:02 | 66M | |
| mastersplayground_14..> | 2014-06-20 18:00 | 608M | |
| mastersplayground_14..> | 2014-06-06 18:00 | 611M | |
| mastersplayground_14..> | 2014-05-30 18:09 | 612M | |
| mastersplayground_14..> | 2014-05-30 18:04 | 5.7M | |
| mastersplayground_14..> | 2014-05-30 18:03 | 11M | |
| mastersplayground_14..> | 2014-05-30 18:01 | 12M | |
| mastersplayground_14..> | 2014-05-23 17:59 | 600M | |
| mastersplayground_14..> | 2014-05-16 18:01 | 578M | |
| mastersplayground_14..> | 2014-05-13 23:37 | 10M | |
| masters_140509_17002..> | 2014-05-09 18:00 | 572M | |
| masters_140425_17072..> | 2014-04-25 18:07 | 571M | |
| masters_140418_17033..> | 2014-04-18 18:03 | 557M | |
| masters_140411_17045..> | 2014-04-11 18:04 | 598M | |
| masters_140404_17023..> | 2014-04-04 18:02 | 589M | |
| masters_140328_17011..> | 2014-03-28 18:01 | 599M | |
| masters_140321_17000..> | 2014-03-21 18:00 | 569M | |
| masters_140314_17044..> | 2014-03-14 18:04 | 582M | |
| masters_140307_18095..> | 2014-03-07 18:09 | 572M | |
| masters_140228_18011..> | 2014-02-28 18:01 | 575M | |
| mary tyler moore.wav | 2011-04-17 16:47 | 9.9M | |
| markpodcast_140713_1..> | 2014-07-13 14:45 | 9.5M | |
| markpodcast_140713_1..> | 2014-07-13 14:44 | 15M | |
| manningtebowsaints.wav | 2012-03-25 11:50 | 7.2M | |
| manicjimmy_130922_16..> | 2013-09-22 16:26 | 55M | |
| malkmus.wav | 2011-04-20 21:02 | 18M | |
| magicson.wav | 2013-04-09 11:02 | 6.0M | |
| losangelesnista_twof..> | 2013-09-02 14:03 | 3.5M | |
| losangelesnista_reco..> | 2013-09-02 14:01 | 12M | |
| losangelesnista_musi..> | 2013-09-02 14:11 | 5.1M | |
| losangelesnista_musi..> | 2013-09-02 14:06 | 48M | |
| losangelesnista_lani..> | 2013-09-02 14:12 | 11M | |
| losangelesnista_lani..> | 2013-09-02 14:12 | 2.9M | |
| losangelesnista_itsc..> | 2013-09-02 13:56 | 34M | |
| losangelesnista_cave..> | 2013-09-02 13:54 | 18M | |
| losangelesnista_1405..> | 2014-05-12 21:15 | 1.0G | |
| losangelesnista_1405..> | 2014-05-05 21:00 | 1.1G | |
| losangelesnista_1404..> | 2014-04-28 21:00 | 1.1G | |
| losangelesnista_1404..> | 2014-04-21 21:00 | 1.1G | |
| losangelesnista_1404..> | 2014-04-14 21:00 | 1.1G | |
| losangelesnista_1404..> | 2014-04-07 21:00 | 1.1G | |
| losangelesnista_1403..> | 2014-03-31 23:18 | 818M | |
| losangelesnista_1403..> | 2014-03-31 21:00 | 1.1G | |
| losangelesnista_1403..> | 2014-03-31 13:00 | 1.1G | |
| losangelesnista_1403..> | 2014-03-25 20:00 | 1.1G | |
| losangelesnista_1403..> | 2014-03-24 21:00 | 1.1G | |
| losangelesnista_1403..> | 2014-03-20 10:00 | 1.2G | |
| losangelesnista_1403..> | 2014-03-19 12:00 | 615M | |
| losangelesnista_1403..> | 2014-03-17 21:00 | 1.1G | |
| losangelesnista_1403..> | 2014-03-17 14:00 | 610M | |
| losangelesnista_1403..> | 2014-03-17 13:00 | 581M | |
| losangelesnista_1403..> | 2014-03-10 21:00 | 1.1G | |
| losangelesnista_1403..> | 2014-03-07 12:00 | 1.1G | |
| losangelesnista_1403..> | 2014-03-03 21:00 | 1.1G | |
| losangelesnista_1402..> | 2014-02-26 13:00 | 1.2G | |
| losangelesnista_1402..> | 2014-02-25 19:30 | 1.1G | |
| losangelesnista_1402..> | 2014-02-24 21:00 | 1.2G | |
| losangelesnista_1402..> | 2014-02-18 19:30 | 1.1G | |
| losangelesnista_1402..> | 2014-02-17 21:00 | 1.1G | |
| losangelesnista_1402..> | 2014-02-11 19:30 | 1.1G | |
| losangelesnista_1402..> | 2014-02-10 21:00 | 1.2G | |
| losangelesnista_1401..> | 2014-01-31 14:31 | 860M | |
| losangelesnista_1401..> | 2014-01-19 18:00 | 478M | |
| losangelesnista_1401..> | 2014-01-14 19:29 | 592M | |
| losangelesnista_1312..> | 2013-12-15 18:32 | 337M | |
| losangelesnista_1312..> | 2013-12-15 18:01 | 297M | |
| losangelesnista_1312..> | 2013-12-15 17:30 | 310M | |
| losangelesnista_1312..> | 2013-12-15 16:59 | 287M | |
| losangelesnista_1312..> | 2013-12-15 16:30 | 285M | |
| losangelesnista_1312..> | 2013-12-15 15:59 | 292M | |
| losangelesnista_1312..> | 2013-12-12 13:57 | 822M | |
| losangelesnista_1312..> | 2013-12-12 13:00 | 565M | |
| losangelesnista_1312..> | 2013-12-08 18:30 | 315M | |
| losangelesnista_1312..> | 2013-12-08 17:59 | 310M | |
| losangelesnista_1312..> | 2013-12-08 17:31 | 265M | |
| losangelesnista_1312..> | 2013-12-08 16:57 | 323M | |
| losangelesnista_1312..> | 2013-12-08 16:30 | 266M | |
| losangelesnista_1312..> | 2013-12-08 16:00 | 297M | |
| losangelesnista_1312..> | 2013-12-08 15:56 | 33M | |
| losangelesnista_1311..> | 2013-11-23 11:00 | 636M | |
| losangelesnista_1311..> | 2013-11-20 16:00 | 541M | |
| losangelesnista_1311..> | 2013-11-20 15:11 | 335M | |
| losangelesnista_1311..> | 2013-11-20 14:26 | 305M | |
| losangelesnista_1311..> | 2013-11-12 12:00 | 605M | |
| losangelesnista_1311..> | 2013-11-05 16:00 | 626M | |
| losangelesnista_1311..> | 2013-11-04 15:00 | 543M | |
| losangelesnista_1311..> | 2013-11-03 22:29 | 595M | |
| losangelesnista_1309..> | 2013-09-06 12:59 | 785M | |
| losangelesnista_1308..> | 2013-08-12 21:15 | 3.9M | |
| losangelesnista_1306..> | 2013-06-24 22:25 | 329M | |
| losangelesnista_1306..> | 2013-06-24 21:02 | 792M | |
| losangelesnista_1305..> | 2013-05-20 22:45 | 195M | |
| losangelesnista_1305..> | 2013-05-21 18:26 | 1.1G | |
| losangelesnista_1305..> | 2013-05-20 21:07 | 945M | |
| losangelesnista_1305..> | 2013-05-20 16:09 | 682M | |
| losangelesnista_1305..> | 2013-05-17 13:05 | 656M | |
| losangelesnista_1305..> | 2013-05-13 21:06 | 964M | |
| losangelesnista_1305..> | 2013-05-10 15:50 | 671M | |
| losangelesnista_1304..> | 2013-04-23 14:28 | 296M | |
| losangelesnista_1304..> | 2013-04-23 14:52 | 1.0G | |
| losangelesnista_1304..> | 2013-04-23 14:28 | 781M | |
| losangelesnista_1304..> | 2013-04-20 22:02 | 917M | |
| losangelesnista_1304..> | 2013-04-13 12:07 | 920M | |
| losangelesnista_1304..> | 2013-04-11 19:04 | 194M | |
| losangelesnista_1304..> | 2013-04-11 17:59 | 599M | |
| losangelesnista_1304..> | 2013-04-08 22:26 | 233M | |
| losangelesnista_1304..> | 2013-04-08 21:08 | 786M | |
| losangelesnista_1303..> | 2013-03-28 21:00 | 594M | |
| losangelesnista_1303..> | 2013-03-28 19:01 | 832M | |
| losangelesnista-prom..> | 2013-09-08 12:50 | 2.9M | |
| losanagelesnista_121..> | 2012-12-03 21:11 | 770M | |
| losanagelesnista_121..> | 2012-11-26 21:08 | 633M | |
| losanagelesnista_121..> | 2012-11-12 21:04 | 573M | |
| lorax.wav | 2012-03-03 18:47 | 8.0M | |
| lindsaylohanclip.wav | 2013-03-27 10:21 | 2.9M | |
| limbaughsadick.wav | 2012-03-11 14:33 | 5.6M | |
| lataco_teaser.wav | 2015-11-20 23:37 | 10M | |
| lataco_160621_174954..> | 2016-06-21 18:49 | 552M | |
| lataco_160614_175329..> | 2016-06-14 18:53 | 548M | |
| lataco_160602_175544..> | 2016-06-02 18:55 | 545M | |
| lataco_160428_175544..> | 2016-04-28 18:55 | 549M | |
| lataco_160421_180748..> | 2016-04-21 19:07 | 547M | |
| lataco_160414_174333..> | 2016-04-14 18:43 | 540M | |
| lataco_160331_175608..> | 2016-03-31 18:56 | 546M | |
| lataco_160324_175555..> | 2016-03-24 18:55 | 537M | |
| lataco_160317_175400..> | 2016-03-17 18:54 | 554M | |
| lataco_160303_184851..> | 2016-03-03 18:48 | 572M | |
| lataco_160223_185800..> | 2016-02-23 18:58 | 546M | |
| lataco_160218_185927..> | 2016-02-18 18:59 | 551M | |
| lataco_160204_185802..> | 2016-02-04 18:58 | 543M | |
| lataco_160128_185715..> | 2016-01-28 18:57 | 546M | |
| lataco_160121_185643..> | 2016-01-21 18:56 | 546M | |
| lataco_160107_185822..> | 2016-01-07 18:58 | 541M | |
| lataco_160107_1900.wav | 2016-01-10 14:07 | 589M | |
| lataco_151223_185847..> | 2015-12-23 18:58 | 548M | |
| lataco_151223_185715..> | 2015-12-23 18:57 | 7.2M | |
| lataco_151217_185835..> | 2015-12-17 18:58 | 546M | |
| lataco_151217_164647..> | 2015-12-17 16:46 | 6.3M | |
| lataco_151217_164506..> | 2015-12-17 16:45 | 6.9M | |
| lataco_151209_190722..> | 2015-12-09 19:07 | 550M | |
| lataco_151209_190651..> | 2015-12-09 19:06 | 769K | |
| lataco_151119_185840..> | 2015-11-19 18:58 | 548M | |
| la_mascota_bakery.wav | 2013-04-17 13:18 | 2.7M | |
| kool_skull_promo.wav | 2011-07-01 00:19 | 33M | |
| knivesclip.wav | 2013-05-01 10:59 | 4.7M | |
| klubkushradio_130720..> | 2013-07-20 02:44 | 556M | |
| kisosound.wav | 2004-01-05 14:55 | 1.3M | |
| kinkfromtheundergrou..> | 2012-08-31 10:30 | 585M | |
| kinkfromtheundergrou..> | 2012-08-24 10:30 | 585M | |
| killer kids.wav | 2016-03-08 15:42 | 2.7M | |
| kids all together pr..> | 2011-05-11 23:08 | 3.1M | |
| karzaipullback.wav | 2012-03-18 15:32 | 4.1M | |
| karen spanish lesson..> | 2011-05-04 22:20 | 18M | |
| karen on drugs.wav | 2011-04-13 23:07 | 17M | |
| karen freakout.wav | 2011-04-13 22:50 | 15M | |
| karen filipino lesso..> | 2011-05-04 22:31 | 14M | |
| karen bodyworship.wav | 2011-04-13 22:58 | 11M | |
| johnnyscottgramercy_..> | 2013-03-24 21:05 | 570M | |
| johnnyscottgramercy_..> | 2013-03-17 21:08 | 566M | |
| johnnyscottgramercy_..> | 2013-03-08 19:54 | 588M | |
| johnnyscottgramercy_..> | 2013-03-06 10:52 | 573M | |
| johnnyscottgramercy_..> | 2013-02-10 21:01 | 593M | |
| johnnyscottgramercy_..> | 2013-01-27 20:59 | 566M | |
| johnnyscottgramercy_..> | 2013-01-20 20:59 | 560M | |
| jfs_teaser1.wav | 2015-11-21 00:28 | 11M | |
| jfs_teaser.wav | 2015-11-21 00:27 | 11M | |
| jfs_teaser-old1.wav | 2015-11-21 00:21 | 11M | |
| jfs_160426_165526_WP..> | 2016-04-26 17:55 | 549M | |
| jfs_160419_165622_WP..> | 2016-04-19 17:56 | 556M | |
| jfs_160412_165522_WP..> | 2016-04-12 17:55 | 559M | |
| jfs_160405_165632_WP..> | 2016-04-05 17:56 | 543M | |
| jfs_160329_170336_WP..> | 2016-03-29 18:03 | 559M | |
| jfs_160322_165552_WP..> | 2016-03-22 17:55 | 578M | |
| jfs_160315_170518_WP..> | 2016-03-15 18:05 | 608M | |
| jfs_160308_175557_WP..> | 2016-03-08 17:55 | 541M | |
| jfs_160301_175732_WP..> | 2016-03-01 17:57 | 565M | |
| jfs_160223_175623_WP..> | 2016-02-23 17:56 | 527M | |
| jfs_160216_175800_WP..> | 2016-02-16 17:58 | 531M | |
| jfs_160209_175743_WP..> | 2016-02-09 17:57 | 556M | |
| jfs_160202_175612_WP..> | 2016-02-02 17:56 | 536M | |
| jfs_160119_175926_WP..> | 2016-01-19 17:59 | 561M | |
| jfs_160112_175931_WP..> | 2016-01-12 17:59 | 191M | |
| jfs_160112_175722_WP..> | 2016-01-12 17:57 | 14M | |
| jfs_151215_181223_WP..> | 2015-12-15 18:12 | 593M | |
| jfs_151208_175746_WP..> | 2015-12-08 17:57 | 609M | |
| jfs_151117_175840_WP..> | 2015-11-17 17:58 | 616M | |
| jfs_151011_145851_SR..> | 2015-10-11 15:58 | 554M | |
| jfs_151004_150408_SR..> | 2015-10-04 16:04 | 501M | |
| jfs_150927_145955_SR..> | 2015-09-27 15:59 | 613M | |
| jfs_150920_145925_SR..> | 2015-09-20 15:59 | 556M | |
| jfs_150913_150004_SR..> | 2015-09-13 16:00 | 536M | |
| jfs_150906_145945_SR..> | 2015-09-06 15:59 | 525M | |
| jfs_150830_145944_SR..> | 2015-08-30 15:59 | 527M | |
| jfs_150830_145024_SR..> | 2015-08-30 15:50 | 7.4M | |
| jfs_150830_145021_SR..> | 2015-08-30 15:50 | 553K | |
| jfs_150830_144954_SR..> | 2015-08-30 15:49 | 4.6M | |
| jfs_150823_150003_SR..> | 2015-08-23 16:00 | 560M | |
| jfs_150816_150004_SR..> | 2015-08-16 16:00 | 574M | |
| jfs_150810_160038_SR..> | 2015-08-10 17:00 | 616M | |
| jfs_150802_160000_SR..> | 2015-08-02 17:00 | 560M | |
| jeremy chest buster.wav | 2011-05-04 22:42 | 13M | |
| jem_motors_promo1.wav | 2013-09-21 15:41 | 9.4M | |
| jellybelly-ad.wav | 2013-02-14 17:35 | 3.5M | |
| james_quall_promo.wav | 2011-08-19 00:06 | 19M | |
| izradiotime_130820_1..> | 2013-08-20 19:16 | 447M | |
| izradiotime_130820_1..> | 2013-08-20 18:04 | 730M | |
| izradiotime_130813_1..> | 2013-08-13 19:06 | 508M | |
| izradiotime_130813_1..> | 2013-08-13 18:00 | 671M | |
| izradiotime_130806_1..> | 2013-08-06 18:59 | 567M | |
| izradiotime_130806_1..> | 2013-08-06 17:59 | 603M | |
| izradiotime_130730_1..> | 2013-07-30 18:53 | 627M | |
| izradiotime_130730_1..> | 2013-07-30 18:00 | 540M | |
| itsburger_131212_230..> | 2013-12-12 22:00 | 561M | |
| itsafairquestion_edi..> | 2013-10-18 14:16 | 2.6M | |
| itsafairquestion_edi..> | 2013-09-23 14:21 | 8.6M | |
| itsafairquestion_edi..> | 2013-09-23 14:14 | 2.9M | |
| itsafairquestion_edi..> | 2013-09-23 13:48 | 7.6M | |
| itsafairquestion_edi..> | 2013-09-23 13:45 | 9.5M | |
| itsafairquestion_edi..> | 2013-09-23 13:42 | 3.5M | |
| itsafairquestion_edi..> | 2013-09-23 13:41 | 5.1M | |
| itsafairquestion_edi..> | 2013-09-23 13:40 | 10M | |
| itsafairquestion_edi..> | 2013-09-23 13:26 | 20M | |
| itsafairquestion_160..> | 2016-06-01 17:53 | 568M | |
| itsafairquestion_160..> | 2016-05-31 22:08 | 577M | |
| itsafairquestion_160..> | 2016-05-25 21:09 | 588M | |
| itsafairquestion_160..> | 2016-05-19 18:53 | 619M | |
| itsafairquestion_160..> | 2016-05-19 18:51 | 6.0M | |
| itsafairquestion_160..> | 2016-05-19 18:48 | 34M | |
| itsafairquestion_160..> | 2016-04-27 21:55 | 460M | |
| itsafairquestion_160..> | 2016-04-13 20:57 | 579M | |
| itsafairquestion_160..> | 2016-04-06 22:59 | 599M | |
| itsafairquestion_160..> | 2016-03-30 21:12 | 591M | |
| itsafairquestion_160..> | 2016-03-24 21:11 | 608M | |
| itsafairquestion_160..> | 2016-03-23 23:12 | 594M | |
| itsafairquestion_160..> | 2016-03-23 22:06 | 511M | |
| itsafairquestion_160..> | 2016-02-10 20:18 | 586M | |
| itsafairquestion_160..> | 2016-02-03 20:59 | 600M | |
| itsafairquestion_160..> | 2016-01-20 20:10 | 565M | |
| itsafairquestion_160..> | 2016-01-13 21:21 | 591M | |
| itsafairquestion_160..> | 2016-01-06 20:03 | 606M | |
| itsafairquestion_151..> | 2015-12-22 22:27 | 588M | |
| itsafairquestion_151..> | 2015-12-21 20:37 | 628M | |
| itsafairquestion_150..> | 2015-08-13 20:01 | 591M | |
| itsafairquestion_150..> | 2015-08-10 11:19 | 599M | |
| itsafairquestion_150..> | 2015-02-06 21:50 | 572M | |
| itsafairquestion_150..> | 2015-02-06 20:47 | 573M | |
| itsafairquestion_141..> | 2014-12-19 15:10 | 591M | |
| itsafairquestion_141..> | 2014-12-19 15:09 | 7.5M | |
| itsafairquestion_141..> | 2014-12-19 13:06 | 605M | |
| itsafairquestion_141..> | 2014-11-26 22:05 | 565M | |
| itsafairquestion_140..> | 2014-08-13 14:02 | 606M | |
| itsafairquestion_140..> | 2014-06-25 22:02 | 597M | |
| itsafairquestion_140..> | 2014-06-13 20:00 | 597M | |
| itsafairquestion_140..> | 2014-06-04 22:02 | 562M | |
| itsafairquestion_140..> | 2014-04-16 22:02 | 581M | |
| itsafairquestion_140..> | 2014-03-19 22:01 | 580M | |
| itsafairquestion_140..> | 2014-03-14 14:47 | 70M | |
| itsafairquestion_140..> | 2014-03-14 14:46 | 4.9M | |
| itsafairquestion_140..> | 2014-03-14 14:42 | 27M | |
| itsafairquestion_140..> | 2014-03-05 21:59 | 592M | |
| itsafairquestion_140..> | 2014-02-19 22:05 | 594M | |
| itsafairquestion_140..> | 2014-02-11 12:29 | 579M | |
| itsafairquestion_140..> | 2014-02-05 22:06 | 586M | |
| itsafairquestion_131..> | 2013-12-18 22:05 | 607M | |
| itsafairquestion_131..> | 2013-12-11 22:16 | 573M | |
| itsafairquestion_131..> | 2013-12-11 22:11 | 8.5M | |
| itsafairquestion_131..> | 2013-11-27 22:00 | 590M | |
| itsafairquestion_131..> | 2013-11-20 22:09 | 613M | |
| itsafairquestion_131..> | 2013-11-06 22:00 | 616M | |
| itsafairquestion_131..> | 2013-10-23 22:04 | 619M | |
| itsafairquestion_131..> | 2013-10-16 22:05 | 616M | |
| itsafairquestion_131..> | 2013-10-18 15:15 | 541M | |
| itsafairquestion_131..> | 2013-10-02 22:43 | 568M | |
| itsafairquestion_130..> | 2013-09-18 22:02 | 633M | |
| itsafairquestion_130..> | 2013-09-23 14:57 | 551M | |
| itsafairquestion_130..> | 2013-08-28 22:02 | 563M | |
| itsafairquestion_130..> | 2013-08-21 22:03 | 583M | |
| itsafairquestion_130..> | 2013-08-14 22:10 | 606M | |
| itsafairquestion_130..> | 2013-08-07 22:04 | 577M | |
| itsafairquestion_130..> | 2013-07-24 22:09 | 582M | |
| itsafairquestion_130..> | 2013-07-21 13:00 | 566M | |
| itsafairquestion_130..> | 2013-07-10 22:11 | 570M | |
| itsafairquestion_130..> | 2013-06-26 22:03 | 568M | |
| itsafairquestion_130..> | 2013-05-29 22:05 | 568M | |
| itsafairquestion_130..> | 2013-05-22 23:33 | 481K | |
| itsafairquestion_130..> | 2013-05-23 12:12 | 560M | |
| itsafairquestion_130..> | 2013-05-22 22:01 | 560M | |
| itsafairquestion_130..> | 2013-05-15 22:00 | 559M | |
| itsafairquestion_130..> | 2013-05-20 23:34 | 555M | |
| itsafairquestion_130..> | 2013-05-08 22:06 | 560M | |
| itsafairquestion_130..> | 2013-04-24 22:05 | 606M | |
| itsafairquestion_130..> | 2013-04-17 22:23 | 560M | |
| itsafairquestion_130..> | 2013-04-13 14:08 | 545M | |
| itsafairquestion_130..> | 2013-04-10 22:10 | 559M | |
| itsafairquestion_130..> | 2013-04-03 22:00 | 559M | |
| itsafairquestion_130..> | 2013-03-17 14:07 | 559M | |
| itsafairquestion_130..> | 2013-03-17 14:07 | 559M | |
| itsafairquestion_130..> | 2013-03-13 22:11 | 559M | |
| itsafairquestion_130..> | 2013-03-06 22:12 | 559M | |
| itsafairquestion_130..> | 2013-02-28 11:29 | 560M | |
| itsafairquestion_130..> | 2013-02-20 22:13 | 592M | |
| itsafairquestion_130..> | 2013-02-13 22:05 | 556M | |
| itsafairquestion_130..> | 2013-02-13 22:00 | 1.3M | |
| itsafairquestion_130..> | 2013-02-06 22:04 | 557M | |
| itsafairquestion_130..> | 2013-01-29 22:16 | 812M | |
| itsafairquestion_130..> | 2013-01-22 22:21 | 565M | |
| itsafairquestion_130..> | 2013-01-15 22:06 | 552M | |
| itsafairquestion_130..> | 2013-01-08 22:08 | 567M | |
| itsafairquestion_121..> | 2012-12-25 22:06 | 563M | |
| itsafairquestion_121..> | 2012-12-18 22:01 | 620M | |
| itsafairquestion_121..> | 2012-12-11 22:03 | 737M | |
| itsafairquestion_121..> | 2012-12-04 22:05 | 751M | |
| itsafairquestion_121..> | 2012-11-27 22:06 | 826M | |
| islandsurf-ad.wav | 2013-02-14 17:36 | 4.0M | |
| invalid entry warnin..> | 2011-09-25 16:17 | 1.6M | |
| invalid entry goodby..> | 2011-09-25 16:20 | 1.5M | |
| invalid entry 1.wav | 2011-09-25 16:16 | 684K | |
| intro to hearing.wav | 2015-03-04 11:05 | 43M | |
| intro-corporatemumbo..> | 2012-09-14 15:00 | 949K | |
| intro (WAV).wav | 2011-04-05 01:20 | 30M | |
| inthesportsbooth_121..> | 2012-11-25 18:01 | 630M | |
| inthesportsbooth_121..> | 2012-11-18 18:00 | 614M | |
| inthesportsbooth_121..> | 2012-11-11 18:17 | 595M | |
| inthesportsbooth_121..> | 2012-11-04 18:00 | 620M | |
| inthesportsbooth_121..> | 2012-10-28 18:01 | 567M | |
| inthesportsbooth_121..> | 2012-10-21 18:00 | 559M | |
| inthesportsbooth_121..> | 2012-10-14 18:00 | 562M | |
| inthesportsbooth_121..> | 2012-10-07 18:00 | 552M | |
| inthesportsbooth_120..> | 2012-09-30 18:01 | 547M | |
| inthesportsbooth_120..> | 2012-09-23 18:00 | 561M | |
| inthesportsbooth_120..> | 2012-09-16 20:07 | 937K | |
| inthesportsbooth_120..> | 2012-09-16 18:59 | 18M | |
| inthesportsbooth_120..> | 2012-09-09 18:00 | 554M | |
| inthesportsbooth_120..> | 2012-09-02 18:00 | 595M | |
| inthesportsbooth_120..> | 2012-08-26 18:00 | 595M | |
| inthesportsbooth_120..> | 2012-08-19 18:00 | 595M | |
| inthesportsbooth_120..> | 2012-08-12 18:00 | 595M | |
