Index of /wav
![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[SND]](/icons/sound2.gif) | The_Adam_O_Podcast_1..> | 1969-12-31 23:00 | 595M | |
![[SND]](/icons/sound2.gif) | click.wav | 2000-02-09 16:58 | 7.9K | |
![[SND]](/icons/sound2.gif) | conlink.wav | 2000-05-25 06:38 | 9.6K | |
![[SND]](/icons/sound2.gif) | missile.wav | 2000-05-25 06:38 | 12K | |
![[SND]](/icons/sound2.gif) | service.wav | 2000-05-25 06:38 | 29K | |
![[SND]](/icons/sound2.gif) | whoosh.wav | 2000-05-25 06:38 | 21K | |
![[SND]](/icons/sound2.gif) | Beep.wav | 2000-06-13 05:47 | 2.1K | |
![[SND]](/icons/sound2.gif) | Boing.wav | 2000-06-13 05:47 | 15K | |
![[SND]](/icons/sound2.gif) | Boom.wav | 2000-06-13 05:47 | 24K | |
![[SND]](/icons/sound2.gif) | Bubbles.wav | 2000-06-13 05:47 | 16K | |
![[SND]](/icons/sound2.gif) | Bweep.wav | 2000-06-13 05:47 | 14K | |
![[SND]](/icons/sound2.gif) | Doink.wav | 2000-06-13 05:47 | 14K | |
![[SND]](/icons/sound2.gif) | DoorClose.wav | 2000-06-13 05:47 | 19K | |
![[SND]](/icons/sound2.gif) | Eeeooop.wav | 2000-06-13 05:47 | 18K | |
![[SND]](/icons/sound2.gif) | FingerSnap.wav | 2000-06-13 05:47 | 4.4K | |
![[SND]](/icons/sound2.gif) | Machine.wav | 2000-06-13 05:47 | 43K | |
![[SND]](/icons/sound2.gif) | MechFootstep.wav | 2000-06-13 05:47 | 48K | |
![[SND]](/icons/sound2.gif) | Shutdown.wav | 2000-06-13 05:47 | 70K | |
![[SND]](/icons/sound2.gif) | Troll_Grumble.wav | 2000-06-13 05:47 | 55K | |
![[SND]](/icons/sound2.gif) | Wooeep.wav | 2000-06-13 05:47 | 21K | |
![[SND]](/icons/sound2.gif) | beethoven.wav | 2000-06-13 05:47 | 73K | |
![[SND]](/icons/sound2.gif) | boingiggig.wav | 2000-06-13 05:47 | 15K | |
![[SND]](/icons/sound2.gif) | drip.wav | 2000-06-13 05:47 | 1.2K | |
![[SND]](/icons/sound2.gif) | estart.wav | 2000-06-13 05:47 | 320K | |
![[SND]](/icons/sound2.gif) | rubberband.wav | 2000-06-13 05:47 | 9.7K | |
![[SND]](/icons/sound2.gif) | tink.wav | 2000-06-13 05:47 | 2.7K | |
![[SND]](/icons/sound2.gif) | George etc..wav | 2000-08-08 18:31 | 57M | |
![[SND]](/icons/sound2.gif) | netfound.wav | 2001-08-03 17:33 | 21K | |
![[SND]](/icons/sound2.gif) | alarm.wav | 2001-10-21 19:09 | 9.5K | |
![[SND]](/icons/sound2.gif) | sample2.wav | 2001-12-31 10:38 | 33K | |
![[SND]](/icons/sound2.gif) | error.wav | 2003-12-13 15:19 | 43K | |
![[SND]](/icons/sound2.gif) | warning.wav | 2003-12-13 15:19 | 42K | |
![[SND]](/icons/sound2.gif) | kisosound.wav | 2004-01-05 14:55 | 1.3M | |
![[SND]](/icons/sound2.gif) | track-20.wav | 2004-03-19 23:10 | 15M | |
![[SND]](/icons/sound2.gif) | 6367959105-0606-1913..> | 2004-06-06 20:23 | 13K | |
![[SND]](/icons/sound2.gif) | track-01.wav | 2004-06-13 19:26 | 36M | |
![[SND]](/icons/sound2.gif) | track-02.wav | 2004-06-13 19:26 | 35M | |
![[SND]](/icons/sound2.gif) | track-03.wav | 2004-06-13 19:26 | 39M | |
![[SND]](/icons/sound2.gif) | track-04.wav | 2004-06-13 19:26 | 34M | |
![[SND]](/icons/sound2.gif) | track-05.wav | 2004-06-13 19:26 | 45M | |
![[SND]](/icons/sound2.gif) | track-06.wav | 2004-06-13 19:27 | 36M | |
![[SND]](/icons/sound2.gif) | track-07.wav | 2004-06-13 19:27 | 30M | |
![[SND]](/icons/sound2.gif) | track-08.wav | 2004-06-13 19:27 | 35M | |
![[SND]](/icons/sound2.gif) | track-09.wav | 2004-06-13 19:27 | 31M | |
![[SND]](/icons/sound2.gif) | track-10.wav | 2004-06-13 19:27 | 26M | |
![[SND]](/icons/sound2.gif) | track-11.wav | 2004-06-13 19:27 | 47M | |
![[SND]](/icons/sound2.gif) | track-12.wav | 2004-06-13 19:27 | 36M | |
![[SND]](/icons/sound2.gif) | track-13.wav | 2004-06-13 19:28 | 36M | |
![[SND]](/icons/sound2.gif) | track-14.wav | 2004-06-13 19:28 | 35M | |
![[SND]](/icons/sound2.gif) | track-15.wav | 2004-06-13 19:28 | 39M | |
![[SND]](/icons/sound2.gif) | track-16.wav | 2004-06-13 19:28 | 36M | |
![[SND]](/icons/sound2.gif) | track-17.wav | 2004-06-13 19:28 | 29M | |
![[SND]](/icons/sound2.gif) | track-18.wav | 2004-06-13 19:28 | 16M | |
![[SND]](/icons/sound2.gif) | track-19.wav | 2004-06-13 19:28 | 30M | |
![[SND]](/icons/sound2.gif) | Censor_B-Josh-1221.wav | 2005-01-25 22:05 | 10K | |
![[SND]](/icons/sound2.gif) | 19 Hold On 99.wav | 2006-10-27 12:35 | 56M | |
![[SND]](/icons/sound2.gif) | 128 Georgia Lee 99.wav | 2006-10-27 12:37 | 44M | |
![[SND]](/icons/sound2.gif) | Georgia Lee 99.wav | 2006-10-27 12:37 | 44M | |
![[SND]](/icons/sound2.gif) | It's Not So Hard 06.wav | 2006-10-28 22:44 | 29M | |
![[SND]](/icons/sound2.gif) | Took It All.wav | 2006-12-16 00:42 | 47M | |
![[SND]](/icons/sound2.gif) | Took It All 04.wav | 2006-12-16 00:42 | 47M | |
![[SND]](/icons/sound2.gif) | 20 Someone Keeps Mov..> | 2006-12-16 01:04 | 23M | |
![[SND]](/icons/sound2.gif) | 22 Someone Keeps Mov..> | 2006-12-16 01:04 | 23M | |
![[SND]](/icons/sound2.gif) | Someone Keeps Moving..> | 2006-12-16 01:04 | 23M | |
![[SND]](/icons/sound2.gif) | CB Radio Loud Tone.wav | 2007-05-14 18:44 | 431K | |
![[SND]](/icons/sound2.gif) | CB Radio Two Level T..> | 2007-05-14 19:06 | 869K | |
![[SND]](/icons/sound2.gif) | 8 Nobody Knows My Na..> | 2007-05-15 18:13 | 35M | |
![[SND]](/icons/sound2.gif) | 13 Requiem 06.wav | 2007-12-11 21:22 | 28M | |
![[SND]](/icons/sound2.gif) | 20 I'm The Greatest ..> | 2008-02-10 19:43 | 34M | |
![[SND]](/icons/sound2.gif) | I'm The Greatest 73.wav | 2008-02-10 19:43 | 34M | |
![[SND]](/icons/sound2.gif) | Applause (short).wav | 2009-03-09 14:14 | 1.4M | |
![[SND]](/icons/sound2.gif) | 1. One For Me.wav | 2009-06-25 08:09 | 27M | |
![[SND]](/icons/sound2.gif) | 24 I'll Go Crazy If ..> | 2009-06-29 17:13 | 46M | |
![[SND]](/icons/sound2.gif) | 5. Into My Arms.wav | 2009-09-07 14:19 | 47M | |
![[SND]](/icons/sound2.gif) | 4. The Last Chance T..> | 2009-09-07 15:51 | 45M | |
![[SND]](/icons/sound2.gif) | 11 Jump Jump 81.wav | 2009-09-07 16:15 | 49M | |
![[SND]](/icons/sound2.gif) | 31 Bottle Of You 97.wav | 2009-09-09 13:02 | 60M | |
![[SND]](/icons/sound2.gif) | 37. Bottle Of You.wav | 2009-09-09 13:02 | 60M | |
![[SND]](/icons/sound2.gif) | 47 Dirty Blvd. 89.wav | 2009-10-17 16:44 | 38M | |
![[SND]](/icons/sound2.gif) | 18 Perfect Day 72.wav | 2009-10-17 16:52 | 41M | |
![[SND]](/icons/sound2.gif) | 217 Perfect Day 72.wav | 2009-10-17 16:52 | 41M | |
![[SND]](/icons/sound2.gif) | 27 Walk On The Wild ..> | 2009-10-17 16:53 | 47M | |
![[SND]](/icons/sound2.gif) | Walk On The Wild Sid..> | 2009-10-17 16:53 | 47M | |
![[SND]](/icons/sound2.gif) | Lady Day 73.wav | 2009-10-17 16:58 | 40M | |
![[SND]](/icons/sound2.gif) | 4. Nothing Is Wasted..> | 2009-12-05 19:16 | 32M | |
![[SND]](/icons/sound2.gif) | 9. Fairy Tales Forgo..> | 2009-12-05 19:20 | 45M | |
![[SND]](/icons/sound2.gif) | 5. I Can Give You Ti..> | 2009-12-15 15:34 | 47M | |
![[SND]](/icons/sound2.gif) | 04 El Espejo.wav | 2010-11-02 19:25 | 35M | |
![[SND]](/icons/sound2.gif) | 10 Half Light [Tail ..> | 2010-11-06 15:10 | 74M | |
![[SND]](/icons/sound2.gif) | 209 Half Light [Tail..> | 2010-11-06 15:10 | 74M | |
![[SND]](/icons/sound2.gif) | Half Light [Tail Cre..> | 2010-11-06 15:10 | 74M | |
![[SND]](/icons/sound2.gif) | Half Light [Tail Cre..> | 2010-11-06 15:10 | 74M | |
![[SND]](/icons/sound2.gif) | 2. Bruises.wav | 2010-12-05 22:56 | 48M | |
![[SND]](/icons/sound2.gif) | 01 Eaters of Shit.wav | 2010-12-11 19:54 | 24M | |
![[SND]](/icons/sound2.gif) | 02 High School Dog K..> | 2010-12-11 19:54 | 27M | |
![[SND]](/icons/sound2.gif) | 03 Work Related Mucu..> | 2010-12-11 19:55 | 30M | |
![[SND]](/icons/sound2.gif) | 04 Placemats of Purg..> | 2010-12-11 19:55 | 30M | |
![[SND]](/icons/sound2.gif) | 05 Friend Detector.wav | 2010-12-11 19:56 | 31M | |
![[SND]](/icons/sound2.gif) | 1212_221040.WAV | 2010-12-12 22:10 | 418M | |
![[SND]](/icons/sound2.gif) | 1214_183717.WAV | 2010-12-14 18:37 | 207M | |
![[SND]](/icons/sound2.gif) | 1218_155918.WAV | 2010-12-18 15:59 | 714M | |
![[SND]](/icons/sound2.gif) | 1227_185712.WAV | 2010-12-27 18:57 | 416M | |
![[SND]](/icons/sound2.gif) | 1231_114300.WAV | 2010-12-31 11:43 | 503M | |
![[SND]](/icons/sound2.gif) | 1218_155918.output.WAV | 2011-01-03 00:47 | 714M | |
![[SND]](/icons/sound2.gif) | 0107_213040.WAV | 2011-01-07 21:30 | 1.5G | |
![[SND]](/icons/sound2.gif) | 0107_213040.output.WAV | 2011-01-07 23:29 | 1.5G | |
![[SND]](/icons/sound2.gif) | 0109_234015.WAV | 2011-01-09 23:40 | 38M | |
![[SND]](/icons/sound2.gif) | 0109_234015.output.WAV | 2011-01-09 23:46 | 38M | |
![[SND]](/icons/sound2.gif) | 0115_002317.WAV | 2011-01-15 00:23 | 1.1G | |
![[SND]](/icons/sound2.gif) | 0115_002317.output.WAV | 2011-01-15 02:39 | 1.1G | |
![[SND]](/icons/sound2.gif) | 0122_100019.WAV | 2011-01-22 10:00 | 2.0G | |
![[SND]](/icons/sound2.gif) | 0122_121531.WAV | 2011-01-22 13:57 | 1.4G | |
![[SND]](/icons/sound2.gif) | 0122_135807.WAV | 2011-01-22 13:58 | 406M | |
![[SND]](/icons/sound2.gif) | 0122_142612.WAV | 2011-01-22 14:26 | 39M | |
![[SND]](/icons/sound2.gif) | 0122_100019.output.WAV | 2011-02-03 22:47 | 2.0G | |
![[SND]](/icons/sound2.gif) | 0122_121531.output.WAV | 2011-02-03 23:45 | 1.4G | |
![[SND]](/icons/sound2.gif) | 0122_135807.output.WAV | 2011-02-03 23:53 | 406M | |
![[SND]](/icons/sound2.gif) | 0122_142612.output.WAV | 2011-02-04 00:19 | 39M | |
![[SND]](/icons/sound2.gif) | 0205_233347.WAV | 2011-02-05 23:33 | 1.6G | |
![[SND]](/icons/sound2.gif) | 0205_233347.output.WAV | 2011-02-06 01:49 | 1.6G | |
![[SND]](/icons/sound2.gif) | LeFrost and Moe Show..> | 2011-02-10 15:47 | 16M | |
![[SND]](/icons/sound2.gif) | 0211_223729.WAV | 2011-02-11 22:37 | 1.5G | |
![[SND]](/icons/sound2.gif) | 0211_223729.output.WAV | 2011-02-12 01:07 | 1.5G | |
![[SND]](/icons/sound2.gif) | LeFrost&MoeShow_1.wav | 2011-02-16 16:02 | 14M | |
![[SND]](/icons/sound2.gif) | 0218_225819.WAV | 2011-02-18 22:58 | 1.6G | |
![[SND]](/icons/sound2.gif) | 0218_225819.output.WAV | 2011-02-19 01:07 | 1.6G | |
![[SND]](/icons/sound2.gif) | LeFrost&MoeProduce2.wav | 2011-02-19 15:44 | 0 | |
![[SND]](/icons/sound2.gif) | LeFrostandMoeShowInt..> | 2011-02-21 19:34 | 14M | |
![[SND]](/icons/sound2.gif) | 0225_221357.WAV | 2011-02-25 22:13 | 1.9G | |
![[SND]](/icons/sound2.gif) | 0225_221357.output.WAV | 2011-02-26 10:40 | 1.9G | |
![[SND]](/icons/sound2.gif) | Cindy Hit 1.WAV | 2011-03-02 21:37 | 4.4M | |
![[SND]](/icons/sound2.gif) | Cindy Hit 2.WAV | 2011-03-02 21:37 | 2.8M | |
![[SND]](/icons/sound2.gif) | Charlie Sheen - Winn..> | 2011-03-03 01:25 | 129K | |
![[SND]](/icons/sound2.gif) | Charlie Sheen - Winn..> | 2011-03-03 01:26 | 129K | |
![[SND]](/icons/sound2.gif) | Poison Teacher - 03-..> | 2011-03-03 23:44 | 632M | |
![[SND]](/icons/sound2.gif) | Poison Teacher - 03-..> | 2011-03-04 00:38 | 632M | |
![[SND]](/icons/sound2.gif) | Cheech and Chong - M..> | 2011-03-04 19:17 | 13M | |
![[SND]](/icons/sound2.gif) | Cheech and Chong - M..> | 2011-03-04 19:18 | 13M | |
![[SND]](/icons/sound2.gif) | Green Light Intervie..> | 2011-03-04 21:17 | 298M | |
![[SND]](/icons/sound2.gif) | 0304_215346.WAV | 2011-03-04 21:53 | 1.6G | |
![[SND]](/icons/sound2.gif) | 0304_215346.output.WAV | 2011-03-05 00:03 | 1.6G | |
![[SND]](/icons/sound2.gif) | Green Light Intervie..> | 2011-03-05 02:58 | 298M | |
![[SND]](/icons/sound2.gif) | 0307_191112.output.WAV | 2011-03-07 19:16 | 59M | |
![[SND]](/icons/sound2.gif) | 0311_225541.WAV | 2011-03-11 22:55 | 1.7G | |
![[SND]](/icons/sound2.gif) | 0311_225541.output.WAV | 2011-03-12 01:37 | 1.7G | |
![[SND]](/icons/sound2.gif) | 110318_002956_MZ001.wav | 2011-03-18 00:29 | 6.5M | |
![[SND]](/icons/sound2.gif) | 110318_215058_MZ001.wav | 2011-03-18 21:50 | 1.2G | |
![[SND]](/icons/sound2.gif) | 0325_202906.WAV | 2011-03-25 20:29 | 1.8G | |
![[SND]](/icons/sound2.gif) | 110325_212657_MZ001.wav | 2011-03-25 23:59 | 1.8G | |
![[SND]](/icons/sound2.gif) | mormusic_bumper.wav | 2011-03-28 00:16 | 2.7M | |
![[SND]](/icons/sound2.gif) | urban chaos bumper.wav | 2011-03-28 00:30 | 2.7M | |
![[SND]](/icons/sound2.gif) | intro (WAV).wav | 2011-04-05 01:20 | 30M | |
![[SND]](/icons/sound2.gif) | Urban Chaos.wav | 2011-04-07 16:33 | 2.7M | |
![[SND]](/icons/sound2.gif) | mormusic radio intro..> | 2011-04-07 16:33 | 2.7M | |
![[SND]](/icons/sound2.gif) | Ching Chong Bumper.wav | 2011-04-07 16:34 | 2.5M | |
![[SND]](/icons/sound2.gif) | Satanic Lola Bumper.wav | 2011-04-07 16:34 | 2.9M | |
![[SND]](/icons/sound2.gif) | ching chong.wav | 2011-04-07 16:34 | 2.5M | |
![[SND]](/icons/sound2.gif) | satanic lola.wav | 2011-04-07 16:34 | 2.9M | |
![[SND]](/icons/sound2.gif) | Classical Bumper.wav | 2011-04-07 16:34 | 4.0M | |
![[SND]](/icons/sound2.gif) | classical.wav | 2011-04-07 16:34 | 4.0M | |
![[SND]](/icons/sound2.gif) | 110407_221021_MZ001.wav | 2011-04-08 01:34 | 2.0G | |
![[SND]](/icons/sound2.gif) | 110408_214633_MZ001.wav | 2011-04-09 01:12 | 2.0G | |
![[SND]](/icons/sound2.gif) | karen freakout.wav | 2011-04-13 22:50 | 15M | |
![[SND]](/icons/sound2.gif) | karen bodyworship.wav | 2011-04-13 22:58 | 11M | |
![[SND]](/icons/sound2.gif) | karen on drugs.wav | 2011-04-13 23:07 | 17M | |
![[SND]](/icons/sound2.gif) | 110415_003031_MZ001.wav | 2011-04-15 00:48 | 141M | |
![[SND]](/icons/sound2.gif) | 110414_221537_MZ001.wav | 2011-04-15 01:28 | 2.0G | |
![[SND]](/icons/sound2.gif) | Apr_14_2011-MorMusic..> | 2011-04-15 02:16 | 1.4G | |
![[SND]](/icons/sound2.gif) | Apr_14_2011-MorMusic..> | 2011-04-15 02:45 | 1.4G | |
![[SND]](/icons/sound2.gif) | arlo-promos2.wav | 2011-04-15 17:38 | 11M | |
![[SND]](/icons/sound2.gif) | arlo-promos1.wav | 2011-04-15 17:38 | 37M | |
![[SND]](/icons/sound2.gif) | 110415_220231_MZ001.wav | 2011-04-15 22:06 | 51M | |