| inthesportsbooth_120..> | 2012-08-05 18:00 | 595M | |
| inthesportsbooth_120..> | 2012-07-29 18:00 | 595M | |
| intellectualkink_140..> | 2014-05-07 21:00 | 556M | |
| intellectualkink_140..> | 2014-04-30 21:00 | 556M | |
| intellectualkink_140..> | 2014-04-16 21:00 | 556M | |
| intellectualkink_140..> | 2014-04-09 21:00 | 556M | |
| intellectualkink_140..> | 2014-04-02 21:00 | 556M | |
| intellectualkink_140..> | 2014-03-26 21:00 | 556M | |
| intellectualkink_140..> | 2014-03-19 21:00 | 557M | |
| intellectualkink_140..> | 2014-03-12 20:59 | 556M | |
| intellectualkink_140..> | 2014-02-26 21:00 | 554M | |
| intellectualkink_140..> | 2014-02-19 21:00 | 559M | |
| intellectualkink_140..> | 2014-02-12 20:59 | 557M | |
| intellectualkink_140..> | 2014-02-05 21:01 | 556M | |
| intellectualkink_140..> | 2014-01-29 21:00 | 556M | |
| intellectualkink_140..> | 2014-01-22 21:02 | 561M | |
| intellectualkink_140..> | 2014-01-15 21:00 | 556M | |
| intellectualkink_140..> | 2014-01-08 21:00 | 556M | |
| intellectualkink_131..> | 2013-12-18 21:00 | 555M | |
| intellectualkink_131..> | 2013-12-11 21:09 | 555M | |
| intellectualkink_131..> | 2013-12-04 21:00 | 555M | |
| intellectualkink_131..> | 2013-11-29 12:32 | 105M | |
| intellectualkink_131..> | 2013-11-20 21:00 | 560M | |
| intellectualkink_131..> | 2013-10-30 21:03 | 557M | |
| intelkink_140902_180..> | 2014-09-02 19:00 | 556M | |
| intelkink_140819_180..> | 2014-08-19 19:00 | 556M | |
| intelkink_140805_180..> | 2014-08-05 19:02 | 557M | |
| intelkink_140722_180..> | 2014-07-22 19:00 | 556M | |
| intelkink_140708_200..> | 2014-07-08 21:00 | 556M | |
| intelkink_140702_200..> | 2014-07-02 21:00 | 2.0G | |
| intelkink_140625_200..> | 2014-06-25 21:00 | 555M | |
| intelkink_131023_210..> | 2013-10-23 21:05 | 558M | |
| intelkink_131016_210..> | 2013-10-16 21:02 | 556M | |
| intelkink_131009_210..> | 2013-10-09 21:02 | 558M | |
| intelkink_131002_210..> | 2013-10-02 21:00 | 558M | |
| intelkink_130925_210..> | 2013-09-25 21:04 | 571M | |
| intelkink_130918_210..> | 2013-09-18 21:01 | 556M | |
| intelkink_130911_210..> | 2013-09-11 21:06 | 557M | |
| intelkink_130904_210..> | 2013-09-04 21:04 | 556M | |
| intelkink_130828_210..> | 2013-08-28 21:00 | 556M | |
| intelkink_130821_210..> | 2013-08-21 21:02 | 556M | |
| intelkink_130814_210..> | 2013-08-14 21:04 | 556M | |
| intelkink_130807_210..> | 2013-08-07 21:03 | 551M | |
| intelkink_130731_210..> | 2013-07-31 21:03 | 556M | |
| intelkink_130724_210..> | 2013-07-24 21:04 | 556M | |
| intelkink_130717_210..> | 2013-07-17 21:04 | 556M | |
| intelkink_130710_210..> | 2013-07-10 21:00 | 560M | |
| intelkink_130703_210..> | 2013-07-03 21:00 | 557M | |
| intelkink_130626_210..> | 2013-06-26 21:00 | 560M | |
| intelkink_130619_210..> | 2013-06-19 21:00 | 558M | |
| intelkink_130612_210..> | 2013-06-12 21:00 | 557M | |
| intelkink_130605_210..> | 2013-06-05 21:00 | 558M | |
| intelkink_130529_210..> | 2013-05-29 21:00 | 557M | |
| intelkink_130522_210..> | 2013-05-23 12:05 | 558M | |
| inetvideo-ad.wav | 2013-02-14 17:39 | 4.1M | |
| indieface_150917_160..> | 2015-09-17 17:04 | 1.1G | |
| indieface_150817_170..> | 2015-08-17 18:00 | 1.2G | |
| indieface_150723_170..> | 2015-07-23 18:00 | 568M | |
| indieface_150618_160..> | 2015-06-18 17:04 | 1.1G | |
| indieface_150514_210..> | 2015-05-14 22:08 | 1.2G | |
| indieface_150402_200..> | 2015-04-02 21:03 | 1.2G | |
| indieface_150312_200..> | 2015-03-12 21:09 | 1.2G | |
| indieface_150212_220..> | 2015-02-12 22:05 | 1.2G | |
| indieface_150108_210..> | 2015-01-08 21:02 | 1.2G | |
| indieface_141212_210..> | 2014-12-12 21:03 | 1.1G | |
| indieface_141114_210..> | 2014-11-14 21:00 | 1.1G | |
| indieface_141010_200..> | 2014-10-10 21:06 | 1.1G | |
| indieface_140912_150..> | 2014-09-12 16:01 | 1.1G | |
| indieface_140815_150..> | 2014-08-15 16:02 | 1.1G | |
| indieface_140711_150..> | 2014-07-11 16:00 | 1.1G | |
| indieface_140612_160..> | 2014-06-12 17:00 | 1.2G | |
| indieface_140529_170..> | 2014-05-29 18:00 | 572M | |
| indieface_140522_170..> | 2014-05-22 18:00 | 557M | |
| indieface_140517_191..> | 2014-05-17 20:17 | 20M | |
| imburger_140911_2103..> | 2014-09-11 22:03 | 556M | |
| imburger_140904_2100..> | 2014-09-04 22:00 | 565M | |
| imburger_140828_2101..> | 2014-08-28 22:01 | 558M | |
| imburger_140814_2102..> | 2014-08-14 22:02 | 557M | |
| imburger_140807_2022..> | 2014-08-07 21:22 | 563M | |
| imburger_140731_2101..> | 2014-07-31 22:01 | 558M | |
| imburger_140717_2107..> | 2014-07-17 22:07 | 575M | |
| imburger_140703_2103..> | 2014-07-03 22:03 | 575M | |
| imburger_140626_2104..> | 2014-06-26 22:04 | 568M | |
| imburger_140619_2107..> | 2014-06-19 22:07 | 566M | |
| imburger_140612_2108..> | 2014-06-12 22:08 | 566M | |
| imburger_140605_2108..> | 2014-06-05 22:08 | 472M | |
| imburger_140529_2103..> | 2014-05-29 22:03 | 566M | |
| imburger_140522_2106..> | 2014-05-22 22:06 | 566M | |
| imburger_140515_2109..> | 2014-05-15 22:09 | 565M | |
| imburger_140508_2100..> | 2014-05-08 22:00 | 560M | |
| imburger_140501_2100..> | 2014-05-01 22:00 | 558M | |
| imburger_140424_2100..> | 2014-04-24 22:00 | 560M | |
| imburger_140417_2100..> | 2014-04-17 22:00 | 558M | |
| imburger_140410_2100..> | 2014-04-10 22:00 | 566M | |
| imburger_140403_2100..> | 2014-04-03 22:00 | 567M | |
| imburger_140327_2100..> | 2014-03-27 22:00 | 566M | |
| imburger_140320_2100..> | 2014-03-20 22:00 | 570M | |
| imburger_140313_2101..> | 2014-03-13 22:01 | 566M | |
| imburger_140306_2205..> | 2014-03-06 22:05 | 615M | |
| imburger_140227_2204..> | 2014-02-27 22:04 | 636M | |
| imburger_140220_2205..> | 2014-02-20 22:05 | 566M | |
| imburger_140213_2208..> | 2014-02-13 22:08 | 584M | |
| imburger_140206_2204..> | 2014-02-06 22:04 | 593M | |
| imburger_140123_2202..> | 2014-01-23 16:00 | 566M | |
| imburger_140116_2211..> | 2014-01-16 22:11 | 566M | |
| imburger_140109_2209..> | 2014-01-09 22:09 | 566M | |
| imburger_140102_2202..> | 2014-01-02 22:02 | 569M | |
| imburger_131226_2200..> | 2013-12-26 22:00 | 579M | |
| imburger_131219_2200..> | 2013-12-19 22:00 | 569M | |
| ignocio_la_mascota_b..> | 2013-04-17 13:33 | 1.6M | |
| howardmanning.wav | 2012-03-18 15:32 | 10M | |
| hedgehog lives.wav | 2013-04-10 22:03 | 7.5M | |
| hardyardsla_promo_13..> | 2013-09-08 20:03 | 265K | |
| hardyardsla_promo_13..> | 2013-09-09 19:10 | 5.0M | |
| hardyardsla_151011_1..> | 2015-10-11 18:59 | 563M | |
| hardyardsla_150927_2..> | 2015-09-27 21:01 | 565M | |
| hardyardsla_150913_1..> | 2015-09-13 20:05 | 502M | |
| hardyardsla_150823_1..> | 2015-08-23 20:03 | 559M | |
| hardyardsla_150802_1..> | 2015-08-02 19:00 | 558M | |
| hardyardsla_150607_1..> | 2015-06-07 19:00 | 535M | |
| hardyardsla_150524_1..> | 2015-05-24 19:00 | 542M | |
| hardyardsla_150517_1..> | 2015-05-17 19:00 | 562M | |
| hardyardsla_150503_1..> | 2015-05-03 19:00 | 562M | |
| hardyardsla_150412_1..> | 2015-04-12 19:00 | 563M | |
| hardyardsla_150322_1..> | 2015-03-22 19:00 | 563M | |
| hardyardsla_150315_1..> | 2015-03-15 18:00 | 563M | |
| hardyardsla_150301_1..> | 2015-03-01 19:00 | 567M | |
| hardyardsla_150222_1..> | 2015-02-22 19:00 | 489M | |
| hardyardsla_150208_1..> | 2015-02-08 19:00 | 560M | |
| hardyardsla_150125_1..> | 2015-01-25 19:02 | 563M | |
| hardyardsla_150111_1..> | 2015-01-11 19:00 | 560M | |
| hardyardsla_150104_1..> | 2015-01-04 19:00 | 560M | |
| hardyardsla_141214_1..> | 2014-12-14 19:00 | 569M | |
| hardyardsla_141207_1..> | 2014-12-07 16:00 | 360M | |
| hardyardsla_141123_1..> | 2014-11-23 19:00 | 561M | |
| hardyardsla_141117_1..> | 2014-11-17 19:00 | 561M | |
| hardyardsla_141109_1..> | 2014-11-09 19:00 | 560M | |
| hardyardsla_141102_1..> | 2014-11-02 19:00 | 561M | |
| hardyardsla_141026_1..> | 2014-10-26 19:00 | 561M | |
| hardyardsla_141019_1..> | 2014-10-19 19:00 | 562M | |
| hardyardsla_141012_1..> | 2014-10-12 19:01 | 560M | |
| hardyardsla_140928_1..> | 2014-09-28 19:00 | 540M | |
| hardyardsla_140921_1..> | 2014-09-21 19:00 | 563M | |
| hardyardsla_140914_1..> | 2014-09-14 19:01 | 563M | |
| hardyardsla_140907_1..> | 2014-09-07 19:24 | 563M | |
| hardyardsla_140831_1..> | 2014-08-31 19:00 | 547M | |
| hardyardsla_140824_1..> | 2014-08-24 19:03 | 562M | |
| hardyardsla_140810_1..> | 2014-08-10 15:02 | 563M | |
| hardyardsla_140803_1..> | 2014-08-03 19:01 | 956M | |
| hardyardsla_140727_1..> | 2014-07-27 19:01 | 563M | |
| hardyardsla_140713_2..> | 2014-07-13 22:37 | 660M | |
| hardyardsla_140713_1..> | 2014-07-13 19:14 | 2.0G | |
| hardyardsla_140629_1..> | 2014-06-29 19:00 | 561M | |
| hardyardsla_140622_1..> | 2014-06-22 19:00 | 559M | |
| hardyardsla_140615_1..> | 2014-06-15 18:59 | 1.1G | |
| hardyardsla_140608_1..> | 2014-06-08 19:00 | 560M | |
| hardyardsla_140606_1..> | 2014-06-06 16:08 | 11M | |
| hardyardsla_140601_1..> | 2014-06-01 19:01 | 533M | |
| hardyardsla_140601_1..> | 2014-06-01 19:00 | 6.1M | |
| hardyardsla_140513_2..> | 2014-05-13 23:36 | 5.3M | |
| hardyardsla_140513_2..> | 2014-05-13 23:34 | 5.9M | |
| hardyardsla_140513_2..> | 2014-05-13 23:32 | 11M | |
| hardyardsla_140511_1..> | 2014-05-11 16:59 | 555M | |
| hardyardsla_140504_1..> | 2014-05-04 19:00 | 509M | |
| hardyardsla_140427_1..> | 2014-04-27 19:00 | 468M | |
| hardyardsla_140413_1..> | 2014-04-13 18:00 | 562M | |
| hardyardsla_140330_1..> | 2014-03-30 19:00 | 561M | |
| hardyardsla_140323_1..> | 2014-03-23 19:00 | 563M | |
| hardyardsla_140309_1..> | 2014-03-09 19:00 | 563M | |
| hardyardsla_140302_1..> | 2014-03-02 19:00 | 567M | |
| hardyardsla_140223_1..> | 2014-02-23 19:00 | 559M | |
| hardyardsla_140209_1..> | 2014-02-09 19:00 | 537M | |
| hardyardsla_140126_1..> | 2014-01-26 19:01 | 541M | |
| hardyardsla_140120_1..> | 2014-01-20 17:00 | 446M | |
| hardyardsla_140112_1..> | 2014-01-12 19:00 | 551M | |
| hardyardsla_140105_1..> | 2014-01-05 19:00 | 561M | |
| hardyardsla_131216_1..> | 2013-12-16 18:00 | 561M | |
| hardyardsla_131208_2..> | 2013-12-08 19:05 | 560M | |
| hardyardsla_131201_2..> | 2013-12-01 19:00 | 559M | |
| hardyardsla_131125_1..> | 2013-11-25 18:00 | 589M | |
| hardyardsla_131117_2..> | 2013-11-17 19:00 | 561M | |
| hardyardsla_131110_2..> | 2013-11-10 19:00 | 579M | |
| hardyardsla_131103_2..> | 2013-11-03 19:00 | 565M | |
| hardyardsla_131020_1..> | 2013-10-20 19:00 | 562M | |
| hardyardsla_131013_1..> | 2013-10-13 19:03 | 521M | |
| hardyardsla_131013_1..> | 2013-10-13 19:01 | 1.5M | |
| hardyardsla_131013_1..> | 2013-10-13 18:44 | 1.4M | |
| hardyardsla_131006_1..> | 2013-10-06 19:00 | 555M | |
| hardyardsla_130929_1..> | 2013-09-29 19:00 | 574M | |
| hardyardsla_130922_2..> | 2013-09-22 20:02 | 585M | |
| hardyardsla_130915_1..> | 2013-09-15 18:59 | 575M | |
| hardyardsla_130908_1..> | 2013-09-08 18:59 | 576M | |
| hardyardsla_130901_1..> | 2013-09-01 19:00 | 571M | |
| hardyardsla_130825_1..> | 2013-08-25 19:01 | 564M | |
| hardyardsla_130818_1..> | 2013-08-18 18:59 | 589M | |
| hardyardsla_130811_1..> | 2013-08-11 18:59 | 560M | |
| hardyardsla_130804_1..> | 2013-08-04 18:59 | 558M | |
| hackers.wav | 2013-04-30 11:14 | 5.8M | |
| gravesatsea-dots-110..> | 2014-11-05 22:06 | 121M | |
| grandtheftaudioradio..> | 2012-06-20 09:00 | 1.2G | |
| grandtheftaudioradio..> | 2012-06-15 09:00 | 1.2G | |
| grandtheftaudioradio..> | 2012-06-14 09:00 | 1.2G | |
| grandtheftaudioradio..> | 2012-06-13 09:00 | 1.2G | |
| grandtheftaudioradio..> | 2012-06-12 09:00 | 1.2G | |
| grandtheftaudioradio..> | 2012-06-11 09:00 | 1.2G | |
| grandtheftaudioradio..> | 2012-06-08 09:00 | 1.2G | |
| grandtheftaudioradio..> | 2012-06-07 09:00 | 1.2G | |
| grandtheftaudioradio..> | 2012-06-06 09:00 | 1.2G | |
| grandtheftaudioradio..> | 2012-06-05 09:00 | 1.2G | |
| grandtheftaudioradio..> | 2012-06-04 09:00 | 1.2G | |
| grandtheftaudioradio..> | 2012-06-01 09:00 | 1.2G | |
| grandtheftaudioradio..> | 2012-05-31 09:00 | 1.2G | |
| grandtheftaudioradio..> | 2019-11-03 10:43 | 892M | |
| grandtheftaudioradio..> | 2019-11-03 10:23 | 1.2G | |
| grandtheftaudioradio..> | 2019-11-03 10:19 | 1.2G | |
| grandtheftaudioradio..> | 2019-11-03 10:15 | 1.2G | |
| grandtheftaudioradio..> | 2019-11-03 10:11 | 1.2G | |
| grandtheftaudioradio..> | 2019-11-03 10:06 | 1.2G | |
| grandtheftaudioradio..> | 2019-11-03 10:02 | 1.2G | |
| grandtheftaudioradio..> | 2019-11-03 09:57 | 1.2G | |
| grandtheftaudioradio..> | 2019-11-03 09:53 | 1.2G | |
| grandtheftaudioradio..> | 2019-11-03 09:48 | 1.2G | |
| grandtheftaudioradio..> | 2019-11-03 09:44 | 1.2G | |
| grandtheftaudioradio..> | 2019-11-03 09:40 | 1.2G | |
| grandtheftaudioradio..> | 2019-11-03 09:36 | 1.2G | |
| grandtheftaudioradio..> | 2019-11-03 09:31 | 1.2G | |
| grandtheftaudioradio..> | 2019-11-03 09:27 | 1.2G | |
| grandtheftaudioradio..> | 2019-11-03 09:23 | 1.2G | |
| grandtheftaudioradio..> | 2019-11-03 09:19 | 1.2G | |
| grandtheftaudioradio..> | 2019-11-03 09:15 | 1.2G | |
| grandtheftaudioradio..> | 2019-11-03 09:10 | 1.2G | |
| grandtheftaudioradio..> | 2019-11-03 09:06 | 1.2G | |
| grandtheftaudioradio..> | 2019-11-03 09:01 | 1.2G | |
| grandtheftaudioradio..> | 2019-11-03 08:56 | 1.2G | |
| gonna_die_bigtime.wav | 2013-09-06 09:53 | 279K | |
| goldmansachs.wav | 2012-03-18 15:32 | 5.5M | |
| gingerweds_140123_14..> | 2014-01-23 14:53 | 9.0M | |
| gingerweds_140123_14..> | 2014-01-23 14:53 | 6.2M | |
| gingerweds_140123_14..> | 2014-01-23 14:52 | 7.4M | |
| gingerweds_140123_14..> | 2014-01-23 14:51 | 3.6M | |
| gingerweds_140123_14..> | 2014-01-23 14:51 | 5.1M | |
| gingertuesday_140123..> | 2014-01-23 14:55 | 7.4M | |
| gingertuesday_140123..> | 2014-01-23 14:49 | 8.4M | |
| gingerthu_140123_145..> | 2014-01-23 14:57 | 8.3M | |
| gingerthu_140123_145..> | 2014-01-23 14:56 | 2.1M | |
| gingerpromo_140123_1..> | 2014-01-23 15:09 | 17M | |
| gingerpromo_140123_1..> | 2014-01-23 15:09 | 6.4M | |
| gingerpromo_140123_1..> | 2014-01-23 15:06 | 26M | |
| gingerfri_140123_145..> | 2014-01-23 14:58 | 8.0M | |
| gingerauctionsmonday..> | 2014-01-23 14:47 | 6.8M | |
| gingerauctionsmonday..> | 2014-01-23 14:46 | 8.3M | |
| gingerauctionsmonday..> | 2014-01-23 14:46 | 5.9M | |
| gingerauctionsmonday..> | 2014-01-23 06:47 | 6.2M | |
| gingerauctions2_1401..> | 2014-01-23 14:42 | 3.6M | |
| gingerauctions1_1401..> | 2014-01-23 14:40 | 13M | |
| ginger_weds_final.wav | 2014-01-23 16:27 | 9.9M | |
| ginger_weds.wav | 2014-01-23 15:24 | 8.2M | |
| ginger_tues_final.wav | 2014-01-23 16:35 | 7.8M | |
| ginger_tues.wav | 2014-01-23 15:26 | 6.8M | |
| ginger_thurs_final.wav | 2014-01-23 16:38 | 7.9M | |
| ginger_thurs.wav | 2014-01-23 15:29 | 7.3M | |
| ginger_promo1_final.wav | 2014-01-23 16:54 | 16M | |
| ginger_promo1.wav | 2014-01-23 15:18 | 14M | |
| ginger_mon_final.wav | 2014-01-25 21:31 | 6.8M | |
| ginger_mon.wav | 2014-01-23 15:34 | 5.9M | |
| ginger_fri_final.wav | 2014-01-25 21:33 | 7.3M | |
| ginger_fri.wav | 2014-01-23 15:31 | 6.7M | |
| ginger_auctions_prom..> | 2014-01-23 16:23 | 2.6M | |
| ginger_auctions_prom..> | 2014-01-23 15:39 | 2.2M | |
| ginger_auctions_prom..> | 2014-01-23 16:15 | 11M | |
| ginger_auctions_prom..> | 2014-01-23 15:48 | 9.6M | |
| gentrification.wav | 2016-03-01 15:22 | 6.0M | |
| gamechange.wav | 2012-03-18 15:32 | 6.1M | |
| galeriaalternativa_1..> | 2013-02-21 15:26 | 288M | |
| galeriaalternativa_1..> | 2013-02-14 12:00 | 619M | |
| galeriaalternativa_1..> | 2013-02-07 12:00 | 609M | |
| galeriaalternativa_1..> | 2013-01-31 12:59 | 5.6M | |
| galeriaalternativa_1..> | 2013-01-31 12:00 | 605M | |
| galeriaalternativa_1..> | 2013-01-24 12:59 | 5.9M | |
| galeriaalternativa_1..> | 2013-01-24 12:00 | 600M | |
| galeriaalternativa_1..> | 2013-01-17 12:00 | 643M | |
| galeriaalternativa_1..> | 2013-01-10 12:00 | 624M | |
| galeriaalternativa_1..> | 2012-12-20 12:00 | 632M | |
| galeriaalternativa_1..> | 2012-11-15 20:00 | 662M | |
| galeriaalternativa_1..> | 2012-11-08 20:00 | 598M | |
| galeriaalternativa_1..> | 2012-11-01 20:00 | 630M | |
| galeriaalternativa_1..> | 2012-10-25 20:00 | 631M | |
| galeriaalternativa_1..> | 2012-10-18 20:00 | 601M | |
| galeriaalternativa_1..> | 2012-10-11 20:00 | 574M | |
| galeriaalternativa_1..> | 2019-11-03 08:12 | 1.1G | |
| galeriaalternativa_1..> | 2019-11-03 08:08 | 76M | |
| galeriaalternativa_1..> | 2019-11-03 08:07 | 632M | |
| galeriaalternativa_1..> | 2019-11-03 08:05 | 568M | |
| galeriaalternativa_1..> | 2019-11-03 08:03 | 596M | |
| galeriaalternativa_1..> | 2019-11-03 08:01 | 3.8M | |
| galeriaalternativa_1..> | 2019-11-03 08:00 | 6.8M | |
| galeriaalternativa_1..> | 2019-11-03 08:00 | 576M | |
| galeriaalternativa_1..> | 2019-11-03 07:58 | 595M | |
| galeriaalternativa_1..> | 2019-11-03 07:56 | 596M | |
| galeriaalternativa_1..> | 2019-11-03 07:53 | 595M | |
| galeriaalternativa_1..> | 2019-11-03 07:51 | 595M | |
| galariaalternativa_1..> | 2019-11-03 07:49 | 595M | |
| funiclipo.wav | 2013-04-17 12:02 | 3.6M | |
| fuck that puto.wav | 2016-03-01 15:06 | 1.1M | |
| firstTWWUpromo12ï..> | 2013-01-03 10:29 | 5.0M | |
| firstTWWUpromo.wav | 2013-01-02 21:46 | 5.0M | |
| findlegalforms-ad.wav | 2013-02-14 17:40 | 3.6M | |
| finalvo.wav | 2015-06-26 12:31 | 2.1M | |
| fathermethcahy.wav | 2013-04-08 11:30 | 8.2M | |
| falsetto teeth rocke..> | 2011-05-04 21:37 | 96M | |
| evolution.wav | 2012-03-11 14:34 | 11M | |
| everytime.wav | 2011-10-04 02:07 | 26M | |
| etchasketch.wav | 2012-03-25 11:49 | 3.1M | |
| estart.wav | 2000-06-13 05:47 | 320K | |
| error.wav | 2003-12-13 15:19 | 43K | |
| entrepreneur_150421_..> | 2015-04-21 11:00 | 574M | |
| entrepreneur_150303_..> | 2015-03-03 11:00 | 556M | |
| entrepreneur_150224_..> | 2015-02-24 11:00 | 549M | |
| entrepreneur_150210_..> | 2015-02-10 11:00 | 565M | |
| entrepreneur_150203_..> | 2015-02-03 11:05 | 564M | |
| entrepreneur_150127_..> | 2015-01-27 11:00 | 559M | |
| entrepreneur_150113_..> | 2015-01-13 11:00 | 571M | |
| entrepreneur_150106_..> | 2015-01-06 11:00 | 578M | |
| entrepreneur_141021_..> | 2014-10-21 11:00 | 578M | |
| entrepreneur_140930_..> | 2014-09-30 11:00 | 551M | |
| entrepreneur_140923_..> | 2014-09-23 11:00 | 557M | |
| entrepreneur_140826_..> | 2014-08-26 11:04 | 559M | |
| entrepreneur_140819_..> | 2014-08-19 11:00 | 558M | |
| entrepreneur_140812_..> | 2014-08-12 11:02 | 546M | |
| entrepreneur_140624_..> | 2014-06-24 11:00 | 547M | |
| entrepreneur_140610_..> | 2014-06-10 11:00 | 560M | |
| entrepreneur_140527_..> | 2014-05-27 11:00 | 558M | |
| entrepreneur_140520_..> | 2014-05-20 11:00 | 566M | |
| entrepreneur_140513_..> | 2014-05-13 11:00 | 570M | |
| entrepreneur_140422_..> | 2014-04-22 12:11 | 3.8M | |
| entrepreneur_140422_..> | 2014-04-22 12:11 | 289K | |