![[SND]](/icons/sound2.gif) | 110415_221948_MZ001.wav | 2011-04-16 01:47 | 437M | |
![[SND]](/icons/sound2.gif) | 110415_232215_MZ001.wav | 2011-04-16 02:14 | 1.9G | |
![[SND]](/icons/sound2.gif) | 110415_221948_MZ001...> | 2011-04-16 02:27 | 437M | |
![[SND]](/icons/sound2.gif) | 110415_232215_MZ001...> | 2011-04-16 03:06 | 1.9G | |
![[SND]](/icons/sound2.gif) | mary tyler moore.wav | 2011-04-17 16:47 | 9.9M | |
![[SND]](/icons/sound2.gif) | arlo starting at T's..> | 2011-04-17 16:59 | 5.5M | |
![[SND]](/icons/sound2.gif) | 110418_205658_MZ001.wav | 2011-04-18 23:45 | 1.5G | |
![[SND]](/icons/sound2.gif) | 110418_205658_MZ001...> | 2011-04-19 00:09 | 1.5G | |
![[SND]](/icons/sound2.gif) | malkmus.wav | 2011-04-20 21:02 | 18M | |
![[SND]](/icons/sound2.gif) | arlo on weed.wav | 2011-04-20 21:03 | 4.1M | |
![[SND]](/icons/sound2.gif) | arlo on work.wav | 2011-04-20 21:20 | 4.1M | |
![[SND]](/icons/sound2.gif) | arlo montage final.wav | 2011-04-20 22:11 | 17M | |
![[SND]](/icons/sound2.gif) | 110422_002535_MZ001.wav | 2011-04-22 00:54 | 106M | |
![[SND]](/icons/sound2.gif) | 110421_222818_MZ001.wav | 2011-04-22 01:22 | 1.7G | |
![[SND]](/icons/sound2.gif) | 110421_222818_MZ001...> | 2011-04-22 01:44 | 1.7G | |
![[SND]](/icons/sound2.gif) | mmm_promo1.wav | 2011-04-22 01:46 | 106M | |
![[SND]](/icons/sound2.gif) | 0422_225607.WAV | 2011-04-22 22:56 | 58M | |
![[SND]](/icons/sound2.gif) | 110423_000051_MZ001.wav | 2011-04-23 00:21 | 193M | |
![[SND]](/icons/sound2.gif) | 110422_214443_MZ001.wav | 2011-04-23 00:49 | 1.7G | |
![[SND]](/icons/sound2.gif) | Charcoal_Designs-1.wav | 2011-04-23 13:49 | 6.8M | |
![[SND]](/icons/sound2.gif) | Charcoal_Designs-1.o..> | 2011-04-23 13:50 | 6.8M | |
![[SND]](/icons/sound2.gif) | 110415_010804_MZ001.wav | 2011-04-23 14:51 | 11M | |
![[SND]](/icons/sound2.gif) | 0422_225607.output.WAV | 2011-04-23 15:19 | 58M | |
![[SND]](/icons/sound2.gif) | 110425_232841_MZ001.wav | 2011-04-25 23:44 | 134M | |
![[SND]](/icons/sound2.gif) | 110425_211344_MZ001.wav | 2011-04-26 00:18 | 2.0G | |
![[SND]](/icons/sound2.gif) | mmm radio promo.wav | 2011-04-28 21:49 | 1.4M | |
![[SND]](/icons/sound2.gif) | arlo show promo real..> | 2011-04-28 21:50 | 1.1M | |
![[SND]](/icons/sound2.gif) | arlo jeremy hansen f..> | 2011-04-28 21:50 | 769K | |
![[SND]](/icons/sound2.gif) | arlo favorite radio ..> | 2011-04-28 21:51 | 1.4M | |
![[SND]](/icons/sound2.gif) | arlo call in real.wav | 2011-04-28 21:51 | 1.8M | |
![[SND]](/icons/sound2.gif) | 110428_221903_MZ001.wav | 2011-04-29 20:54 | 1.8G | |
![[SND]](/icons/sound2.gif) | 110429_220134_MZ001.wav | 2011-04-30 00:39 | 1.8G | |
![[SND]](/icons/sound2.gif) | 110503_225913_MZ001.wav | 2011-05-03 23:21 | 210M | |
![[SND]](/icons/sound2.gif) | 110503_204416_MZ001.wav | 2011-05-03 23:55 | 2.0G | |
![[SND]](/icons/sound2.gif) | crn pain crank morty..> | 2011-05-04 21:15 | 34M | |
![[SND]](/icons/sound2.gif) | Rocket Fuel Sex Magi..> | 2011-05-04 21:37 | 96M | |
![[SND]](/icons/sound2.gif) | falsetto teeth rocke..> | 2011-05-04 21:37 | 96M | |
![[SND]](/icons/sound2.gif) | dangeroscoe i lie to..> | 2011-05-04 21:45 | 32M | |
![[SND]](/icons/sound2.gif) | karen spanish lesson..> | 2011-05-04 22:20 | 18M | |
![[SND]](/icons/sound2.gif) | karen filipino lesso..> | 2011-05-04 22:31 | 14M | |
![[SND]](/icons/sound2.gif) | jeremy chest buster.wav | 2011-05-04 22:42 | 13M | |
![[SND]](/icons/sound2.gif) | 0505_231727.WAV | 2011-05-05 23:17 | 124M | |
![[SND]](/icons/sound2.gif) | 0505_232541.WAV | 2011-05-05 23:25 | 33M | |
![[SND]](/icons/sound2.gif) | 110505_222006_MZ001.wav | 2011-05-06 00:43 | 1.7G | |
![[SND]](/icons/sound2.gif) | May_5_2011-MorMusic_..> | 2011-05-06 03:25 | 1.1G | |
![[SND]](/icons/sound2.gif) | May_5_2011-MorMusic_..> | 2011-05-06 03:48 | 1.1G | |
![[SND]](/icons/sound2.gif) | 110510_231726_MZ001.wav | 2011-05-11 00:23 | 598M | |
![[SND]](/icons/sound2.gif) | 110510_210229_MZ001.wav | 2011-05-11 00:49 | 2.0G | |
![[SND]](/icons/sound2.gif) | cain call.wav | 2011-05-11 21:30 | 11M | |
![[SND]](/icons/sound2.gif) | 110511_190015_MZ001.wav | 2011-05-11 21:38 | 1.6G | |
![[SND]](/icons/sound2.gif) | cain work.wav | 2011-05-11 22:17 | 10M | |
![[SND]](/icons/sound2.gif) | shelly movie imperso..> | 2011-05-11 22:21 | 23M | |
![[SND]](/icons/sound2.gif) | elvis.wav | 2011-05-11 22:40 | 28M | |
![[SND]](/icons/sound2.gif) | cain promo long.wav | 2011-05-11 22:47 | 2.6M | |
![[SND]](/icons/sound2.gif) | tony whitfield call ..> | 2011-05-11 22:51 | 6.5M | |
![[SND]](/icons/sound2.gif) | shelly best promo.wav | 2011-05-11 23:02 | 3.9M | |
![[SND]](/icons/sound2.gif) | shelly call in 2.wav | 2011-05-11 23:04 | 1.9M | |
![[SND]](/icons/sound2.gif) | michael monogan prom..> | 2011-05-11 23:05 | 1.4M | |
![[SND]](/icons/sound2.gif) | kids all together pr..> | 2011-05-11 23:08 | 3.1M | |
![[SND]](/icons/sound2.gif) | 110512_003358_MZ001.wav | 2011-05-12 00:36 | 17M | |
![[SND]](/icons/sound2.gif) | 110512_003931_MZ001.wav | 2011-05-12 00:41 | 16M | |
![[SND]](/icons/sound2.gif) | 110512_005122_MZ001.wav | 2011-05-12 00:53 | 22M | |
![[SND]](/icons/sound2.gif) | 110512_005651_MZ001.wav | 2011-05-12 00:58 | 18M | |
![[SND]](/icons/sound2.gif) | 110513_003500_MZ001.wav | 2011-05-13 00:39 | 36M | |
![[SND]](/icons/sound2.gif) | 110512_222329_MZ001.wav | 2011-05-13 01:12 | 1.9G | |
![[SND]](/icons/sound2.gif) | stab_city_promos.wav | 2011-05-13 01:17 | 24M | |
![[SND]](/icons/sound2.gif) | 110513_215828_MZ001.wav | 2011-05-14 00:30 | 1.8G | |
![[SND]](/icons/sound2.gif) | 110518_211124_MZ001.wav | 2011-05-18 21:27 | 126M | |
![[SND]](/icons/sound2.gif) | 110518_185625_MZ001.wav | 2011-05-18 22:24 | 2.0G | |
![[SND]](/icons/sound2.gif) | I Got You.wav | 2011-05-19 18:18 | 39M | |
![[SND]](/icons/sound2.gif) | Hard To See.wav | 2011-05-19 18:18 | 44M | |
![[SND]](/icons/sound2.gif) | She's Dead.wav | 2011-05-19 18:18 | 57M | |
![[SND]](/icons/sound2.gif) | All My Pain.wav | 2011-05-19 18:18 | 40M | |
![[SND]](/icons/sound2.gif) | Scream Out Your Brea..> | 2011-05-19 18:18 | 41M | |
![[SND]](/icons/sound2.gif) | Open Cries.wav | 2011-05-19 18:18 | 38M | |
![[SND]](/icons/sound2.gif) | As You Go Down.wav | 2011-05-19 18:18 | 36M | |
![[SND]](/icons/sound2.gif) | 110520_002638_SRS001..> | 2011-05-20 00:32 | 38M | |
![[SND]](/icons/sound2.gif) | 110520_001339_SRS001..> | 2011-05-20 00:36 | 177M | |
![[SND]](/icons/sound2.gif) | 110519_215842_SRS001..> | 2011-05-20 01:11 | 2.0G | |
![[SND]](/icons/sound2.gif) | 400-Blows-Promo.wav | 2011-05-20 01:40 | 25M | |
![[SND]](/icons/sound2.gif) | 110520_235638_SRS001..> | 2011-05-20 23:58 | 8.9M | |
![[SND]](/icons/sound2.gif) | 110520_235246_SRS001..> | 2011-05-20 23:59 | 55M | |
![[SND]](/icons/sound2.gif) | 110520_212544_SRS001..> | 2011-05-21 00:36 | 2.0G | |
![[SND]](/icons/sound2.gif) | 110521_093957_SRS001..> | 2011-05-21 10:06 | 318M | |
![[SND]](/icons/sound2.gif) | 110524_225447_SRS001..> | 2011-05-24 23:03 | 67M | |
![[SND]](/icons/sound2.gif) | 110524_203946_SRS001..> | 2011-05-24 23:39 | 2.0G | |
![[SND]](/icons/sound2.gif) | 110525_212649_SRS001..> | 2011-05-25 21:32 | 45M | |
![[SND]](/icons/sound2.gif) | 110525_191152_SRS001..> | 2011-05-25 22:08 | 2.0G | |
![[SND]](/icons/sound2.gif) | 110531_200842_SRS001..> | 2011-05-31 22:04 | 1.3G | |
![[SND]](/icons/sound2.gif) | 110601_211352_SRS001..> | 2011-06-01 21:40 | 248M | |
![[SND]](/icons/sound2.gif) | 110601_185855_SRS001..> | 2011-06-01 22:12 | 2.0G | |
![[SND]](/icons/sound2.gif) | 110602_220424_SRS001..> | 2011-06-03 00:21 | 1.6G | |
![[SND]](/icons/sound2.gif) | 110603_215109_SRS001..> | 2011-06-04 00:39 | 1.9G | |
![[SND]](/icons/sound2.gif) | 110607_221323_SRS001..> | 2011-06-07 22:47 | 332M | |
![[SND]](/icons/sound2.gif) | 110607_195826_SRS001..> | 2011-06-07 23:18 | 2.0G | |
![[SND]](/icons/sound2.gif) | 110608_190135_SRS001..> | 2011-06-09 20:39 | 1.9G | |
![[SND]](/icons/sound2.gif) | 110610_000719_SRS001..> | 2011-06-10 00:10 | 24M | |
![[SND]](/icons/sound2.gif) | 110609_220411_SRS001..> | 2011-06-10 00:32 | 1.7G | |
![[SND]](/icons/sound2.gif) | 110610_234454_SRS001..> | 2011-06-10 23:48 | 21M | |
![[SND]](/icons/sound2.gif) | 110610_213340_SRS001..> | 2011-06-11 00:23 | 1.9G | |
![[SND]](/icons/sound2.gif) | 110612_200432_SRS001..> | 2011-06-12 21:39 | 1.1G | |
![[SND]](/icons/sound2.gif) | burning.wav | 2011-06-13 11:54 | 53M | |
![[SND]](/icons/sound2.gif) | 110615_211500_SRS001..> | 2011-06-15 21:37 | 65M | |
![[SND]](/icons/sound2.gif) | 110615_185959_SRS001..> | 2011-06-15 22:13 | 2.0G | |
![[SND]](/icons/sound2.gif) | 110616_220052_SRS001..> | 2011-06-17 00:44 | 1.7G | |
![[SND]](/icons/sound2.gif) | 110617_214451_SRS001..> | 2011-06-18 00:33 | 1.9G | |
![[SND]](/icons/sound2.gif) | 110623_220537_SRS001..> | 2011-06-24 00:51 | 1.9G | |
![[SND]](/icons/sound2.gif) | dlh_ap_promo1.wav | 2011-06-24 09:24 | 15M | |
![[SND]](/icons/sound2.gif) | 110624_235010_SRS001..> | 2011-06-25 00:02 | 96M | |
![[SND]](/icons/sound2.gif) | 110624_213513_SRS001..> | 2011-06-25 00:38 | 2.0G | |
![[SND]](/icons/sound2.gif) | 110627_215157_SRS001..> | 2011-06-28 00:13 | 1.6G | |
![[SND]](/icons/sound2.gif) | 110628_230141_SRS001..> | 2011-06-28 23:07 | 44M | |
![[SND]](/icons/sound2.gif) | 110628_224731_SRS001..> | 2011-06-28 23:12 | 187M | |
![[SND]](/icons/sound2.gif) | 110628_203233_SRS001..> | 2011-06-28 23:46 | 2.0G | |
![[SND]](/icons/sound2.gif) | presentation.WAV | 2011-06-29 15:08 | 783M | |
![[SND]](/icons/sound2.gif) | 110629_185950_SRS001..> | 2011-06-29 21:47 | 1.9G | |
![[SND]](/icons/sound2.gif) | dadsi_one.WAV | 2011-06-30 11:01 | 50M | |
![[SND]](/icons/sound2.gif) | dadsi_two.WAV | 2011-06-30 11:04 | 59M | |
![[SND]](/icons/sound2.gif) | andrea ross.WAV | 2011-06-30 12:28 | 84M | |
![[SND]](/icons/sound2.gif) | wendell.WAV | 2011-06-30 22:38 | 80M | |
![[SND]](/icons/sound2.gif) | SRS_001.WAV | 2011-07-01 00:12 | 1.5G | |
![[SND]](/icons/sound2.gif) | kool_skull_promo.wav | 2011-07-01 00:19 | 33M | |
![[SND]](/icons/sound2.gif) | 110630_223109_SRS001..> | 2011-07-01 00:42 | 1.5G | |
![[SND]](/icons/sound2.gif) | Stop Your Fussin 88.wav | 2011-07-04 21:47 | 47M | |
![[SND]](/icons/sound2.gif) | 110705_212953_SRS001..> | 2011-07-06 18:52 | 95M | |
![[SND]](/icons/sound2.gif) | 110705_191456_SRS001..> | 2011-07-06 19:36 | 2.0G | |
![[SND]](/icons/sound2.gif) | 110706_190030_SRS001..> | 2011-07-06 21:52 | 2.0G | |
![[SND]](/icons/sound2.gif) | 0707_153032.WAV | 2011-07-07 15:30 | 6.7M | |
![[SND]](/icons/sound2.gif) | dino_promos.wav | 2011-07-08 01:29 | 27M | |
![[SND]](/icons/sound2.gif) | 110708_003847_SRS001..> | 2011-07-08 01:30 | 74M | |
![[SND]](/icons/sound2.gif) | 110707_222353_SRS001..> | 2011-07-08 02:06 | 2.0G | |
![[SND]](/icons/sound2.gif) | 0708_062514.WAV | 2011-07-08 06:25 | 228M | |
![[SND]](/icons/sound2.gif) | 0709_093509.WAV | 2011-07-09 09:35 | 27M | |
![[SND]](/icons/sound2.gif) | 0709_094204.WAV | 2011-07-09 09:42 | 311M | |
![[SND]](/icons/sound2.gif) | 110710_201051_SRS001..> | 2011-07-10 22:20 | 1.5G | |
![[SND]](/icons/sound2.gif) | 110710_201051_SRS001..> | 2011-07-13 07:38 | 1.0G | |
![[SND]](/icons/sound2.gif) | 0713_133603.WAV | 2011-07-13 13:36 | 30K | |
![[SND]](/icons/sound2.gif) | 110717_201701_SRS001..> | 2011-07-17 21:55 | 1.1G | |
![[SND]](/icons/sound2.gif) | 110717_201701_SRS001..> | 2011-07-17 21:55 | 1.1G | |
![[SND]](/icons/sound2.gif) | 110719_223723_SRS001..> | 2011-07-19 22:49 | 107M | |
![[SND]](/icons/sound2.gif) | 110719_202227_SRS001..> | 2011-07-19 23:23 | 2.0G | |
![[SND]](/icons/sound2.gif) | 110720_192644_SRS001..> | 2011-07-20 21:32 | 1.5G | |
![[SND]](/icons/sound2.gif) | 110721_221239_SRS001..> | 2011-07-22 00:12 | 1.4G | |
![[SND]](/icons/sound2.gif) | 0724_135238.WAV | 2011-07-24 13:52 | 1.3G | |
![[SND]](/icons/sound2.gif) | 0726_200907.WAV | 2011-07-26 20:09 | 29M | |
![[SND]](/icons/sound2.gif) | 0726_202004.WAV | 2011-07-26 20:20 | 128M | |
![[SND]](/icons/sound2.gif) | 0726_203232.WAV | 2011-07-26 20:32 | 364M | |
![[SND]](/icons/sound2.gif) | 110726_202505_SRS001..> | 2011-07-26 23:06 | 1.9G | |
![[SND]](/icons/sound2.gif) | 110727_190320_SRS001..> | 2011-07-27 21:54 | 2.0G | |
![[SND]](/icons/sound2.gif) | 0728_151051.WAV | 2011-07-28 15:10 | 42M | |
![[SND]](/icons/sound2.gif) | 0728_151619.WAV | 2011-07-28 15:16 | 65M | |
![[SND]](/icons/sound2.gif) | 0728_152041.WAV | 2011-07-28 15:20 | 25M | |
![[SND]](/icons/sound2.gif) | 0728_152230.WAV | 2011-07-28 15:22 | 20M | |
![[SND]](/icons/sound2.gif) | 0728_152905.WAV | 2011-07-28 15:29 | 69M | |
![[SND]](/icons/sound2.gif) | 0728_154434.WAV | 2011-07-28 15:44 | 116M | |
![[SND]](/icons/sound2.gif) | 0728_162508.WAV | 2011-07-28 16:45 | 327M | |
![[SND]](/icons/sound2.gif) | 0728_165103.WAV | 2011-07-28 16:51 | 182M | |
![[SND]](/icons/sound2.gif) | sassafras_promo.wav | 2011-07-28 23:54 | 26M | |
![[SND]](/icons/sound2.gif) | 110728_222136_SRS001..> | 2011-07-29 00:17 | 1.3G | |
![[SND]](/icons/sound2.gif) | 13 -en mi opinion.wav | 2011-08-03 12:03 | 24M | |
![[SND]](/icons/sound2.gif) | 110803_211252_SRS001..> | 2011-08-03 21:16 | 35M | |
![[SND]](/icons/sound2.gif) | 110803_185755_SRS001..> | 2011-08-03 21:53 | 2.0G | |
![[SND]](/icons/sound2.gif) | Colonial Man.WAV | 2011-08-04 07:56 | 82M | |
![[SND]](/icons/sound2.gif) | questions4audience.WAV | 2011-08-04 14:22 | 116M | |
![[SND]](/icons/sound2.gif) | 110805_000420_SRS001..> | 2011-08-05 00:06 | 18M | |
![[SND]](/icons/sound2.gif) | 110804_222925_SRS001..> | 2011-08-05 00:25 | 1.3G | |
![[SND]](/icons/sound2.gif) | 110808_195853_SRS001..> | 2011-08-08 21:21 | 1.0G | |
![[SND]](/icons/sound2.gif) | 110809_220259_SRS001..> | 2011-08-09 23:22 | 771M | |
![[SND]](/icons/sound2.gif) | 110809_194759_SRS001..> | 2011-08-09 23:46 | 2.0G | |
![[SND]](/icons/sound2.gif) | patti_b.WAV | 2011-08-10 20:55 | 42M | |
![[SND]](/icons/sound2.gif) | 110810_190801_SRS001..> | 2011-08-11 20:03 | 1.8G | |
![[SND]](/icons/sound2.gif) | 110811_223203_SRS001..> | 2011-08-12 01:16 | 1.9G | |
![[SND]](/icons/sound2.gif) | 0814_120751.WAV | 2011-08-14 12:07 | 76M | |
![[SND]](/icons/sound2.gif) | 110814_200052_SRS001..> | 2011-08-14 21:59 | 1.4G | |
![[SND]](/icons/sound2.gif) | 110815_195859_SRS001..> | 2011-08-15 21:24 | 1.0G | |
![[SND]](/icons/sound2.gif) | 110816_200005_SRS001..> | 2011-08-16 21:27 | 1.0G | |
![[SND]](/icons/sound2.gif) | 110817_191600_SRS001..> | 2011-08-17 21:59 | 1.8G | |
![[SND]](/icons/sound2.gif) | james_quall_promo.wav | 2011-08-19 00:06 | 19M | |
![[SND]](/icons/sound2.gif) | 110818_222100_SRS001..> | 2011-08-19 00:33 | 1.5G | |
![[SND]](/icons/sound2.gif) | MMRP-James_Quall.wav | 2011-08-19 08:36 | 1.0G | |
![[SND]](/icons/sound2.gif) | SRS_010.WAV | 2011-08-20 15:13 | 100M | |
![[SND]](/icons/sound2.gif) | 110821_201057_SRS001..> | 2011-08-21 21:57 | 1.2G | |
![[SND]](/icons/sound2.gif) | 110822_195550_SRS001..> | 2011-08-22 21:20 | 1.0G | |
![[SND]](/icons/sound2.gif) | 110824_190853_SRS001..> | 2011-08-24 21:50 | 1.7G | |
![[SND]](/icons/sound2.gif) | 110826_010040_SRS001..> | 2011-08-26 01:06 | 47M | |
![[SND]](/icons/sound2.gif) | 110826_004537_SRS001..> | 2011-08-26 01:12 | 224M | |
![[SND]](/icons/sound2.gif) | 110825_223040_SRS001..> | 2011-08-26 01:48 | 2.0G | |
![[SND]](/icons/sound2.gif) | Katy Perry -E.T..wav | 2011-08-28 14:54 | 38M | |
![[SND]](/icons/sound2.gif) | americans_should_eat..> | 2011-08-28 16:15 | 1.7M | |
![[SND]](/icons/sound2.gif) | 110828_190616_SRS001..> | 2011-08-28 21:18 | 17M | |
![[SND]](/icons/sound2.gif) | 110828_175859_SRS001..> | 2011-08-28 21:55 | 1.0G | |
![[SND]](/icons/sound2.gif) | 110828_195949_SRS001..> | 2011-08-28 21:57 | 1.1G | |
![[SND]](/icons/sound2.gif) | 110829_195914_SRS001..> | 2011-08-29 21:17 | 926M | |
![[SND]](/icons/sound2.gif) | 110831_191326_SRS001..> | 2011-08-31 21:32 | 1.6G | |
![[SND]](/icons/sound2.gif) | 110901_224143_SRS001..> | 2011-09-02 01:20 | 1.8G | |
![[SND]](/icons/sound2.gif) | Sex Dwarf - Soft Cel..> | 2011-09-04 15:55 | 58M | |
![[SND]](/icons/sound2.gif) | Give Head - Dirty Sa..> | 2011-09-04 15:58 | 31M | |
![[SND]](/icons/sound2.gif) | Master and Servant -..> | 2011-09-04 16:02 | 42M | |
![[SND]](/icons/sound2.gif) | Titties Bounce by Gr..> | 2011-09-04 16:17 | 31M | |
![[SND]](/icons/sound2.gif) | 110904_190645_SRS001..> | 2011-09-04 19:08 | 9.7M | |
![[SND]](/icons/sound2.gif) | 110904_175938_SRS001..> | 2011-09-04 19:25 | 1.0G | |
![[SND]](/icons/sound2.gif) | 110904_195926_SRS001..> | 2011-09-04 21:57 | 1.2G | |
![[SND]](/icons/sound2.gif) | SRS_002.WAV | 2011-09-11 12:05 | 59M | |
![[SND]](/icons/sound2.gif) | SRS_003.WAV | 2011-09-11 12:05 | 181K | |
![[SND]](/icons/sound2.gif) | SRS_004.WAV | 2011-09-11 12:25 | 112M | |
![[SND]](/icons/sound2.gif) | SRS_005.WAV | 2011-09-11 13:08 | 148M | |
![[SND]](/icons/sound2.gif) | SRS_006.WAV | 2011-09-11 15:04 | 313M | |
![[SND]](/icons/sound2.gif) | SRS_007.WAV | 2011-09-11 16:06 | 201M | |
![[SND]](/icons/sound2.gif) | 110912_015018_SRS001..> | 2011-09-12 01:50 | 6.4M | |
![[SND]](/icons/sound2.gif) | 110912_195644_SRS001..> | 2011-09-12 21:45 | 1.2G | |
![[SND]](/icons/sound2.gif) | Bad Dreams Dig_MSTR2..> | 2011-09-14 20:51 | 42M | |
![[SND]](/icons/sound2.gif) | 110914_192046_SRS001..> | 2011-09-14 22:44 | 1.9G | |
![[SND]](/icons/sound2.gif) | 110915_220424_SRS001..> | 2011-09-16 00:32 | 1.7G | |
![[SND]](/icons/sound2.gif) | mentionedrealignment..> | 2011-09-18 09:07 | 55M | |
![[SND]](/icons/sound2.gif) | 110918_172929_SRS001..> | 2011-09-18 17:42 | 151M | |
![[SND]](/icons/sound2.gif) | 110918_191822_SRS001..> | 2011-09-18 19:26 | 74M | |
![[SND]](/icons/sound2.gif) | 110918_191050_SRS001..> | 2011-09-18 19:27 | 91M | |
![[SND]](/icons/sound2.gif) | 110918_175941_SRS001..> | 2011-09-18 19:33 | 1.0G | |
![[SND]](/icons/sound2.gif) | 110919_195610_SRS001..> | 2011-09-19 21:33 | 1.1G | |
![[SND]](/icons/sound2.gif) | 110921_191645_SRS001..> | 2011-09-21 21:29 | 1.5G | |
![[SND]](/icons/sound2.gif) | Welcome.wav | 2011-09-25 16:01 | 5.3M | |
![[SND]](/icons/sound2.gif) | select show intro.wav | 2011-09-25 16:02 | 1.8M | |
![[SND]](/icons/sound2.gif) | Select Show Repeat.wav | 2011-09-25 16:04 | 1.9M | |
![[SND]](/icons/sound2.gif) | Show Active 1.wav | 2011-09-25 16:05 | 6.8M | |
![[SND]](/icons/sound2.gif) | Show Closing 1.wav | 2011-09-25 16:07 | 6.1M | |
![[SND]](/icons/sound2.gif) | vm general 1.wav | 2011-09-25 16:10 | 2.9M | |
![[SND]](/icons/sound2.gif) | vm queue dump 1.wav | 2011-09-25 16:12 | 4.9M | |
![[SND]](/icons/sound2.gif) | screen direct 1.wav | 2011-09-25 16:14 | 1.1M | |
![[SND]](/icons/sound2.gif) | invalid entry 1.wav | 2011-09-25 16:16 | 684K | |
![[SND]](/icons/sound2.gif) | invalid entry warnin..> | 2011-09-25 16:17 | 1.6M | |
![[SND]](/icons/sound2.gif) | invalid entry goodby..> | 2011-09-25 16:20 | 1.5M | |
![[SND]](/icons/sound2.gif) | show offer 1.wav | 2011-09-25 16:25 | 1.4M | |
![[SND]](/icons/sound2.gif) | show intro 1.wav | 2011-09-25 16:26 | 1.5M | |
![[SND]](/icons/sound2.gif) | show offer 2.wav | 2011-09-25 16:28 | 1.4M | |
![[SND]](/icons/sound2.gif) | show intro 2.wav | 2011-09-25 16:30 | 1.2M | |
![[SND]](/icons/sound2.gif) | show offer 3.wav | 2011-09-25 16:30 | 1.2M | |
![[SND]](/icons/sound2.gif) | show intro 3.wav | 2011-09-25 16:32 | 1.4M | |
![[SND]](/icons/sound2.gif) | show introo 3.wav | 2011-09-25 16:32 | 1.4M | |
![[SND]](/icons/sound2.gif) | show offer 4.wav | 2011-09-25 16:34 | 1.3M | |
![[SND]](/icons/sound2.gif) | show intro 4.wav | 2011-09-25 16:35 | 1.2M | |
![[SND]](/icons/sound2.gif) | show offer 5.wav | 2011-09-25 16:36 | 1.0M | |
![[SND]](/icons/sound2.gif) | show intro 5.wav | 2011-09-25 16:37 | 1.1M | |
![[SND]](/icons/sound2.gif) | Welcome 1.wav | 2011-09-25 16:48 | 1.1M | |
![[SND]](/icons/sound2.gif) | Welcome 1 1.wav | 2011-09-25 16:48 | 1.1M | |
![[SND]](/icons/sound2.gif) | Welcome 1 2.wav | 2011-09-25 16:48 | 1.1M | |
![[SND]](/icons/sound2.gif) | Welcome 2.wav | 2011-09-25 16:48 | 1.1M | |
![[SND]](/icons/sound2.gif) | Welcome 2 1.wav | 2011-09-25 16:48 | 1.1M | |
![[SND]](/icons/sound2.gif) | Welcome 2 2.wav | 2011-09-25 16:48 | 1.1M | |
![[SND]](/icons/sound2.gif) | 110925_180231_SRS001..> | 2011-09-25 19:24 | 969M | |
![[SND]](/icons/sound2.gif) | psychopaths.wav | 2011-09-26 17:22 | 9.3M | |
![[SND]](/icons/sound2.gif) | OutgoingFile.wav | 2011-09-26 21:45 | 969M | |
![[SND]](/icons/sound2.gif) | 110926_195929_SRS001..> | 2011-09-26 21:53 | 1.0G | |
![[SND]](/icons/sound2.gif) | select-show-intro.wav | 2011-09-27 12:01 | 1.9M | |
![[SND]](/icons/sound2.gif) | Select-show-repeat.wav | 2011-09-27 12:02 | 1.9M | |
![[SND]](/icons/sound2.gif) | Show-Active-1.wav | 2011-09-27 12:09 | 6.8M | |
![[SND]](/icons/sound2.gif) | Show-Active-2.wav | 2011-09-27 12:09 | 6.8M | |
![[SND]](/icons/sound2.gif) | Show-Active-3.wav | 2011-09-27 12:09 | 6.8M | |
![[SND]](/icons/sound2.gif) | Show-Active-4.wav | 2011-09-27 12:10 | 6.8M | |
![[SND]](/icons/sound2.gif) | Show-Active-5.wav | 2011-09-27 12:10 | 6.8M | |
![[SND]](/icons/sound2.gif) | Show-Closing-1.wav | 2011-09-27 12:11 | 6.1M | |
![[SND]](/icons/sound2.gif) | Show-Closing-2.wav | 2011-09-27 12:11 | 6.1M | |
![[SND]](/icons/sound2.gif) | Show-Closing-3.wav | 2011-09-27 12:11 | 6.1M | |
![[SND]](/icons/sound2.gif) | Show-Closing-4.wav | 2011-09-27 12:11 | 6.1M | |
![[SND]](/icons/sound2.gif) | Show-Closing-5.wav | 2011-09-27 12:12 | 6.1M | |
![[SND]](/icons/sound2.gif) | VM-General-1.wav | 2011-09-27 12:12 | 2.9M | |
![[SND]](/icons/sound2.gif) | VM-General-2.wav | 2011-09-27 12:13 | 2.9M | |
![[SND]](/icons/sound2.gif) | VM-General-3.wav | 2011-09-27 12:13 | 2.9M | |
![[SND]](/icons/sound2.gif) | VM-General-4.wav | 2011-09-27 12:13 | 2.9M | |
![[SND]](/icons/sound2.gif) | VM-General-5.wav | 2011-09-27 12:13 | 2.9M | |
![[SND]](/icons/sound2.gif) | VM-Queue-dump-1.wav | 2011-09-27 12:14 | 4.9M | |
![[SND]](/icons/sound2.gif) | VM-Queue-dump-2.wav | 2011-09-27 12:14 | 4.9M | |
![[SND]](/icons/sound2.gif) | VM-Queue-dump-3.wav | 2011-09-27 12:14 | 4.9M | |
![[SND]](/icons/sound2.gif) | VM-Queue-dump-4.wav | 2011-09-27 12:15 | 4.9M | |
![[SND]](/icons/sound2.gif) | VM-Queue-dump-5.wav | 2011-09-27 12:15 | 4.9M | |
![[SND]](/icons/sound2.gif) | screen intro 1.wav | 2011-09-27 12:15 | 1.7M | |
![[SND]](/icons/sound2.gif) | Screen-Intro-1.wav | 2011-09-27 12:16 | 1.7M | |
![[SND]](/icons/sound2.gif) | Screen-Intro-2.wav | 2011-09-27 12:16 | 1.7M | |
![[SND]](/icons/sound2.gif) | Screen-Intro-3.wav | 2011-09-27 12:16 | 1.7M | |
![[SND]](/icons/sound2.gif) | Screen-Intro-4.wav | 2011-09-27 12:16 | 1.7M | |
![[SND]](/icons/sound2.gif) | Screen-Intro-5.wav | 2011-09-27 12:16 | 1.7M | |
![[SND]](/icons/sound2.gif) | Screen-Direct-1.wav | 2011-09-27 12:17 | 1.1M | |
![[SND]](/icons/sound2.gif) | Screen-Direct-2.wav | 2011-09-27 12:17 | 1.1M | |
![[SND]](/icons/sound2.gif) | Screen-Direct-3.wav | 2011-09-27 12:18 | 1.1M | |
![[SND]](/icons/sound2.gif) | Screen-Direct-4.wav | 2011-09-27 12:18 | 1.1M | |
![[SND]](/icons/sound2.gif) | Screen-Direct-5.wav | 2011-09-27 12:18 | 1.1M | |
![[SND]](/icons/sound2.gif) | No-Response-Warning-..> | 2011-09-27 12:23 | 2.3M | |
![[SND]](/icons/sound2.gif) | No-Response-Warning-..> | 2011-09-27 12:23 | 2.3M | |
![[SND]](/icons/sound2.gif) | No-Response-Warning-..> | 2011-09-27 12:23 | 2.3M | |
![[SND]](/icons/sound2.gif) | Invalid-Entry-1.wav | 2011-09-27 13:02 | 685K | |
![[SND]](/icons/sound2.gif) | Invalid-Entry-2.wav | 2011-09-27 13:02 | 685K | |
![[SND]](/icons/sound2.gif) | Invalid-Entry-3.wav | 2011-09-27 13:02 | 686K | |
![[SND]](/icons/sound2.gif) | Invalid-Entry-4.wav | 2011-09-27 13:02 | 686K | |
![[SND]](/icons/sound2.gif) | Invalid-Entry-5.wav | 2011-09-27 13:03 | 687K | |
![[SND]](/icons/sound2.gif) | Invalid-Entry-Goodby..> | 2011-09-27 13:03 | 1.5M | |
![[SND]](/icons/sound2.gif) | Invalid-Entry-Goodby..> | 2011-09-27 13:03 | 1.5M | |
![[SND]](/icons/sound2.gif) | Invalid-Entry-Goodby..> | 2011-09-27 13:03 | 1.5M | |
![[SND]](/icons/sound2.gif) | Invalid-Entry-Goodby..> | 2011-09-27 13:04 | 1.5M | |
![[SND]](/icons/sound2.gif) | Invalid-Entry-Goodby..> | 2011-09-27 13:04 | 1.5M | |
![[SND]](/icons/sound2.gif) | Invalid-Entry-Warnin..> | 2011-09-27 13:04 | 1.6M | |
![[SND]](/icons/sound2.gif) | Invalid-Entry-Warnin..> | 2011-09-27 13:04 | 1.6M | |
![[SND]](/icons/sound2.gif) | Invalid-Entry-Warnin..> | 2011-09-27 13:05 | 1.6M | |
![[SND]](/icons/sound2.gif) | Invalid-Entry-Warnin..> | 2011-09-27 13:05 | 1.6M | |
![[SND]](/icons/sound2.gif) | Invalid-Entry-Warnin..> | 2011-09-27 13:05 | 1.6M | |
![[SND]](/icons/sound2.gif) | no response goodbye ..> | 2011-09-27 13:05 | 1.9M | |
![[SND]](/icons/sound2.gif) | no response warning ..> | 2011-09-27 13:06 | 2.3M | |
![[SND]](/icons/sound2.gif) | No-Response-Goodbye-..> | 2011-09-27 13:06 | 1.9M | |
![[SND]](/icons/sound2.gif) | No-Response-Goodbye-..> | 2011-09-27 13:07 | 1.9M | |
![[SND]](/icons/sound2.gif) | No-Response-Goodbye-..> | 2011-09-27 13:07 | 1.9M | |
![[SND]](/icons/sound2.gif) | No-Response-Goodbye-..> | 2011-09-27 13:07 | 1.9M | |
![[SND]](/icons/sound2.gif) | No-Response-Goodbye-..> | 2011-09-27 13:08 | 1.9M | |
![[SND]](/icons/sound2.gif) | No-Response-Warning-..> | 2011-09-27 13:09 | 2.3M | |
![[SND]](/icons/sound2.gif) | No-Response-Warning-..> | 2011-09-27 13:10 | 2.3M | |
![[SND]](/icons/sound2.gif) | 110928_191034_SRS001..> | 2011-09-28 21:36 | 1.7G | |
![[SND]](/icons/sound2.gif) | Sept_28_2011-Pinata_..> | 2011-09-29 20:06 | 1.7G | |
![[SND]](/icons/sound2.gif) | Sept_28_2011-Pinata_..> | 2011-09-29 20:09 | 1.7G | |
![[SND]](/icons/sound2.gif) | 110929_223910_SRS001..> | 2011-09-30 01:06 | 1.7G | |
![[SND]](/icons/sound2.gif) | R09_0006.WAV | 2011-10-01 08:24 | 62M | |
![[SND]](/icons/sound2.gif) | R09_0007.WAV | 2011-10-01 08:53 | 83M | |
![[SND]](/icons/sound2.gif) | 111002_192105_SRS001..> | 2011-10-02 19:21 | 5.7M | |
![[SND]](/icons/sound2.gif) | 111002_180219_SRS001..> | 2011-10-02 19:27 | 1.0G | |
![[SND]](/icons/sound2.gif) | 111002_200007_SRS001..> | 2011-10-02 21:19 | 935M | |
![[SND]](/icons/sound2.gif) | 01 Focus.wav | 2011-10-02 23:21 | 41M | |
![[SND]](/icons/sound2.gif) | 2-04 Chefs In Da Kit..> | 2011-10-02 23:21 | 21M | |
![[SND]](/icons/sound2.gif) | End Of A Cycle.wav | 2011-10-02 23:21 | 27M | |
![[SND]](/icons/sound2.gif) | 111003_195943_SRS001..> | 2011-10-03 21:23 | 1.0G | |
![[SND]](/icons/sound2.gif) | everytime.wav | 2011-10-04 02:07 | 26M | |
![[SND]](/icons/sound2.gif) | corp.bap mix 4.wav | 2011-10-04 19:26 | 58M | |
![[SND]](/icons/sound2.gif) | 111005_190517_SRS001..> | 2011-10-05 21:34 | 1.7G | |
![[SND]](/icons/sound2.gif) | 111006_220057_SRS001..> | 2011-10-07 00:32 | 1.7G | |
![[SND]](/icons/sound2.gif) | SRS_008.WAV | 2011-10-08 17:08 | 675K | |
![[SND]](/icons/sound2.gif) | SRS_009.WAV | 2011-10-08 17:34 | 25M | |
![[SND]](/icons/sound2.gif) | 111009_191026_SRS001..> | 2011-10-09 19:12 | 15M | |