| entrepreneur_140408_..> | 2014-04-08 11:00 | 577M | |
| entrepreneur_140401_..> | 2014-04-01 10:59 | 560M | |
| entrepreneur_140318_..> | 2014-03-18 11:07 | 562M | |
| entrepreneur_140311_..> | 2014-03-11 11:00 | 571M | |
| entrepreneur_140225_..> | 2014-02-25 11:00 | 556M | |
| entrepreneur_140218_..> | 2014-02-18 11:00 | 557M | |
| entrepreneur_140211_..> | 2014-02-11 11:00 | 571M | |
| entrepreneur_140128_..> | 2014-01-28 10:59 | 558M | |
| entrepreneur_140114_..> | 2014-01-14 11:00 | 561M | |
| entrepreneur_140107_..> | 2014-01-07 11:00 | 559M | |
| entrepreneur_131217_..> | 2013-12-17 11:00 | 580M | |
| entrepreneur_131210_..> | 2013-12-10 10:59 | 559M | |
| entrepreneur_131203_..> | 2013-12-03 11:00 | 562M | |
| entrepreneur_131119_..> | 2013-11-19 11:00 | 554M | |
| entrepreneur_131112_..> | 2013-11-12 11:00 | 537M | |
| entrepreneur_131105_..> | 2013-11-05 11:03 | 559M | |
| entrepreneur_131029_..> | 2013-10-29 11:00 | 554M | |
| entrepreneur_131022_..> | 2013-10-22 11:00 | 556M | |
| entrepreneur_131015_..> | 2013-10-15 11:00 | 555M | |
| entrepreneur_131008_..> | 2013-10-08 11:00 | 508M | |
| entrepreneur_131001_..> | 2013-10-01 10:59 | 552M | |
| elvis.wav | 2011-05-11 22:40 | 28M | |
| elattb_150720_180329..> | 2015-07-20 19:03 | 517M | |
| elattb_150607_132539..> | 2015-06-07 14:25 | 325M | |
| elattb_150426_123103..> | 2015-04-26 13:31 | 411M | |
| eddie_la_nista.wav | 2013-04-17 13:35 | 826K | |
| echoesblack_150302_1..> | 2015-03-02 13:26 | 563M | |
| echoesblack_150220_1..> | 2015-02-20 19:00 | 562M | |
| echoesblack_150206_1..> | 2015-02-06 18:59 | 561M | |
| drip.wav | 2000-06-13 05:47 | 1.2K | |
| dramaqueen_150514_16..> | 2015-05-14 17:01 | 630M | |
| dramaqueen_150514_16..> | 2015-05-14 17:00 | 3.6M | |
| dramaqueen_150328_18..> | 2015-03-28 19:00 | 506M | |
| dramaqueen_150221_20..> | 2015-02-21 20:44 | 217K | |
| dramaqueen_150221_20..> | 2015-02-21 20:21 | 7.1M | |
| dramaqueen_150221_19..> | 2015-02-21 19:01 | 799M | |
| downtowncrossroads_1..> | 2013-08-26 11:59 | 581M | |
| downtowncrossroads_1..> | 2013-08-12 12:01 | 571M | |
| downtowncrossroads_1..> | 2013-08-05 11:59 | 568M | |
| downtowncrossroads_1..> | 2013-07-29 11:59 | 634M | |
| downtowncrossroads_1..> | 2013-07-22 12:00 | 609M | |
| downtowncrossroads_1..> | 2013-07-15 12:00 | 558M | |
| dlh_ap_promo1.wav | 2011-06-24 09:24 | 15M | |
| discoverychannel-ad.wav | 2013-02-14 17:42 | 3.3M | |
| directorschair_16060..> | 2016-06-01 20:08 | 596M | |
| directorschair_16052..> | 2016-05-23 20:29 | 569M | |
| directorschair_16052..> | 2016-05-23 20:28 | 2.3M | |
| directorschair_16050..> | 2016-05-04 19:40 | 563M | |
| directorschair_16040..> | 2016-04-06 21:16 | 562M | |
| directorschair_16040..> | 2016-04-06 21:14 | 16M | |
| directorschair_16040..> | 2016-04-06 19:15 | 604M | |
| directorschair_16032..> | 2016-03-28 19:51 | 589M | |
| directorschair_16031..> | 2016-03-16 20:59 | 587M | |
| directorschair_16030..> | 2016-03-09 19:01 | 555M | |
| directorschair_16030..> | 2016-03-02 19:03 | 569M | |
| directorschair_16022..> | 2016-02-24 21:02 | 570M | |
| directorschair_16022..> | 2016-02-24 12:40 | 556M | |
| directorschair_16021..> | 2016-02-17 20:07 | 581M | |
| directorschair_16021..> | 2016-02-10 18:58 | 558M | |
| directorschair_16020..> | 2016-02-03 19:16 | 652M | |
| dino_promos.wav | 2011-07-08 01:29 | 27M | |
| dickcheese_120506_16..> | 2019-11-03 07:46 | 2.0K | |
| devlis r 3.wav | 2016-03-29 14:26 | 9.4M | |
| deliasdarkside_15022..> | 2015-02-22 13:00 | 559M | |
| deliasdarkside_14121..> | 2014-12-14 13:00 | 561M | |
| deliasdarkside_14102..> | 2014-10-26 16:01 | 561M | |
| deliasdarkside_14092..> | 2014-09-21 16:00 | 558M | |
| deliasdarkside_14081..> | 2014-08-17 16:00 | 589M | |
| deliasdarkside_14071..> | 2014-07-13 16:04 | 563M | |
| deliasdarkside_14062..> | 2014-06-29 16:00 | 553M | |
| deliasdarkside_14061..> | 2014-06-15 16:00 | 519M | |
| deliasdarkside_14052..> | 2014-05-25 16:00 | 572M | |
| deliasdarkside_14050..> | 2014-05-04 16:00 | 556M | |
| deliasdarkside_14042..> | 2014-04-27 16:00 | 557M | |
| deliasdarkside_14041..> | 2014-04-13 16:00 | 616M | |
| deliasdarkside_14040..> | 2014-04-06 16:00 | 563M | |
| deliasdarkside_14033..> | 2014-03-30 16:00 | 556M | |
| deliasdarkside_14032..> | 2014-03-23 16:00 | 457M | |
| deliasdarkside_14031..> | 2014-03-16 16:00 | 532M | |
| deliasdarkside_14030..> | 2014-03-09 16:06 | 523M | |
| dearabbyclip.wav | 2013-01-24 00:38 | 2.0M | |
| dead kennedys-riot.wav | 2016-04-26 15:24 | 60M | |
| darkmark_160331_2034..> | 2016-03-31 21:34 | 825M | |
| darkmark_160218_2020..> | 2016-02-18 20:20 | 703M | |
| darkmark_151217_2018..> | 2015-12-17 20:18 | 566M | |
| darkmark_150806_2009..> | 2015-08-06 21:09 | 1.0G | |
| darkmark_150730_1914..> | 2015-07-30 20:14 | 601M | |
| darkmark_150723_1906..> | 2015-07-23 20:06 | 590M | |
| darkmark_150716_1907..> | 2015-07-16 20:07 | 503M | |
| darkmark_150709_1901..> | 2015-07-09 20:01 | 604M | |
| darkmark_150702_1900..> | 2015-07-02 20:00 | 577M | |
| darkmark_150625_1917..> | 2015-06-25 20:17 | 410M | |
| darkmark_150618_1908..> | 2015-06-18 20:08 | 545M | |
| darkmark_150611_1908..> | 2015-06-11 20:08 | 557M | |
| darkmark_150604_1900..> | 2015-06-04 20:00 | 550M | |
| darkmark_150528_1900..> | 2015-05-28 20:00 | 572M | |
| darkmark_150521_1816..> | 2015-05-21 19:16 | 479M | |
| darkmark_150514_1907..> | 2015-05-14 20:07 | 529M | |
| darkmark_150430_1902..> | 2015-04-30 20:02 | 554M | |
| darkmark_150423_1900..> | 2015-04-23 20:00 | 565M | |
| darkmark_150409_1902..> | 2015-04-09 20:02 | 543M | |
| darkmark_150401_1908..> | 2015-04-01 20:08 | 589M | |
| darkmark_150326_1903..> | 2015-03-26 20:03 | 529M | |
| darkmark_150319_1906..> | 2015-03-19 20:06 | 499M | |
| darkmark_150312_1905..> | 2015-03-12 20:05 | 524M | |
| darkmark_150305_2006..> | 2015-03-05 20:06 | 537M | |
| darkmark_150226_2002..> | 2015-02-26 20:02 | 541M | |
| darkmark_150219_2005..> | 2015-02-19 20:05 | 509M | |
| darkmark_150212_2004..> | 2015-02-12 20:04 | 517M | |
| darkmark_150205_2006..> | 2015-02-05 20:06 | 536M | |
| darkmark_150129_2000..> | 2015-01-29 20:00 | 564M | |
| darkmark_150122_2004..> | 2015-01-22 20:04 | 543M | |
| darkmark_150115_2015..> | 2015-01-15 20:15 | 471M | |
| darkmark_150108_2001..> | 2015-01-08 20:01 | 544M | |
| darkmark_141218_1959..> | 2014-12-18 19:59 | 567M | |
| darkmark_141211_2000..> | 2014-12-11 20:00 | 572M | |
| darkmark_141120_2003..> | 2014-11-20 20:03 | 530M | |
| darkmark_141113_2001..> | 2014-11-13 20:01 | 566M | |
| darkmark_141106_2036..> | 2014-11-06 20:36 | 536M | |
| darkmark_141030_1902..> | 2014-10-30 20:02 | 561M | |
| darkmark_141023_1902..> | 2014-10-23 20:02 | 541M | |
| darkmark_141009_1902..> | 2014-10-09 20:02 | 568M | |
| darkmark_141002_1903..> | 2014-10-02 20:03 | 519M | |
| darkmark_140925_1901..> | 2014-09-25 20:01 | 589M | |
| darkmark_140918_1901..> | 2014-09-18 20:01 | 559M | |
| darkmark_140911_1915..> | 2014-09-11 20:15 | 419M | |
| darkmark_140904_1910..> | 2014-09-04 20:10 | 454M | |
| darkmark_140828_1901..> | 2014-08-28 20:01 | 559M | |
| darkmark_140821_1900..> | 2014-08-21 20:00 | 564M | |
| darkmark_140814_1903..> | 2014-08-14 20:03 | 568M | |
| darkmark_140807_1902..> | 2014-08-07 20:02 | 595M | |
| darkmark_140731_1902..> | 2014-07-31 20:02 | 560M | |
| darkmark_140724_1910..> | 2014-07-24 20:10 | 457M | |
| darkmark_140717_1909..> | 2014-07-17 20:09 | 480M | |
| darkmark_140717_1900..> | 2014-07-18 19:30 | 543M | |
| darkmark_140717_1900..> | 2014-07-17 20:00 | 65M | |
| darkmark_140710_1901..> | 2014-07-10 20:01 | 568M | |
| darkmark_140626_1900..> | 2014-06-26 20:00 | 562M | |
| darkmark_140619_1901..> | 2014-06-19 20:01 | 564M | |
| darkmark_140612_1900..> | 2014-06-12 20:00 | 562M | |
| darkmark_140605_1901..> | 2014-06-05 20:01 | 559M | |
| darkmark_140529_1900..> | 2014-05-29 20:00 | 564M | |
| darkmark_140522_1900..> | 2014-05-22 20:00 | 316M | |
| darkmark_140515_1904..> | 2014-05-15 20:04 | 617M | |
| darkmark_140508_1900..> | 2014-05-08 20:00 | 560M | |
| darkmark_140501_1900..> | 2014-05-01 20:00 | 547M | |
| darkmark_140424_1906..> | 2014-04-24 20:06 | 497M | |
| darkmark_140417_1901..> | 2014-04-17 20:01 | 558M | |
| darkmark_140410_1900..> | 2014-04-10 20:00 | 559M | |
| darkmark_140403_1904..> | 2014-04-03 20:04 | 632M | |
| darkmark_140327_1903..> | 2014-03-27 20:03 | 553M | |
| darkmark_140320_1900..> | 2014-03-20 20:00 | 601M | |
| darkmark_140313_1915..> | 2014-03-13 20:15 | 402M | |
| darkmark_140306_1959..> | 2014-03-06 19:59 | 555M | |
| darkmark_140227_2002..> | 2014-02-27 20:02 | 551M | |
| darkmark_140220_2003..> | 2014-02-20 20:03 | 564M | |
| darkmark_140220_2000..> | 2014-02-20 20:00 | 7.2M | |
| darkmark_140213_2016..> | 2014-02-13 20:16 | 422M | |
| darkmark_140206_2001..> | 2014-02-06 20:01 | 557M | |
| darkmark_140123_2000..> | 2014-01-23 20:00 | 561M | |
| darkmark_140116_2007..> | 2014-01-16 20:07 | 545M | |
| darkmark_140109_2003..> | 2014-01-09 20:03 | 574M | |
| darkmark_140102_2001..> | 2014-01-02 20:01 | 613M | |
| darkmark_131219_2010..> | 2013-12-19 20:10 | 605M | |
| darkmark_131212_2100..> | 2013-12-12 20:00 | 573M | |
| darkmark_131205_2100..> | 2013-12-05 20:00 | 608M | |
| darkmark_131121_2106..> | 2013-11-21 20:06 | 622M | |
| darkmark_131114_2101..> | 2013-11-14 20:01 | 598M | |
| darkmark_131107_2110..> | 2013-11-07 20:10 | 575M | |
| darkmark_131031_1959..> | 2013-10-31 19:59 | 601M | |
| darkmark_131017_2000..> | 2013-10-17 20:00 | 635M | |
| darkmark_131010_2010..> | 2013-10-10 20:10 | 692M | |
| darkmark_131003_2009..> | 2013-10-03 20:09 | 693M | |
| darkmark_130926_2011..> | 2013-09-26 20:11 | 635M | |
| darkmark_130919_2005..> | 2013-09-19 20:05 | 623M | |
| darkmark_130912_2009..> | 2013-09-12 20:09 | 564M | |
| darkmark_130912_2000..> | 2013-09-12 20:00 | 1.9M | |
| darkmark_130905_2022..> | 2013-09-05 20:22 | 742M | |
| darkmark_130829_2014..> | 2013-08-29 20:14 | 568M | |
| darkmark_130822_2004..> | 2013-08-22 20:04 | 741M | |
| darkmark_130815_2013..> | 2013-08-15 20:13 | 542M | |
| dark_recess.wav | 2013-07-29 12:58 | 78M | |
| dark_mark-promo-1.wav | 2013-12-21 16:53 | 4.0M | |
| dangeroscoe i lie to..> | 2011-05-04 21:45 | 32M | |
| dadsi_two.WAV | 2011-06-30 11:04 | 59M | |
| dadsi_one.WAV | 2011-06-30 11:01 | 50M | |
| cypresshill-killaman..> | 2013-02-15 13:27 | 3.5M | |
| crn pain crank morty..> | 2011-05-04 21:15 | 34M | |
| crashingla_150501_18..> | 2015-05-01 19:59 | 604M | |
| crashingla_150402_19..> | 2015-04-02 20:00 | 564M | |
| corporatemumbojumbo.wav | 2012-09-14 14:46 | 31M | |
| corp.bap mix 4.wav | 2011-10-04 19:26 | 58M | |
| conlink.wav | 2000-05-25 06:38 | 9.6K | |
| comedypromo_140713_1..> | 2014-07-13 14:16 | 15M | |
| comedypromo_140713_1..> | 2014-07-13 14:14 | 18M | |
| comedypromo_140713_1..> | 2014-07-13 14:12 | 17M | |
| collinsworld_150816_..> | 2015-08-16 14:03 | 423M | |
| collinsworld_150816_..> | 2015-08-16 13:19 | 1.5M | |
| collinsworld_150816_..> | 2015-08-16 13:14 | 52M | |
| cocktailspromos_1310..> | 2013-10-26 15:46 | 9.4M | |
| cocktailspromos_1310..> | 2013-10-26 15:45 | 6.3M | |
| cocktailspromos_1310..> | 2013-10-26 15:36 | 7.8M | |
| cocktailspromos_1310..> | 2013-10-26 15:35 | 7.4M | |
| cocktailsintro_13102..> | 2013-10-26 15:49 | 4.9M | |
| coachmiller_shorelin..> | 2013-11-15 21:36 | 9.6M | |
| coachmiller_shorelin..> | 2013-11-15 21:35 | 8.4M | |
| coachmiller_shorelin..> | 2013-11-15 21:35 | 673K | |
| coachmiller_shorelin..> | 2013-11-15 21:34 | 9.4M | |
| coachmiller_shorelin..> | 2013-11-15 21:33 | 9.7M | |
| coachmiller_shorelin..> | 2013-11-15 21:32 | 8.8M | |
| coachcom_chinese_140..> | 2014-04-18 20:40 | 9.6M | |
| coachcom_chinese_140..> | 2014-04-18 21:39 | 7.9M | |
| coachcom_chinese_140..> | 2014-04-18 21:38 | 6.2M | |
| coachcom_chinese_140..> | 2014-04-18 21:38 | 4.0M | |
| coachcom9_140411_204..> | 2014-04-11 21:53 | 4.9M | |
| coachcom8_140411_204..> | 2014-04-11 21:50 | 6.4M | |
| coachcom8_140411_204..> | 2014-04-11 21:54 | 7.6M | |
| coachcom8_140411_204..> | 2014-04-11 21:50 | 8.1M | |
| coachcom8_140411_204..> | 2014-04-11 21:45 | 1.0M | |
| coachcom8_140411_204..> | 2014-04-11 21:44 | 1.0M | |
| coachcom8_140411_204..> | 2014-04-11 21:43 | 8.3M | |
| coachcom7_140411_204..> | 2014-04-11 21:54 | 6.7M | |
| coachcom7_140411_204..> | 2014-04-11 21:50 | 7.4M | |
| coachcom7_140411_204..> | 2014-04-11 21:42 | 2.6M | |
| coachcom7_140411_204..> | 2014-04-11 21:40 | 15M | |
| coachcom5_140328_204..> | 2014-03-28 21:49 | 8.6M | |
| coachcom5_140328_204..> | 2014-03-28 21:49 | 4.7M | |
| coachcom5_140328_204..> | 2014-03-28 21:48 | 8.4M | |
| coachcom4_140328_204..> | 2014-03-28 21:46 | 16M | |
| coachcom3_140328_204..> | 2014-03-28 21:43 | 18M | |
| coachcom2_140328_204..> | 2014-03-28 21:42 | 12M | |
| coachcom1_140328_204..> | 2014-03-28 21:40 | 8.7M | |
| click.wav | 2000-02-09 16:58 | 7.9K | |
| classical.wav | 2011-04-07 16:34 | 4.0M | |
| chissum_worthington-..> | 2012-08-10 14:15 | 1.5M | |
| chissum_worthington-..> | 2012-08-10 14:19 | 2.2M | |
| ching chong.wav | 2011-04-07 16:34 | 2.5M | |
| chickstersnest_12082..> | 2019-11-03 07:46 | 595M | |
| chickstersnest_12081..> | 2019-11-03 07:44 | 595M | |
| chickstersnest_12080..> | 2019-11-03 07:42 | 596M | |
| chickstersnest_12072..> | 2019-11-03 07:40 | 595M | |
| chickstersnest_12072..> | 2019-11-03 07:37 | 595M | |
| chickstersnest_12071..> | 2019-11-03 07:35 | 595M | |
| chickstersnest_12070..> | 2019-11-03 07:33 | 595M | |
| chickstersnest_12063..> | 2019-11-03 07:31 | 595M | |
| chickstersnest_12062..> | 2019-11-03 07:29 | 595M | |
| chickstersnest_12061..> | 2019-11-03 07:27 | 595M | |
| chickstersnest_12060..> | 2019-11-03 07:25 | 595M | |
| chickstersnest_12060..> | 2019-11-03 07:22 | 595M | |
| chickstersnest_12052..> | 2019-11-03 07:20 | 596M | |
| chickstersnest_12051..> | 2019-11-03 07:18 | 595M | |
| chickstersnest_12051..> | 2019-11-03 07:16 | 595M | |
| chickstersnest_12050..> | 2019-11-03 07:13 | 596M | |
| chickstersnest_12042..> | 2019-11-03 07:11 | 595M | |
| chicago_school_promo..> | 2013-09-20 12:46 | 7.7M | |
| cathp_150622_120234_..> | 2015-06-22 13:02 | 597M | |
| casanovashow_140813_..> | 2014-08-13 20:02 | 560M | |
| casanovashow_140730_..> | 2014-07-30 19:02 | 517M | |
| casanovashow_140728_..> | 2014-07-29 00:28 | 6.6M | |
| casanovashow_140728_..> | 2014-07-29 00:26 | 8.2M | |
| capital shooting 3.wav | 2013-10-05 14:12 | 1.1M | |
| cape_151013_191247_S..> | 2015-10-13 20:12 | 818M | |
| cape_151012_200238_S..> | 2015-10-12 21:02 | 709M | |
| cape_151011_131036_S..> | 2015-10-11 14:10 | 646M | |
| cape_151005_200023_S..> | 2015-10-05 21:00 | 648M | |
| cape_150927_131207_S..> | 2015-09-27 14:12 | 614M | |
| cape_150921_195932_S..> | 2015-09-21 20:59 | 608M | |
| cape_150914_200452_S..> | 2015-09-14 21:04 | 606M | |
| cape_150907_200225_S..> | 2015-09-07 21:02 | 604M | |
| cape_150831_200405_S..> | 2015-08-31 21:04 | 641M | |
| cape_150831_200214_S..> | 2015-08-31 21:02 | 5.0M | |
| cape_150824_200423_S..> | 2015-08-24 21:04 | 743M | |
| cape_150817_200645_S..> | 2015-08-17 21:06 | 581M | |
| cape_150810_201002_S..> | 2015-08-10 21:10 | 605M | |
| cape_150803_195915_S..> | 2015-08-03 20:59 | 569M | |
| cape_150727_200121_S..> | 2015-07-27 21:01 | 594M | |
| cape_150720_200250_S..> | 2015-07-20 21:02 | 610M | |
| cape_150713_200140_S..> | 2015-07-13 21:01 | 611M | |
| cape_150706_200228_S..> | 2015-07-06 21:02 | 614M | |
| cape_150629_200413_S..> | 2015-06-29 21:04 | 620M | |
| cape_150622_200419_S..> | 2015-06-22 21:04 | 603M | |
| cape_150615_200418_S..> | 2015-06-15 21:04 | 594M | |
| cape_150608_200037_S..> | 2015-06-08 21:00 | 665M | |
| cape_150601_200136_S..> | 2015-06-01 21:01 | 590M | |
| cape_150525_200021_S..> | 2015-05-25 21:00 | 573M | |
| cape_150518_200016_S..> | 2015-05-18 21:00 | 614M | |
| cape_150511_200006_S..> | 2015-05-11 21:00 | 617M | |
| cape_150504_200147_S..> | 2015-05-04 21:01 | 613M | |
| cape_150504_200025_S..> | 2015-05-04 21:00 | 3.8M | |
| cape_150427_200209_S..> | 2015-04-27 21:02 | 566M | |
| cape_150420_200005_S..> | 2015-04-20 21:00 | 613M | |
| cape_150413_200011_S..> | 2015-04-13 21:00 | 607M | |
| cape_150406_200045_S..> | 2015-04-06 21:00 | 585M | |
| cape_150330_200002_S..> | 2015-03-30 21:00 | 613M | |
| cape_150330_195706_S..> | 2015-03-30 20:57 | 30M | |
| cape_150323_200023_S..> | 2015-03-23 21:00 | 607M | |
| cape_150316_200021_S..> | 2015-03-16 21:00 | 584M | |
| cape_150309_200544_S..> | 2015-03-09 21:05 | 590M | |
| cape_150302_211309_S..> | 2015-03-02 21:13 | 585M | |
| cape_150223_220345_S..> | 2015-02-23 22:03 | 583M | |
| cape_150216_220214_S..> | 2015-02-16 22:02 | 583M | |
| cape_150209_220242_S..> | 2015-02-09 22:02 | 574M | |
| cape_150202_220200_S..> | 2015-02-02 22:02 | 584M | |
| cape_150126_220508_S..> | 2015-01-26 22:05 | 585M | |
| cape_150119_220156_S..> | 2015-01-19 22:01 | 567M | |
| cape_150112_220004_S..> | 2015-01-12 22:00 | 566M | |
| cain work.wav | 2011-05-11 22:17 | 10M | |
| cain promo long.wav | 2011-05-11 22:47 | 2.6M | |
| cain call.wav | 2011-05-11 21:30 | 11M | |
| burning.wav | 2011-06-13 11:54 | 53M | |
| burned out cynder.wav | 2016-02-22 14:45 | 2.7M | |
| bumper4.wav | 2013-09-21 14:24 | 7.2M | |
| bumper3.wav | 2013-09-21 14:24 | 9.9M | |
| bumper2.wav | 2013-09-21 14:23 | 5.5M | |
| bumper1.wav | 2013-09-21 14:23 | 10M | |
| bsfp_150927_180018_S..> | 2015-09-27 19:00 | 556M | |
| bsfp_150823_170320_S..> | 2015-08-23 18:03 | 553M | |
| bsfp_150726_180832_S..> | 2015-07-26 19:08 | 4.3M | |
| bsfp_150726_170822_S..> | 2015-07-27 01:00 | 571M | |
| bsfp_150628_170003_S..> | 2015-06-28 18:00 | 541M | |
| bsfp_150531_170214_S..> | 2015-05-31 18:02 | 570M | |
| brodcast.wav | 2012-10-13 23:46 | 20K | |
| bongripper-dots-1101..> | 2014-11-04 12:01 | 161M | |
| boingiggig.wav | 2000-06-13 05:47 | 15K | |
| bobbybuck_151005_145..> | 2015-10-05 15:59 | 562M | |
| bobbybuck_150913_180..> | 2015-09-13 19:01 | 573M | |
| bobbybuck_150507_150..> | 2015-05-07 16:01 | 572M | |
| bobbybuck_150428_090..> | 2015-04-28 10:01 | 563M | |
| bobbybuck_150412_140..> | 2015-04-12 15:00 | 539M | |
| bobbybuck_150403_140..> | 2015-04-03 15:07 | 540M | |
| bobbybuck_150308_140..> | 2015-03-08 15:00 | 608M | |
| bobbybuck_150304_160..> | 2015-03-04 16:00 | 594M | |
| bobbybuck_150208_150..> | 2015-02-08 15:00 | 567M | |
| bobbybuck_150128_160..> | 2015-01-28 16:00 | 556M | |
| bobbybuck_150125_140..> | 2015-01-25 14:01 | 576M | |
| bobbybuck_141219_190..> | 2014-12-19 19:06 | 612M | |
| bobbybuck_141121_190..> | 2014-11-21 19:05 | 505M | |
| bobbybuck_141114_190..> | 2014-11-14 19:09 | 568M | |