![[SND]](/icons/sound2.gif) | 111009_175932_SRS001..> | 2011-10-09 19:20 | 956M | |
![[SND]](/icons/sound2.gif) | 111009_200310_SRS001..> | 2011-10-09 21:44 | 957M | |
![[SND]](/icons/sound2.gif) | 111010_195950_SRS001..> | 2011-10-10 21:21 | 955M | |
![[SND]](/icons/sound2.gif) | PVT SEPTEMBER MIX.wav | 2011-10-12 11:52 | 572M | |
![[SND]](/icons/sound2.gif) | 111012_190349_SRS001..> | 2011-10-12 21:33 | 1.7G | |
![[SND]](/icons/sound2.gif) | 111013_215844_SRS001..> | 2011-10-14 00:52 | 1.9G | |
![[SND]](/icons/sound2.gif) | 111016_180400_SRS001..> | 2011-10-16 19:20 | 902M | |
![[SND]](/icons/sound2.gif) | 111017_195924_SRS001..> | 2011-10-17 21:38 | 1.0G | |
![[SND]](/icons/sound2.gif) | 111019_190314_SRS001..> | 2011-10-19 21:34 | 1.7G | |
![[SND]](/icons/sound2.gif) | 111021_002950_SRS001..> | 2011-10-21 00:32 | 5.4M | |
![[SND]](/icons/sound2.gif) | 111021_003027_SRS001..> | 2011-10-21 00:32 | 4.4M | |
![[SND]](/icons/sound2.gif) | 111020_222606_SRS001..> | 2011-10-21 01:06 | 1.8G | |
![[SND]](/icons/sound2.gif) | 20 Midnight Radio 99..> | 2011-10-27 11:57 | 54M | |
![[SND]](/icons/sound2.gif) | 219 Midnight Radio 9..> | 2011-10-27 11:57 | 54M | |
![[SND]](/icons/sound2.gif) | Midnight Radio 99.wav | 2011-10-27 11:57 | 54M | |
![[SND]](/icons/sound2.gif) | 111116_200150_SRS001..> | 2011-11-16 21:33 | 1.7G | |
![[SND]](/icons/sound2.gif) | 111117_231640_SRS001..> | 2011-11-18 00:38 | 1.6G | |
![[SND]](/icons/sound2.gif) | 17 When Your Mind's ..> | 2011-11-20 02:15 | 40M | |
![[SND]](/icons/sound2.gif) | 216 When Your Mind's..> | 2011-11-20 02:15 | 40M | |
![[SND]](/icons/sound2.gif) | 111120_185846_SRS001..> | 2011-11-21 08:09 | 1.0G | |
![[SND]](/icons/sound2.gif) | 111120_205920_SRS001..> | 2011-11-21 08:19 | 1.1G | |
![[SND]](/icons/sound2.gif) | 111121_205920_SRS001..> | 2011-11-22 12:02 | 956M | |
![[SND]](/icons/sound2.gif) | 111123_231002_SRS001..> | 2011-11-25 04:03 | 1.6G | |
![[SND]](/icons/sound2.gif) | 111123_200057_SRS001..> | 2011-11-25 04:11 | 1.8G | |
![[SND]](/icons/sound2.gif) | 111127_180021_SRS001..> | 2011-11-28 12:56 | 1.0G | |
![[SND]](/icons/sound2.gif) | 111127_200005_SRS001..> | 2011-11-28 13:13 | 1.2G | |
![[SND]](/icons/sound2.gif) | 111128_200005_SRS001..> | 2011-11-29 10:06 | 961M | |
![[SND]](/icons/sound2.gif) | 111130_190342_SRS001..> | 2011-11-30 21:36 | 1.7G | |
![[SND]](/icons/sound2.gif) | 111202_001514_SRS001..> | 2011-12-04 10:44 | 285M | |
![[SND]](/icons/sound2.gif) | 111201_220013_SRS001..> | 2011-12-04 15:38 | 2.0G | |
![[SND]](/icons/sound2.gif) | 111204_180058_SRS001..> | 2011-12-04 19:24 | 1.0G | |
![[SND]](/icons/sound2.gif) | 111205_185814_SRS001..> | 2011-12-05 19:05 | 85M | |
![[SND]](/icons/sound2.gif) | 111205_195952_SRS001..> | 2011-12-05 21:21 | 941M | |
![[SND]](/icons/sound2.gif) | 111207_191127_SRS001..> | 2011-12-07 21:51 | 1.8G | |
![[SND]](/icons/sound2.gif) | 111207_191127_SRS001..> | 2011-12-09 01:06 | 1.8G | |
![[SND]](/icons/sound2.gif) | 111210_152207_SRS001..> | 2011-12-10 15:23 | 8.4M | |
![[SND]](/icons/sound2.gif) | 111208_222124_SRS001..> | 2011-12-10 15:42 | 1.9G | |
![[SND]](/icons/sound2.gif) | 111210_195934_SRS001..> | 2011-12-10 21:32 | 1.1G | |
![[SND]](/icons/sound2.gif) | 111211_175959_SRS001..> | 2011-12-11 19:22 | 959M | |
![[SND]](/icons/sound2.gif) | 111211_195956_SRS001..> | 2011-12-11 21:18 | 915M | |
![[SND]](/icons/sound2.gif) | 111212_195951_SRS001..> | 2011-12-14 17:23 | 208K | |
![[SND]](/icons/sound2.gif) | 111214_211649_SRS001..> | 2011-12-14 21:46 | 38M | |
![[SND]](/icons/sound2.gif) | 111214_190148_SRS001..> | 2011-12-14 22:24 | 2.0G | |
![[SND]](/icons/sound2.gif) | 111216_003637_SRS001..> | 2011-12-16 00:39 | 23M | |
![[SND]](/icons/sound2.gif) | 111215_222139_SRS001..> | 2011-12-16 11:57 | 2.0G | |
![[SND]](/icons/sound2.gif) | 111217_200020_SRS001..> | 2011-12-17 20:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | 111218_180301_SRS001..> | 2011-12-18 18:03 | 1.4G | |
![[SND]](/icons/sound2.gif) | 111218_200043_SRS001..> | 2011-12-18 20:00 | 886M | |
![[SND]](/icons/sound2.gif) | 111219_200006_SRS001..> | 2011-12-19 20:00 | 1.0G | |
![[SND]](/icons/sound2.gif) | 111221_185853_SRS001..> | 2011-12-21 18:58 | 1.9G | |
![[SND]](/icons/sound2.gif) | 111222_224039_SRS001..> | 2011-12-23 11:28 | 1.8G | |
![[SND]](/icons/sound2.gif) | 111223_142918_SRS001..> | 2011-12-23 14:58 | 341M | |
![[SND]](/icons/sound2.gif) | R09_0003.WAV | 2011-12-26 14:57 | 156M | |
![[SND]](/icons/sound2.gif) | R09_0004.WAV | 2011-12-26 15:53 | 157M | |
![[SND]](/icons/sound2.gif) | R09_0005.WAV | 2011-12-26 16:20 | 202M | |
![[SND]](/icons/sound2.gif) | R09_0008.WAV | 2011-12-27 08:50 | 385M | |
![[SND]](/icons/sound2.gif) | YOUR MAN STEM MIXXX ..> | 2011-12-28 16:56 | 41M | |
![[SND]](/icons/sound2.gif) | FAR AWAY STEM MIXXX ..> | 2011-12-28 17:18 | 30M | |
![[SND]](/icons/sound2.gif) | R09_0009.WAV | 2011-12-30 19:51 | 1.5G | |
![[SND]](/icons/sound2.gif) | 120102_200024_SRS001..> | 2012-01-02 20:00 | 1.0G | |
![[SND]](/icons/sound2.gif) | 8 Molly 00.wav | 2012-01-03 23:39 | 29M | |
![[SND]](/icons/sound2.gif) | 120104_190239_SRS001..> | 2012-01-04 19:02 | 2.0G | |
![[SND]](/icons/sound2.gif) | 120104_211740_SRS001..> | 2012-01-04 21:17 | 62M | |
![[SND]](/icons/sound2.gif) | 120104_212456_SRS001..> | 2012-01-04 21:24 | 21M | |
![[SND]](/icons/sound2.gif) | VC010412.wav | 2012-01-04 21:26 | 21M | |
![[SND]](/icons/sound2.gif) | 120104_213141_SRS001..> | 2012-01-04 21:31 | 50M | |
![[SND]](/icons/sound2.gif) | voice crap.wav | 2012-01-04 21:35 | 21M | |
![[SND]](/icons/sound2.gif) | 120105_223544_SRS001..> | 2012-01-05 22:35 | 1.5G | |
![[SND]](/icons/sound2.gif) | 120107_200003_SRS001..> | 2012-01-07 20:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | 120108_191225_SRS001..> | 2012-01-08 19:12 | 34M | |
![[SND]](/icons/sound2.gif) | 120108_200012_SRS001..> | 2012-01-08 20:00 | 1.3G | |
![[SND]](/icons/sound2.gif) | 120109_200046_SRS001..> | 2012-01-09 20:00 | 1.0G | |
![[SND]](/icons/sound2.gif) | 120110_200002_SRS001..> | 2012-01-10 20:00 | 577M | |
![[SND]](/icons/sound2.gif) | 120110_210350_SRS001..> | 2012-01-10 21:03 | 2.0G | |
![[SND]](/icons/sound2.gif) | 120110_231847_SRS001..> | 2012-01-10 23:18 | 350M | |
![[SND]](/icons/sound2.gif) | 120111_190019_SRS001..> | 2012-01-11 19:00 | 2.0G | |
![[SND]](/icons/sound2.gif) | 120111_211520_SRS001..> | 2012-01-11 21:15 | 184M | |
![[SND]](/icons/sound2.gif) | R09_0010.WAV | 2012-01-12 19:12 | 1.3G | |
![[SND]](/icons/sound2.gif) | 120112_220450_SRS001..> | 2012-01-13 02:03 | 1.5G | |
![[SND]](/icons/sound2.gif) | SRS_012.WAV | 2012-01-13 18:18 | 276M | |
![[SND]](/icons/sound2.gif) | 120114_195921_SRS001..> | 2012-01-14 19:59 | 1.2G | |
![[SND]](/icons/sound2.gif) | 120115_180007_SRS001..> | 2012-01-15 18:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | 120115_200005_SRS001..> | 2012-01-15 20:00 | 1.0G | |
![[SND]](/icons/sound2.gif) | 20 River Man 69.wav | 2012-01-15 23:41 | 44M | |
![[SND]](/icons/sound2.gif) | River Man.wav | 2012-01-15 23:41 | 44M | |
![[SND]](/icons/sound2.gif) | 120116_200010_SRS001..> | 2012-01-16 20:00 | 962M | |
![[SND]](/icons/sound2.gif) | 22 South Side 00.wav | 2012-01-17 02:22 | 39M | |
![[SND]](/icons/sound2.gif) | South Side 00.wav | 2012-01-17 02:22 | 39M | |
![[SND]](/icons/sound2.gif) | 12 C'est Le Vent, Be..> | 2012-01-17 08:51 | 43M | |
![[SND]](/icons/sound2.gif) | 211 C'est Le Vent, B..> | 2012-01-17 08:51 | 43M | |
![[SND]](/icons/sound2.gif) | C'est Le Vent, Betty..> | 2012-01-17 08:51 | 43M | |
![[SND]](/icons/sound2.gif) | 120117_195939_SRS001..> | 2012-01-17 19:59 | 779M | |
![[SND]](/icons/sound2.gif) | 120117_210034_SRS001..> | 2012-01-17 21:00 | 2.0G | |
![[SND]](/icons/sound2.gif) | 120118_190150_SRS001..> | 2012-01-18 19:01 | 1.9G | |
![[SND]](/icons/sound2.gif) | 120119_220054_SRS001..> | 2012-01-19 22:00 | 1.8G | |
![[SND]](/icons/sound2.gif) | 120121_110455_SRS001..> | 2012-01-21 11:04 | 712M | |
![[SND]](/icons/sound2.gif) | 120121_195956_SRS001..> | 2012-01-21 19:59 | 2.0G | |
![[SND]](/icons/sound2.gif) | 120121_221456_SRS001..> | 2012-01-21 22:14 | 10M | |
![[SND]](/icons/sound2.gif) | Mat Time Radio Intro..> | 2012-01-22 14:28 | 49M | |
![[SND]](/icons/sound2.gif) | 120122_180014_SRS001..> | 2012-01-22 18:00 | 1.3G | |
![[SND]](/icons/sound2.gif) | 120122_194104_SRS001..> | 2012-01-22 19:41 | 12M | |
![[SND]](/icons/sound2.gif) | 120122_194153_SRS001..> | 2012-01-22 19:41 | 17M | |
![[SND]](/icons/sound2.gif) | 120122_195952_SRS001..> | 2012-01-22 19:59 | 914M | |
![[SND]](/icons/sound2.gif) | 120122_210059_SRS001..> | 2012-01-22 21:00 | 20M | |
![[SND]](/icons/sound2.gif) | 120122_210711_SRS001..> | 2012-01-22 21:07 | 1.1G | |
![[SND]](/icons/sound2.gif) | 120123_200002_SRS001..> | 2012-01-23 20:00 | 948M | |
![[SND]](/icons/sound2.gif) | 120125_190138_SRS001..> | 2012-01-25 19:01 | 1.2G | |
![[SND]](/icons/sound2.gif) | 120126_220007_SRS001..> | 2012-01-26 22:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | R09_0002.WAV | 2012-01-26 22:10 | 37M | |
![[SND]](/icons/sound2.gif) | Episode_35-MMRP-Bong..> | 2012-01-28 05:29 | 1.2G | |
![[SND]](/icons/sound2.gif) | 120128_110020_SRS001..> | 2012-01-28 11:00 | 596M | |
![[SND]](/icons/sound2.gif) | Episode_2-Chicksters..> | 2012-01-28 17:35 | 582M | |
![[SND]](/icons/sound2.gif) | 120128_110020_SRS001..> | 2012-01-28 19:03 | 582M | |
![[SND]](/icons/sound2.gif) | 120128_200028_SRS001..> | 2012-01-28 20:00 | 822M | |
![[SND]](/icons/sound2.gif) | 120128_221303_SRS001..> | 2012-01-28 22:13 | 5.5M | |
![[SND]](/icons/sound2.gif) | 120128_221618_SRS001..> | 2012-01-28 22:16 | 8.4M | |
![[SND]](/icons/sound2.gif) | 120128_221744_SRS001..> | 2012-01-28 22:17 | 4.2M | |
![[SND]](/icons/sound2.gif) | 120128_221837_SRS001..> | 2012-01-28 22:18 | 3.5M | |
![[SND]](/icons/sound2.gif) | 120128_222138_SRS001..> | 2012-01-28 22:21 | 10M | |
![[SND]](/icons/sound2.gif) | 120128_222311_SRS001..> | 2012-01-28 22:23 | 12M | |
![[SND]](/icons/sound2.gif) | 120128_225454_SRS001..> | 2012-01-28 22:54 | 4.4M | |
![[SND]](/icons/sound2.gif) | Color_Red.wav | 2012-01-29 14:51 | 42M | |
![[SND]](/icons/sound2.gif) | Color_Red-processed.wav | 2012-01-29 15:03 | 42M | |
![[SND]](/icons/sound2.gif) | 120129_153316_SRS001..> | 2012-01-29 15:33 | 102M | |
![[SND]](/icons/sound2.gif) | Poorman_Stickam_Call..> | 2012-01-29 15:53 | 95M | |
![[SND]](/icons/sound2.gif) | Poorman_Stickam_Call..> | 2012-01-29 16:43 | 95M | |
![[SND]](/icons/sound2.gif) | 120129_175957_SRS001..> | 2012-01-29 17:59 | 681M | |
![[SND]](/icons/sound2.gif) | 120129_191007_SRS001..> | 2012-01-29 19:10 | 10M | |
![[SND]](/icons/sound2.gif) | 120129_195953_SRS001..> | 2012-01-29 19:59 | 570M | |
![[SND]](/icons/sound2.gif) | 120129_210047_SRS001..> | 2012-01-29 21:00 | 852M | |
![[SND]](/icons/sound2.gif) | 120130_200003_SRS001..> | 2012-01-30 20:00 | 632M | |
![[SND]](/icons/sound2.gif) | 120130_214949_SRS001..> | 2012-01-30 21:49 | 114M | |
![[SND]](/icons/sound2.gif) | Lightnin_Woodcock-Pr..> | 2012-01-30 23:10 | 25M | |
![[SND]](/icons/sound2.gif) | 120131_195959_SRS001..> | 2012-01-31 19:59 | 500M | |
![[SND]](/icons/sound2.gif) | 120131_205901_SRS001..> | 2012-01-31 20:59 | 1.4G | |
![[SND]](/icons/sound2.gif) | 120131_195959_SRS001..> | 2012-02-01 02:49 | 497M | |
![[SND]](/icons/sound2.gif) | 120131_205901_SRS001..> | 2012-02-01 03:00 | 1.4G | |
![[SND]](/icons/sound2.gif) | 120131_195959_SRS001..> | 2012-02-01 05:34 | 497M | |
![[SND]](/icons/sound2.gif) | 120131_205901_SRS001..> | 2012-02-01 09:26 | 1.4G | |
![[SND]](/icons/sound2.gif) | 120201_190628_SRS001..> | 2012-02-01 19:06 | 1.1G | |
![[SND]](/icons/sound2.gif) | 120201_190628_SRS001..> | 2012-02-02 13:08 | 1.1G | |
![[SND]](/icons/sound2.gif) | 120201_190628_SRS001..> | 2012-02-02 17:45 | 1.1G | |
![[SND]](/icons/sound2.gif) | 120202_190013_SRS001..> | 2012-02-02 19:00 | 841K | |
![[SND]](/icons/sound2.gif) | 120202_190020_SRS001..> | 2012-02-02 19:00 | 1.3G | |
![[SND]](/icons/sound2.gif) | 120202_190020_SRS001..> | 2012-02-02 22:12 | 1.3G | |
![[SND]](/icons/sound2.gif) | 120202_222512_SRS001..> | 2012-02-02 22:25 | 1.3G | |
![[SND]](/icons/sound2.gif) | 120202_190020_SRS001..> | 2012-02-03 03:45 | 1.3G | |
![[SND]](/icons/sound2.gif) | 120204_110004_SRS001..> | 2012-02-04 11:00 | 522M | |
![[SND]](/icons/sound2.gif) | 120204_110004_SRS001..> | 2012-02-04 12:35 | 518M | |
![[SND]](/icons/sound2.gif) | 120204_110004_SRS001..> | 2012-02-04 14:41 | 518M | |
![[SND]](/icons/sound2.gif) | Episode_3-Chickster_..> | 2012-02-04 19:15 | 522M | |
![[SND]](/icons/sound2.gif) | Episode_3-Chickster_..> | 2012-02-04 19:25 | 518M | |
![[SND]](/icons/sound2.gif) | 120204_195953_SRS001..> | 2012-02-04 19:59 | 1.0G | |
![[SND]](/icons/sound2.gif) | Episode_3-Chickster_..> | 2012-02-04 21:35 | 518M | |
![[SND]](/icons/sound2.gif) | 120206_200006_SRS001..> | 2012-02-06 20:00 | 702M | |
![[SND]](/icons/sound2.gif) | 120204_195953_SRS001..> | 2012-02-06 22:27 | 1.0G | |
![[SND]](/icons/sound2.gif) | 120204_195953_SRS001..> | 2012-02-07 01:59 | 1.0G | |
![[SND]](/icons/sound2.gif) | 120206_200006_SRS001..> | 2012-02-07 11:47 | 700M | |
![[SND]](/icons/sound2.gif) | 120202_222512_SRS001..> | 2012-02-07 11:51 | 1.3G | |
![[SND]](/icons/sound2.gif) | 120206_200006_SRS001..> | 2012-02-07 15:06 | 700M | |
![[SND]](/icons/sound2.gif) | 120202_222512_SRS001..> | 2012-02-07 17:32 | 1.3G | |
![[SND]](/icons/sound2.gif) | 120207_201733_SRS001..> | 2012-02-07 20:17 | 461M | |
![[SND]](/icons/sound2.gif) | 120207_210805_SRS001..> | 2012-02-07 21:08 | 1.1G | |
![[SND]](/icons/sound2.gif) | 120207_210805_SRS001..> | 2012-02-08 00:17 | 1.1G | |
![[SND]](/icons/sound2.gif) | Episode_4-Ham_On_Eve..> | 2012-02-08 04:24 | 1.1G | |
![[SND]](/icons/sound2.gif) | 120208_190308_SRS001..> | 2012-02-08 19:03 | 1.2G | |
![[SND]](/icons/sound2.gif) | 120208_190308_SRS001..> | 2012-02-08 22:39 | 1.2G | |
![[SND]](/icons/sound2.gif) | Episode_33-Pinata_Ho..> | 2012-02-09 03:13 | 1.2G | |
![[SND]](/icons/sound2.gif) | 120209_185951_SRS001..> | 2012-02-09 18:59 | 1.6G | |
![[SND]](/icons/sound2.gif) | 5 Mandolin Wind 71.wav | 2012-02-09 22:13 | 57M | |
![[SND]](/icons/sound2.gif) | 49. Mandolin Wind.wav | 2012-02-09 22:13 | 57M | |
![[SND]](/icons/sound2.gif) | 120209_221702_SRS001..> | 2012-02-09 22:17 | 1.0G | |
![[SND]](/icons/sound2.gif) | 120209_221702_SRS001..> | 2012-02-10 02:29 | 1.0G | |
![[SND]](/icons/sound2.gif) | 120209_185951_SRS001..> | 2012-02-10 02:34 | 1.6G | |
![[SND]](/icons/sound2.gif) | Episode_37-MMRP-Kool..> | 2012-02-10 07:11 | 1.0G | |
![[SND]](/icons/sound2.gif) | Episode_2-The_Jayk_G..> | 2012-02-10 09:24 | 1.6G | |
![[SND]](/icons/sound2.gif) | 120211_110039_SRS001..> | 2012-02-11 11:00 | 710M | |
![[SND]](/icons/sound2.gif) | 120211_122742_SRS001..> | 2012-02-11 12:27 | 45M | |
![[SND]](/icons/sound2.gif) | 120211_124530_SRS001..> | 2012-02-11 12:45 | 24M | |
![[SND]](/icons/sound2.gif) | 120211_124917_SRS001..> | 2012-02-11 12:49 | 157M | |
![[SND]](/icons/sound2.gif) | 120211_130827_SRS001..> | 2012-02-11 13:08 | 3.0M | |
![[SND]](/icons/sound2.gif) | Boogie_By_The_River-..> | 2012-02-11 14:06 | 15M | |
![[SND]](/icons/sound2.gif) | 120211_195934_SRS001..> | 2012-02-11 19:59 | 658M | |
![[SND]](/icons/sound2.gif) | 120212_144505_SRS001..> | 2012-02-12 14:45 | 7.6M | |
![[SND]](/icons/sound2.gif) | 120212_144917_SRS001..> | 2012-02-12 14:49 | 6.6M | |
![[SND]](/icons/sound2.gif) | 120212_145310_SRS001..> | 2012-02-12 14:53 | 2.8M | |
![[SND]](/icons/sound2.gif) | 120212_145854_SRS001..> | 2012-02-12 14:58 | 2.7M | |
![[SND]](/icons/sound2.gif) | 120212_150159_SRS001..> | 2012-02-12 15:01 | 4.1M | |
![[SND]](/icons/sound2.gif) | 120212_150417_SRS001..> | 2012-02-12 15:04 | 1.9M | |
![[SND]](/icons/sound2.gif) | 120212_150643_SRS001..> | 2012-02-12 15:06 | 3.0M | |
![[SND]](/icons/sound2.gif) | 120212_151952_SRS001..> | 2012-02-12 15:19 | 4.4M | |
![[SND]](/icons/sound2.gif) | 120212_152456_SRS001..> | 2012-02-12 15:24 | 5.6M | |
![[SND]](/icons/sound2.gif) | Episode_11-The_Adam-..> | 2012-02-12 15:50 | 459M | |
![[SND]](/icons/sound2.gif) | 120212_200007_SRS001..> | 2012-02-12 20:00 | 629M | |
![[SND]](/icons/sound2.gif) | 1001.WAV | 2012-02-12 20:23 | 31M | |
![[SND]](/icons/sound2.gif) | 1002.WAV | 2012-02-12 20:29 | 10M | |
![[SND]](/icons/sound2.gif) | 1003.WAV | 2012-02-12 20:38 | 14M | |
![[SND]](/icons/sound2.gif) | 1004.WAV | 2012-02-12 21:05 | 88M | |
![[SND]](/icons/sound2.gif) | 120212_210823_SRS001..> | 2012-02-12 21:08 | 652M | |
![[SND]](/icons/sound2.gif) | 120213_200004_SRS001..> | 2012-02-13 20:00 | 664M | |
![[SND]](/icons/sound2.gif) | 120212_180018_SRS001..> | 2012-02-14 18:15 | 812M | |
![[SND]](/icons/sound2.gif) | 120212_222149_SRS001..> | 2012-02-14 18:37 | 28M | |
![[SND]](/icons/sound2.gif) | 120215_190136_SRS001..> | 2012-02-15 19:01 | 1.2G | |
![[SND]](/icons/sound2.gif) | 120216_190011_SRS001..> | 2012-02-16 19:00 | 1.3G | |
![[SND]](/icons/sound2.gif) | 120216_221737_SRS001..> | 2012-02-16 22:17 | 1.2G | |
![[SND]](/icons/sound2.gif) | 120217_004536_SRS001..> | 2012-02-17 00:45 | 53M | |
![[SND]](/icons/sound2.gif) | 120218_200144_SRS001..> | 2012-02-18 20:01 | 2.2M | |
![[SND]](/icons/sound2.gif) | 120218_200155_SRS001..> | 2012-02-18 20:01 | 786M | |
![[SND]](/icons/sound2.gif) | 120218_212307_SRS001..> | 2012-02-18 21:23 | 60M | |
![[SND]](/icons/sound2.gif) | 120219_144507_SRS001..> | 2012-02-19 14:45 | 6.8M | |
![[SND]](/icons/sound2.gif) | 120219_145224_SRS001..> | 2012-02-19 14:52 | 2.2M | |
![[SND]](/icons/sound2.gif) | 120219_145518_SRS001..> | 2012-02-19 14:55 | 5.8M | |
![[SND]](/icons/sound2.gif) | 120219_145759_SRS001..> | 2012-02-19 14:57 | 2.1M | |
![[SND]](/icons/sound2.gif) | 120219_151029_SRS001..> | 2012-02-19 15:10 | 2.1M | |
![[SND]](/icons/sound2.gif) | 120219_151110_SRS001..> | 2012-02-19 15:11 | 2.3M | |
![[SND]](/icons/sound2.gif) | 120219_151315_SRS001..> | 2012-02-19 15:13 | 5.8M | |
![[SND]](/icons/sound2.gif) | 120219_151601_SRS001..> | 2012-02-19 15:16 | 3.5M | |
![[SND]](/icons/sound2.gif) | 120219_151831_SRS001..> | 2012-02-19 15:18 | 1.6M | |
![[SND]](/icons/sound2.gif) | 120219_152035_SRS001..> | 2012-02-19 15:20 | 3.6M | |
![[SND]](/icons/sound2.gif) | 120219_180007_SRS001..> | 2012-02-19 18:00 | 793M | |
![[SND]](/icons/sound2.gif) | 120219_200004_SRS001..> | 2012-02-19 20:00 | 633M | |
![[SND]](/icons/sound2.gif) | 120219_210839_SRS001..> | 2012-02-19 21:08 | 740M | |
![[SND]](/icons/sound2.gif) | 120220_170110_SRS001..> | 2012-02-20 17:01 | 154M | |
![[SND]](/icons/sound2.gif) | 120220_195942_SRS001..> | 2012-02-20 19:59 | 687M | |
![[SND]](/icons/sound2.gif) | smb_gameover.wav | 2012-02-20 21:13 | 163K | |
![[SND]](/icons/sound2.gif) | smb_mariodie.wav | 2012-02-20 21:13 | 118K | |
![[SND]](/icons/sound2.gif) | smb_warning.wav | 2012-02-20 21:13 | 127K | |
![[SND]](/icons/sound2.gif) | smb_stage_clear.wav | 2012-02-20 21:13 | 244K | |
![[SND]](/icons/sound2.gif) | smb_world_clear.wav | 2012-02-20 21:13 | 271K | |
![[SND]](/icons/sound2.gif) | smb_1-up.wav | 2012-02-20 21:14 | 38K | |
![[SND]](/icons/sound2.gif) | smb_fireworks.wav | 2012-02-20 21:14 | 19K | |
![[SND]](/icons/sound2.gif) | 120220_211619_SRS001..> | 2012-02-20 21:16 | 1.5M | |
![[SND]](/icons/sound2.gif) | 120220_211823_SRS001..> | 2012-02-20 21:18 | 2.1M | |
![[SND]](/icons/sound2.gif) | 120220_213325_SRS001..> | 2012-02-20 21:33 | 21M | |
![[SND]](/icons/sound2.gif) | 120220_214043_SRS001..> | 2012-02-20 21:40 | 8.8M | |
![[SND]](/icons/sound2.gif) | Mario_Promo.wav | 2012-02-20 22:07 | 11M | |
![[SND]](/icons/sound2.gif) | Episode_38-MMRP-Joe_..> | 2012-02-21 16:13 | 1.2G | |
![[SND]](/icons/sound2.gif) | 120222_190229_SRS001..> | 2012-02-22 19:02 | 1.3G | |
![[SND]](/icons/sound2.gif) | 120223_190010_SRS001..> | 2012-02-23 19:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | 120223_222941_SRS001..> | 2012-02-23 22:29 | 968M | |
![[SND]](/icons/sound2.gif) | 120225_105956_SRS001..> | 2012-02-25 10:59 | 603M | |
![[SND]](/icons/sound2.gif) | 120225_225234_SRS001..> | 2012-02-25 22:52 | 7.8M | |
![[SND]](/icons/sound2.gif) | 120225_225629_SRS001..> | 2012-02-25 22:56 | 2.7M | |
![[SND]](/icons/sound2.gif) | 120225_225843_SRS001..> | 2012-02-25 22:58 | 11M | |
![[SND]](/icons/sound2.gif) | 120225_230212_SRS001..> | 2012-02-25 23:02 | 4.1M | |
![[SND]](/icons/sound2.gif) | 120225_230457_SRS001..> | 2012-02-25 23:04 | 6.2M | |
![[SND]](/icons/sound2.gif) | 120225_230839_SRS001..> | 2012-02-25 23:08 | 5.2M | |
![[SND]](/icons/sound2.gif) | 120225_231206_SRS001..> | 2012-02-25 23:12 | 4.1M | |
![[SND]](/icons/sound2.gif) | 120225_231508_SRS001..> | 2012-02-25 23:15 | 4.2M | |
![[SND]](/icons/sound2.gif) | 120225_231801_SRS001..> | 2012-02-25 23:18 | 7.5M | |
![[SND]](/icons/sound2.gif) | 120225_232019_SRS001..> | 2012-02-25 23:20 | 5.3M | |
![[SND]](/icons/sound2.gif) | 120226_180010_SRS001..> | 2012-02-26 18:00 | 594M | |
![[SND]](/icons/sound2.gif) | 120226_200029_SRS001..> | 2012-02-26 20:00 | 606M | |
![[SND]](/icons/sound2.gif) | 120226_210548_SRS001..> | 2012-02-26 21:05 | 831M | |
![[SND]](/icons/sound2.gif) | 120227_200012_SRS001..> | 2012-02-27 20:00 | 652M | |
![[SND]](/icons/sound2.gif) | 1 Glad 70.wav | 2012-02-27 20:54 | 70M | |
![[SND]](/icons/sound2.gif) | 208 Glad 70.wav | 2012-02-27 20:54 | 70M | |
![[SND]](/icons/sound2.gif) | Glad 70.wav | 2012-02-27 20:54 | 70M | |
![[SND]](/icons/sound2.gif) | 120229_190720_SRS001..> | 2012-02-29 19:07 | 1.1G | |
![[SND]](/icons/sound2.gif) | 120301_190017_SRS001..> | 2012-03-01 19:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | Still Alive.wav | 2012-03-01 19:50 | 41M | |
![[SND]](/icons/sound2.gif) | 120301_220016_SRS001..> | 2012-03-01 22:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | 120301_220016_SRS001..> | 2012-03-02 02:27 | 1.1G | |
![[SND]](/icons/sound2.gif) | 120302_200659_SRS001..> | 2012-03-02 20:06 | 1.2G | |
![[SND]](/icons/sound2.gif) | 120303_110001_SRS001..> | 2012-03-03 11:00 | 645M | |
![[SND]](/icons/sound2.gif) | saudi911.wav | 2012-03-03 18:47 | 12M | |
![[SND]](/icons/sound2.gif) | mittflop.wav | 2012-03-03 18:47 | 7.2M | |
![[SND]](/icons/sound2.gif) | satanvsUS.wav | 2012-03-03 18:47 | 3.6M | |
![[SND]](/icons/sound2.gif) | wilt.wav | 2012-03-03 18:47 | 6.8M | |
![[SND]](/icons/sound2.gif) | lorax.wav | 2012-03-03 18:47 | 8.0M | |
![[SND]](/icons/sound2.gif) | 120303_195437_SRS001..> | 2012-03-03 19:54 | 44M | |
![[SND]](/icons/sound2.gif) | 120303_200001_SRS001..> | 2012-03-03 20:00 | 606M | |
![[SND]](/icons/sound2.gif) | schedule_testing_120..> | 2012-03-04 16:05 | 20M | |
![[SND]](/icons/sound2.gif) | Realtor_Commercial.wav | 2012-03-04 17:17 | 130M | |
![[SND]](/icons/sound2.gif) | Mat_Time_Radio_12030..> | 2012-03-04 18:00 | 595M | |
![[SND]](/icons/sound2.gif) | New_Mat_Time_Radio_P..> | 2012-03-04 19:06 | 10M | |
![[SND]](/icons/sound2.gif) | The_Love_Bite_120304..> | 2012-03-04 20:00 | 596M | |
![[SND]](/icons/sound2.gif) | The_Weekly_Wrap_Up_1..> | 2012-03-04 21:00 | 595M | |
![[SND]](/icons/sound2.gif) | The_Qumran_Report_12..> | 2012-03-05 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | RealEstate_Commercia..> | 2012-03-06 19:56 | 8.1M | |
![[SND]](/icons/sound2.gif) | The_Adam_O_Podcast_1..> | 2012-03-06 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | Pinata_Hour_120307_1..> | 2012-03-07 19:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | The_Adam_O_Podcast_1..> | 2012-03-07 22:08 | 413M | |
![[SND]](/icons/sound2.gif) | The_Jayk_Gallagher_P..> | 2012-03-08 19:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | MorMusic_Radio_Pod_1..> | 2012-03-08 22:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | Chicksters_Nest_1203..> | 2012-03-10 11:00 | 595M | |
![[SND]](/icons/sound2.gif) | The_Call_Sheet_12031..> | 2012-03-10 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | ayatolla.wav | 2012-03-11 14:33 | 4.7M | |
![[SND]](/icons/sound2.gif) | limbaughsadick.wav | 2012-03-11 14:33 | 5.6M | |
![[SND]](/icons/sound2.gif) | netenyahubummer.wav | 2012-03-11 14:33 | 4.7M | |
![[SND]](/icons/sound2.gif) | palin2012.wav | 2012-03-11 14:33 | 4.4M | |
![[SND]](/icons/sound2.gif) | peytonreleased.wav | 2012-03-11 14:33 | 7.1M | |
![[SND]](/icons/sound2.gif) | nflbounty.wav | 2012-03-11 14:33 | 4.2M | |
![[SND]](/icons/sound2.gif) | evolution.wav | 2012-03-11 14:34 | 11M | |
![[SND]](/icons/sound2.gif) | 120311_150005_SRS001..> | 2012-03-11 15:00 | 598M | |
![[SND]](/icons/sound2.gif) | The_Weekly_Wrap_Up_1..> | 2012-03-11 16:00 | 1.5M | |
![[SND]](/icons/sound2.gif) | Mat_Time_Radio_12031..> | 2012-03-11 18:00 | 595M | |
![[SND]](/icons/sound2.gif) | The_Qumran_Report_12..> | 2012-03-12 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | The_Adam_O_Podcast_1..> | 2012-03-13 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | Pinata_Hour_120314_1..> | 2012-03-14 19:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | 120314_212959_SRS001..> | 2012-03-14 21:29 | 608M | |
![[SND]](/icons/sound2.gif) | The_Jayk_Gallagher_P..> | 2012-03-15 19:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | MorMusic_Radio_Pod_1..> | 2012-03-15 22:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | 3 Jackie Wilson Said..> | 2012-03-18 03:25 | 30M | |
![[SND]](/icons/sound2.gif) | 45 Jackie Wilson Sai..> | 2012-03-18 03:25 | 30M | |
![[SND]](/icons/sound2.gif) | 10 Listen To The Lio..> | 2012-03-18 03:26 | 112M | |
![[SND]](/icons/sound2.gif) | 42 Listen To The Lio..> | 2012-03-18 03:26 | 112M | |
![[SND]](/icons/sound2.gif) | afghankillings.wav | 2012-03-18 15:32 | 5.0M | |
![[SND]](/icons/sound2.gif) | karzaipullback.wav | 2012-03-18 15:32 | 4.1M | |
![[SND]](/icons/sound2.gif) | gamechange.wav | 2012-03-18 15:32 | 6.1M | |
![[SND]](/icons/sound2.gif) | palinonGC.wav | 2012-03-18 15:32 | 2.2M | |
![[SND]](/icons/sound2.gif) | romneystruggles.wav | 2012-03-18 15:32 | 10M | |
![[SND]](/icons/sound2.gif) | schmidt.wav | 2012-03-18 15:32 | 8.7M | |
![[SND]](/icons/sound2.gif) | speakenglish.wav | 2012-03-18 15:32 | 9.3M | |
![[SND]](/icons/sound2.gif) | goldmansachs.wav | 2012-03-18 15:32 | 5.5M | |
![[SND]](/icons/sound2.gif) | howardmanning.wav | 2012-03-18 15:32 | 10M | |
![[SND]](/icons/sound2.gif) | The_Weekly_Wrap_Up_1..> | 2012-03-18 16:00 | 595M | |
![[SND]](/icons/sound2.gif) | Mat_Time_Radio_12031..> | 2012-03-18 18:00 | 595M | |
![[SND]](/icons/sound2.gif) | The_Love_Bite_120318..> | 2012-03-18 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | The_Qumran_Report_12..> | 2012-03-19 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | 120319_210808_SRS001..> | 2012-03-19 21:08 | 1.0G | |
![[SND]](/icons/sound2.gif) | RAGfest-unprocessed.wav | 2012-03-20 10:20 | 3.2G | |
![[SND]](/icons/sound2.gif) | File0001.WAV | 2012-03-20 22:11 | 1.2G | |
![[SND]](/icons/sound2.gif) | File0002.WAV | 2012-03-20 22:24 | 595M | |
![[SND]](/icons/sound2.gif) | File0003.WAV | 2012-03-20 22:26 | 120M | |