| bobbybuck_141107_190..> | 2014-11-07 19:05 | 555M | |
| bobbybuck_141017_180..> | 2014-10-17 19:00 | 561M | |
| bobbybuck_141010_180..> | 2014-10-10 19:04 | 537M | |
| bobbybuck_141003_181..> | 2014-10-03 19:10 | 568M | |
| bobbybuck_140926_180..> | 2014-09-26 19:06 | 511M | |
| bobbybuck_140919_180..> | 2014-09-19 19:04 | 516M | |
| bobbybuck_140912_180..> | 2014-09-12 19:01 | 551M | |
| bobbybuck_140905_180..> | 2014-09-05 19:01 | 593M | |
| bobbybuck_140822_180..> | 2014-08-22 19:05 | 521M | |
| bobbybuck_140815_180..> | 2014-08-15 19:05 | 562M | |
| blastoff_130220_2103..> | 2013-02-20 20:03 | 558M | |
| blastoff_130213_2100..> | 2013-02-13 20:00 | 560M | |
| blastoff_130206_2100..> | 2013-02-06 20:00 | 559M | |
| blastoff_130130_2100..> | 2013-01-30 20:00 | 43M | |
| blastoff_130123_2100..> | 2013-01-23 20:00 | 560M | |
| blastoff_130116_2100..> | 2013-01-16 20:00 | 559M | |
| blastoff_130109_2100..> | 2013-01-09 20:00 | 600M | |
| blameitonginger_1412..> | 2014-12-03 16:00 | 1.1G | |
| blameitonginger_1412..> | 2014-12-02 16:00 | 1.1G | |
| blameitonginger_1412..> | 2014-12-01 16:00 | 1.1G | |
| blameitonginger_1411..> | 2014-11-26 16:03 | 1.1G | |
| blameitonginger_1411..> | 2014-11-25 16:00 | 1.1G | |
| blameitonginger_1411..> | 2014-11-24 16:00 | 1.1G | |
| blameitonginger_1411..> | 2014-11-20 16:11 | 1.2G | |
| blameitonginger_1411..> | 2014-11-19 16:09 | 1.1G | |
| blameitonginger_1411..> | 2014-11-18 16:00 | 1.1G | |
| blameitonginger_1411..> | 2014-11-17 16:00 | 1.1G | |
| blameitonginger_1411..> | 2014-11-13 16:00 | 1.2G | |
| blameitonginger_1411..> | 2014-11-12 16:00 | 1.1G | |
| blameitonginger_1411..> | 2014-11-11 16:01 | 1.1G | |
| blameitonginger_1411..> | 2014-11-10 16:00 | 1.2G | |
| blameitonginger_1411..> | 2014-11-06 16:00 | 1.1G | |
| blameitonginger_1411..> | 2014-11-05 16:00 | 1.2G | |
| blameitonginger_1411..> | 2014-11-04 16:01 | 1.1G | |
| blameitonginger_1411..> | 2014-11-03 15:59 | 1.1G | |
| blameitonginger_1410..> | 2014-10-30 16:00 | 1.1G | |
| blameitonginger_1410..> | 2014-10-29 16:00 | 1.1G | |
| blameitonginger_1410..> | 2014-10-28 16:00 | 1.1G | |
| blameitonginger_1410..> | 2014-10-27 16:00 | 1.1G | |
| blameitonginger_1410..> | 2014-10-26 00:50 | 7.7M | |
| blameitonginger_1410..> | 2014-10-23 16:01 | 1.1G | |
| blameitonginger_1410..> | 2014-10-22 16:01 | 1.1G | |
| blameitonginger_1410..> | 2014-10-21 16:00 | 1.1G | |
| blameitonginger_1410..> | 2014-10-20 16:00 | 1.1G | |
| blameitonginger_1410..> | 2014-10-15 16:03 | 1.1G | |
| blameitonginger_1410..> | 2014-10-14 16:01 | 1.1G | |
| blameitonginger_1410..> | 2014-10-13 16:01 | 1.2G | |
| blameitonginger_1410..> | 2014-10-09 16:01 | 1.1G | |
| blameitonginger_1410..> | 2014-10-08 16:00 | 970M | |
| blameitonginger_1410..> | 2014-10-07 16:02 | 1.1G | |
| blameitonginger_1410..> | 2014-10-06 16:01 | 1.1G | |
| blameitonginger_1410..> | 2014-10-02 16:00 | 1.2G | |
| blameitonginger_1410..> | 2014-10-01 16:03 | 1.2G | |
| blameitonginger_1409..> | 2014-09-30 16:01 | 1.1G | |
| blameitonginger_1409..> | 2014-09-29 16:01 | 1.1G | |
| blameitonginger_1409..> | 2014-09-25 16:00 | 1.1G | |
| blameitonginger_1409..> | 2014-09-23 16:02 | 1.2G | |
| blameitonginger_1409..> | 2014-09-22 16:00 | 1.2G | |
| blameitonginger_1409..> | 2014-09-18 16:01 | 1.1G | |
| blameitonginger_1409..> | 2014-09-17 16:01 | 1.1G | |
| blameitonginger_1409..> | 2014-09-16 16:03 | 1.1G | |
| blameitonginger_1409..> | 2014-09-15 16:01 | 1.2G | |
| blameitonginger_1409..> | 2014-09-11 16:02 | 1.1G | |
| blameitonginger_1409..> | 2014-09-10 16:02 | 1.1G | |
| blameitonginger_1409..> | 2014-09-09 16:00 | 1.2G | |
| blameitonginger_1409..> | 2014-09-08 16:01 | 1.1G | |
| blameitonginger_1409..> | 2014-09-04 16:00 | 510M | |
| blameitonginger_1409..> | 2014-09-03 16:00 | 1.1G | |
| blameitonginger_1409..> | 2014-09-01 15:59 | 1.1G | |
| blameitonginger_1408..> | 2014-08-28 16:01 | 848M | |
| blameitonginger_1408..> | 2014-08-27 16:03 | 1.1G | |
| blameitonginger_1408..> | 2014-08-25 16:07 | 1.1G | |
| blameitonginger_1408..> | 2014-08-25 16:03 | 14M | |
| blameitonginger_1408..> | 2014-08-21 16:00 | 1.2G | |
| blameitonginger_1408..> | 2014-08-20 16:06 | 1.1G | |
| blameitonginger_1408..> | 2014-08-19 16:00 | 1.1G | |
| blameitonginger_1408..> | 2014-08-18 16:05 | 1.1G | |
| blameitonginger_1408..> | 2014-08-14 16:03 | 1.2G | |
| blameitonginger_1408..> | 2014-08-13 16:02 | 1.1G | |
| blameitonginger_1408..> | 2014-08-11 16:12 | 1.1G | |
| blameitonginger_1408..> | 2014-08-07 16:02 | 1.1G | |
| blameitonginger_1408..> | 2014-08-06 16:02 | 1.1G | |
| blameitonginger_1408..> | 2014-08-05 16:03 | 1.1G | |
| blameitonginger_1408..> | 2014-08-04 16:04 | 1.2G | |
| blameitonginger_1407..> | 2014-07-31 16:01 | 1.1G | |
| blameitonginger_1407..> | 2014-07-30 16:01 | 1.1G | |
| blameitonginger_1407..> | 2014-07-29 16:01 | 1.1G | |
| blameitonginger_1407..> | 2014-07-28 16:01 | 1.1G | |
| blameitonginger_1407..> | 2014-07-24 16:00 | 1.1G | |
| blameitonginger_1407..> | 2014-07-23 16:00 | 1.1G | |
| blameitonginger_1407..> | 2014-07-22 16:03 | 1.1G | |
| blameitonginger_1407..> | 2014-07-21 16:00 | 1.1G | |
| blameitonginger_1407..> | 2014-07-17 16:00 | 1.2G | |
| blameitonginger_1407..> | 2014-07-16 16:03 | 1.1G | |
| blameitonginger_1407..> | 2014-07-15 16:00 | 1.1G | |
| blameitonginger_1407..> | 2014-07-14 16:00 | 1.1G | |
| blameitonginger_1407..> | 2014-07-10 16:00 | 1.1G | |
| blameitonginger_1407..> | 2014-07-09 16:00 | 1.1G | |
| blameitonginger_1407..> | 2014-07-08 16:00 | 1.1G | |
| blameginger_140707_1..> | 2014-07-07 16:00 | 1.1G | |
| blameginger_140501_1..> | 2014-05-01 15:59 | 1.1G | |
| blameginger_140430_1..> | 2014-04-30 16:00 | 1.2G | |
| blameginger_140429_1..> | 2014-04-29 16:00 | 1.1G | |
| blameginger_140428_1..> | 2014-04-28 16:00 | 1.1G | |
| blameginger_140425_1..> | 2014-04-25 16:00 | 1.2G | |
| blameginger_140424_1..> | 2014-04-24 16:03 | 1.1G | |
| blameginger_140423_1..> | 2014-04-23 16:00 | 1.2G | |
| blameginger_140422_1..> | 2014-04-22 16:00 | 1.1G | |
| blameginger_140421_1..> | 2014-04-21 16:00 | 1.1G | |
| blameginger_140418_1..> | 2014-04-18 15:58 | 1.1G | |
| blameginger_140417_1..> | 2014-04-17 16:00 | 1.1G | |
| blameginger_140416_1..> | 2014-04-16 16:00 | 1.2G | |
| blameginger_140415_1..> | 2014-04-15 16:00 | 1.1G | |
| blameginger_140414_1..> | 2014-04-14 16:02 | 1.1G | |
| blameginger_140411_1..> | 2014-04-11 16:00 | 1.2G | |
| blameginger_140410_1..> | 2014-04-10 16:00 | 1.1G | |
| blameginger_140409_1..> | 2014-04-09 16:06 | 1.1G | |
| blameginger_140408_1..> | 2014-04-08 16:00 | 1.1G | |
| blameginger_140407_1..> | 2014-04-07 16:00 | 1.1G | |
| blameginger_140404_1..> | 2014-04-04 16:00 | 1.1G | |
| blameginger_140403_1..> | 2014-04-03 16:00 | 1.1G | |
| blameginger_140402_1..> | 2014-04-02 16:00 | 1.1G | |
| blameginger_140401_1..> | 2014-04-01 16:00 | 1.1G | |
| blameginger_140331_1..> | 2014-03-31 16:00 | 1.1G | |
| blameginger_140328_1..> | 2014-03-28 16:00 | 1.1G | |
| blameginger_140327_1..> | 2014-03-27 16:00 | 1.2G | |
| blameginger_140326_1..> | 2014-03-26 16:00 | 1.1G | |
| blameginger_140325_1..> | 2014-03-25 16:00 | 1.1G | |
| blameginger_140324_1..> | 2014-03-24 16:00 | 1.1G | |
| blameginger_140321_1..> | 2014-03-21 15:59 | 1.1G | |
| blameginger_140320_1..> | 2014-03-20 16:00 | 1.1G | |
| blameginger_140319_1..> | 2014-03-19 16:00 | 1.2G | |
| blameginger_140318_1..> | 2014-03-18 16:00 | 1.1G | |
| blameginger_140317_1..> | 2014-03-17 16:00 | 1.1G | |
| blameginger_140314_1..> | 2014-03-14 16:03 | 1.1G | |
| blameginger_140312_1..> | 2014-03-12 16:36 | 870M | |
| blameginger_140311_1..> | 2014-03-11 16:35 | 887M | |
| blameginger_140310_1..> | 2014-03-10 16:36 | 874M | |
| blameginger_140307_1..> | 2014-03-07 16:36 | 876M | |
| blameginger_140306_1..> | 2014-03-06 16:00 | 1.1G | |
| blameginger_140305_1..> | 2014-03-05 16:00 | 1.2G | |
| blameginger_140304_1..> | 2014-03-04 16:00 | 1.1G | |
| blameginger_140303_1..> | 2014-03-03 16:00 | 1.1G | |
| blameginger_140228_1..> | 2014-02-28 16:00 | 1.1G | |
| blameginger_140227_1..> | 2014-02-27 16:00 | 1.2G | |
| blameginger_140226_1..> | 2014-02-26 16:00 | 1.1G | |
| blameginger_140225_1..> | 2014-02-25 16:00 | 1.1G | |
| blameginger_140224_1..> | 2014-02-24 15:59 | 1.1G | |
| blameginger_140221_1..> | 2014-02-21 16:00 | 1.2G | |
| blameginger_140220_1..> | 2014-02-20 16:00 | 1.2G | |
| blameginger_140219_1..> | 2014-02-19 16:00 | 1.1G | |
| blameginger_140218_1..> | 2014-02-18 16:00 | 1.1G | |
| blameginger_140218_1..> | 2014-02-18 14:00 | 336M | |
| blameginger_140217_1..> | 2014-02-17 16:00 | 1.1G | |
| blameginger_140214_1..> | 2014-02-14 16:00 | 1.1G | |
| blameginger_140213_1..> | 2014-02-13 16:00 | 1.1G | |
| blameginger_140212_1..> | 2014-02-12 16:00 | 1.1G | |
| blameginger_140211_1..> | 2014-02-11 16:00 | 1.1G | |
| blameginger_140210_1..> | 2014-02-10 16:00 | 1.1G | |
| blameginger_140207_1..> | 2014-02-07 15:59 | 1.1G | |
| blameginger_140206_1..> | 2014-02-06 15:59 | 1.1G | |
| blameginger_140205_1..> | 2014-02-05 16:00 | 1.1G | |
| blameginger30_140313..> | 2014-03-13 16:00 | 1.2G | |
| blameginger30_140312..> | 2014-03-12 16:00 | 322M | |
| blameginger30_140311..> | 2014-03-11 16:00 | 325M | |
| blameginger30_140310..> | 2014-03-10 16:01 | 326M | |
| blameginger30_140307..> | 2014-03-07 16:01 | 318M | |
| blah.wav | 2012-10-19 16:25 | 88M | |
| biog_suzysdelights_1..> | 2014-02-10 15:50 | 10M | |
| biog_suzysdelights_2..> | 2014-02-11 15:41 | 12M | |
| biog_suzysdelights_2..> | 2014-02-11 15:36 | 12M | |
| biog_suzysdelights_2..> | 2014-02-11 15:32 | 5.4M | |
| billkelliher-mastodo..> | 2014-01-29 14:39 | 206M | |
| bestbuyglasses-ad.wav | 2013-02-14 17:45 | 4.7M | |
| bernie.wav | 2016-02-08 21:41 | 10M | |
| beethoven.wav | 2000-06-13 05:47 | 73K | |
| beast.wav | 2013-08-09 14:00 | 114K | |
| bbclip.wav | 2013-03-28 23:20 | 5.7M | |
| battlesex_141029_170..> | 2014-10-29 18:02 | 564M | |
| battlesex_141015_170..> | 2014-10-15 18:01 | 560M | |
| battlesex_141008_170..> | 2014-10-08 18:06 | 548M | |
| battlesex_141001_170..> | 2014-10-01 18:06 | 566M | |
| battlesex_140924_170..> | 2014-09-24 18:09 | 572M | |
| battlesex_140917_170..> | 2014-09-17 18:04 | 573M | |
| battlesex_140910_170..> | 2014-09-10 18:01 | 561M | |
| battlesex_140827_170..> | 2014-08-27 18:06 | 566M | |
| battlesex_140820_170..> | 2014-08-20 18:03 | 593M | |
| battlesex_140813_170..> | 2014-08-13 18:05 | 567M | |
| battlesex_140806_170..> | 2014-08-06 18:05 | 565M | |
| battlesex_140730_170..> | 2014-07-30 18:02 | 553M | |
| battlesex_140723_170..> | 2014-07-23 18:01 | 561M | |
| battlesex_140716_170..> | 2014-07-16 18:04 | 559M | |
| battlesex_140709_170..> | 2014-07-09 18:08 | 528M | |
| battlesex_140709_142..> | 2014-07-09 15:23 | 3.5M | |
| battlesex_140709_142..> | 2014-07-09 15:22 | 7.3M | |
| baldwinupdate.wav | 2012-12-11 11:44 | 2.6M | |
| baghdad.wav | 2016-02-08 22:13 | 1.6M | |
| badadvice_BADADVICE2..> | 2013-01-21 02:13 | 24M | |
| badadvice_130902_pro..> | 2013-02-06 15:18 | 5.1M | |
| badadvice_130330_140..> | 2013-03-30 14:00 | 150M | |
| badadvice_130323_pro..> | 2013-03-20 18:04 | 5.1M | |
| badadvice_130323_140..> | 2013-03-23 14:01 | 606M | |
| badadvice_130316_pro..> | 2013-03-13 20:13 | 5.3M | |
| badadvice_130316_140..> | 2013-03-16 14:00 | 606M | |
| badadvice_130309_pro..> | 2013-03-06 18:18 | 5.3M | |
| badadvice_130309_150..> | 2013-03-09 14:00 | 606M | |
| badadvice_130302_pro..> | 2013-02-27 21:18 | 5.4M | |
| badadvice_130223_pro..> | 2013-02-20 20:15 | 5.1M | |
| badadvice_130223_152..> | 2013-02-23 14:20 | 607M | |
| badadvice_130216_150..> | 2013-02-16 14:00 | 606M | |
| badadvice_130209_pro..> | 2013-02-13 19:18 | 5.6M | |
| badadvice_130209_150..> | 2013-02-09 14:00 | 606M | |
| badadvice_130204_pro..> | 2013-01-31 11:24 | 5.1M | |
| badadvice_130202_150..> | 2013-02-02 14:00 | 606M | |
| badadvice_130126_150..> | 2013-01-26 14:00 | 606M | |
| badadvice_130119_150..> | 2013-01-19 14:00 | 606M | |
| badadvice_121229_145..> | 2012-12-29 13:59 | 606M | |
| badadvice_121222_150..> | 2012-12-22 14:00 | 606M | |
| badadvice_121215_150..> | 2012-12-15 14:00 | 606M | |
| badadvice_121208_150..> | 2012-12-08 14:00 | 609M | |
| badadvice_121201_150..> | 2012-12-01 14:00 | 559M | |
| badadvice_121124_150..> | 2012-11-24 14:00 | 559M | |
| badadvice_121110_150..> | 2012-11-10 14:01 | 553M | |
| badadvice_121103_140..> | 2012-11-03 14:00 | 615M | |
| badadvice_121027_140..> | 2012-10-27 14:00 | 590M | |
| badadvice_121020_140..> | 2012-10-20 14:00 | 592M | |
| badadvice_121013_140..> | 2012-10-13 14:00 | 589M | |
| badadvice_121006_200..> | 2019-11-03 07:03 | 550M | |
| badadvice_121006_200..> | 2019-11-03 07:00 | 1.0M | |
| badadvice_121006_140..> | 2019-11-03 07:00 | 584M | |
| badadvice_120929_140..> | 2019-11-03 06:57 | 595M | |
| badadvice_120915_140..> | 2019-11-03 06:55 | 592M | |
| badadvice_120915_140..> | 2019-11-03 06:52 | 3.3M | |
| badadvice_120908_140..> | 2019-11-03 06:52 | 595M | |
| badadvice_120901_140..> | 2019-11-03 06:50 | 595M | |
| badadvice_120825_140..> | 2019-11-03 06:48 | 595M | |
| badadvice_120818_140..> | 2019-11-03 06:45 | 595M | |
| badadvice_120811_140..> | 2019-11-03 06:43 | 595M | |
| badadvice_120804_140..> | 2019-11-03 06:41 | 595M | |
| badadvice_120728_140..> | 2019-11-03 06:39 | 596M | |
| badadvice_120721_140..> | 2019-11-03 06:37 | 595M | |
| badadvice_120714_140..> | 2019-11-03 06:35 | 595M | |
| badadvice_120707_140..> | 2019-11-03 06:32 | 595M | |
| badadvice_120630_140..> | 2019-11-03 06:30 | 595M | |
| badadvice_120623_140..> | 2019-11-03 06:27 | 595M | |
| badadvice_120616_140..> | 2019-11-03 06:24 | 596M | |
| badadvice_120609_140..> | 2019-11-03 06:22 | 595M | |
| badadvice_120602_140..> | 2019-11-03 06:20 | 595M | |
| badadvice_120526_140..> | 2019-11-03 06:17 | 595M | |
| badadvice_120519_140..> | 2019-11-03 06:15 | 595M | |
| badadvice_120512_140..> | 2019-11-03 06:12 | 596M | |
| badadvice_120428_140..> | 2019-11-03 06:10 | 595M | |
| ayatolla.wav | 2012-03-11 14:33 | 4.7M | |
| awkwardcoversations_..> | 2013-03-30 12:00 | 124M | |
| awkwardcoversations_..> | 2013-03-23 12:04 | 594M | |
| awkwardcoversations_..> | 2013-03-09 11:59 | 593M | |
| awkwardcoversations_..> | 2013-03-02 13:04 | 507M | |
| awkwardcoversations_..> | 2013-03-02 11:59 | 614M | |
| awkwardcoversations_..> | 2013-02-23 12:00 | 620M | |
| awkwardcoversations_..> | 2013-02-16 12:00 | 648M | |
| awkwardcoversations_..> | 2013-02-09 12:00 | 606M | |
| awkwardcoversations_..> | 2013-01-26 12:00 | 587M | |
| awkwardcoversations_..> | 2013-01-19 12:00 | 681M | |
| awkwardcoversations_..> | 2013-01-12 12:11 | 629M | |
| awkwardcoversations_..> | 2013-01-05 11:59 | 651M | |
| awkwardcoversations_..> | 2012-12-29 12:33 | 563M | |
| awkwardcoversations_..> | 2012-12-22 12:00 | 622M | |
| awkwardcoversations_..> | 2012-12-15 12:00 | 613M | |
| awkwardcoversations_..> | 2012-12-08 12:00 | 613M | |
| awkwardcoversations_..> | 2012-12-01 12:02 | 771M | |
| awkwardcoversations_..> | 2012-11-24 12:00 | 610M | |
| awkwardcoversations_..> | 2012-11-17 12:00 | 611M | |
| awkwardcoversations_..> | 2012-11-10 12:00 | 561M | |
| awkwardcoversations_..> | 2012-11-03 12:04 | 616M | |
| awkwardcoversations_..> | 2012-10-27 12:00 | 615M | |
| awkwardcoversations_..> | 2012-10-20 12:01 | 589M | |
| awkwardcoversations_..> | 2012-10-13 12:01 | 561M | |
| awkwardcoversations_..> | 2019-11-03 06:05 | 560M | |
| awkwardcoversations_..> | 2019-11-03 06:03 | 601M | |
| awkwardcoversations_..> | 2019-11-03 06:00 | 578M | |
| awkwardcoversations_..> | 2019-11-03 05:58 | 785M | |
| awkwardcoversations_..> | 2019-11-03 05:55 | 619M | |
| awkwardcoversations_..> | 2019-11-03 05:52 | 541M | |
| awkwardconversations..> | 2019-11-03 05:51 | 575M | |
| auralstimulationprom..> | 2019-11-03 05:49 | 4.8M | |
| auralstimulationprom..> | 2019-11-03 05:49 | 23M | |
| auralstimulation_130..> | 2013-05-08 21:00 | 606M | |
| auralstimulation_130..> | 2013-05-01 21:04 | 606M | |
| auralstimulation_130..> | 2013-04-23 22:31 | 7.6M | |
| auralstimulation_130..> | 2013-04-24 21:00 | 606M | |
| auralstimulation_130..> | 2013-04-16 00:26 | 5.0M | |
| auralstimulation_130..> | 2013-04-17 21:13 | 607M | |
| auralstimulation_130..> | 2013-04-17 20:58 | 48M | |
| auralstimulation_130..> | 2013-04-10 21:01 | 606M | |
| auralstimulation_130..> | 2013-03-27 07:34 | 5.0M | |
| auralstimulation_130..> | 2013-03-27 21:03 | 606M | |
| auralstimulation_130..> | 2013-03-20 21:02 | 606M | |
| auralstimulation_130..> | 2013-03-13 21:00 | 606M | |
| auralstimulation_130..> | 2013-03-05 22:06 | 567M | |
| auralstimulation_130..> | 2013-02-26 22:51 | 5.0M | |
| auralstimulation_130..> | 2013-02-27 21:04 | 606M | |
| auralstimulation_130..> | 2013-02-18 18:06 | 5.0M | |
| auralstimulation_130..> | 2013-02-20 21:04 | 606M | |
| auralstimulation_130..> | 2013-02-10 23:10 | 2.5M | |
| auralstimulation_130..> | 2013-02-13 21:00 | 606M | |
| auralstimulation_130..> | 2013-02-06 20:59 | 606M | |
| auralstimulation_130..> | 2013-01-23 22:05 | 606M | |
| auralstimulation_130..> | 2013-01-23 21:01 | 606M | |
| auralstimulation_130..> | 2013-01-17 16:54 | 608M | |
| auralstimulation_121..> | 2012-12-26 22:43 | 606M | |
| auralstimulation_121..> | 2012-12-26 21:04 | 606M | |
| auralstimulation_121..> | 2012-12-19 21:02 | 594M | |
| auralstimulation_121..> | 2012-12-12 21:01 | 605M | |
| auralstimulation_121..> | 2012-12-07 21:06 | 606M | |
| auralstimulation_121..> | 2012-12-05 21:03 | 560M | |
| auralstimulation_121..> | 2012-11-28 21:02 | 528M | |
| auralstimulation_121..> | 2012-11-14 21:03 | 527M | |
| auralstimulation_121..> | 2012-11-07 21:00 | 550M | |
| auralstimulation_121..> | 2012-10-31 20:59 | 561M | |
| auralstimulation_121..> | 2012-10-24 21:03 | 542M | |
| auralstimulation_121..> | 2012-10-17 21:03 | 547M | |
| auralstimulation_121..> | 2019-11-03 05:48 | 747M | |
| auralstimulation_121..> | 2019-11-03 05:46 | 544M | |
| auralstimulation_120..> | 2019-11-03 05:43 | 533M | |
| auralstimulation_120..> | 2019-11-03 05:41 | 518M | |
| arlo starting at T's..> | 2011-04-17 16:59 | 5.5M | |
| arlo show promo real..> | 2011-04-28 21:50 | 1.1M | |
| arlo on work.wav | 2011-04-20 21:20 | 4.1M | |
| arlo on weed.wav | 2011-04-20 21:03 | 4.1M | |
| arlo montage final.wav | 2011-04-20 22:11 | 17M | |
| arlo jeremy hansen f..> | 2011-04-28 21:50 | 769K | |
| arlo favorite radio ..> | 2011-04-28 21:51 | 1.4M | |
| arlo call in real.wav | 2011-04-28 21:51 | 1.8M | |
| arlo-promos2.wav | 2011-04-15 17:38 | 11M | |
| arlo-promos1.wav | 2011-04-15 17:38 | 37M | |