![[SND]](/icons/sound2.gif) | File0004.WAV | 2012-03-20 22:39 | 595M | |
![[SND]](/icons/sound2.gif) | File0005.WAV | 2012-03-20 22:51 | 595M | |
![[SND]](/icons/sound2.gif) | File0006.WAV | 2012-03-20 23:03 | 544M | |
![[SND]](/icons/sound2.gif) | File0007.WAV | 2012-03-20 23:18 | 706M | |
![[SND]](/icons/sound2.gif) | File0008.WAV | 2012-03-20 23:18 | 1.5M | |
![[SND]](/icons/sound2.gif) | File0009.WAV | 2012-03-20 23:39 | 1.0G | |
![[SND]](/icons/sound2.gif) | File0010.WAV | 2012-03-20 23:43 | 177M | |
![[SND]](/icons/sound2.gif) | File0011.WAV | 2012-03-20 23:55 | 595M | |
![[SND]](/icons/sound2.gif) | File0012.WAV | 2012-03-21 00:10 | 595M | |
![[SND]](/icons/sound2.gif) | File0013.WAV | 2012-03-21 00:44 | 1.6G | |
![[SND]](/icons/sound2.gif) | File0014.WAV | 2012-03-21 01:05 | 1.0G | |
![[SND]](/icons/sound2.gif) | File0015.WAV | 2012-03-21 01:15 | 464M | |
![[SND]](/icons/sound2.gif) | File0016.WAV | 2012-03-21 01:16 | 69M | |
![[SND]](/icons/sound2.gif) | File0017.WAV | 2012-03-21 01:18 | 81M | |
![[SND]](/icons/sound2.gif) | File0018.WAV | 2012-03-21 01:30 | 595M | |
![[SND]](/icons/sound2.gif) | File0019.WAV | 2012-03-21 01:43 | 606M | |
![[SND]](/icons/sound2.gif) | File0020.WAV | 2012-03-21 01:56 | 595M | |
![[SND]](/icons/sound2.gif) | File0021.WAV | 2012-03-21 02:08 | 595M | |
![[SND]](/icons/sound2.gif) | File0022.WAV | 2012-03-21 02:21 | 595M | |
![[SND]](/icons/sound2.gif) | File0023.WAV | 2012-03-21 02:54 | 1.6G | |
![[SND]](/icons/sound2.gif) | Episode_14-The_Adam-..> | 2012-03-21 09:39 | 464M | |
![[SND]](/icons/sound2.gif) | Pinata_Hour_120321_1..> | 2012-03-21 19:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | 120321_210723_SRS001..> | 2012-03-21 21:07 | 532M | |
![[SND]](/icons/sound2.gif) | 5 Washing of the Wat..> | 2012-03-21 21:24 | 39M | |
![[SND]](/icons/sound2.gif) | Washing of the Water..> | 2012-03-21 21:24 | 39M | |
![[SND]](/icons/sound2.gif) | MorMusic_Radio_Pod_1..> | 2012-03-22 22:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | 15 Somewhere Down Th..> | 2012-03-22 22:24 | 50M | |
![[SND]](/icons/sound2.gif) | 120323_195657_SRS001..> | 2012-03-23 19:56 | 1.0G | |
![[SND]](/icons/sound2.gif) | Chicksters_Nest_1203..> | 2012-03-24 11:00 | 595M | |
![[SND]](/icons/sound2.gif) | TonyTee-Interview-Cl..> | 2012-03-24 19:27 | 1.0G | |
![[SND]](/icons/sound2.gif) | The_Call_Sheet_12032..> | 2012-03-24 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | etchasketch.wav | 2012-03-25 11:49 | 3.1M | |
![[SND]](/icons/sound2.gif) | trayvonmartin.wav | 2012-03-25 11:49 | 17M | |
![[SND]](/icons/sound2.gif) | mediamattersad.wav | 2012-03-25 11:49 | 10M | |
![[SND]](/icons/sound2.gif) | mittflop copy.wav | 2012-03-25 11:49 | 7.2M | |
![[SND]](/icons/sound2.gif) | manningtebowsaints.wav | 2012-03-25 11:50 | 7.2M | |
![[SND]](/icons/sound2.gif) | toulouseshooter.wav | 2012-03-25 11:50 | 7.8M | |
![[SND]](/icons/sound2.gif) | The_Weekly_Wrap_Up_1..> | 2012-03-25 16:00 | 595M | |
![[SND]](/icons/sound2.gif) | Mat_Time_Radio_12032..> | 2012-03-25 18:00 | 595M | |
![[SND]](/icons/sound2.gif) | The_Love_Bite_120325..> | 2012-03-25 20:00 | 596M | |
![[SND]](/icons/sound2.gif) | 1005.WAV | 2012-03-26 14:41 | 776K | |
![[SND]](/icons/sound2.gif) | 1006.WAV | 2012-03-26 14:41 | 253K | |
![[SND]](/icons/sound2.gif) | 1007.WAV | 2012-03-26 14:42 | 1.1M | |
![[SND]](/icons/sound2.gif) | 1008.WAV | 2012-03-26 14:43 | 554K | |
![[SND]](/icons/sound2.gif) | 1009.WAV | 2012-03-26 14:43 | 770K | |
![[SND]](/icons/sound2.gif) | 1010.WAV | 2012-03-26 15:52 | 8.8M | |
![[SND]](/icons/sound2.gif) | 1011.WAV | 2012-03-26 17:17 | 186M | |
![[SND]](/icons/sound2.gif) | 1012.WAV | 2012-03-26 18:15 | 67M | |
![[SND]](/icons/sound2.gif) | 1013.WAV | 2012-03-26 18:21 | 12M | |
![[SND]](/icons/sound2.gif) | 1014.WAV | 2012-03-26 19:07 | 86M | |
![[SND]](/icons/sound2.gif) | The_Qumran_Report_12..> | 2012-03-26 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | The_Adam_O_Podcast_1..> | 2012-03-27 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | Pinata_Hour_120328_1..> | 2012-03-28 19:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | 120328_210116_SRS001..> | 2012-03-28 21:01 | 593M | |
![[SND]](/icons/sound2.gif) | 120329_221754_SRS001..> | 2012-03-29 22:17 | 1.3G | |
![[SND]](/icons/sound2.gif) | Chicksters_Nest_1203..> | 2012-03-31 11:00 | 596M | |
![[SND]](/icons/sound2.gif) | The_Call_Sheet_12033..> | 2012-03-31 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | zimmermansurveillanc..> | 2012-04-01 15:33 | 8.5M | |
![[SND]](/icons/sound2.gif) | trialbytvshow.wav | 2012-04-01 15:33 | 20M | |
![[SND]](/icons/sound2.gif) | newtmeetsmitt.wav | 2012-04-01 15:33 | 10M | |
![[SND]](/icons/sound2.gif) | obamacarecase.wav | 2012-04-01 15:34 | 10M | |
![[SND]](/icons/sound2.gif) | adelsononromney.wav | 2012-04-01 15:34 | 4.6M | |
![[SND]](/icons/sound2.gif) | tebowsexcited.wav | 2012-04-01 15:34 | 6.9M | |
![[SND]](/icons/sound2.gif) | anchorman2.wav | 2012-04-01 15:34 | 4.6M | |
![[SND]](/icons/sound2.gif) | The_Weekly_Wrap_Up_1..> | 2012-04-01 16:00 | 596M | |
![[SND]](/icons/sound2.gif) | Mat_Time_Radio_12040..> | 2012-04-01 18:00 | 595M | |
![[SND]](/icons/sound2.gif) | adelsononromney10.wav | 2012-04-01 18:41 | 4.6M | |
![[SND]](/icons/sound2.gif) | anchormanII10.wav | 2012-04-01 18:41 | 4.6M | |
![[SND]](/icons/sound2.gif) | tebowsexcited10.wav | 2012-04-01 18:43 | 6.9M | |
![[SND]](/icons/sound2.gif) | trialbytvshow10.wav | 2012-04-01 18:46 | 20M | |
![[SND]](/icons/sound2.gif) | The_Love_Bite_120401..> | 2012-04-01 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | The_Qumran_Report_12..> | 2012-04-02 20:00 | 596M | |
![[SND]](/icons/sound2.gif) | TonyTee-Interview-Cl..> | 2012-04-03 18:30 | 808M | |
![[SND]](/icons/sound2.gif) | The_Adam_O_Podcast_1..> | 2012-04-03 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | Pinata_Hour_120404_1..> | 2012-04-04 19:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | MorMusic_Radio_Pod_1..> | 2012-04-05 22:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | MMRP-EPISODE_45.wav | 2012-04-07 05:51 | 1.0G | |
![[SND]](/icons/sound2.gif) | The_Call_Sheet_12040..> | 2012-04-07 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | The_Weekly_Wrap_Up_1..> | 2012-04-08 16:00 | 595M | |
![[SND]](/icons/sound2.gif) | The_Qumran_Report_12..> | 2012-04-09 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | The_Adam_O_Podcast_1..> | 2012-04-10 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | Pinata_Hour_120411_1..> | 2012-04-11 19:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | MorMusic_Radio_Pod_1..> | 2012-04-12 22:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | MorMusic_Radio_Pod-E..> | 2012-04-14 17:59 | 1.0G | |
![[SND]](/icons/sound2.gif) | The_Call_Sheet_12041..> | 2012-04-14 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | The_Love_Bite_120415..> | 2012-04-15 15:00 | 595M | |
![[SND]](/icons/sound2.gif) | Mat_Time_Radio_12041..> | 2012-04-15 18:00 | 595M | |
![[SND]](/icons/sound2.gif) | The_Qumran_Report_12..> | 2012-04-16 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | The_Adam_O_Podcast_1..> | 2012-04-17 20:00 | 596M | |
![[SND]](/icons/sound2.gif) | Paul_Kengor.wav | 2012-04-18 18:19 | 285M | |
![[SND]](/icons/sound2.gif) | Pinata_Hour_120418_1..> | 2012-04-18 19:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | Sexy_Time_Talk_12041..> | 2012-04-18 21:00 | 595M | |
![[SND]](/icons/sound2.gif) | 3 All The Young Dude..> | 2012-04-19 00:24 | 36M | |
![[SND]](/icons/sound2.gif) | 9. Accidents Will Ha..> | 2012-04-19 00:45 | 35M | |
![[SND]](/icons/sound2.gif) | Accidents Will Happe..> | 2012-04-19 00:45 | 35M | |
![[SND]](/icons/sound2.gif) | Accidents Will Happe..> | 2012-04-19 00:45 | 35M | |
![[SND]](/icons/sound2.gif) | Combined.wav | 2012-04-20 21:37 | 5.0M | |
![[SND]](/icons/sound2.gif) | The_Call_Sheet_12042..> | 2012-04-21 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | The_Love_Bite_120422..> | 2012-04-22 15:00 | 596M | |
![[SND]](/icons/sound2.gif) | Mat_Time_Radio_12042..> | 2012-04-22 18:00 | 595M | |
![[SND]](/icons/sound2.gif) | The_Qumran_Report_12..> | 2012-04-23 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | 23 Long Cool Woman (..> | 2012-04-25 01:20 | 33M | |
![[SND]](/icons/sound2.gif) | Pinata_Hour_120425_1..> | 2012-04-25 19:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | MorMusic_Radio_Pod_1..> | 2012-04-26 22:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | thecallsheet_120428_..> | 2012-04-28 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | thelovebite_120429_1..> | 2012-04-29 15:00 | 595M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1204..> | 2012-04-29 16:00 | 596M | |
![[SND]](/icons/sound2.gif) | mattimeradio_120429_..> | 2012-04-29 18:00 | 595M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1204..> | 2012-04-30 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | theadamopodcast_1205..> | 2012-05-01 20:00 | 596M | |
![[SND]](/icons/sound2.gif) | pinatahour_120502_19..> | 2012-05-02 19:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | sexytimetalk_120502_..> | 2012-05-02 21:00 | 595M | |
![[SND]](/icons/sound2.gif) | mormusicradiopod_120..> | 2012-05-03 22:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | 1bindeadenusa15.wav | 2012-05-05 19:12 | 4.2M | |
![[SND]](/icons/sound2.gif) | 2bidendiss15.wav | 2012-05-05 19:12 | 3.7M | |
![[SND]](/icons/sound2.gif) | 3dissident15.wav | 2012-05-05 19:12 | 1.0M | |
![[SND]](/icons/sound2.gif) | 10seau15.wav | 2012-05-05 19:12 | 4.2M | |
![[SND]](/icons/sound2.gif) | 4chenabroad15.wav | 2012-05-05 19:12 | 6.6M | |
![[SND]](/icons/sound2.gif) | 5pretaskforce15.wav | 2012-05-05 19:12 | 8.4M | |
![[SND]](/icons/sound2.gif) | 6newtdorsement15.wav | 2012-05-05 19:12 | 6.9M | |
![[SND]](/icons/sound2.gif) | 7grennell15.wav | 2012-05-05 19:12 | 4.7M | |
![[SND]](/icons/sound2.gif) | 8amfamilyass15.wav | 2012-05-05 19:12 | 7.9M | |
![[SND]](/icons/sound2.gif) | 9lizedwards15.wav | 2012-05-05 19:12 | 9.9M | |
![[SND]](/icons/sound2.gif) | thelovebite_120506_1..> | 2012-05-06 15:00 | 596M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1205..> | 2012-05-06 16:00 | 596M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1205..> | 2012-05-07 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | theadamopodcast_1205..> | 2012-05-08 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | pinatahour_120509_19..> | 2012-05-09 19:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | sexytimetalk_120509_..> | 2012-05-09 21:00 | 596M | |
![[SND]](/icons/sound2.gif) | mormusicradiopod_120..> | 2012-05-10 22:08 | 1.1G | |
![[SND]](/icons/sound2.gif) | sonnydonator_120506_..> | 2012-05-11 02:53 | 327M | |
![[SND]](/icons/sound2.gif) | thecallsheet_120512_..> | 2012-05-12 20:00 | 596M | |
![[SND]](/icons/sound2.gif) | thelovebite_120513_1..> | 2012-05-13 15:00 | 595M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1205..> | 2012-05-13 16:00 | 596M | |
![[SND]](/icons/sound2.gif) | mattimeradio_120513_..> | 2012-05-13 18:00 | 596M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1205..> | 2012-05-14 20:00 | 596M | |
![[SND]](/icons/sound2.gif) | theadamopodcast_1205..> | 2012-05-15 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | pinatahour_120516_19..> | 2012-05-16 19:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | sexytimetalk_120516_..> | 2012-05-16 21:00 | 596M | |
![[SND]](/icons/sound2.gif) | 02 A Wedding In Cher..> | 2012-05-17 22:21 | 32M | |
![[SND]](/icons/sound2.gif) | 45 A Wedding In Cher..> | 2012-05-17 22:21 | 32M | |
![[SND]](/icons/sound2.gif) | A Wedding In Cheroke..> | 2012-05-17 22:21 | 32M | |
![[SND]](/icons/sound2.gif) | thecallsheet_120519_..> | 2012-05-19 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | thelovebite_120520_1..> | 2012-05-20 15:00 | 595M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1205..> | 2012-05-20 16:00 | 596M | |
![[SND]](/icons/sound2.gif) | mattimeradio_120520_..> | 2012-05-20 18:00 | 595M | |
![[SND]](/icons/sound2.gif) | 7cainendorse16.wav | 2012-05-21 11:05 | 6.5M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1205..> | 2012-05-21 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | mormusicradiopod_120..> | 2012-05-22 10:32 | 1.2G | |
![[SND]](/icons/sound2.gif) | theadamopodcast_1205..> | 2012-05-22 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | pinatahour_120523_19..> | 2012-05-23 19:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | sexytimetalk_120523_..> | 2012-05-23 21:00 | 595M | |
![[SND]](/icons/sound2.gif) | mormusicradiopod_120..> | 2012-05-24 22:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | 1pakdoc17.wav | 2012-05-26 00:13 | 5.0M | |
![[SND]](/icons/sound2.gif) | thecallsheet_120526_..> | 2012-05-26 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | thelovebite_120527_1..> | 2012-05-27 15:00 | 595M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1205..> | 2012-05-27 16:00 | 596M | |
![[SND]](/icons/sound2.gif) | mattimeradio_120527_..> | 2012-05-27 18:00 | 596M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1205..> | 2012-05-28 20:00 | 596M | |
![[SND]](/icons/sound2.gif) | 2repcoffman17.wav | 2012-05-29 16:54 | 2.2M | |
![[SND]](/icons/sound2.gif) | 3misspoke17.wav | 2012-05-29 16:56 | 8.3M | |
![[SND]](/icons/sound2.gif) | theadamopodcast_1205..> | 2012-05-29 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | pinatahour_120530_19..> | 2012-05-30 19:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | sexytimetalk_120530_..> | 2012-05-30 21:00 | 596M | |
![[SND]](/icons/sound2.gif) | grandtheftaudioradio..> | 2012-05-31 09:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | mormusicradiopod_120..> | 2012-05-31 22:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | grandtheftaudioradio..> | 2012-06-01 09:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | thecallsheet_120602_..> | 2012-06-02 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | 10snigdha18.wav | 2012-06-03 01:31 | 6.6M | |
![[SND]](/icons/sound2.gif) | 11metnono18.wav | 2012-06-03 01:31 | 2.7M | |
![[SND]](/icons/sound2.gif) | 1syriarussia18.wav | 2012-06-03 01:31 | 11M | |
![[SND]](/icons/sound2.gif) | 2viruses18.wav | 2012-06-03 01:31 | 14M | |
![[SND]](/icons/sound2.gif) | 3nosoda18.wav | 2012-06-03 01:31 | 13M | |
![[SND]](/icons/sound2.gif) | 4doma18.wav | 2012-06-03 01:31 | 7.0M | |
![[SND]](/icons/sound2.gif) | 5edwardsverdict18.wav | 2012-06-03 01:31 | 6.6M | |
![[SND]](/icons/sound2.gif) | 6wolftrump18.wav | 2012-06-03 01:31 | 13M | |
![[SND]](/icons/sound2.gif) | 7needstrump18.wav | 2012-06-03 01:31 | 3.2M | |
![[SND]](/icons/sound2.gif) | 8zimbond18.wav | 2012-06-03 01:31 | 12M | |
![[SND]](/icons/sound2.gif) | 9facewich18.wav | 2012-06-03 01:31 | 1.2M | |
![[SND]](/icons/sound2.gif) | thelovebite_120603_1..> | 2012-06-03 15:00 | 595M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1206..> | 2012-06-03 16:00 | 596M | |
![[SND]](/icons/sound2.gif) | mattimeradio_120603_..> | 2012-06-03 18:00 | 595M | |
![[SND]](/icons/sound2.gif) | grandtheftaudioradio..> | 2012-06-04 09:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | thequmranreport_1206..> | 2012-06-04 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | grandtheftaudioradio..> | 2012-06-05 09:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | theadamopodcast_1206..> | 2012-06-05 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | grandtheftaudioradio..> | 2012-06-06 09:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | pinatahour_120606_19..> | 2012-06-06 19:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | sexytimetalk_120606_..> | 2012-06-06 21:00 | 596M | |
![[SND]](/icons/sound2.gif) | grandtheftaudioradio..> | 2012-06-07 09:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | mormusicradiopod_120..> | 2012-06-07 22:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | grandtheftaudioradio..> | 2012-06-08 09:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | 1monitorshot19.wav | 2012-06-08 15:20 | 8.2M | |
![[SND]](/icons/sound2.gif) | 2walkerwins19.wav | 2012-06-08 15:20 | 9.4M | |
![[SND]](/icons/sound2.gif) | 3gayporncanibal19.wav | 2012-06-08 15:20 | 7.9M | |
![[SND]](/icons/sound2.gif) | 4sandusky19.wav | 2012-06-08 15:20 | 5.3M | |
![[SND]](/icons/sound2.gif) | 5teenidiot19.wav | 2012-06-08 15:20 | 10M | |
![[SND]](/icons/sound2.gif) | 6kingsheen19.wav | 2012-06-08 15:20 | 7.4M | |
![[SND]](/icons/sound2.gif) | 7kjhondo19.wav | 2012-06-08 15:20 | 3.0M | |
![[SND]](/icons/sound2.gif) | 8nfllawsuit19.wav | 2012-06-08 15:21 | 6.3M | |
![[SND]](/icons/sound2.gif) | thecallsheet_120609_..> | 2012-06-09 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | thelovebite_120610_1..> | 2012-06-10 15:00 | 596M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1206..> | 2012-06-10 16:00 | 596M | |
![[SND]](/icons/sound2.gif) | mattimeradio_120610_..> | 2012-06-10 18:00 | 595M | |
![[SND]](/icons/sound2.gif) | grandtheftaudioradio..> | 2012-06-11 09:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | thequmranreport_1206..> | 2012-06-11 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | grandtheftaudioradio..> | 2012-06-12 09:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | theadamopodcast_1206..> | 2012-06-12 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | grandtheftaudioradio..> | 2012-06-13 09:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | pinatahour_120613_19..> | 2012-06-13 19:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | sexytimetalk_120613_..> | 2012-06-13 21:00 | 596M | |
![[SND]](/icons/sound2.gif) | grandtheftaudioradio..> | 2012-06-14 09:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | mormusicradiopod_120..> | 2012-06-14 22:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | grandtheftaudioradio..> | 2012-06-15 09:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | thecallsheet_120616_..> | 2012-06-16 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | thelovebite_120617_1..> | 2012-06-17 15:00 | 595M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1206..> | 2012-06-17 16:00 | 596M | |
![[SND]](/icons/sound2.gif) | grandtheftaudioradio..> | 2012-06-20 09:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | pinatahour_120620_19..> | 2012-06-20 19:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | sexytimetalk_120620_..> | 2012-06-20 21:00 | 595M | |
![[SND]](/icons/sound2.gif) | mormusicradiopod_120..> | 2012-06-21 22:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | thecallsheet_120623_..> | 2012-06-23 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | thelovebite_120624_1..> | 2012-06-24 15:00 | 595M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1206..> | 2012-06-24 16:00 | 596M | |
![[SND]](/icons/sound2.gif) | mattimeradio_120624_..> | 2012-06-24 18:00 | 595M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1206..> | 2012-06-25 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | theadamopodcast_1206..> | 2012-06-26 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | pinatahour_120627_19..> | 2012-06-27 19:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | sexytimetalk_120627_..> | 2012-06-27 21:00 | 596M | |
![[SND]](/icons/sound2.gif) | mormusicradiopod_120..> | 2012-06-28 22:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | thecallsheet_120630_..> | 2012-06-30 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | thelovebite_120701_1..> | 2012-07-01 15:00 | 595M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1207..> | 2012-07-01 16:00 | 596M | |
![[SND]](/icons/sound2.gif) | mattimeradio_120701_..> | 2012-07-01 18:00 | 595M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1207..> | 2012-07-02 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | theadamopodcast_1207..> | 2012-07-03 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | pinatahour_120704_19..> | 2012-07-04 19:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | sexytimetalk_120704_..> | 2012-07-04 21:00 | 595M | |
![[SND]](/icons/sound2.gif) | mormusicradiopod_120..> | 2012-07-05 22:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | thecallsheet_120707_..> | 2012-07-07 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | thelovebite_120708_1..> | 2012-07-08 15:00 | 595M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1207..> | 2012-07-08 16:00 | 596M | |
![[SND]](/icons/sound2.gif) | mattimeradio_120708_..> | 2012-07-08 18:00 | 595M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1207..> | 2012-07-09 20:00 | 596M | |
![[SND]](/icons/sound2.gif) | theadamopodcast_1207..> | 2012-07-10 20:00 | 596M | |
![[SND]](/icons/sound2.gif) | pinatahour_120711_19..> | 2012-07-11 19:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | sexytimetalk_120711_..> | 2012-07-11 21:00 | 596M | |
![[SND]](/icons/sound2.gif) | mormusicradiopod_120..> | 2012-07-12 22:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | thecallsheet_120714_..> | 2012-07-14 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | thelovebite_120715_1..> | 2012-07-15 15:00 | 596M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1207..> | 2012-07-15 16:00 | 596M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1207..> | 2012-07-16 20:00 | 596M | |
![[SND]](/icons/sound2.gif) | theadamopodcast_1207..> | 2012-07-17 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | twwuad2.wav | 2012-07-18 09:42 | 5.0M | |
![[SND]](/icons/sound2.gif) | pinatahour_120718_19..> | 2012-07-18 19:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | sexytimetalk_120718_..> | 2012-07-18 21:00 | 595M | |
![[SND]](/icons/sound2.gif) | mormusicradiopod_120..> | 2012-07-19 22:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | thecallsheet_120721_..> | 2012-07-21 20:00 | 596M | |
![[SND]](/icons/sound2.gif) | thelovebite_120722_1..> | 2012-07-22 15:00 | 595M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1207..> | 2012-07-22 16:00 | 596M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1207..> | 2012-07-23 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | theadamopodcast_1207..> | 2012-07-24 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | pinatahour_120725_19..> | 2012-07-25 19:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | SummerZoundzMix.wav | 2012-07-27 09:15 | 835M | |
![[SND]](/icons/sound2.gif) | inthesportsbooth_120..> | 2012-07-29 18:00 | 595M | |
![[SND]](/icons/sound2.gif) | thecallsheet_120728_..> | 2012-07-29 19:00 | 595M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1207..> | 2012-07-29 19:12 | 596M | |
![[SND]](/icons/sound2.gif) | thelovebite_120729_1..> | 2012-07-29 19:39 | 596M | |
![[SND]](/icons/sound2.gif) | thelovebitekink_1207..> | 2012-07-29 19:54 | 595M | |
![[SND]](/icons/sound2.gif) | sexytimetalk_120725_..> | 2012-07-29 20:05 | 595M | |
![[SND]](/icons/sound2.gif) | mormusicradiopod_120..> | 2012-07-29 20:34 | 1.2G | |
![[SND]](/icons/sound2.gif) | thequmranreport_1207..> | 2012-07-30 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | theadamopodcast_1207..> | 2012-07-31 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | theadamopodcast_1207..> | 2012-08-01 17:36 | 622M | |
![[SND]](/icons/sound2.gif) | pinatahour_120801_19..> | 2012-08-01 19:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | sexytimetalk_120801_..> | 2012-08-01 21:00 | 596M | |
![[SND]](/icons/sound2.gif) | mormusicradiopod_120..> | 2012-08-02 22:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | thecallsheet_120804_..> | 2012-08-04 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | thelovebite_120805_1..> | 2012-08-05 15:00 | 595M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1208..> | 2012-08-05 16:00 | 596M | |
![[SND]](/icons/sound2.gif) | inthesportsbooth_120..> | 2012-08-05 18:00 | 595M | |
![[SND]](/icons/sound2.gif) | registeredearoffende..> | 2012-08-05 21:20 | 595M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1208..> | 2012-08-06 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | theadamopodcast_1208..> | 2012-08-07 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | pinatahour_120808_19..> | 2012-08-08 19:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | sexytimetalk_120808_..> | 2012-08-08 21:00 | 595M | |
![[SND]](/icons/sound2.gif) | mormusicradiopod_120..> | 2012-08-09 22:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | registeredearoffende..> | 2012-08-10 13:00 | 595M | |
![[SND]](/icons/sound2.gif) | chissum_worthington-..> | 2012-08-10 14:15 | 1.5M | |
![[SND]](/icons/sound2.gif) | chissum_worthington-..> | 2012-08-10 14:19 | 2.2M | |
![[SND]](/icons/sound2.gif) | MorMusic-Promo-1.wav | 2012-08-10 15:17 | 11M | |
![[SND]](/icons/sound2.gif) | thecallsheet_120811_..> | 2012-08-11 20:00 | 596M | |
![[SND]](/icons/sound2.gif) | thelovebite_120812_1..> | 2012-08-12 15:00 | 595M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1208..> | 2012-08-12 16:00 | 596M | |
![[SND]](/icons/sound2.gif) | inthesportsbooth_120..> | 2012-08-12 18:00 | 595M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1208..> | 2012-08-13 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | theadamopodcast_1208..> | 2012-08-14 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | pinatahour_120815_19..> | 2012-08-15 19:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | sexytimetalk_120815_..> | 2012-08-15 21:00 | 596M | |
![[SND]](/icons/sound2.gif) | TWWUgh.wav | 2012-08-16 20:19 | 21M | |
![[SND]](/icons/sound2.gif) | mormusicradiopod_120..> | 2012-08-16 22:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | registeredearoffende..> | 2012-08-17 13:00 | 595M | |
![[SND]](/icons/sound2.gif) | thecallsheet_120818_..> | 2012-08-18 20:00 | 596M | |
![[SND]](/icons/sound2.gif) | thelovebite_120819_1..> | 2012-08-19 15:00 | 595M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1208..> | 2012-08-19 16:00 | 596M | |
![[SND]](/icons/sound2.gif) | inthesportsbooth_120..> | 2012-08-19 18:00 | 595M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1208..> | 2012-08-20 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | theadamopodcast_1208..> | 2012-08-21 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | pinatahour_120822_19..> | 2012-08-22 19:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | sexytimetalk_120822_..> | 2012-08-22 21:00 | 596M | |
![[SND]](/icons/sound2.gif) | mormusicradiopod_120..> | 2012-08-23 22:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | WeeklyWrapUp.wav | 2012-08-24 00:44 | 21M | |
![[SND]](/icons/sound2.gif) | kinkfromtheundergrou..> | 2012-08-24 10:30 | 585M | |
![[SND]](/icons/sound2.gif) | KFTU_Sirius_Promo1.wav | 2012-08-24 10:46 | 5.1M | |
![[SND]](/icons/sound2.gif) | registeredearoffende..> | 2012-08-24 13:00 | 595M | |