| apintofcacophony_150..> | 2015-02-23 21:00 | 557M | |
| apintofcacophony_150..> | 2015-02-16 21:00 | 556M | |
| apintofcacophony_150..> | 2015-02-09 21:00 | 558M | |
| apintofcacophony_150..> | 2015-02-02 21:00 | 561M | |
| apintofcacophony_150..> | 2015-01-26 21:00 | 556M | |
| apintofcacophony_150..> | 2015-01-19 21:00 | 549M | |
| apintofcacophony_150..> | 2015-01-05 21:02 | 694M | |
| apintofcacophony_141..> | 2014-12-15 21:03 | 656M | |
| apintofcacophony_141..> | 2014-12-01 21:03 | 656M | |
| apintofcacophony_141..> | 2014-11-17 21:03 | 582M | |
| apintofcacophony_141..> | 2014-11-10 21:01 | 680M | |
| apintofcacophony_141..> | 2014-11-03 21:01 | 656M | |
| apintofcacophony_141..> | 2014-10-20 21:04 | 668M | |
| apintofcacophony_141..> | 2014-10-13 21:02 | 679M | |
| apintofcacophony_140..> | 2014-09-29 21:02 | 665M | |
| apintofcacophony_140..> | 2014-09-22 21:03 | 620M | |
| apintofcacophony_140..> | 2014-09-15 21:07 | 644M | |
| apintofcacophony_140..> | 2014-09-08 21:02 | 657M | |
| apintofcacophony_140..> | 2014-08-25 21:04 | 625M | |
| apintofcacophony_140..> | 2014-08-18 21:01 | 636M | |
| apintofcacophony_140..> | 2014-08-11 21:02 | 639M | |
| apintofcacophony_140..> | 2014-08-04 21:01 | 615M | |
| apintofcacophony_140..> | 2014-07-28 21:07 | 609M | |
| apintofcacophony_140..> | 2014-07-21 21:00 | 634M | |
| apintofcacophony_140..> | 2014-07-14 21:01 | 597M | |
| apintofcacophony_140..> | 2014-07-07 21:02 | 652M | |
| apintofcacophony_140..> | 2014-06-30 21:03 | 630M | |
| apintofcacophony_140..> | 2014-06-16 21:03 | 591M | |
| apintofcacophony_140..> | 2014-06-09 23:00 | 606M | |
| apintofcacophony_140..> | 2014-06-02 23:00 | 704M | |
| apintofcacophony_140..> | 2014-05-26 23:00 | 656M | |
| apintofcacophony_140..> | 2014-05-19 23:00 | 564M | |
| apintofcacophony_140..> | 2014-05-12 23:04 | 778M | |
| apintofcacophony_140..> | 2014-04-28 23:06 | 1.2G | |
| apintofcacophony_140..> | 2014-04-21 23:07 | 1.1G | |
| apintofcacophony_140..> | 2014-04-14 23:04 | 940M | |
| apintofcacophony_140..> | 2014-04-07 23:05 | 857M | |
| apintofcacophony_140..> | 2014-03-24 23:06 | 764M | |
| apintofcacophony_140..> | 2014-03-17 23:08 | 821M | |
| apintofcacophony_140..> | 2014-03-10 23:05 | 770M | |
| apintofcacophony_140..> | 2014-03-03 23:09 | 381M | |
| apintofcacophony_140..> | 2014-02-24 23:09 | 655M | |
| apintofcacophony_140..> | 2014-02-10 23:06 | 596M | |
| apintofcacophony_140..> | 2014-02-03 23:05 | 603M | |
| apintofcacophony_140..> | 2014-01-27 23:06 | 594M | |
| apintofcacophony_140..> | 2014-01-20 23:04 | 614M | |
| apintofcacophony_140..> | 2014-01-13 23:05 | 560M | |
| apintofcacophony_140..> | 2014-01-06 22:59 | 643M | |
| angrydorkspodcast_13..> | 2013-02-11 18:00 | 563M | |
| angrydorkspodcast_13..> | 2013-02-04 18:00 | 561M | |
| angrydorkspodcast_13..> | 2013-01-28 18:00 | 561M | |
| angrydorkspodcast_13..> | 2013-01-21 18:00 | 561M | |
| angrydorkspodcast_13..> | 2013-01-14 17:59 | 557M | |
| angrydorkspodcast_12..> | 2012-12-17 18:00 | 560M | |
| angrydorkspodcast_12..> | 2012-12-10 18:00 | 611M | |
| angrydorkspodcast_12..> | 2012-12-04 16:25 | 580M | |
| angrydorkspodcast_12..> | 2012-11-26 18:00 | 560M | |
| angrydorkspodcast_12..> | 2012-11-19 18:00 | 611M | |
| angrydorkspodcast_12..> | 2012-11-12 18:00 | 559M | |
| angrydorkspodcast_12..> | 2012-11-05 18:00 | 611M | |
| angrydorkspodcast_12..> | 2012-10-29 18:00 | 616M | |
| angrydorkspodcast_12..> | 2012-10-24 16:54 | 560M | |
| angrydorkspodcast_12..> | 2012-10-15 18:00 | 561M | |
| angrydorkspodcast_12..> | 2019-11-03 05:39 | 557M | |
| angrydorkspodcast_12..> | 2019-11-03 05:37 | 560M | |
| angrydorkspodcast_12..> | 2019-11-03 05:35 | 561M | |
| angrydorkspodcast_12..> | 2019-11-03 05:33 | 525M | |
| angrydorkspodcast_12..> | 2019-11-03 05:31 | 577K | |
| angrydorkspodcast_12..> | 2019-11-03 05:31 | 542M | |
| angrydorkspodcast_12..> | 2019-11-03 05:29 | 19M | |
| angrydorkspodcast_12..> | 2019-11-03 05:29 | 575M | |
| angrydorkspodcast_12..> | 2019-11-03 05:27 | 575M | |
| angrydorkspodcast_12..> | 2019-11-03 05:25 | 596M | |
| angrydorks_130401_18..> | 2013-04-01 18:29 | 562M | |
| angrydorks_130325_18..> | 2013-03-25 18:01 | 563M | |
| angrydorks_130318_18..> | 2013-03-18 18:03 | 565M | |
| angrydorks_130311_18..> | 2013-03-11 18:00 | 561M | |
| angrydorks_130304_19..> | 2013-03-04 18:00 | 561M | |
| angrydorks_130225_19..> | 2013-02-25 18:29 | 562M | |
| angrydorks_130225_19..> | 2013-02-25 18:00 | 271M | |
| angrydorks_130218_19..> | 2013-02-18 18:02 | 557M | |
| anexposedtruth_13012..> | 2013-01-20 20:00 | 555M | |
| anexposedtruth_13011..> | 2013-01-14 00:23 | 559M | |
| anexposedsecret_1303..> | 2013-03-31 20:00 | 593M | |
| anexposedsecret_1303..> | 2013-03-24 20:00 | 574M | |
| anexposedsecret_1303..> | 2013-03-17 20:00 | 631M | |
| anexposedsecret_1303..> | 2013-03-03 21:03 | 573M | |
| anexposedsecret_1303..> | 2013-03-03 20:00 | 568M | |
| anexposedsecret_1302..> | 2013-02-24 21:04 | 557M | |
| anexposedsecret_1302..> | 2013-02-24 20:00 | 600M | |
| anexposedsecret_1302..> | 2013-02-17 20:00 | 569M | |
| anexposedsecret_1302..> | 2013-02-10 20:00 | 558M | |
| anexposedsecret_1302..> | 2013-02-03 20:00 | 564M | |
| anexposedsecret_1301..> | 2013-01-26 21:12 | 556M | |
| andrea ross.WAV | 2011-06-30 12:28 | 84M | |
| anchormanII10.wav | 2012-04-01 18:41 | 4.6M | |
| anchorman2.wav | 2012-04-01 15:34 | 4.6M | |
| americans_should_eat..> | 2011-08-28 16:15 | 1.7M | |
| alarm.wav | 2001-10-21 19:09 | 9.5K | |
| afghankillings.wav | 2012-03-18 15:32 | 5.0M | |
| adelsononromney10.wav | 2012-04-01 18:41 | 4.6M | |
| adelsononromney.wav | 2012-04-01 15:34 | 4.6M | |
| Zoom Zoom Zoom.wav | 2016-02-16 13:42 | 5.0M | |
| Zimmerman Verdict.wav | 2013-08-09 14:36 | 3.0M | |
| Zimmerman Riot.wav | 2013-08-09 15:11 | 1.4M | |
| Zep thieves.wav | 2016-02-22 14:40 | 8.2M | |
| Zebra 09.wav | 2013-06-14 16:44 | 49M | |
| Zac - That's Not A S..> | 2013-09-30 22:23 | 29M | |
| Zac - It's Not Impor..> | 2013-09-30 22:23 | 36M | |
| You Won't Let Me Dow..> | 2013-07-26 17:32 | 35M | |
| You Fucking Bitch.wav | 2016-05-17 14:20 | 1.8M | |
| You Can Have It All ..> | 2013-08-19 20:53 | 47M | |
| You Can't Always Get..> | 2013-07-02 01:51 | 75M | |
| You've Been Loved 02..> | 2013-06-30 01:59 | 46M | |
| Yoga Means Union 04.wav | 2013-06-14 18:18 | 50M | |
| Year Of The Cat 76.wav | 2013-06-14 16:51 | 67M | |
| YOUR MAN STEM MIXXX ..> | 2011-12-28 16:56 | 41M | |
| Wovoka - Sleep Eater..> | 2016-03-19 20:42 | 83M | |
| Words and Things Int..> | 2015-06-26 12:45 | 4.3M | |
| Wooeep.wav | 2000-06-13 05:47 | 21K | |
| Wolf.wav | 2016-03-29 13:58 | 1.3M | |
| Witchfinder Movie.wav | 2013-09-14 11:01 | 1.9M | |
| Winning 06.wav | 2013-07-26 16:51 | 52M | |
| Why Don't You Shut U..> | 2016-05-17 14:38 | 285K | |
| Whoframedrogerebert.wav | 2013-04-08 15:30 | 1.6M | |
| Who Invernted Yester..> | 2013-09-30 23:18 | 29M | |
| Who Do You Love 75.wav | 2013-06-14 18:55 | 39M | |
| Which Will 72.wav | 2013-06-14 20:00 | 30M | |
| Where Is My Mind 88.wav | 2013-07-26 03:09 | 40M | |
| Where I'm From 00.wav | 2013-07-13 21:41 | 39M | |
| Where Did You Sleep ..> | 2013-07-26 02:46 | 51M | |
| Well Hung Heart - I ..> | 2014-01-20 02:44 | 26M | |
| Well Hung Heart - Co..> | 2014-01-20 01:44 | 37M | |
| Well Hung Heart - Bl..> | 2014-01-20 01:44 | 31M | |
| Welcome 2 2.wav | 2011-09-25 16:48 | 1.1M | |
| Welcome 2 1.wav | 2011-09-25 16:48 | 1.1M | |
| Welcome 2.wav | 2011-09-25 16:48 | 1.1M | |
| Welcome 1 2.wav | 2011-09-25 16:48 | 1.1M | |
| Welcome 1 1.wav | 2011-09-25 16:48 | 1.1M | |
| Welcome 1.wav | 2011-09-25 16:48 | 1.1M | |
| Welcome.wav | 2011-09-25 16:01 | 5.3M | |
| Weight.wav | 2016-03-29 14:30 | 22M | |
| WeeklyWrapUp.wav | 2012-08-24 00:44 | 21M | |
| Waylon Bacon Promo.wav | 2014-09-17 01:09 | 11M | |
| Washing of the Water..> | 2012-03-21 21:24 | 39M | |
| Walk On The Wild Sid..> | 2009-10-17 16:53 | 47M | |
| Walk On By.wav | 2013-08-22 23:37 | 122M | |
| Wake Up 94.wav | 2013-07-22 00:30 | 41M | |
| WHY ARE YOU DRESSED ..> | 2014-01-06 14:42 | 500K | |
| Voivod - Warriors Of..> | 2016-05-17 14:56 | 51M | |
| Vince Scully 2.wav | 2013-10-19 12:51 | 738K | |
| Vince Scully.wav | 2013-10-19 12:49 | 1.3M | |
| Videotape 07.wav | 2013-07-13 20:26 | 47M | |
| Videodrone 2.wav | 2013-10-05 13:26 | 3.3M | |
| Videodrone 1.wav | 2013-10-05 13:23 | 2.9M | |
| Victim Of Love 81.wav | 2013-07-26 04:44 | 44M | |
| Valkyrja - The Crema..> | 2016-03-29 14:04 | 46M | |
| VM-Queue-dump-5.wav | 2011-09-27 12:15 | 4.9M | |
| VM-Queue-dump-4.wav | 2011-09-27 12:15 | 4.9M | |
| VM-Queue-dump-3.wav | 2011-09-27 12:14 | 4.9M | |
| VM-Queue-dump-2.wav | 2011-09-27 12:14 | 4.9M | |
| VM-Queue-dump-1.wav | 2011-09-27 12:14 | 4.9M | |
| VM-General-5.wav | 2011-09-27 12:13 | 2.9M | |
| VM-General-4.wav | 2011-09-27 12:13 | 2.9M | |
| VM-General-3.wav | 2011-09-27 12:13 | 2.9M | |
| VM-General-2.wav | 2011-09-27 12:13 | 2.9M | |
| VM-General-1.wav | 2011-09-27 12:12 | 2.9M | |
| VC010412.wav | 2012-01-04 21:26 | 21M | |
| Urban Chaos.wav | 2011-04-07 16:33 | 2.7M | |
| Unholy Lust Taste Th..> | 2016-05-03 16:39 | 38M | |
| Under My Wheels 71.wav | 2013-06-18 13:20 | 29M | |
| Ufo News 1.wav | 2016-05-03 16:06 | 1.6M | |
| USvSanta.wav | 2013-04-01 14:38 | 8.3M | |
| Tyson Ill eat your a..> | 2016-01-12 12:41 | 424K | |
| Two Janes 92.wav | 2013-07-22 00:25 | 39M | |
| Turn signal.wav | 2015-03-18 11:07 | 1.3M | |
| Tupelo Honey 71.wav | 2013-08-22 23:54 | 70M | |
| Trump intro 2.wav | 2016-04-05 15:07 | 1.6M | |
| Trump dont learn.wav | 2016-03-22 16:38 | 9.8M | |
| Trump Vigilant.wav | 2016-03-22 16:37 | 5.0M | |
| Trump The Joker.wav | 2016-04-19 16:14 | 4.4M | |
| Trump Muslims.wav | 2016-05-24 15:03 | 8.0M | |
| Trump Mexico 1.wav | 2016-05-17 14:40 | 3.4M | |
| Trump Mexico.wav | 2016-03-01 15:05 | 2.8M | |
| Trump Mexico (2).wav | 2016-05-17 15:09 | 2.8M | |
| Trump Mexicans Bring..> | 2016-03-01 15:19 | 1.1M | |
| Trump Intro.wav | 2016-04-05 15:04 | 6.6M | |
| Trump I didnt start ..> | 2016-05-17 15:13 | 5.0M | |
| Trump Good Reason.wav | 2016-05-31 14:37 | 5.9M | |
| Trump Bernie 2.wav | 2016-05-31 14:33 | 4.4M | |
| TrumpBernie 1.wav | 2016-05-31 14:30 | 3.4M | |
| Trump Abortion 2.wav | 2016-04-05 15:11 | 8.6M | |
| Trump 5.wav | 2016-04-05 15:20 | 6.9M | |
| Trump 4.wav | 2016-04-05 15:18 | 1.8M | |
| Trump.wav | 2016-03-01 15:01 | 2.5M | |
| True Religion 72.wav | 2013-07-13 01:54 | 48M | |
| Troll_Grumble.wav | 2000-06-13 05:47 | 55K | |
| Trash City 88.wav | 2013-07-13 19:25 | 42M | |
| Traffic on the 110.wav | 2015-03-18 11:19 | 5.6M | |
| Toronto Mayor Rob Fo..> | 2016-03-22 16:36 | 7.4M | |
| Took It All 04.wav | 2006-12-16 00:42 | 47M | |
| Took It All.wav | 2006-12-16 00:42 | 47M | |
| TonyTee-Interview-Cl..> | 2012-03-24 19:27 | 1.0G | |
| TonyTee-Interview-Cl..> | 2012-04-03 18:30 | 808M | |
| Tom Traubert's Blues..> | 2013-06-18 14:26 | 71M | |
| Titties Bounce by Gr..> | 2011-09-04 16:17 | 31M | |
| Tin Angel 12.wav | 2013-08-13 21:10 | 92M | |
| Three Speed 98.wav | 2013-07-21 23:51 | 28M | |
| This Woman's Work 89..> | 2013-06-20 13:44 | 37M | |
| This Will Be Our Yea..> | 2013-07-26 20:44 | 22M | |
| TherapyCable_promo.wav | 2014-07-07 22:08 | 6.4M | |
| Therapy Cable Promo.wav | 2014-07-07 22:08 | 6.4M | |
| Then She Did 90.wav | 2013-06-20 13:21 | 84M | |
| The day the music di..> | 2016-01-20 14:11 | 1.5M | |
| The_Weekly_Wrap_Up_1..> | 2012-04-08 16:00 | 595M | |
| The_Weekly_Wrap_Up_1..> | 2012-04-01 16:00 | 596M | |
| The_Weekly_Wrap_Up_1..> | 2012-03-25 16:00 | 595M | |
| The_Weekly_Wrap_Up_1..> | 2012-03-18 16:00 | 595M | |
| The_Weekly_Wrap_Up_1..> | 2012-03-11 16:00 | 1.5M | |
| The_Weekly_Wrap_Up_1..> | 2012-03-04 21:00 | 595M | |
| The_Qumran_Report_12..> | 2012-04-23 20:00 | 595M | |
| The_Qumran_Report_12..> | 2012-04-16 20:00 | 595M | |
| The_Qumran_Report_12..> | 2012-04-09 20:00 | 595M | |
| The_Qumran_Report_12..> | 2012-04-02 20:00 | 596M | |
| The_Qumran_Report_12..> | 2012-03-26 20:00 | 595M | |
| The_Qumran_Report_12..> | 2012-03-19 20:00 | 595M | |
| The_Qumran_Report_12..> | 2012-03-12 20:00 | 595M | |
| The_Qumran_Report_12..> | 2012-03-05 20:00 | 595M | |
| The_Love_Bite_120422..> | 2012-04-22 15:00 | 596M | |
| The_Love_Bite_120415..> | 2012-04-15 15:00 | 595M | |
| The_Love_Bite_120401..> | 2012-04-01 20:00 | 595M | |
| The_Love_Bite_120325..> | 2012-03-25 20:00 | 596M | |
| The_Love_Bite_120318..> | 2012-03-18 20:00 | 595M | |
| The_Love_Bite_120304..> | 2012-03-04 20:00 | 596M | |
| The_Jayk_Gallagher_P..> | 2012-03-15 19:00 | 1.2G | |
| The_Jayk_Gallagher_P..> | 2012-03-08 19:00 | 1.2G | |
| The_Call_Sheet_12042..> | 2012-04-21 20:00 | 595M | |
| The_Call_Sheet_12041..> | 2012-04-14 20:00 | 595M | |
| The_Call_Sheet_12040..> | 2012-04-07 20:00 | 595M | |
| The_Call_Sheet_12033..> | 2012-03-31 20:00 | 595M | |
| The_Call_Sheet_12032..> | 2012-03-24 20:00 | 595M | |
| The_Call_Sheet_12031..> | 2012-03-10 20:00 | 595M | |
| The_Adam_O_Podcast_1..> | 2012-04-17 20:00 | 596M | |
| The_Adam_O_Podcast_1..> | 2012-04-10 20:00 | 595M | |
| The_Adam_O_Podcast_1..> | 2012-04-03 20:00 | 595M | |
| The_Adam_O_Podcast_1..> | 2012-03-27 20:00 | 595M | |
| The_Adam_O_Podcast_1..> | 1969-12-31 23:00 | 595M | |
| The_Adam_O_Podcast_1..> | 2012-03-13 20:00 | 595M | |
| The_Adam_O_Podcast_1..> | 2012-03-06 20:00 | 595M | |
| The_Adam_O_Podcast_1..> | 2012-03-07 22:08 | 413M | |
| The Wind Cries Mary ..> | 2013-07-13 01:57 | 37M | |
| The Whip Appeal Talk..> | 2013-10-19 14:37 | 25M | |
| The Weekly Wrap Up s..> | 2013-01-09 16:44 | 20M | |
| The Way You Make Me ..> | 2013-05-31 17:25 | 55M | |
| The Very Manic Jimmy..> | 2013-09-09 18:58 | 5.8M | |
| The Snow Leopard 08.wav | 2013-06-14 16:42 | 52M | |
| The Skull Ron int 2.wav | 2016-01-26 14:26 | 35M | |
| The Skull Ron int 1.wav | 2016-01-26 14:19 | 28M | |
| The Shrine Destroyer..> | 2016-03-01 15:32 | 40M | |
| The Sarcastic News S..> | 2013-05-20 15:41 | 13M | |
| The Sadist.wav | 2016-02-22 14:33 | 4.3M | |
| The Rub PR Commercia..> | 2013-10-26 16:17 | 6.7M | |
| The Rub PR Commercia..> | 2013-10-26 16:02 | 4.8M | |
| The Rods - Power Lov..> | 2016-05-17 14:23 | 26M | |
| The Pretender 76.wav | 2013-06-14 18:57 | 53M | |
| The Obsessed - On th..> | 2016-05-17 14:48 | 50M | |
| The Matador and The ..> | 2014-01-04 19:07 | 70M | |
| The Master's Eyes 85..> | 2013-07-26 04:18 | 41M | |
| The Life Of An Entre..> | 2013-09-22 12:51 | 1.9M | |
| The Life Of An Entre..> | 2013-10-15 03:35 | 2.4M | |
| The Last Resort 76.wav | 2013-06-14 18:36 | 75M | |
| The Killing Type.wav | 2013-08-23 00:37 | 45M | |
| The Heart Of The Mat..> | 2013-06-18 18:00 | 54M | |
| The Healing Hour Int..> | 2013-10-01 19:41 | 2.7M | |
| The Healing Hour Int..> | 2013-09-03 20:06 | 2.1M | |
| The Healing Hour Int..> | 2013-06-25 20:23 | 10M | |
| The Healing Hour Int..> | 2013-06-25 20:23 | 10M | |
| The Healing Hour Int..> | 2013-06-25 19:11 | 11M | |
| The Ghost Of You Wal..> | 2013-09-01 22:13 | 37M | |
| The Germs Lexicon De..> | 2016-05-17 14:32 | 21M | |
| The Fool On The Hill..> | 2013-08-05 01:22 | 30M | |
| The Face Of Love 96.wav | 2013-06-18 14:01 | 111M | |
| The Devil 1.wav | 2016-03-15 15:18 | 2.7M | |
| The Day I Tried To L..> | 2013-07-26 03:40 | 54M | |
| The Dark Mark Show P..> | 2013-12-21 16:53 | 4.0M | |
| The Crystal Ship 67.wav | 2013-06-04 07:07 | 26M | |
| The Crystal Ship.wav | 2013-06-04 07:07 | 26M | |
| The Blower's Daughte..> | 2013-05-26 15:56 | 48M | |
| The Big Sky 85.wav | 2013-07-13 02:02 | 102M | |
| The Beast And Dragon..> | 2013-09-01 22:26 | 44M | |
| That's The Way God P..> | 2013-05-21 18:15 | 45M | |
| That's Entertainment..> | 2013-07-21 23:56 | 37M | |
| That's All You Need ..> | 2013-07-21 23:46 | 51M | |
| Terrorism Egypt Air.wav | 2016-05-24 15:27 | 3.3M | |
| Ted Cruz_ Trump a 's..> | 2016-03-29 13:34 | 19M | |
| Ted 1.wav | 2016-03-29 13:35 | 2.2M | |
| Teardrop 98.wav | 2013-07-26 01:57 | 56M | |
| Taliban Attack.wav | 2016-04-19 16:17 | 5.2M | |
| Take My Hand.wav | 2013-06-04 18:32 | 48M | |
| Take It Easy.wav | 2016-01-20 14:21 | 58M | |
| TWWUpromo12913..> | 2013-01-29 12:35 | 5.0M | |
| TWWUpromo11513..> | 2013-01-17 11:24 | 5.0M | |
| TWWUgh.wav | 2012-08-16 20:19 | 21M | |
| TWWUgenpromo.wav | 2013-01-07 09:32 | 5.0M | |
| TWWU2minclip.wav | 2012-11-28 11:39 | 20M | |
| TURNED WINE INTO FRI..> | 2014-01-03 21:08 | 930K | |
| TOURETTES TALK ABOUT..> | 2014-01-06 14:34 | 925K | |
| TOURETTES PIECE OF S..> | 2014-01-06 14:28 | 540K | |
| TOURETTES OH SHIT.wav | 2014-01-06 14:39 | 218K | |
| TOURETTES FUCK YOU.wav | 2014-01-06 14:35 | 132K | |
| TOURETTES FUCKED IN ..> | 2014-01-06 14:37 | 442K | |
| TOURETTES DICKS.wav | 2014-01-06 14:27 | 339K | |
| TOURETTES CHEWBACCA.wav | 2014-01-06 14:32 | 637K | |
| TOURETTES BOB SAGET.wav | 2014-01-06 14:39 | 276K | |
| TOURETTES BITCH I LO..> | 2014-01-06 14:31 | 523K | |
| TOURETTES BIGFOOT.wav | 2014-01-06 14:41 | 391K | |
| TOURETTES ASSHOLE.wav | 2014-01-06 14:31 | 178K | |
| TIME TO PLUG IN CURL..> | 2014-01-03 21:05 | 597K | |
| THEY'RE ALL GONNA LA..> | 2014-01-06 14:27 | 879K | |
| THERE'S NOTHING BETT..> | 2014-01-03 20:58 | 511K | |
| THE FUCKIN INTRO.wav | 2014-01-02 23:46 | 67M | |
| THANATOLOGY_ VERDUGO..> | 2016-02-02 10:15 | 13M | |
| TAKING MY BRA OFF.wav | 2014-01-03 21:06 | 597K | |
| Syria Move Chemical.wav | 2013-09-12 23:18 | 647K | |
| Syria Chemical 4.wav | 2013-08-24 22:46 | 1.6M | |
| Syria Chemical 3.wav | 2013-08-24 22:41 | 3.8M | |
| Syria Chemical 2.wav | 2013-08-24 22:38 | 1.4M | |
| Syria Chemical.wav | 2013-08-24 22:36 | 691K | |
| Syria Baseless.wav | 2013-09-07 10:41 | 2.6M | |
| Sweet Virginia 72.wav | 2013-07-26 00:30 | 45M | |
| Sweet Bump It - Savv..> | 2014-07-18 18:17 | 26M | |
| Sweet Bump It - Fury..> | 2014-07-18 18:23 | 25M | |
| Sweet Bump It - Daup..> | 2014-07-18 18:12 | 35M | |
| Swallowed By The Cra..> | 2013-07-26 04:53 | 43M | |
| Surprise, AZ 05.wav | 2013-07-13 19:13 | 37M | |
| Sunny Afternoon 66.wav | 2013-06-18 02:31 | 39M | |
| Sun C 79 74.wav | 2013-06-14 18:20 | 46M | |
| SummerZoundzMix.wav | 2012-07-27 09:15 | 835M | |
| Suck - Your edit.wav | 2016-06-07 16:21 | 36M | |
| Subhumans - Reason F..> | 2016-03-22 16:49 | 25M | |
| Stupidity.wav | 2013-08-10 11:13 | 1.2M | |
| Stunned 83.wav | 2013-07-26 03:54 | 39M | |
| Strawberry Fields Fo..> | 2013-07-23 01:03 | 42M | |
| Stop Your Fussin 88.wav | 2011-07-04 21:47 | 47M | |
| Still Alive.wav | 2012-03-01 19:50 | 41M | |
| Steeler Edit.wav | 2016-05-24 15:49 | 42M | |
| Steel And Glass.wav | 2013-08-07 00:29 | 47M | |
| Stay (Faraway, So Cl..> | 2013-08-13 20:28 | 50M | |
| Starsky and Hutch th..> | 2016-02-08 22:04 | 3.5M | |
| Starsky Hutch Satan.wav | 2016-02-08 21:58 | 2.5M | |
| Stardust Time.wav | 2013-09-30 23:21 | 36M | |
| Stained Glass.wav | 2013-09-30 23:19 | 31M | |
| Squeaky Idling Bus.wav | 2015-03-18 11:09 | 914K | |
| Spotlight On Books I..> | 2013-09-21 16:17 | 6.8M | |
| South Side 00.wav | 2012-01-17 02:22 | 39M | |
| Someone Keeps Moving..> | 2006-12-16 01:04 | 23M | |
| Someday 89.wav | 2013-06-20 13:58 | 58M | |
| Somebody's Leavin' 7..> | 2013-07-26 01:44 | 52M | |
| So inhuman The Sadis..> | 2016-02-22 14:29 | 1.6M | |
| Soilent Green 1.wav | 2013-09-28 18:50 | 2.6M | |
| So It Goes 78.wav | 2013-07-26 02:29 | 26M | |
| Small Town Moon 12.wav | 2013-09-01 22:10 | 33M | |
| Slow Girl.wav | 2013-09-30 23:17 | 37M | |
| Sleep Bandit.wav | 2016-06-07 15:50 | 3.2M | |
| Skidrow Warning.wav | 2013-09-22 09:21 | 3.0M | |
| Skidrow Studios Muth..> | 2013-05-29 16:00 | 6.8M | |
| Skidrow Studios Muth..> | 2013-05-29 16:02 | 6.8M | |
| Skidrow Studios Muth..> | 2013-05-29 15:58 | 6.7M | |
| Skidrow Studios Muth..> | 2013-05-29 16:03 | 6.7M | |
| Skidrow Radio Spot f..> | 2014-05-18 21:10 | 4.5M | |
| Skating Polly - Dead..> | 2014-01-15 14:10 | 37M | |
| Six Underground 96.wav | 2013-07-26 04:19 | 39M | |
| Sister Madly 88.wav | 2013-07-26 04:48 | 32M | |
| Sir Baltimore Intro.wav | 2016-03-08 13:05 | 1.7M | |
| Silly Thing 76.wav | 2013-09-01 14:57 | 29M | |
| Silence Track - 30 s..> | 2015-12-17 16:36 | 5.0M | |
| Silence Track - 6 se..> | 2013-06-25 20:15 | 1.0M | |
| Silence Track - 6 se..> | 2013-06-25 20:15 | 1.0M | |
| Silence Track - 3 se..> | 2013-01-22 04:29 | 517K | |
| Silence Track - 2.5 ..> | 2013-01-19 13:42 | 431K | |
| Shutdown.wav | 2000-06-13 05:47 | 70K | |
| Show Yourself 06.wav | 2013-08-19 20:41 | 30M | |
| Show Closing 1.wav | 2011-09-25 16:07 | 6.1M | |
| Show Active 1.wav | 2011-09-25 16:05 | 6.8M | |
| Show-Closing-5.wav | 2011-09-27 12:12 | 6.1M | |
| Show-Closing-4.wav | 2011-09-27 12:11 | 6.1M | |
| Show-Closing-3.wav | 2011-09-27 12:11 | 6.1M | |
| Show-Closing-2.wav | 2011-09-27 12:11 | 6.1M | |
| Show-Closing-1.wav | 2011-09-27 12:11 | 6.1M | |
| Show-Active-5.wav | 2011-09-27 12:10 | 6.8M | |
| Show-Active-4.wav | 2011-09-27 12:10 | 6.8M | |
| Show-Active-3.wav | 2011-09-27 12:09 | 6.8M | |
| Show-Active-2.wav | 2011-09-27 12:09 | 6.8M | |
| Show-Active-1.wav | 2011-09-27 12:09 | 6.8M | |
| She Don't Use Jelly ..> | 2013-06-04 18:36 | 37M | |
| She Don't Use Jelly.wav | 2013-06-04 18:36 | 37M | |
| She's Tight 82.wav | 2013-05-31 11:03 | 30M | |
| She's Tight.wav | 2013-05-31 11:03 | 30M | |
| She's Dead.wav | 2011-05-19 18:18 | 57M | |
| Sharron 4.wav | 2016-05-17 14:37 | 3.5M | |
| Sharron 3.wav | 2016-05-17 14:32 | 2.4M | |
| Sharron 2.wav | 2016-05-17 14:24 | 876K | |
| Sharron 1.wav | 2016-05-17 14:19 | 3.0M | |
| Sharon Osbourne open..> | 2016-05-17 14:28 | 7.0M | |
| Shakedown On 9th Str..> | 2013-07-26 03:26 | 29M | |
| Sexy_Time_Talk_12041..> | 2012-04-18 21:00 | 595M | |
| Sexuo - UFO CLUB (Cl..> | 2013-10-01 04:31 | 50M | |
| Sex Dwarf - Soft Cel..> | 2011-09-04 15:55 | 58M | |
| Seven Nation Army 03..> | 2013-08-28 00:24 | 39M | |
| Serial Hawk Lying In..> | 2016-03-19 20:24 | 39M | |
| Serial Hawk - Desola..> | 2016-03-19 20:39 | 93M | |
| Sept_28_2011-Pinata_..> | 2011-09-29 20:06 | 1.7G | |
| Sept_28_2011-Pinata_..> | 2011-09-29 20:09 | 1.7G | |
| Select Show Repeat.wav | 2011-09-25 16:04 | 1.9M | |
| Select-show-repeat.wav | 2011-09-27 12:02 | 1.9M | |
| Seed Of Wonder.wav | 2013-07-26 17:41 | 62M | |
| See How We Are (Demo..> | 2013-06-18 13:39 | 36M | |
| Screen-Intro-5.wav | 2011-09-27 12:16 | 1.7M | |
| Screen-Intro-4.wav | 2011-09-27 12:16 | 1.7M | |
| Screen-Intro-3.wav | 2011-09-27 12:16 | 1.7M | |
| Screen-Intro-2.wav | 2011-09-27 12:16 | 1.7M | |
| Screen-Intro-1.wav | 2011-09-27 12:16 | 1.7M | |
| Screen-Direct-5.wav | 2011-09-27 12:18 | 1.1M | |
| Screen-Direct-4.wav | 2011-09-27 12:18 | 1.1M | |
| Screen-Direct-3.wav | 2011-09-27 12:18 | 1.1M | |
| Screen-Direct-2.wav | 2011-09-27 12:17 | 1.1M | |
| Screen-Direct-1.wav | 2011-09-27 12:17 | 1.1M | |
| Scream Out Your Brea..> | 2011-05-19 18:18 | 41M | |
| Scoreboard Media Pro..> | 2013-09-21 15:16 | 8.6M | |
| Say No More.wav | 2013-06-04 18:33 | 20M | |
| Savoir Faire 80.wav | 2013-07-26 02:03 | 32M | |
| Save It For Later 82..> | 2013-08-05 00:10 | 36M | |
| Savages - Part 1_Mix..> | 2014-01-06 17:27 | 31M | |
| Savage Grace - The D..> | 2016-05-24 15:47 | 44M | |
| Satanic Lola Bumper.wav | 2011-04-07 16:34 | 2.9M | |
| Satanic Killed.wav | 2014-02-22 16:06 | 1.5M | |
| Satanic I had to kil..> | 2014-02-22 16:03 | 651K | |
| Satanic Cult.wav | 2014-02-22 16:01 | 1.2M | |
| Safe And Sound 02.wav | 2013-07-26 03:33 | 50M | |
| Sadist tast the dirt..> | 2016-02-22 14:47 | 3.0M | |
| SRS is the place to ..> | 2012-12-23 14:11 | 4.1M | |
| SRS background jazz.wav | 2012-12-23 14:11 | 19M | |
| SRS_012.WAV | 2012-01-13 18:18 | 276M | |
| SRS_010.WAV | 2011-08-20 15:13 | 100M | |
| SRS_009.WAV | 2011-10-08 17:34 | 25M | |
| SRS_008.WAV | 2011-10-08 17:08 | 675K | |
| SRS_007.WAV | 2011-09-11 16:06 | 201M | |
| SRS_006.WAV | 2011-09-11 15:04 | 313M | |
| SRS_005.WAV | 2011-09-11 13:08 | 148M | |
| SRS_004.WAV | 2011-09-11 12:25 | 112M | |
| SRS_003.WAV | 2011-09-11 12:05 | 181K | |
| SRS_002.WAV | 2011-09-11 12:05 | 59M | |
| SRS_001.WAV | 2011-07-01 00:12 | 1.5G | |
| SO SORE I CAN BARELY..> | 2014-01-03 20:59 | 787K | |
| SANTANA BAND NAME.wav | 2014-01-06 14:24 | 2.6M | |
| S.W.A.G.Talk_Intro.wav | 2015-02-05 15:28 | 19M | |
| S.W.A.G.Talk Intro.wav | 2015-02-05 15:28 | 19M | |
| S.W.A.G. Talk Intro.wav | 2015-02-04 20:38 | 19M | |
| RunningwithNeedlesLo..> | 2012-10-19 01:30 | 47M | |
| RunningwithNeedles.wav | 2012-10-19 01:30 | 47M | |
| Running The World 07..> | 2013-07-21 23:58 | 48M | |
| Run That Body Down 7..> | 2013-07-26 02:40 | 39M | |
| Royal_Blood_Mix_01.wav | 2014-01-08 20:49 | 36M | |
| Rocket Fuel Sex Magi..> | 2011-05-04 21:37 | 96M | |
| River Man.wav | 2012-01-15 23:41 | 44M | |
| Ritual - come to th..> | 2016-04-12 16:38 | 39M | |
| Ritual - Soldiers Un..> | 2016-04-12 16:36 | 36M | |
| Ritual(Bel) - Last N..> | 2016-04-12 16:39 | 29M | |
| Right Hand Man 95.wav | 2013-06-04 18:40 | 51M | |
| Right Hand Man.wav | 2013-06-04 18:40 | 51M | |
| Rich Man.wav | 2012-10-26 00:25 | 46M | |
| Revelator 01.wav | 2013-06-25 18:05 | 64M | |
| Resist And Exist - I..> | 2016-03-22 16:57 | 67M | |
| Redemption Song 80.wav | 2013-09-01 14:26 | 39M | |
| Red Red Red 05.wav | 2013-07-13 01:45 | 45M | |
| Realtor_Commercial.wav | 2012-03-04 17:17 | 130M | |
| RealEstate_Commercia..> | 2012-03-06 19:56 | 8.1M | |
| Rain 66.wav | 2013-06-21 12:26 | 31M | |
| Radio Nowhere 07.wav | 2013-07-13 01:41 | 33M | |
| R^3 dropz_1#29.wav | 2015-03-20 12:00 | 2.6M | |
| R^3 dropz_1#01-3.wav | 2015-04-08 10:15 | 5.6M | |
| R^3 dropz_1#01-2.wav | 2015-04-08 10:15 | 5.6M | |
| R^3 dropz_1#01-1.wav | 2015-04-08 10:15 | 5.6M | |
| RITUAL COMBAT - Terr..> | 2016-03-29 14:08 | 26M | |
| RETOX ID GOOF.wav | 2014-01-03 20:53 | 1.7M | |
| RETOX ID.wav | 2014-01-03 20:53 | 1.1M | |
| RAGfest-unprocessed.wav | 2012-03-20 10:20 | 3.2G | |
| R09_0010.WAV | 2012-01-12 19:12 | 1.3G | |
| R09_0009.WAV | 2011-12-30 19:51 | 1.5G | |
| R09_0008.WAV | 2011-12-27 08:50 | 385M | |
| R09_0007.WAV | 2011-10-01 08:53 | 83M | |
| R09_0006.WAV | 2011-10-01 08:24 | 62M | |
| R09_0005.WAV | 2011-12-26 16:20 | 202M | |
| R09_0004.WAV | 2011-12-26 15:53 | 157M | |
| R09_0003.WAV | 2011-12-26 14:57 | 156M | |
| R09_0002.WAV | 2012-01-26 22:10 | 37M | |
| Pussy Whip 1.wav | 2016-01-12 12:55 | 709K | |
| Pulling away.wav | 2015-03-18 11:23 | 744K | |
| Pullin' Back The Rei..> | 2013-06-20 13:40 | 45M | |
| Psychic Everyday Pro..> | 2013-05-20 16:02 | 11M | |
| Psychic Everyday Pro..> | 2013-05-16 02:15 | 5.9M | |
| Psych 1 On 1 Promo 1..> | 2013-05-15 15:11 | 12M | |
| Psych 1 On 1 Outro.wav | 2013-10-07 18:52 | 3.4M | |
| Psych 1 On 1 Intro.wav | 2013-10-07 18:48 | 4.9M | |
| Psych 1 On 1 - Chica..> | 2013-09-20 12:46 | 7.7M | |
| Power ball winner.wav | 2016-01-12 12:55 | 747K | |
| Possessed- Holy Hell..> | 2016-05-03 16:21 | 42M | |
| Poorman_Stickam_Call..> | 2012-01-29 15:53 | 95M | |
| Poorman_Stickam_Call..> | 2012-01-29 16:43 | 95M | |
| Political Science 72..> | 2013-07-13 20:28 | 20M | |
| Poison Teacher - 03-..> | 2011-03-04 00:38 | 632M | |
| Poison Teacher - 03-..> | 2011-03-03 23:44 | 632M | |
| Please Please Me.wav | 2013-09-30 23:23 | 41M | |
| Play On 74.wav | 2013-06-12 14:57 | 31M | |
| Pinata_Hour_120425_1..> | 2012-04-25 19:00 | 1.2G | |
| Pinata_Hour_120418_1..> | 2012-04-18 19:00 | 1.2G | |
| Pinata_Hour_120411_1..> | 2012-04-11 19:00 | 1.2G | |
| Pinata_Hour_120404_1..> | 2012-04-04 19:00 | 1.2G | |
| Pinata_Hour_120328_1..> | 2012-03-28 19:00 | 1.2G | |
| Pinata_Hour_120321_1..> | 2012-03-21 19:00 | 1.2G | |
| Pinata_Hour_120314_1..> | 2012-03-14 19:00 | 1.2G | |
| Pinata_Hour_120307_1..> | 2012-03-07 19:00 | 1.2G | |
| Phil Apology 2.wav | 2016-02-08 21:45 | 2.9M | |
| Phil A White P.wav | 2016-02-02 10:04 | 7.7M | |
| Phil A Racist Shirt.wav | 2016-02-02 10:06 | 5.1M | |
| Phantasm Now you die..> | 2016-01-12 12:43 | 844K | |
| Perfect Circle 83.wav | 2013-07-13 20:23 | 35M | |
| Paul_Kengor.wav | 2012-04-18 18:19 | 285M | |
| Passing By 01.wav | 2013-06-30 02:07 | 67M | |
| Passenger chatter an..> | 2015-03-18 11:08 | 2.4M | |
| Passenger chatter En..> | 2015-03-18 11:17 | 4.3M | |
| Pared_De_Muerte Edit..> | 2016-05-17 15:10 | 22M | |
| PVT SEPTEMBER MIX.wav | 2011-10-12 11:52 | 572M | |
| PORN AGAIN-Podcast O..> | 2016-02-19 01:59 | 4.0M | |
| PORN AGAIN-Podcast I..> | 2016-02-19 02:00 | 6.9M | |
| PLAY IT AGAIN DAN.wav | 2014-01-03 21:00 | 207K | |
| Ozzy Osbourne - Mama..> | 2016-05-17 15:08 | 42M | |
| Ozzy No Sex.wav | 2016-05-17 14:22 | 2.2M | |
| Over The Mountain ed..> | 2016-05-17 14:21 | 45M | |
| Over The Hills And F..> | 2013-07-26 01:41 | 49M | |
| OutgoingFile.wav | 2011-09-26 21:45 | 969M | |
| Out Of My Hands 97.wav | 2013-07-26 02:01 | 37M | |
| Our Way To Fall 00.wav | 2013-08-19 20:52 | 43M | |
| Orange G interview.wav | 2013-10-12 22:10 | 63M | |
| Orange G Jimmy Cabbs..> | 2013-10-12 22:12 | 369K | |
| Open Cries.wav | 2011-05-19 18:18 | 38M | |
| One Step Up 87.wav | 2013-07-26 04:41 | 48M | |
| One More Night (Your..> | 2013-07-26 03:43 | 54M | |
| One Man, Ten Thousan..> | 2013-09-30 23:18 | 44M | |
| One Day Late 04.wav | 2013-07-26 03:27 | 32M | |
| Onboard Quiet Bus Ge..> | 2015-03-18 11:05 | 8.1M | |
| On Older Bus BEST OF..> | 2015-03-18 11:16 | 3.6M | |
| Old Town 82.wav | 2013-08-05 00:25 | 35M | |
| Obama Minimum Wage.wav | 2013-10-05 13:16 | 1.1M | |
| Obama Gov Shut Down.wav | 2013-10-19 13:04 | 3.2M | |
| Obama 1.wav | 2013-09-06 19:58 | 4.3M | |
| OUTRO.wav | 2012-11-26 18:20 | 9.6M | |
| OH THAT WAS HARD.wav | 2014-01-03 21:00 | 264K | |
| Nube2.wav | 2013-01-24 11:58 | 40M | |
| Not For You 96.wav | 2013-07-26 02:43 | 59M | |
| Noctuary - Funeral C..> | 2016-03-08 15:48 | 33M | |
| Noctrurnal Graves Wh..> | 2016-05-24 15:30 | 46M | |
| No Small Children - ..> | 2014-02-03 18:51 | 38M | |
| No Self Control 80.wav | 2013-07-26 13:51 | 40M | |
| No-Response-Warning-..> | 2011-09-27 12:23 | 2.3M | |
| No-Response-Warning-..> | 2011-09-27 12:23 | 2.3M | |
| No-Response-Warning-..> | 2011-09-27 12:23 | 2.3M | |
| No-Response-Warning-..> | 2011-09-27 13:10 | 2.3M | |
| No-Response-Warning-..> | 2011-09-27 13:09 | 2.3M | |
| No-Response-Goodbye-..> | 2011-09-27 13:08 | 1.9M | |
| No-Response-Goodbye-..> | 2011-09-27 13:07 | 1.9M | |
| No-Response-Goodbye-..> | 2011-09-27 13:07 | 1.9M | |
| No-Response-Goodbye-..> | 2011-09-27 13:07 | 1.9M | |
| No-Response-Goodbye-..> | 2011-09-27 13:06 | 1.9M | |
| Night Stalker 2.wav | 2016-03-15 15:15 | 3.6M | |
| Night Stalker 1.wav | 2016-03-15 15:09 | 1.0M | |
| Night Gallery TV Int..> | 2016-02-16 13:15 | 5.3M | |
| Night Gallery TV Int..> | 2016-03-15 14:25 | 5.2M | |
| Nigga Payout.wav | 2013-09-06 18:37 | 3.6M | |
| New_Mat_Time_Radio_P..> | 2012-03-04 19:06 | 10M | |
| Never again Morley S..> | 2016-05-24 15:17 | 688K | |
| Never Be One.wav | 2013-04-24 12:00 | 41M | |
| Network Truth 1.wav | 2013-09-07 13:00 | 2.9M | |
| Network The Whole Wo..> | 2013-09-07 12:25 | 2.6M | |
| Nestorious_Public_Ra..> | 2013-05-20 16:02 | 11M | |
| Neighborhood Love Ra..> | 2013-12-26 21:24 | 5.4M | |
| Neighboorhood Fuck Y..> | 2014-01-11 13:51 | 774K | |
| Naval shooting 1.wav | 2013-09-28 17:57 | 1.4M | |
| Naval Shoot 2.wav | 2013-09-28 18:16 | 2.2M | |
| Nancy R 3.wav | 2016-03-08 15:23 | 3.7M | |
| Nancy R 2.wav | 2016-03-08 15:21 | 3.1M | |
| Nancy R 1.wav | 2016-03-08 15:19 | 19M | |
| Nancy Promo.wav | 2013-06-04 17:56 | 4.9M | |
| NOTHIN SENDS ME OFF ..> | 2014-01-03 21:01 | 747K | |
| NO STEVE CARELL.wav | 2014-01-06 14:21 | 500K | |
| NOOO.wav | 2014-01-06 14:22 | 218K | |
| NO NO NO.wav | 2014-01-06 14:20 | 270K | |
| NOMADS Bite Back edi..> | 2016-03-01 15:00 | 5.8M | |
| NO I AM NOT HIGH.wav | 2014-01-06 14:19 | 287K | |
| NECROPHAGIA(ELA) - B..> | 2016-04-05 16:02 | 60M | |
| NATO chief says it's..> | 2016-03-22 16:27 | 10M | |
| N.Y.C. 97.wav | 2013-07-26 03:42 | 37M | |
| My War (single) 02-0..> | 2013-01-14 18:13 | 40M | |
| My Ever Changing Moo..> | 2013-06-18 05:38 | 36M | |
| My Baby Just Cares f..> | 2013-06-06 08:21 | 37M | |
| My Baby Just Cares f..> | 2013-06-06 08:21 | 37M | |
| Mudslide 96.wav | 2013-07-26 16:48 | 36M | |
| Morley Safer whoop i..> | 2016-05-24 15:52 | 1.0M | |
| Morley Safer Pay.wav | 2016-05-24 15:17 | 906K | |
| Morley Safer.wav | 2016-05-24 15:14 | 5.4M | |
| More gay sex - Givin..> | 2016-04-05 15:34 | 3.1M | |
| MorMusic_Radio_Pod_1..> | 2012-04-26 22:00 | 1.2G | |
| MorMusic_Radio_Pod_1..> | 2012-04-12 22:00 | 1.2G | |
| MorMusic_Radio_Pod_1..> | 2012-04-05 22:00 | 1.2G | |
| MorMusic_Radio_Pod_1..> | 2012-03-22 22:00 | 1.2G | |
| MorMusic_Radio_Pod_1..> | 2012-03-15 22:00 | 1.2G | |
| MorMusic_Radio_Pod_1..> | 2012-03-08 22:00 | 1.2G | |
| MorMusic_Radio_Pod-E..> | 2012-04-14 17:59 | 1.0G | |
| MorMusic-Promo-1.wav | 2012-08-10 15:17 | 11M | |
| Modern World 05.wav | 2013-07-26 20:58 | 29M | |
| Misunderstanding 80.wav | 2013-05-31 17:17 | 33M | |
| Misunderstanding.wav | 2013-05-31 17:17 | 33M | |
| MistressC-bumper4.wav | 2013-10-22 14:30 | 2.4M | |
| MistressC-bumper3.wav | 2013-10-22 14:29 | 2.6M | |
| MistressC-bumper2.wav | 2013-10-22 14:29 | 2.6M | |
| MistressC-bumper1.wav | 2013-10-22 14:29 | 2.5M | |
| MistressC-4.wav | 2013-10-22 14:10 | 2.4M | |
| MistressC-4-old1.wav | 2013-10-22 12:39 | 2.4M | |
| MistressC-3.wav | 2013-10-22 14:10 | 2.6M | |
| MistressC-3-old1.wav | 2013-10-22 12:39 | 2.6M | |
| MistressC-2.wav | 2013-10-22 14:09 | 2.6M | |
| MistressC-2-old1.wav | 2013-10-22 12:39 | 2.6M | |
| MistressC-1.wav | 2013-10-22 12:38 | 2.5M | |
| Mistakes.wav | 2016-03-22 16:34 | 6.1M | |
| Midnight Radio 99.wav | 2011-10-27 11:57 | 54M | |
| Melvins - Bullhead -..> | 2016-05-17 14:53 | 42M | |
| Mega deth.wav | 2016-05-24 15:05 | 66M | |
| Medicus Graphics Cen..> | 2013-09-21 13:35 | 7.8M | |
| MechFootstep.wav | 2000-06-13 05:47 | 48K | |
| Me And Bobby McGee.wav | 2013-07-26 20:39 | 99M | |
| Mayor 1.wav | 2016-04-26 15:27 | 15M | |
| Maybe I'm Amazed 70.wav | 2013-09-01 15:29 | 39M | |
| May_5_2011-MorMusic_..> | 2011-05-06 03:25 | 1.1G | |
| May_5_2011-MorMusic_..> | 2011-05-06 03:48 | 1.1G | |
| Matter Of Pride 81.wav | 2013-07-26 04:10 | 33M | |
| Matte Kudasai 81.wav | 2013-07-26 01:33 | 38M | |
| Mat_Time_Radio_12042..> | 2012-04-22 18:00 | 595M | |
| Mat_Time_Radio_12041..> | 2012-04-15 18:00 | 595M | |
| Mat_Time_Radio_12040..> | 2012-04-01 18:00 | 595M | |
| Mat_Time_Radio_12032..> | 2012-03-25 18:00 | 595M | |
| Mat_Time_Radio_12031..> | 2012-03-18 18:00 | 595M | |
| Mat_Time_Radio_12031..> | 2012-03-11 18:00 | 595M | |
| Mat_Time_Radio_12030..> | 2012-03-04 18:00 | 595M | |
| Mat Time Radio Intro..> | 2012-01-22 14:28 | 49M | |
| Master and Servant -..> | 2011-09-04 16:02 | 42M | |
| Mask of Satan 3.wav | 2016-03-15 15:05 | 2.0M | |
| Mask of Satan 2.wav | 2016-03-15 15:01 | 3.3M | |
| Mask of Satan 1.wav | 2016-03-15 14:58 | 7.2M | |
| Marry Me 08.wav | 2013-07-26 03:53 | 38M | |
| Mario_Promo.wav | 2012-02-20 22:07 | 11M | |
| MarathonM Discomfort..> | 2013-09-07 13:13 | 917K | |
| Mantervention.wav | 2012-10-03 21:25 | 33M | |
| Mans Downfall.wav | 2013-08-09 15:14 | 3.6M | |
| Malice - New Breed O..> | 2016-05-03 16:16 | 55M | |
| Magic.wav | 2013-04-09 14:40 | 6.4M | |
| Machine.wav | 2000-06-13 05:47 | 43K | |
| MOSES WAS GOOD AT SP..> | 2014-01-03 21:09 | 810K | |
| MMRP-James_Quall.wav | 2011-08-19 08:36 | 1.0G | |
| MMRP-EPISODE_45.wav | 2012-04-07 05:51 | 1.0G | |
| MMM, BALLS.wav | 2014-01-03 21:02 | 253K | |
| METAL CHURCH - HITMA..> | 2016-05-31 16:01 | 16M | |
| MELT BANANA HERE'S D..> | 2014-01-03 20:54 | 648K | |
| MAYBE YOULL GET LUCK..> | 2014-01-06 14:19 | 442K | |
| MASTERS OF METAL - S..> | 2016-05-03 16:22 | 26M | |
| MALICE CAPTIVE OF TH..> | 2016-05-24 15:50 | 34M | |
| Lucy In The Sky With..> | 2013-09-09 23:21 | 35M | |
| Luck In My Eyes 89.wav | 2013-06-20 13:41 | 41M | |
| Loveless - Go 04.wav | 2013-07-26 01:49 | 38M | |
| Love Jesus.wav | 2016-01-20 14:54 | 1.2M | |
| Loud sitting bus.wav | 2015-03-18 11:10 | 2.1M | |
| Lost in LA MSTR.wav | 2013-05-23 14:41 | 36M | |
| Los Angeles Nista Pr..> | 2013-09-08 12:50 | 2.9M | |
| Longest Days 08.wav | 2013-08-07 00:29 | 32M | |
| Long Distance Love 7..> | 2013-06-05 07:37 | 27M | |
| Lonely is [As Lonely..> | 2013-07-26 04:57 | 41M | |
| Lonely is [As Lonely..> | 2013-07-26 04:57 | 41M | |
| Loan Me A Dime 69.wav | 2013-06-18 03:24 | 143M | |
| Living Proof 92.wav | 2013-07-21 23:08 | 49M | |
| Lightnin_Woodcock-Pr..> | 2012-01-30 23:10 | 25M | |
| Lifeless.wav | 2013-04-15 18:08 | 39M | |
| Life_Of_An_Entrepren..> | 2013-10-01 10:14 | 1.7M | |
| Life_Of_An_Entrepren..> | 2013-09-22 12:51 | 1.9M | |
| Life Of An Entrepren..> | 2013-10-01 10:14 | 1.7M | |
| Let Me Dream.wav | 2013-09-30 23:16 | 36M | |
| LeFrostandMoeShowInt..> | 2011-02-21 19:34 | 14M | |
| LeFrost and Moe Show..> | 2011-02-10 15:47 | 16M | |
| LeFrost&MoeShow_1.wav | 2011-02-16 16:02 | 14M | |
| LeFrost&MoeProduce2.wav | 2011-02-19 15:44 | 0 | |
| Lady Day 73.wav | 2009-10-17 16:58 | 40M | |
| La Riots 4.wav | 2016-04-26 15:46 | 5.8M | |
| La Riots 3.wav | 2016-04-26 15:43 | 7.5M | |
| La Riots 2.wav | 2016-04-26 15:39 | 7.9M | |
| La Riots 1.wav | 2016-04-26 15:34 | 9.6M | |
| Kreator - Riot of Vi..> | 2016-04-26 15:20 | 49M | |
| Knock Me Down.wav | 2013-07-26 18:09 | 37M | |
| Kingdom Come 80.wav | 2013-07-26 04:56 | 41M | |
| King Jury 2.wav | 2016-04-26 15:36 | 6.6M | |
| King Jury.wav | 2016-04-26 15:33 | 3.6M | |
| King.wav | 2016-04-26 15:17 | 9.1M | |
| Killing from a dista..> | 2016-05-25 12:25 | 4.5M | |
| Killer Zodiac.wav | 2016-03-01 15:11 | 4.9M | |
| Kill baby 1.wav | 2016-05-25 12:09 | 942K | |
| Kerry 4.wav | 2013-09-06 18:34 | 2.2M | |
| Kerry 3.wav | 2013-09-06 17:55 | 2.6M | |
| Kerry 2.wav | 2013-09-06 17:46 | 2.6M | |
| Kerry 1.wav | 2013-09-06 17:43 | 2.0M | |
| Kenya Shopping M Sho..> | 2013-09-28 18:47 | 549K | |
| Katy Perry -E.T..wav | 2011-08-28 14:54 | 38M | |
| Katon Crybaby.wav | 2016-02-22 14:23 | 5.1M | |
| KFTU_Sirius_Promo1.wav | 2012-08-24 10:46 | 5.1M | |
| Just Like Honey 85.wav | 2013-08-05 00:17 | 31M | |
| Jury Verdict questio..> | 2016-04-26 15:18 | 2.0M | |
| Jolie Louise 89.wav | 2013-07-26 04:51 | 27M | |
| Johnny Sunshine 93.wav | 2013-07-26 01:46 | 35M | |
| Johnny Appleseed 01.wav | 2013-06-24 16:35 | 41M | |
| Jew Bear Bastard.wav | 2016-02-16 13:21 | 14M | |
| Jesca Hoop - Seed Of..> | 2013-07-26 17:41 | 62M | |
| Jen Trynin - Knock M..> | 2013-07-26 18:09 | 37M | |
| Jem Motors Promo 1.wav | 2013-09-21 15:41 | 9.4M | |
| Jeannette Rizzi.wav | 2012-09-14 00:34 | 28M | |
| Jap attack 2.wav | 2013-10-12 16:36 | 1.3M | |
| JAP ATTACK.wav | 2013-10-12 16:26 | 2.3M | |
| It Never Rains 82.wav | 2013-08-05 00:03 | 88M | |
| It's Not So Hard 06.wav | 2006-10-28 22:44 | 29M | |
| Israel 1.wav | 2013-09-06 18:51 | 3.3M | |
| Invalid-Entry-Warnin..> | 2011-09-27 13:05 | 1.6M | |
| Invalid-Entry-Warnin..> | 2011-09-27 13:05 | 1.6M | |
| Invalid-Entry-Warnin..> | 2011-09-27 13:05 | 1.6M | |
| Invalid-Entry-Warnin..> | 2011-09-27 13:04 | 1.6M | |
| Invalid-Entry-Warnin..> | 2011-09-27 13:04 | 1.6M | |
| Invalid-Entry-Goodby..> | 2011-09-27 13:04 | 1.5M | |
| Invalid-Entry-Goodby..> | 2011-09-27 13:04 | 1.5M | |
| Invalid-Entry-Goodby..> | 2011-09-27 13:03 | 1.5M | |
| Invalid-Entry-Goodby..> | 2011-09-27 13:03 | 1.5M | |
| Invalid-Entry-Goodby..> | 2011-09-27 13:03 | 1.5M | |
| Invalid-Entry-5.wav | 2011-09-27 13:03 | 687K | |
| Invalid-Entry-4.wav | 2011-09-27 13:02 | 686K | |
| Invalid-Entry-3.wav | 2011-09-27 13:02 | 686K | |
| Invalid-Entry-2.wav | 2011-09-27 13:02 | 685K | |
| Invalid-Entry-1.wav | 2011-09-27 13:02 | 685K | |
| In the name of Satan..> | 2016-02-16 14:01 | 1.3M | |
| In the Name of Satan..> | 2016-04-12 15:56 | 1.0M | |
| Inmates (We're All C..> | 2013-06-18 13:27 | 51M | |
| Infamy Intro.wav | 2016-04-05 15:55 | 4.1M | |
| I killed.wav | 2016-03-29 14:27 | 3.0M | |
| If I Think Of Love.wav | 2013-08-06 23:24 | 38M | |
| Iconoclast The End.wav | 2016-03-22 16:51 | 18M | |
| Iconoclast After The..> | 2016-03-22 16:41 | 19M | |
| I can't hear you, it..> | 2016-03-15 14:43 | 1.5M | |
| I Wish I Was Your Mo..> | 2013-07-26 02:17 | 48M | |
| I Will See You In Fa..> | 2013-07-26 02:17 | 43M | |
| I Will.wav | 2013-09-09 23:37 | 18M | |
| I Want You Back 79.wav | 2013-07-13 01:52 | 36M | |
| I Still Haven't Foun..> | 2013-07-26 14:06 | 47M | |
| ISIS Claims Responsi..> | 2016-03-22 16:31 | 7.0M | |
| I SAW HER SUCKIN ON ..> | 2014-01-06 14:16 | 620K | |
| INTRO.wav | 2012-11-26 18:21 | 51M | |
| INCREDIBLE SEX DEATH..> | 2014-01-06 14:17 | 2.0M | |
| I Must Not Think Bad..> | 2013-07-26 04:29 | 42M | |
| I LIKE THE WAY THAT ..> | 2014-01-03 21:02 | 494K | |
| I LIKE A BIG POC.wav | 2014-01-03 21:03 | 494K | |
| I Know I'm Not Wrong..> | 2013-06-14 18:49 | 68M | |
| I Had To Let Go.wav | 2013-09-30 23:20 | 34M | |
| I Got You.wav | 2011-05-19 18:18 | 39M | |
| I GOTTA TAKE A PISS.wav | 2014-01-06 14:37 | 195K | |
| I Dont Blame You 03.wav | 2013-09-01 14:33 | 34M | |
| I DONT HAVE A DICK Y..> | 2014-01-06 14:37 | 345K | |
| I Believe In You 70.wav | 2013-07-13 20:16 | 35M | |
| I Ain't Going To Dra..> | 2013-07-26 04:34 | 44M | |
| I'm The Greatest 73.wav | 2008-02-10 19:43 | 34M | |
| I'm So Tired.wav | 2013-09-09 23:36 | 21M | |
| I'll KICK YOU IN THE..> | 2014-01-06 14:38 | 362K | |
| I'M NOT GONNA BE IGN..> | 2014-01-06 14:23 | 362K | |
| Hypnotized to death.wav | 2016-02-16 13:48 | 4.0M | |
| Husker Du broken hea..> | 2016-05-17 14:39 | 21M | |
| Hurt 94.wav | 2013-07-26 00:24 | 63M | |
| House of Wolves - Ro..> | 2014-01-08 19:49 | 36M | |
| Hot for teacher 2.wav | 2016-06-07 15:55 | 2.4M | |
| Hot for teacher 1.wav | 2016-06-07 15:45 | 7.8M | |
| Hot for Teacher 5.wav | 2016-06-07 16:01 | 6.6M | |
| Hot for Teacher 4.wav | 2016-06-07 15:37 | 6.2M | |
| Hot for Teacher 3.wav | 2016-06-07 15:58 | 2.7M | |
| Hotel California.wav | 2016-01-20 14:27 | 107M | |
| Hot Tuna - True Reli..> | 2013-07-13 01:54 | 48M | |
| Hostage Injustice.wav | 2016-05-24 15:54 | 670K | |
| HoneymoonSketchWave.wav | 2012-11-08 23:17 | 29M | |
| Hillside strangler n..> | 2016-03-08 15:35 | 1.1M | |
| Hillside strangler 2..> | 2016-03-08 15:38 | 1.7M | |
| Highway One 05.wav | 2013-07-13 01:44 | 33M | |
| Here To Love You 79.wav | 2013-07-26 14:36 | 41M | |
| Helloterrie.wav | 2014-03-20 19:25 | 9.4M | |
| Hellion - Backstabbe..> | 2016-05-24 15:55 | 36M | |
| Held Accountable.wav | 2013-08-17 13:54 | 3.1M | |
| Heavy Duty.wav | 2013-08-17 13:15 | 749K | |
| Heartattackackack.wav | 2013-03-30 14:19 | 11M | |
| Heart 81.wav | 2013-07-13 20:31 | 29M | |
| Healing Codes Spot.wav | 2013-08-15 21:08 | 5.7M | |
| Headlines Bumper.wav | 2012-11-02 01:04 | 1.1M | |
| He Is Risen 16COMP.wav | 2013-01-09 10:58 | 47M | |
| Hard Yards LA - Prom..> | 2013-09-09 19:10 | 5.0M | |
| Hard To See.wav | 2011-05-19 18:18 | 44M | |
| Half Light [Tail Cre..> | 2010-11-06 15:10 | 74M | |
| Half Light [Tail Cre..> | 2010-11-06 15:10 | 74M | |
| HOT JAMBALAYA.wav | 2014-01-06 14:13 | 213K | |
| HEY DANIEL D AND D.wav | 2014-01-06 14:13 | 454K | |
| GuestIntroMusic.wav | 2012-11-22 18:22 | 2.0M | |
| Green Light Intervie..> | 2011-03-05 02:58 | 298M | |
| Green Light Intervie..> | 2011-03-04 21:17 | 298M | |
| Grand_Theft_Audio_Ra..> | 2019-11-03 08:52 | 1.2G | |
| Grand_Theft_Audio_Ra..> | 2019-11-03 08:47 | 1.2G | |
| Grand_Theft_Audio_Ra..> | 2019-11-03 08:43 | 1.2G | |
| Grand_Theft_Audio_Ra..> | 2019-11-03 08:39 | 1.2G | |
| Grand_Theft_Audio_Ra..> | 2019-11-03 08:35 | 1.2G | |
| Grand_Theft_Audio_Ra..> | 2019-11-03 08:30 | 1.2G | |
| Grand_Theft_Audio_Ra..> | 2019-11-03 08:26 | 1.2G | |
| Grand_Theft_Audio_Ra..> | 2019-11-03 08:22 | 1.2G | |
| Grand_Theft_Audio_Ra..> | 2019-11-03 08:17 | 1.2G | |
| Gorilla 1.wav | 2016-05-31 14:39 | 3.6M | |
| Goodbye To Romance e..> | 2016-05-17 15:16 | 55M | |
| Good Day 96.wav | 2013-07-26 02:42 | 44M | |
| Going To My Home Tow..> | 2013-07-13 21:03 | 58M | |
| God's Song (That's W..> | 2013-06-30 01:37 | 38M | |
| Go 04.wav | 2013-07-26 01:49 | 38M | |
| Glassellalia 13.wav | 2013-06-18 13:31 | 82M | |
| Glad 70.wav | 2012-02-27 20:54 | 70M | |
| Give Me Back My Man ..> | 2013-05-31 11:03 | 41M | |
| Give Head - Dirty Sa..> | 2011-09-04 15:58 | 31M | |
| Girlfriend 91.wav | 2013-07-26 01:59 | 37M | |
| Get your paw off me.wav | 2016-04-26 15:40 | 2.3M | |
| Georgia Lee 99.wav | 2006-10-27 12:37 | 44M | |
| George etc..wav | 2000-08-08 18:31 | 57M | |
| Genesis 74.wav | 2013-06-04 21:16 | 48M | |
| Galeria Intro.wav | 2012-09-06 19:55 | 352M | |
| GOD LED ZEPPELIN.wav | 2014-01-06 14:12 | 1.6M | |
| Fuqua Law Center - e..> | 2014-04-07 02:25 | 9.1M | |
| Fucking Pay Me.wav | 2016-05-25 12:18 | 9.4M | |
| Fuck Mountain.wav | 2012-08-28 00:13 | 122M | |
| Frog Executioner.wav | 2016-01-20 15:02 | 7.4M | |
| FredoOrtiz.wav | 2014-01-29 14:29 | 290M | |
| Footlose Serpent of ..> | 2013-10-19 12:54 | 3.5M | |
| Flying High Again ED..> | 2016-05-17 14:59 | 47M | |
| Fishing.wav | 2012-08-29 16:25 | 34M | |
| Fishing-old1.wav | 2012-08-29 15:50 | 33M | |
| Fisherman's Blues 88..> | 2013-07-26 14:25 | 45M | |
| First Strike.wav | 2013-08-09 14:44 | 704K | |
| FingerSnap.wav | 2000-06-13 05:47 | 4.4K | |
| Fine Minds - Catch Y..> | 2014-04-28 16:57 | 25M | |
| Final Conflict - Con..> | 2016-03-22 16:48 | 30M | |
| File0023.WAV | 2012-03-21 02:54 | 1.6G | |
| File0022.WAV | 2012-03-21 02:21 | 595M | |
| File0021.WAV | 2012-03-21 02:08 | 595M | |
| File0020.WAV | 2012-03-21 01:56 | 595M | |
| File0019.WAV | 2012-03-21 01:43 | 606M | |
| File0018.WAV | 2012-03-21 01:30 | 595M | |
| File0017.WAV | 2012-03-21 01:18 | 81M | |
| File0016.WAV | 2012-03-21 01:16 | 69M | |
| File0015.WAV | 2012-03-21 01:15 | 464M | |
| File0014.WAV | 2012-03-21 01:05 | 1.0G | |
| File0013.WAV | 2012-03-21 00:44 | 1.6G | |
| File0012.WAV | 2012-03-21 00:10 | 595M | |
| File0011.WAV | 2012-03-20 23:55 | 595M | |
| File0010.WAV | 2012-03-20 23:43 | 177M | |
| File0009.WAV | 2012-03-20 23:39 | 1.0G | |
| File0008.WAV | 2012-03-20 23:18 | 1.5M | |
| File0007.WAV | 2012-03-20 23:18 | 706M | |
| File0006.WAV | 2012-03-20 23:03 | 544M | |
| File0005.WAV | 2012-03-20 22:51 | 595M | |
| File0004.WAV | 2012-03-20 22:39 | 595M | |
| File0003.WAV | 2012-03-20 22:26 | 120M | |
| File0002.WAV | 2012-03-20 22:24 | 595M | |
| File0001.WAV | 2012-03-20 22:11 | 1.2G | |
| Fidel Castro 1.wav | 2016-03-29 13:46 | 17M | |
| Fever Dog - Iroquois..> | 2014-06-09 14:17 | 24M | |
| Fast Food 94.wav | 2013-08-23 00:04 | 28M | |
| FAR AWAY STEM MIXXX ..> | 2011-12-28 17:18 | 30M | |
| Expresso Love 80.wav | 2013-07-13 19:23 | 57M | |
| Expect Everything As..> | 2013-09-12 23:07 | 2.4M | |
| Exorcist The Demon.wav | 2013-10-19 13:25 | 2.7M | |
| Exit Music (For A Fi..> | 2013-07-02 01:49 | 45M | |
| Exciter interview 1.wav | 2016-04-26 15:50 | 48M | |
| Exciter int 2.wav | 2016-04-26 15:54 | 69M | |
| Evil.wav | 2016-03-15 15:08 | 4.7M | |
| Everybody Hurts 93.wav | 2013-09-01 22:06 | 54M | |
| Ethylene 95.wav | 2013-06-04 18:39 | 41M | |
| Ethylene.wav | 2013-06-04 18:39 | 41M | |
| Erie Canal 06.wav | 2013-07-26 00:36 | 41M | |
| Episode_38-MMRP-Joe_..> | 2012-02-21 16:13 | 1.2G | |
| Episode_37-MMRP-Kool..> | 2012-02-10 07:11 | 1.0G | |
| Episode_35-MMRP-Bong..> | 2012-01-28 05:29 | 1.2G | |
| Episode_33-Pinata_Ho..> | 2012-02-09 03:13 | 1.2G | |
| Episode_14-The_Adam-..> | 2012-03-21 09:39 | 464M | |
| Episode_11-The_Adam-..> | 2012-02-12 15:50 | 459M | |
| Episode_4-Ham_On_Eve..> | 2012-02-08 04:24 | 1.1G | |
| Episode_3-Chickster_..> | 2012-02-04 21:35 | 518M | |
| Episode_3-Chickster_..> | 2012-02-04 19:25 | 518M | |
| Episode_3-Chickster_..> | 2012-02-04 19:15 | 522M | |
| Episode_2-The_Jayk_G..> | 2012-02-10 09:24 | 1.6G | |
| Episode_2-Chicksters..> | 2012-01-28 17:35 | 582M | |
| End Of A Cycle.wav | 2011-10-02 23:21 | 27M | |
| Electro Magnetic Wav..> | 2013-09-28 18:21 | 1.3M | |
| Egypt Air Missing.wav | 2016-05-24 14:54 | 4.9M | |
| Eeeooop.wav | 2000-06-13 05:47 | 18K | |
| EXCELLENT.wav | 2014-01-06 14:11 | 373K | |
| ENGRAVE - Minister_s..> | 2016-05-03 16:46 | 53M | |
| ENGRAVE - Minister´..> | 2016-05-03 16:46 | 53M | |
| Dry 93.wav | 2013-07-26 03:13 | 37M | |
| DrumTech(3-stolen).wav | 2015-05-15 23:13 | 6.8M | |
| Drifting Apart.wav | 2013-09-30 23:19 | 34M | |
| Doors Opening.wav | 2015-03-18 11:18 | 309K | |
| DoorClose.wav | 2000-06-13 05:47 | 19K | |
| Doom natural abuse E..> | 2016-05-31 14:25 | 17M | |
| Dont fuck with me.wav | 2016-01-12 12:41 | 2.5M | |
| Donald Coward.wav | 2016-03-29 13:35 | 316K | |
| Donald Coward (3).wav | 2016-03-29 13:37 | 316K | |
| Donald Coward (2).wav | 2016-03-29 13:36 | 316K | |
| Don't You Worry 'Bou..> | 2013-06-14 19:43 | 48M | |
| Don't Leave 96.wav | 2013-07-26 01:08 | 40M | |
| Doink.wav | 2000-06-13 05:47 | 14K | |
| Doctor Blind 06.wav | 2013-07-13 19:32 | 40M | |
| Dirge 99.wav | 2013-06-30 01:30 | 63M | |
| Die You Bastard - Mo..> | 2016-03-22 16:33 | 44M | |
| Devils reign.wav | 2016-02-08 22:25 | 10M | |
| Devils R 2.wav | 2016-03-29 14:06 | 9.6M | |
| Devils R 1.wav | 2016-03-29 14:01 | 7.4M | |
| Despise You - All Yo..> | 2016-02-02 10:13 | 19M | |
| Desperados Under The..> | 2013-06-18 15:25 | 53M | |
| Descendents - Suburb..> | 2016-05-17 14:26 | 17M | |
| Dear Prudence.wav | 2013-09-09 23:35 | 39M | |
| Dead Man Walkin' 96.wav | 2013-07-02 01:16 | 28M | |
| Dead Kennedys - Too ..> | 2016-05-17 14:34 | 27M | |
| Dead Behind The Eyes..> | 2016-03-29 14:19 | 31M | |
| Days Of Rain 05.wav | 2013-06-14 16:33 | 51M | |
| Dark Knight hospital..> | 2016-05-25 12:33 | 9.8M | |
| Dark Hole Review.wav | 2012-08-28 01:20 | 122M | |
| Dangerously Sleezy -..> | 2014-09-17 14:34 | 27M | |
| Dale Homeboy quote.wav | 2016-03-01 15:24 | 1.3M | |
| Dagos - Dinosaurs R ..> | 2014-01-26 12:22 | 40M | |
| DAN WHY DON'T YOU LO..> | 2014-01-03 21:04 | 448K | |
| DANIEL WATCH OUT HE'..> | 2014-01-06 14:42 | 620K | |
| DANIEL THE WHOLE TIM..> | 2014-01-06 14:25 | 1.5M | |
| DAN FACT - PANDAS.wav | 2014-01-03 21:11 | 1.4M | |
| DAN FACT - NICKLES.wav | 2014-01-03 21:14 | 649K | |
| DAN FACT - CLINT EAS..> | 2014-01-03 21:13 | 1.4M | |
| DAN FACT - BASS PLAY..> | 2014-01-03 21:12 | 856K | |
| DAN'S BALLS.wav | 2014-01-03 20:57 | 373K | |
| Cutty Flam - Sugga S..> | 2014-02-09 18:47 | 61M | |
| Cutty Flam - See Me ..> | 2014-02-09 19:47 | 36M | |
| Cutty Flam - Robot H..> | 2014-02-09 18:48 | 55M | |
| Cutty Flam - Hubba B..> | 2014-02-09 19:48 | 51M | |
| Cutty Flam - Holy No..> | 2014-02-09 18:48 | 52M | |
| Cutty Flam -Do You W..> | 2014-02-09 18:47 | 36M | |
| Cry Wolf 94.wav | 2013-06-15 09:38 | 55M | |
| Cry Baby Cry.wav | 2013-09-09 23:41 | 31M | |
| Crucifix - Annihilat..> | 2016-03-22 16:44 | 15M | |
| Crom 1.wav | 2016-03-19 20:16 | 4.9M | |
| Criminal Hygiene - W..> | 2013-11-22 02:27 | 39M | |
| Criminal Hygiene - S..> | 2013-11-22 02:26 | 21M | |
| Criminal Hygiene - R..> | 2014-01-26 12:08 | 21M | |
| Criminal Hygiene - B..> | 2013-11-22 02:27 | 36M | |
| Cosmia 06.wav | 2013-09-01 15:02 | 74M | |
| Corporate Mumbo Jumb..> | 2012-09-17 19:51 | 34M | |
| Cool Water_9412.wav | 2014-01-04 19:12 | 32M | |
| Conflict - As Others..> | 2016-03-22 16:46 | 18M | |
| ConfessionsIntro.wav | 2012-11-16 01:50 | 2.0M | |
| Conan Strength.wav | 2016-03-19 20:32 | 2.2M | |
| Conan Steel.wav | 2016-03-19 20:26 | 4.2M | |
| Conan SKid Row.wav | 2013-10-03 18:51 | 26M | |
| Conan SKid Row (2).wav | 2013-10-03 18:51 | 26M | |
| Combined.wav | 2012-04-20 21:37 | 5.0M | |
| Coma Girl 03.wav | 2013-07-22 00:01 | 38M | |
| Colors promo.wav | 2016-01-20 15:00 | 2.5M | |
| Color_Red.wav | 2012-01-29 14:51 | 42M | |
| Color_Red-processed.wav | 2012-01-29 15:03 | 42M | |
| Colonial Man.WAV | 2011-08-04 07:56 | 82M | |
| Coffin Texts - The S..> | 2016-05-03 16:42 | 67M | |
| Coffin Texts - Reven..> | 2016-05-03 16:47 | 30M | |
| Coffin Texts - Final..> | 2016-04-12 16:44 | 50M | |
| Coffin Texts - Final..> | 2016-05-03 16:35 | 48M | |
| Coffin Texts - Ether..> | 2016-05-03 16:32 | 47M | |
| Cocktails with Kimbe..> | 2013-10-26 15:55 | 4.9M | |
| CocktailIntro.wav | 2013-10-26 15:55 | 4.9M | |
| Coach Miller Rap Thi..> | 2013-09-21 14:42 | 9.4M | |
| Coach Miller Rap Sec..> | 2013-09-21 14:41 | 4.8M | |
| Coach Miller Rap Fou..> | 2013-09-21 14:38 | 10M | |
| Coach Miller Rap Fir..> | 2013-09-21 14:48 | 6.8M | |
| Clones (We're All) 8..> | 2013-06-18 13:29 | 31M | |
| CliffYates.wav | 2012-10-03 22:14 | 20M | |
| Cliff Memorial.wav | 2013-09-28 18:25 | 7.5M | |
| Classical Bumper.wav | 2011-04-07 16:34 | 4.0M | |
| Cindy Hit 2.WAV | 2011-03-02 21:37 | 2.8M | |
| Cindy Hit 1.WAV | 2011-03-02 21:37 | 4.4M | |
| Church Of Misery - C..> | 2016-03-01 15:13 | 52M | |
| Christ the Witch - F..> | 2016-02-16 13:53 | 54M | |
| Ching Chong Bumper.wav | 2011-04-07 16:34 | 2.5M | |
| Chicksters_Nest_1204..> | 2019-11-03 07:09 | 595M | |
| Chicksters_Nest_1204..> | 2019-11-03 07:06 | 595M | |
| Chicksters_Nest_1203..> | 2012-03-31 11:00 | 596M | |
| Chicksters_Nest_1203..> | 2012-03-24 11:00 | 595M | |
| Chicksters_Nest_1203..> | 2012-03-10 11:00 | 595M | |
| Chicago School of Ps..> | 2013-09-20 12:46 | 7.7M | |
| Chicago Gun V 2.wav | 2013-09-28 18:09 | 1.6M | |
| Chicago Gun V.wav | 2013-09-28 18:04 | 1.8M | |
| Chemical Attack.wav | 2016-04-19 16:19 | 2.4M | |
| Cheech and Chong - M..> | 2011-03-04 19:17 | 13M | |
| Cheech and Chong - M..> | 2011-03-04 19:18 | 13M | |
| Chatty Chinese Passe..> | 2015-03-18 11:01 | 4.3M | |
| Charlie winning.wav | 2016-05-31 14:53 | 845K | |
| Charlie Sheen 1.wav | 2016-05-31 14:52 | 7.4M | |
| Charlie Sheen - Winn..> | 2011-03-03 01:25 | 129K | |
| Charlie Sheen - Winn..> | 2011-03-03 01:26 | 129K | |
| Charcoal_Designs-1.wav | 2011-04-23 13:49 | 6.8M | |
| Charcoal_Designs-1.o..> | 2011-04-23 13:50 | 6.8M | |
| Champaign and shit.wav | 2016-03-01 14:58 | 6.7M | |
| Censor_B-Josh-1221.wav | 2005-01-25 22:05 | 10K | |
| Cat People [Putting ..> | 2013-07-02 01:24 | 68M | |
| Castles Made Of Sand..> | 2013-07-13 01:58 | 28M | |
| Care Of Cell 44 [Mon..> | 2013-07-26 20:45 | 40M | |
| Capital shooting 2.wav | 2013-10-05 14:09 | 1.2M | |
| Capital Shooting 1.wav | 2013-10-05 14:01 | 3.1M | |
| Candy 96.wav | 2013-07-26 01:54 | 51M | |
| Cancer Of Everything..> | 2013-06-15 09:40 | 44M | |
| Cameron_ 'We will ne..> | 2016-03-22 16:29 | 5.3M | |
| Cal Worthington.wav | 2013-09-12 23:22 | 1.4M | |
| CMON DANIEL ROLL THE..> | 2014-01-06 14:12 | 287K | |
| CB Radio Two Level T..> | 2007-05-14 19:06 | 869K | |
| CB Radio Loud Tone.wav | 2007-05-14 18:44 | 431K | |
| C'est Le Vent, Betty..> | 2012-01-17 08:51 | 43M | |
| Bweep.wav | 2000-06-13 05:47 | 14K | |
| Bus Itself BEST OF T..> | 2015-03-18 11:22 | 11M | |
| Bubbles.wav | 2000-06-13 05:47 | 16K | |
| Brussels attacks.wav | 2016-03-22 16:21 | 8.9M | |
| Brujeria - Viva Pres..> | 2016-05-17 15:01 | 36M | |
| Brujeria - Matando G..> | 2016-05-17 14:46 | 24M | |
| Brujeria - Colas De ..> | 2016-05-17 14:57 | 15M | |
| Bowie farwell.wav | 2016-01-12 12:58 | 589K | |
| Bowie death announce..> | 2016-01-12 12:55 | 1.4M | |
| Both Ends Burning 75..> | 2013-07-26 03:25 | 53M | |
| Boss Nigger Hunt.wav | 2016-03-01 14:57 | 1.0M | |
| Boom.wav | 2000-06-13 05:47 | 24K | |
| Boogie_By_The_River-..> | 2012-02-11 14:06 | 15M | |
| Boing.wav | 2000-06-13 05:47 | 15K | |
| Bodhisattva 73.wav | 2013-06-14 19:34 | 54M | |
| Blvd Nights cholos.wav | 2016-01-20 14:58 | 1.5M | |
| Blvd Gold.wav | 2016-01-20 14:49 | 4.0M | |
| Blame It On Ginger W..> | 2014-01-23 16:27 | 9.9M | |
| Blame It On Ginger T..> | 2014-01-23 16:35 | 7.8M | |
| Blame It On Ginger T..> | 2014-01-23 16:38 | 7.9M | |
| Blame It On Ginger P..> | 2014-01-23 16:54 | 16M | |
| Blame It On Ginger M..> | 2014-01-25 21:31 | 6.8M | |
| Blame It On Ginger F..> | 2014-01-25 21:33 | 7.3M | |
| Blame It On Ginger A..> | 2014-01-23 16:23 | 2.6M | |
| Blame It On Ginger A..> | 2014-01-23 16:15 | 11M | |
| Blame It On Ginger -..> | 2014-02-11 15:41 | 12M | |
| Blame It On Ginger -..> | 2014-02-10 15:50 | 10M | |
| Blame Game 10.wav | 2013-07-26 01:31 | 79M | |
| Blackbird.wav | 2013-09-09 23:37 | 23M | |
| Black Witchery - Uph..> | 2016-02-08 22:01 | 40M | |
| Black Hole Sun 94.wav | 2013-09-01 22:23 | 54M | |
| Black Flag NErvous.wav | 2016-03-01 15:23 | 21M | |
| Black Cobra - Obsole..> | 2016-05-24 15:02 | 27M | |
| Blaak Heat Shujaa Li..> | 2014-01-31 11:27 | 2.1M | |
| Birds 70.wav | 2013-07-13 20:16 | 26M | |
| Bill Halley and The ..> | 2016-03-15 15:15 | 23M | |
| Bill Halley and The ..> | 2016-03-15 15:15 | 23M | |
| Bill Haley and Comet..> | 2016-03-15 15:07 | 28M | |
| Big Empty 94.wav | 2013-07-26 03:49 | 50M | |
| Bible Study Outro.wav | 2015-07-26 18:00 | 17M | |
| Bible Study Intro.wav | 2015-07-26 17:59 | 10M | |
| Bernie Fighting.wav | 2016-06-07 15:18 | 1.2M | |
| Beep.wav | 2000-06-13 05:47 | 2.1K | |
| Beastie Boys - Holy ..> | 2016-05-24 16:01 | 13M | |
| Battalion Of Saints ..> | 2016-03-01 15:03 | 17M | |
| Bathsheba Smiles 99.wav | 2013-08-05 00:27 | 39M | |
| Barbara's Runnin Her..> | 2013-01-09 10:48 | 46M | |
| Bant that pussy.wav | 2016-01-12 12:55 | 1.3M | |
| Ballad Of Dwight Fry..> | 2013-06-18 13:18 | 66M | |
| Bad_Advice_120421_14..> | 2019-11-03 06:08 | 595M | |
| Bad Monkey.wav | 2016-05-31 14:27 | 2.0M | |
| Bad Dreams Dig_MSTR2..> | 2011-09-14 20:51 | 42M | |
| Baby on Board.wav | 2015-03-18 11:06 | 3.1M | |
| BLR_04.06.12-PODCAST..> | 2019-11-03 07:04 | 270M | |
| BITCH LIVE FOR THE W..> | 2016-05-24 15:54 | 53M | |
| BETTER GET SOME MAYO..> | 2014-01-03 21:04 | 505K | |
| BADADVICE2MINCLIP.wav | 2013-01-16 20:23 | 24M | |
| Aztlan Underground -..> | 2016-03-22 16:35 | 26M | |
| Autumn Valentine.wav | 2013-09-30 23:20 | 37M | |
| Aural Love or Lust.wav | 2013-02-18 19:10 | 1.6M | |
| At The Zoo 68.wav | 2013-07-26 03:36 | 26M | |
| At A Bus Stop.wav | 2015-03-18 11:20 | 2.7M | |
| As You Go Down.wav | 2011-05-19 18:18 | 36M | |
| Armored Saint Lesson..> | 2016-05-24 15:41 | 31M | |
| Ariel Death 2.wav | 2013-09-06 11:57 | 1.3M | |
| Are you Deaf.wav | 2016-03-15 14:37 | 5.5M | |
| Apr_14_2011-MorMusic..> | 2011-04-15 02:16 | 1.4G | |
| Apr_14_2011-MorMusic..> | 2011-04-15 02:45 | 1.4G | |
| Applause (short).wav | 2009-03-09 14:14 | 1.4M | |
| Apocalypse - War and..> | 2016-03-22 16:54 | 47M | |
| Another World 08.wav | 2013-07-26 21:08 | 44M | |
| Anna Ballerina.wav | 2013-09-30 23:19 | 40M | |
| Anesthetic Frank - H..> | 2013-01-09 09:58 | 47M | |
| And She Was 85.wav | 2013-08-15 20:24 | 37M | |
| American Sharks - Ov..> | 2014-05-26 12:58 | 20M | |
| American Filth.wav | 2016-03-29 14:16 | 35M | |
| Always With Me, Alwa..> | 2013-06-20 13:32 | 34M | |
| Alone Again Or 67.wav | 2013-07-22 00:28 | 33M | |
| Alma Mater 72.wav | 2013-06-18 13:24 | 45M | |
| Allah.wav | 2013-09-06 11:49 | 439K | |
| All My Pain.wav | 2011-05-19 18:18 | 40M | |
| Agent Steel - Unstop..> | 2016-05-03 16:13 | 39M | |
| Afganistan edit.wav | 2016-05-24 14:48 | 7.0M | |
| Adam-O-Promo.wav | 2019-11-03 05:21 | 4.8M | |
| Accidents Will Happe..> | 2012-04-19 00:45 | 35M | |
| Accidents Will Happe..> | 2012-04-19 00:45 | 35M | |
| A Wedding In Cheroke..> | 2012-05-17 22:21 | 32M | |
| A Wall 3.wav | 2016-06-07 15:33 | 951K | |
| A Wall 2.wav | 2016-06-07 15:24 | 2.6M | |
| A Wall.wav | 2016-06-07 15:19 | 3.4M | |
| A Sanders.wav | 2016-06-07 15:40 | 8.9M | |
| A Salty Dog 69.wav | 2013-07-16 01:06 | 47M | |
| A Really Good Time 7..> | 2013-08-15 20:24 | 38M | |
| ANSWER THE PHONE.wav | 2014-01-06 14:36 | 660K | |
| A Mexicans guns.wav | 2016-06-07 15:31 | 3.5M | |
| A Matter Of Pride 81..> | 2013-06-18 02:46 | 33M | |
| A Loser.wav | 2016-06-07 15:41 | 2.4M | |
| AJ_Jacobs.wav | 2019-11-03 05:22 | 444M | |
| A Good Idea 92.wav | 2013-07-26 03:50 | 38M | |
| @eaDir/ | 2019-11-12 14:18 | - | |
| 6367959105-0606-1913..> | 2004-06-06 20:23 | 13K | |
| 1450404802-935704806..> | 2015-12-17 18:14 | 34K | |
| 160615_231543_WPR001..> | 2016-06-16 00:15 | 481K | |
| 160514_112113_WPR001..> | 2016-05-14 12:21 | 1.4G | |
| 160424_152724_WPR001..> | 2016-04-24 16:27 | 673K | |
| 160413_210253_WPR001..> | 2016-04-13 22:02 | 889K | |
| 160413_210221_WPR001..> | 2016-04-13 22:02 | 481K | |
| 160413_205829_WPR001..> | 2016-04-13 21:58 | 29M | |
| 160220_140209_WPR001..> | 2016-02-20 14:02 | 577K | |
| 160130_234240_WPR001..> | 2016-01-30 23:42 | 1.1M | |
| 160126_175741_WPR001..> | 2016-01-26 17:57 | 567M | |
| 160126_170111_WPR001..> | 2016-01-26 17:01 | 570M | |
| 160122_195743_WPR001..> | 2016-01-22 19:57 | 1.3G | |
| 160113_201441_WPR001..> | 2016-01-13 20:14 | 1.4M | |
| 160113_201404_WPR001..> | 2016-01-13 20:14 | 2.3M | |
| 160113_120416_WPR001..> | 2016-01-13 12:04 | 1.9M | |
| 160112_181837_WPR001..> | 2016-01-12 18:18 | 338M | |
| 160107_084715_WPR001..> | 2016-01-07 08:47 | 1.3G | |
| 160107_052447_WPR001..> | 2016-01-07 05:24 | 2.0G | |
| 160107_020216_WPR001..> | 2016-01-07 02:02 | 2.0G | |
| 160106_223945_WPR001..> | 2016-01-06 22:39 | 2.0G | |
| 160106_223316_WPR001..> | 2016-01-06 22:33 | 15M | |
| 151218_192052_WPR001..> | 2015-12-18 19:20 | 1.4G | |
| 151217_165433_WPR001..> | 2015-12-17 16:54 | 841K | |
| 151217_165423_WPR001..> | 2015-12-17 16:54 | 1.2M | |
| 151116_165938_WPR001..> | 2015-11-16 16:59 | 89M | |
| 151109_175827_WPR001..> | 2015-11-09 17:58 | 386M | |
| 150921_120239_SRS001..> | 2015-09-21 13:02 | 1.3M | |
| 150907_195016_SRS001..> | 2015-09-07 20:50 | 67M | |
| 150905_112451_SRS001..> | 2015-09-05 12:24 | 625K | |
| 150905_112330_SRS001..> | 2015-09-05 12:23 | 529K | |
| 150726_170649_SRS001..> | 2015-07-26 18:06 | 5.2M | |
| 150606_144856_SRS001..> | 2015-06-06 15:48 | 601K | |
| 150606_140357_SRS001..> | 2015-06-06 15:03 | 601K | |
| 150526_135747_SRS001..> | 2015-05-26 14:57 | 1.6G | |
| 150526_135338_SRS001..> | 2015-05-26 14:53 | 42M | |
| 150522_113830_SRS001..> | 2015-05-22 12:38 | 385M | |
| 141125_150308_SRS001..> | 2014-11-25 15:03 | 4.1M | |
| 141125_143322_SRS001..> | 2014-11-25 14:33 | 721K | |
| 141117_203958_SRS001..> | 2014-11-17 20:39 | 27M | |
| 141117_203845_SRS001..> | 2014-11-17 20:38 | 12M | |
| 141008_163930_SRS001..> | 2014-10-08 17:39 | 176M | |
| 141001_112523_SRS001..> | 2014-10-01 12:25 | 601K | |
| 140930_170203_SRS001..> | 2014-09-30 18:02 | 2.3M | |
| 140807_103722_SRS001..> | 2014-08-07 11:37 | 529K | |
| 140724_205940_SRS001..> | 2014-07-24 21:59 | 14M | |
| 140724_205805_SRS001..> | 2014-07-24 21:58 | 15M | |
| 140717_210103_SRS001..> | 2014-07-17 22:01 | 24M | |
| 140717_205934_SRS001..> | 2014-07-17 21:59 | 13M | |
| 140714_170425_SRS001..> | 2014-07-14 18:04 | 2.0M | |
| 140714_170344_SRS001..> | 2014-07-14 18:03 | 2.4M | |
| 140711_022925_SRS001..> | 2014-07-11 03:29 | 625K | |
| 140711_021528_SRS001..> | 2014-07-11 03:15 | 601K | |
| 140711_010229_SRS001..> | 2014-07-11 02:02 | 553K | |
| 140710_200408_SRS001..> | 2014-07-10 21:04 | 100M | |
| 140522_193211_SRS001..> | 2014-05-22 20:32 | 243M | |
| 140429_170530_SRS001..> | 2014-04-29 18:05 | 2.1M | |
| 140424_170904_SRS001..> | 2014-04-24 18:09 | 37M | |
| 140424_170854_SRS001..> | 2014-04-24 18:08 | 1.7M | |
| 140424_170722_SRS001..> | 2014-04-24 18:07 | 15M | |
| 140422_170518_SRS001..> | 2014-04-22 18:05 | 1.2M | |
| 140422_170434_SRS001..> | 2014-04-22 18:04 | 1.0M | |
| 140422_170352_SRS001..> | 2014-04-22 18:03 | 1.9M | |
| 140422_170331_SRS001..> | 2014-04-22 18:03 | 2.1M | |
| 140422_170255_SRS001..> | 2014-04-22 18:02 | 1.4M | |
| 140422_170236_SRS001..> | 2014-04-22 18:02 | 1.9M | |
| 140417_171101_SRS001..> | 2014-04-17 18:11 | 17M | |
| 140416_170914_SRS001..> | 2014-04-16 18:09 | 2.7M | |
| 140416_170847_SRS001..> | 2014-04-16 18:08 | 2.7M | |
| 140416_170814_SRS001..> | 2014-04-16 18:08 | 2.2M | |
| 140416_170755_SRS001..> | 2014-04-16 18:07 | 2.2M | |
| 140416_145524_SRS001..> | 2014-04-16 15:55 | 2.3M | |
| 140416_145408_SRS001..> | 2014-04-16 15:54 | 5.6M | |
| 140415_170013_SRS001..> | 2014-04-15 18:00 | 1.6M | |
| 140415_170000_SRS001..> | 2014-04-15 18:00 | 2.2M | |
| 140415_165943_SRS001..> | 2014-04-15 17:59 | 1.7M | |
| 140415_165912_SRS001..> | 2014-04-15 17:59 | 5.2M | |
| 140411_232445_SRS001..> | 2014-04-11 23:24 | 10M | |
| 140411_232303_SRS001..> | 2014-04-11 23:23 | 11M | |
| 140411_232123_SRS001..> | 2014-04-11 23:21 | 15M | |
| 140411_231703_SRS001..> | 2014-04-11 23:17 | 33M | |
| 140411_231625_SRS001..> | 2014-04-11 23:16 | 6.3M | |
| 140408_170049_SRS001..> | 2014-04-08 18:00 | 2.9M | |
| 140408_170022_SRS001..> | 2014-04-08 18:00 | 2.5M | |
| 140403_170210_SRS001..> | 2014-04-03 18:02 | 5.0M | |
| 140403_170126_SRS001..> | 2014-04-03 18:01 | 1.7M | |
| 140403_170055_SRS001..> | 2014-04-03 18:00 | 3.3M | |
| 140403_165959_SRS001..> | 2014-04-03 17:59 | 9.4M | |
| 140402_165804_SRS001..> | 2014-04-02 17:58 | 1.6M | |
| 140402_165751_SRS001..> | 2014-04-02 17:57 | 1.4M | |
| 140401_165830_SRS001..> | 2014-04-01 17:58 | 1.5M | |
| 140401_165815_SRS001..> | 2014-04-01 17:58 | 1.4M | |
| 140401_165756_SRS001..> | 2014-04-01 17:57 | 1.9M | |
| 140331_165852_SRS001..> | 2014-03-31 17:58 | 2.3M | |
| 140331_165820_SRS001..> | 2014-03-31 17:58 | 3.8M | |
| 140331_165752_SRS001..> | 2014-03-31 17:57 | 1.8M | |
| 140331_165731_SRS001..> | 2014-03-31 17:57 | 1.8M | |
| 140328_145420_SRS001..> | 2014-03-28 15:54 | 5.9M | |
| 140327_170236_SRS001..> | 2014-03-27 18:02 | 4.2M | |
| 140327_170218_SRS001..> | 2014-03-27 18:02 | 1.8M | |
| 140326_222931_SRS001..> | 2014-03-26 23:29 | 337K | |
| 140326_170735_SRS001..> | 2014-03-26 18:07 | 1.7M | |
| 140326_170721_SRS001..> | 2014-03-26 18:07 | 1.3M | |
| 140326_170700_SRS001..> | 2014-03-26 18:07 | 1.6M | |
| 140325_170216_SRS001..> | 2014-03-25 18:02 | 1.4M | |
| 140325_170154_SRS001..> | 2014-03-25 18:01 | 3.7M | |
| 140325_170024_SRS001..> | 2014-03-25 18:00 | 1.9M | |
| 140325_165922_SRS001..> | 2014-03-25 17:59 | 5.9M | |
| 140325_004617_SRS001..> | 2014-03-25 01:46 | 337K | |
| 140324_144914_SRS001..> | 2014-03-24 15:49 | 11M | |
| 140324_144735_SRS001..> | 2014-03-24 15:47 | 12M | |
| 140321_031114_SRS001..> | 2014-03-21 04:11 | 1.1M | |
| 140321_021349_SRS001..> | 2014-03-21 03:13 | 1.3M | |
| 140320_170144_SRS001..> | 2014-03-20 18:01 | 3.3M | |
| 140320_170127_SRS001..> | 2014-03-20 18:01 | 2.1M | |
| 140320_170035_SRS001..> | 2014-03-20 18:00 | 3.4M | |
| 140320_170018_SRS001..> | 2014-03-20 18:00 | 2.2M | |
| 140317_173546_SRS001..> | 2014-03-17 18:35 | 8.2M | |
| 140312_171155_SRS001..> | 2014-03-12 18:11 | 1.9M | |
| 140312_171123_SRS001..> | 2014-03-12 18:11 | 2.3M | |
| 140312_171048_SRS001..> | 2014-03-12 18:10 | 4.9M | |
| 140312_171023_SRS001..> | 2014-03-12 18:10 | 2.0M | |
| 140312_171002_SRS001..> | 2014-03-12 18:10 | 1.7M | |
| 140311_223324_SRS001..> | 2014-03-11 23:33 | 625K | |
| 140311_171423_SRS001..> | 2014-03-11 18:14 | 5.2M | |
| 140310_171938_SRS001..> | 2014-03-10 18:19 | 3.8M | |
| 140310_171830_SRS001..> | 2014-03-10 18:18 | 1.5M | |
| 140310_171747_SRS001..> | 2014-03-10 18:17 | 3.9M | |
| 140305_180503_SRS001..> | 2014-03-05 18:05 | 3.0M | |
| 140305_180450_SRS001..> | 2014-03-05 18:04 | 1.4M | |
| 140305_180429_SRS001..> | 2014-03-05 18:04 | 1.9M | |
| 140304_181747_SRS001..> | 2014-03-04 18:17 | 4.8M | |
| 140303_175604_SRS001..> | 2014-03-03 17:56 | 8.9M | |
| 140227_182712_SRS001..> | 2014-02-27 18:27 | 2.1M | |
| 140227_182651_SRS001..> | 2014-02-27 18:26 | 3.0M | |
| 140227_180555_SRS001..> | 2014-02-27 18:05 | 3.0M | |
| 140227_180528_SRS001..> | 2014-02-27 18:05 | 2.2M | |
| 140225_181228_SRS001..> | 2014-02-25 18:12 | 3.4M | |
| 140225_181208_SRS001..> | 2014-02-25 18:12 | 745K | |
| 140225_181119_SRS001..> | 2014-02-25 18:11 | 1.8M | |
| 140225_181030_SRS001..> | 2014-02-25 18:10 | 2.1M | |
| 140225_181009_SRS001..> | 2014-02-25 18:10 | 2.3M | |
| 140212_205121_SRS001..> | 2014-02-12 20:51 | 39M | |
| 140205_231429_SRS001..> | 2014-02-05 23:14 | 505K | |
| 140204_160105_SRS001..> | 2014-02-04 16:01 | 433K | |
| 140129_124256_SRS001..> | 2014-01-29 12:42 | 601K | |
| 140129_114809_SRS001..> | 2014-01-29 11:48 | 529K | |
| 131230_205613_SRS001..> | 2013-12-30 20:56 | 99M | |
| 131226_202449_SRS001..> | 2013-12-26 20:27 | 6.5M | |
| 131219_211651_SRS001..> | 2013-12-19 21:40 | 24M | |
| 131205_004513_SRS001..> | 2013-12-04 23:45 | 577K | |
| 131123_190448_SRS001..> | 2013-11-23 18:04 | 4.4M | |
| 131113_220015_SRS001..> | 2013-11-13 21:00 | 560M | |
| 131112_184944_SRS001..> | 2013-11-12 17:49 | 529K | |
| 131026_195656_SRS001..> | 2013-10-26 19:56 | 746M | |
| 131009_221555_SRS001..> | 2013-10-09 22:15 | 561M | |
| 131007_231106_SRS001..> | 2013-10-07 23:11 | 29M | |
| 131002_025312_SRS001..> | 2013-10-02 02:53 | 1.1M | |
| 131002_025054_SRS001..> | 2013-10-02 02:50 | 721K | |
| 130927_191520_SRS001..> | 2013-09-27 19:15 | 105M | |
| 130924_235631_SRS001..> | 2013-09-24 23:56 | 182M | |
| 130923_232957_SRS001..> | 2013-09-23 23:29 | 241K | |
| 130923_232906_SRS001..> | 2013-09-23 23:29 | 5.4M | |
| 130921_010203_SRS001..> | 2013-09-21 01:02 | 277M | |
| 130919_191414_SRS001..> | 2013-09-19 19:14 | 37M | |
| 130917_003226_SRS001..> | 2013-09-17 00:32 | 206M | |
| 130827_204726_SRS001..> | 2013-08-27 20:47 | 676M | |
| 130822_195622_SRS001..> | 2013-08-22 19:56 | 34M | |
| 130821_164626_SRS001..> | 2013-08-21 16:46 | 721K | |
| 130821_164508_SRS001..> | 2013-08-21 16:45 | 11M | |
| 130814_220205_SRS001..> | 2013-08-14 22:02 | 6.5M | |
| 130814_220154_SRS001..> | 2013-08-14 22:01 | 505K | |
| 130801_210310_SRS001..> | 2013-08-01 21:03 | 720M | |
| 130718_210014_SRS001..> | 2013-07-18 21:00 | 698M | |
| 130717_220511_SRS001..> | 2013-07-17 22:05 | 574M | |
| 130711_211052_SRS001..> | 2013-07-11 21:10 | 900M | |
| 130711_193850_SRS001..> | 2013-07-11 19:38 | 577M | |
| 130626_173054_SRS001..> | 2013-06-26 17:30 | 449M | |
| 130625_174930_SRS001..> | 2013-06-25 17:49 | 83M | |
| 130625_144634_SRS001..> | 2013-06-25 14:46 | 525M | |
| 130623_220817_SRS001..> | 2013-06-23 22:08 | 745K | |
| 130623_220436_SRS001..> | 2013-06-23 22:04 | 34M | |
| 130608_171618_SRS001..> | 2013-06-08 17:16 | 505K | |
| 130607_220241_SRS001..> | 2013-06-07 22:02 | 17M | |
| 130602_120459_SRS001..> | 2013-06-02 12:04 | 433K | |
| 130601_221402_SRS001..> | 2013-06-01 22:14 | 29M | |
| 130531_215449_SRS001..> | 2013-05-31 21:54 | 20M | |
| 130528_023330_SRS001..> | 2013-05-28 02:33 | 385K | |
| 130525_193546_SRS001..> | 2013-05-25 19:35 | 601K | |
| 130524_220759_SRS001..> | 2013-05-24 22:07 | 18M | |
| 130522_210107_SRS001..> | 2013-05-22 21:01 | 550M | |
| 130522_210022_SRS001..> | 2013-05-22 21:00 | 4.6M | |
| 130522_210013_SRS001..> | 2013-05-22 21:00 | 1.4M | |
| 130521_201049_SRS001..> | 2013-05-21 20:10 | 27M | |
| 130516_222556_SRS001..> | 2013-05-16 22:25 | 89M | |
| 130516_222026_SRS001..> | 2013-05-16 22:20 | 51M | |
| 130516_221200_SRS001..> | 2013-05-16 22:12 | 80M | |
| 130516_204128_SRS001..> | 2013-05-16 20:41 | 14M | |
| 130516_203323_SRS001..> | 2013-05-16 20:33 | 52M | |
| 130515_185252_SRS001..> | 2013-05-15 18:52 | 44M | |
| 130513_184818_SRS001..> | 2013-05-13 18:48 | 24M | |
| 130504_200641_SRS001..> | 2013-05-04 20:06 | 545M | |
| 130504_015459_SRS001..> | 2013-05-04 01:54 | 337M | |
| 130427_221750_SRS001..> | 2013-04-27 22:17 | 625K | |
| 130427_210616_SRS001..> | 2013-04-27 21:06 | 8.8M | |
| 130427_210507_SRS001..> | 2013-04-27 21:05 | 8.5M | |
| 130416_205643_SRS001..> | 2013-04-16 20:56 | 18M | |
| 130406_210136_SRS001..> | 2013-04-06 21:01 | 65M | |
| 130406_135457_SRS001..> | 2013-04-06 13:54 | 337K | |
| 130406_135046_SRS001..> | 2013-04-06 13:50 | 37M | |
| 130401_200044_SRS001..> | 2013-04-01 20:00 | 556M | |
| 130325_200024_SRS001..> | 2013-03-25 20:00 | 567M | |
| 130323_131631_SRS001..> | 2013-03-23 13:16 | 25M | |
| 130323_115305_SRS001..> | 2013-03-23 11:53 | 8.9M | |
| 130319_163141_SRS001..> | 2013-03-19 16:31 | 47M | |
| 130319_162716_SRS001..> | 2013-03-19 16:27 | 45M | |
| 130312_210845_SRS001..> | 2013-03-12 21:08 | 546M | |
| 130308_201157_SRS001..> | 2013-03-08 19:11 | 19M | |
| 130308_195306_SRS001..> | 2013-03-08 18:53 | 57M | |
| 130308_193744_SRS001..> | 2013-03-08 18:37 | 38M | |
| 130308_193005_SRS001..> | 2013-03-08 18:30 | 51M | |
| 130308_133406_SRS001..> | 2013-03-08 12:34 | 111M | |
| 130306_205557_SRS001..> | 2013-03-06 19:55 | 2.4M | |
| 130306_200325_SRS001..> | 2013-03-06 19:03 | 530M | |
| 130302_150154_SRS001..> | 2013-03-02 14:01 | 607M | |
| 130227_231750_SRS001..> | 2013-02-27 22:17 | 558M | |
| 130226_230256_SRS001..> | 2013-02-26 22:02 | 361K | |
| 130226_230017_SRS001..> | 2013-02-26 22:00 | 7.4M | |
| 130221_225241_SRS001..> | 2013-02-21 21:52 | 271M | |
| 130221_210644_SRS001..> | 2013-02-21 20:06 | 7.1M | |
| 130221_210543_SRS001..> | 2013-02-21 20:05 | 7.2M | |
| 130217_220426_SRS001..> | 2013-02-17 21:04 | 566M | |
| 130214_190016_SRS001..> | 2013-02-14 18:00 | 5.0M | |
| 130214_190006_SRS001..> | 2013-02-14 18:00 | 1.6M | |
| 130214_185237_SRS001..> | 2013-02-14 17:52 | 5.5M | |
| 130214_185210_SRS001..> | 2013-02-14 17:52 | 4.7M | |
| 130214_184832_SRS001..> | 2013-02-14 17:48 | 5.2M | |
| 130214_184827_SRS001..> | 2013-02-14 17:48 | 337K | |
| 130214_184756_SRS001..> | 2013-02-14 17:47 | 5.3M | |
| 130214_184736_SRS001..> | 2013-02-14 17:47 | 3.3M | |
| 130214_184718_SRS001..> | 2013-02-14 17:47 | 3.0M | |
| 130214_184614_SRS001..> | 2013-02-14 17:46 | 5.8M | |
| 130214_183111_SRS001..> | 2013-02-14 17:31 | 4.2M | |
| 130214_182913_SRS001..> | 2013-02-14 17:29 | 4.8M | |
| 130214_182849_SRS001..> | 2013-02-14 17:28 | 4.1M | |
| 130214_182820_SRS001..> | 2013-02-14 17:28 | 4.9M | |
| 130214_182806_SRS001..> | 2013-02-14 17:28 | 2.3M | |
| 130214_182549_SRS001..> | 2013-02-14 17:25 | 5.2M | |
| 130214_182523_SRS001..> | 2013-02-14 17:25 | 4.3M | |
| 130214_182247_SRS001..> | 2013-02-14 17:22 | 4.9M | |
| 130214_182226_SRS001..> | 2013-02-14 17:22 | 3.5M | |
| 130214_182144_SRS001..> | 2013-02-14 17:21 | 4.3M | |
| 130214_182130_SRS001..> | 2013-02-14 17:21 | 2.5M | |
| 130214_181553_SRS001..> | 2013-02-14 17:15 | 4.4M | |
| 130214_181445_SRS001..> | 2013-02-14 17:14 | 6.3M | |
| 130214_181408_SRS001..> | 2013-02-14 17:14 | 6.0M | |
| 130212_002656_SRS001..> | 2013-02-11 23:26 | 12M | |
| 130205_210147_SRS001..> | 2013-02-05 20:01 | 571M | |
| 130204_210019_SRS001..> | 2013-02-04 20:00 | 561M | |
| 130203_221128_SRS001..> | 2013-02-03 21:11 | 456M | |
| 130203_160007_SRS001..> | 2013-02-03 15:00 | 559M | |
| 130202_180509_SRS001..> | 2013-02-02 17:05 | 337K | |
| 130202_180409_SRS001..> | 2013-02-02 17:04 | 10M | |
| 130202_180309_SRS001..> | 2013-02-02 17:03 | 10M | |
| ||||