![[SND]](/icons/sound2.gif) | thecallsheet_120825_..> | 2012-08-25 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | thelovebite_120826_1..> | 2012-08-26 15:00 | 595M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1208..> | 2012-08-26 16:00 | 596M | |
![[SND]](/icons/sound2.gif) | inthesportsbooth_120..> | 2012-08-26 18:00 | 595M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1208..> | 2012-08-27 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | Fuck Mountain.wav | 2012-08-28 00:13 | 122M | |
![[SND]](/icons/sound2.gif) | Dark Hole Review.wav | 2012-08-28 01:20 | 122M | |
![[SND]](/icons/sound2.gif) | theadamopodcast_1208..> | 2012-08-28 20:00 | 596M | |
![[SND]](/icons/sound2.gif) | Fishing-old1.wav | 2012-08-29 15:50 | 33M | |
![[SND]](/icons/sound2.gif) | 1 Sketchy Characters..> | 2012-08-29 16:25 | 34M | |
![[SND]](/icons/sound2.gif) | Fishing.wav | 2012-08-29 16:25 | 34M | |
![[SND]](/icons/sound2.gif) | pinatahour_120829_19..> | 2012-08-29 19:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | sexytimetalk_120829_..> | 2012-08-29 21:00 | 595M | |
![[SND]](/icons/sound2.gif) | mormusicradiopod_120..> | 2012-08-30 22:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | kinkfromtheundergrou..> | 2012-08-31 10:30 | 585M | |
![[SND]](/icons/sound2.gif) | registeredearoffende..> | 2012-08-31 13:00 | 595M | |
![[SND]](/icons/sound2.gif) | thecallsheet_120901_..> | 2012-09-01 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | thelovebite_120902_1..> | 2012-09-02 15:00 | 595M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1209..> | 2012-09-02 16:00 | 596M | |
![[SND]](/icons/sound2.gif) | inthesportsbooth_120..> | 2012-09-02 18:00 | 595M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1209..> | 2012-09-03 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | thehotbox_120904_210..> | 2012-09-04 21:00 | 595M | |
![[SND]](/icons/sound2.gif) | sexytimetalk_120905_..> | 2012-09-05 21:00 | 595M | |
![[SND]](/icons/sound2.gif) | Galeria Intro.wav | 2012-09-06 19:55 | 352M | |
![[SND]](/icons/sound2.gif) | mormusicradiopod_120..> | 2012-09-06 22:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | registeredearoffende..> | 2012-09-07 13:00 | 595M | |
![[SND]](/icons/sound2.gif) | testing_120908_13544..> | 2012-09-08 13:54 | 1.0M | |
![[SND]](/icons/sound2.gif) | thecallsheet_120908_..> | 2012-09-08 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | testing_120908_23041..> | 2012-09-08 23:04 | 219M | |
![[SND]](/icons/sound2.gif) | thelovebite_120909_1..> | 2012-09-09 15:00 | 595M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1209..> | 2012-09-09 16:00 | 596M | |
![[SND]](/icons/sound2.gif) | inthesportsbooth_120..> | 2012-09-09 18:00 | 554M | |
![[SND]](/icons/sound2.gif) | testing_120909_20054..> | 2012-09-09 20:05 | 1.1M | |
![[SND]](/icons/sound2.gif) | testing_120909_20074..> | 2012-09-09 20:07 | 3.1M | |
![[SND]](/icons/sound2.gif) | testing_120909_20091..> | 2012-09-09 20:09 | 2.8M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1209..> | 2012-09-10 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | testing_120911_20473..> | 2012-09-11 20:47 | 8.6M | |
![[SND]](/icons/sound2.gif) | testing_120911_20493..> | 2012-09-11 20:49 | 8.0M | |
![[SND]](/icons/sound2.gif) | thehotbox_120911_210..> | 2012-09-11 21:00 | 595M | |
![[SND]](/icons/sound2.gif) | mormusicradiopod_120..> | 2012-09-13 22:30 | 1.2G | |
![[SND]](/icons/sound2.gif) | Jeannette Rizzi.wav | 2012-09-14 00:34 | 28M | |
![[SND]](/icons/sound2.gif) | registeredearoffende..> | 2012-09-14 13:00 | 595M | |
![[SND]](/icons/sound2.gif) | mormusicradiopod_120..> | 2012-09-14 14:20 | 123M | |
![[SND]](/icons/sound2.gif) | corporatemumbojumbo.wav | 2012-09-14 14:46 | 31M | |
![[SND]](/icons/sound2.gif) | mormusicradiopod_120..> | 2012-09-14 14:54 | 2.1M | |
![[SND]](/icons/sound2.gif) | mormusicradiopod_120..> | 2012-09-14 14:55 | 2.0M | |
![[SND]](/icons/sound2.gif) | intro-corporatemumbo..> | 2012-09-14 15:00 | 949K | |
![[SND]](/icons/sound2.gif) | thelovebite_120916_1..> | 2012-09-16 15:00 | 586M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1209..> | 2012-09-16 16:00 | 600M | |
![[SND]](/icons/sound2.gif) | inthesportsbooth_120..> | 2012-09-16 18:59 | 18M | |
![[SND]](/icons/sound2.gif) | inthesportsbooth_120..> | 2012-09-16 20:07 | 937K | |
![[SND]](/icons/sound2.gif) | 3 SketchyCharacters.wav | 2012-09-17 19:51 | 34M | |
![[SND]](/icons/sound2.gif) | Corporate Mumbo Jumb..> | 2012-09-17 19:51 | 34M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1209..> | 2012-09-17 20:00 | 608M | |
![[SND]](/icons/sound2.gif) | thehotbox_120918_210..> | 2012-09-18 21:04 | 516M | |
![[SND]](/icons/sound2.gif) | thehotbox_120918_220..> | 2012-09-18 22:04 | 2.5M | |
![[SND]](/icons/sound2.gif) | thehotbox_120918_220..> | 2012-09-18 22:05 | 17M | |
![[SND]](/icons/sound2.gif) | thehotbox_120918_220..> | 2012-09-18 22:09 | 5.1M | |
![[SND]](/icons/sound2.gif) | thehotbox_120919_210..> | 2012-09-19 21:00 | 554M | |
![[SND]](/icons/sound2.gif) | mormusicradiopod_120..> | 2012-09-20 22:17 | 1.0G | |
![[SND]](/icons/sound2.gif) | registeredearoffende..> | 2012-09-21 13:00 | 598M | |
![[SND]](/icons/sound2.gif) | thelovebite_120923_1..> | 2012-09-23 15:02 | 536M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1209..> | 2012-09-23 16:00 | 590M | |
![[SND]](/icons/sound2.gif) | inthesportsbooth_120..> | 2012-09-23 18:00 | 561M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1209..> | 2012-09-24 20:00 | 587M | |
![[SND]](/icons/sound2.gif) | thehotbox_120925_175..> | 2012-09-25 17:54 | 6.2M | |
![[SND]](/icons/sound2.gif) | thehotbox_120925_175..> | 2012-09-25 17:56 | 3.1M | |
![[SND]](/icons/sound2.gif) | thehotbox_120925_175..> | 2012-09-25 17:57 | 4.2M | |
![[SND]](/icons/sound2.gif) | thehotbox_120925_175..> | 2012-09-25 17:58 | 7.0M | |
![[SND]](/icons/sound2.gif) | thehotbox_120925_180..> | 2012-09-25 18:00 | 10M | |
![[SND]](/icons/sound2.gif) | thehotbox_120925_180..> | 2012-09-25 18:05 | 2.9M | |
![[SND]](/icons/sound2.gif) | thehotbox_120925_180..> | 2012-09-25 18:09 | 13M | |
![[SND]](/icons/sound2.gif) | thehotbox_120925_181..> | 2012-09-25 18:12 | 6.8M | |
![[SND]](/icons/sound2.gif) | thehotbox_120925_181..> | 2012-09-25 18:13 | 22M | |
![[SND]](/icons/sound2.gif) | thehotbox_120925_185..> | 2012-09-25 18:51 | 265K | |
![[SND]](/icons/sound2.gif) | thehotbox_120925_185..> | 2012-09-25 18:52 | 9.2M | |
![[SND]](/icons/sound2.gif) | thehotbox_120925_210..> | 2012-09-25 21:09 | 572M | |
![[SND]](/icons/sound2.gif) | thehotboxpromo_12092..> | 2012-09-25 22:27 | 13M | |
![[SND]](/icons/sound2.gif) | registeredearoffende..> | 2012-09-28 13:00 | 591M | |
![[SND]](/icons/sound2.gif) | registeredearoffende..> | 2012-09-28 14:18 | 44M | |
![[SND]](/icons/sound2.gif) | registeredearoffende..> | 2012-09-28 14:23 | 28M | |
![[SND]](/icons/sound2.gif) | registeredearoffende..> | 2012-09-28 14:27 | 11M | |
![[SND]](/icons/sound2.gif) | thelovebite_120930_1..> | 2012-09-30 15:02 | 538M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1209..> | 2012-09-30 16:00 | 583M | |
![[SND]](/icons/sound2.gif) | inthesportsbooth_120..> | 2012-09-30 18:01 | 547M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1210..> | 2012-10-01 20:00 | 597M | |
![[SND]](/icons/sound2.gif) | thehotbox_121002_210..> | 2012-10-02 21:00 | 552M | |
![[SND]](/icons/sound2.gif) | 2 Sketchy Characters..> | 2012-10-03 21:25 | 33M | |
![[SND]](/icons/sound2.gif) | Mantervention.wav | 2012-10-03 21:25 | 33M | |
![[SND]](/icons/sound2.gif) | CliffYates.wav | 2012-10-03 22:14 | 20M | |
![[SND]](/icons/sound2.gif) | registeredearoffende..> | 2012-10-05 13:00 | 591M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1210..> | 2012-10-07 16:08 | 11M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1210..> | 2012-10-07 16:16 | 3.0M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1210..> | 2012-10-07 16:22 | 2.4M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1210..> | 2012-10-07 16:24 | 2.5M | |
![[SND]](/icons/sound2.gif) | inthesportsbooth_121..> | 2012-10-07 18:00 | 552M | |
![[SND]](/icons/sound2.gif) | thelovebite_121007_1..> | 2012-10-08 14:36 | 556M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1210..> | 2012-10-08 20:01 | 558M | |
![[SND]](/icons/sound2.gif) | thehotbox_121009_210..> | 2012-10-09 21:01 | 556M | |
![[SND]](/icons/sound2.gif) | galeriaalternativa_1..> | 2012-10-11 20:00 | 574M | |
![[SND]](/icons/sound2.gif) | registeredearoffende..> | 2012-10-12 13:00 | 587M | |
![[SND]](/icons/sound2.gif) | awkwardcoversations_..> | 2012-10-13 12:01 | 561M | |
![[SND]](/icons/sound2.gif) | badadvice_121013_140..> | 2012-10-13 14:00 | 589M | |
![[SND]](/icons/sound2.gif) | 23 brodcast.wav | 2012-10-13 23:46 | 20K | |
![[SND]](/icons/sound2.gif) | brodcast.wav | 2012-10-13 23:46 | 20K | |
![[SND]](/icons/sound2.gif) | 09 brodcast.wav | 2012-10-14 00:46 | 20K | |
![[SND]](/icons/sound2.gif) | 20 brodcast.wav | 2012-10-14 00:46 | 20K | |
![[SND]](/icons/sound2.gif) | 24 brodcast.wav | 2012-10-14 00:46 | 20K | |
![[SND]](/icons/sound2.gif) | 34 brodcast.wav | 2012-10-14 00:46 | 20K | |
![[SND]](/icons/sound2.gif) | thelovebite_121014_1..> | 2012-10-14 15:00 | 581M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1210..> | 2012-10-14 16:00 | 561M | |
![[SND]](/icons/sound2.gif) | inthesportsbooth_121..> | 2012-10-14 18:00 | 562M | |
![[SND]](/icons/sound2.gif) | angrydorkspodcast_12..> | 2012-10-15 18:00 | 561M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1210..> | 2012-10-15 20:00 | 567M | |
![[SND]](/icons/sound2.gif) | thehotbox_121016_210..> | 2012-10-16 21:02 | 563M | |
![[SND]](/icons/sound2.gif) | auralstimulation_121..> | 2012-10-17 21:03 | 547M | |
![[SND]](/icons/sound2.gif) | galeriaalternativa_1..> | 2012-10-18 20:00 | 601M | |
![[SND]](/icons/sound2.gif) | RunningwithNeedles.wav | 2012-10-19 01:30 | 47M | |
![[SND]](/icons/sound2.gif) | RunningwithNeedlesLo..> | 2012-10-19 01:30 | 47M | |
![[SND]](/icons/sound2.gif) | 63FordFalcon.wav | 2012-10-19 01:32 | 53M | |
![[SND]](/icons/sound2.gif) | 63FordFalconLoop.wav | 2012-10-19 01:32 | 53M | |
![[SND]](/icons/sound2.gif) | 121019_122739_SRS001..> | 2012-10-19 12:27 | 120M | |
![[SND]](/icons/sound2.gif) | 121019_124103_SRS001..> | 2012-10-19 12:41 | 88M | |
![[SND]](/icons/sound2.gif) | registeredearoffende..> | 2012-10-19 13:00 | 590M | |
![[SND]](/icons/sound2.gif) | blah.wav | 2012-10-19 16:25 | 88M | |
![[SND]](/icons/sound2.gif) | 121019_165106_SRS001..> | 2012-10-19 16:51 | 1.0M | |
![[SND]](/icons/sound2.gif) | awkwardcoversations_..> | 2012-10-20 12:01 | 589M | |
![[SND]](/icons/sound2.gif) | badadvice_121020_140..> | 2012-10-20 14:00 | 592M | |
![[SND]](/icons/sound2.gif) | thecallsheet_121020_..> | 2012-10-20 20:02 | 588M | |
![[SND]](/icons/sound2.gif) | 121020_210532_SRS001..> | 2012-10-20 21:05 | 769K | |
![[SND]](/icons/sound2.gif) | toofatfucks_121021_1..> | 2012-10-21 13:06 | 926M | |
![[SND]](/icons/sound2.gif) | thelovebite_121021_1..> | 2012-10-21 15:00 | 556M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1210..> | 2012-10-21 16:02 | 607M | |
![[SND]](/icons/sound2.gif) | inthesportsbooth_121..> | 2012-10-21 18:00 | 559M | |
![[SND]](/icons/sound2.gif) | 121021_195249_SRS001..> | 2012-10-21 19:52 | 7.0M | |
![[SND]](/icons/sound2.gif) | 121021_201013_SRS001..> | 2012-10-21 20:10 | 181M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1210..> | 2012-10-22 20:00 | 573M | |
![[SND]](/icons/sound2.gif) | 121022_222651_SRS001..> | 2012-10-22 22:26 | 1.0M | |
![[SND]](/icons/sound2.gif) | thehotbox_121023_210..> | 2012-10-23 21:01 | 555M | |
![[SND]](/icons/sound2.gif) | angrydorkspodcast_12..> | 2012-10-24 16:54 | 560M | |
![[SND]](/icons/sound2.gif) | auralstimulation_121..> | 2012-10-24 21:03 | 542M | |
![[SND]](/icons/sound2.gif) | galeriaalternativa_1..> | 2012-10-25 20:00 | 631M | |
![[SND]](/icons/sound2.gif) | Rich Man.wav | 2012-10-26 00:25 | 46M | |
![[SND]](/icons/sound2.gif) | registeredearoffende..> | 2012-10-26 13:02 | 596M | |
![[SND]](/icons/sound2.gif) | awkwardcoversations_..> | 2012-10-27 12:00 | 615M | |
![[SND]](/icons/sound2.gif) | badadvice_121027_140..> | 2012-10-27 14:00 | 590M | |
![[SND]](/icons/sound2.gif) | thecallsheet_121027_..> | 2012-10-27 20:01 | 599M | |
![[SND]](/icons/sound2.gif) | toofatfucks_121028_1..> | 2012-10-28 13:01 | 865M | |
![[SND]](/icons/sound2.gif) | thelovebite_121028_1..> | 2012-10-28 15:00 | 616M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1210..> | 2012-10-28 16:04 | 595M | |
![[SND]](/icons/sound2.gif) | inthesportsbooth_121..> | 2012-10-28 18:01 | 567M | |
![[SND]](/icons/sound2.gif) | angrydorkspodcast_12..> | 2012-10-29 18:00 | 616M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1210..> | 2012-10-29 20:00 | 601M | |
![[SND]](/icons/sound2.gif) | thehotbox_121030_210..> | 2012-10-30 21:02 | 570M | |
![[SND]](/icons/sound2.gif) | auralstimulation_121..> | 2012-10-31 20:59 | 561M | |
![[SND]](/icons/sound2.gif) | galeriaalternativa_1..> | 2012-11-01 20:00 | 630M | |
![[SND]](/icons/sound2.gif) | Headlines Bumper.wav | 2012-11-02 01:04 | 1.1M | |
![[SND]](/icons/sound2.gif) | registeredearoffende..> | 2012-11-02 13:00 | 594M | |
![[SND]](/icons/sound2.gif) | awkwardcoversations_..> | 2012-11-03 12:04 | 616M | |
![[SND]](/icons/sound2.gif) | badadvice_121103_140..> | 2012-11-03 14:00 | 615M | |
![[SND]](/icons/sound2.gif) | thecallsheet_121103_..> | 2012-11-03 20:02 | 586M | |
![[SND]](/icons/sound2.gif) | 121104_165958_SRS001..> | 2012-11-04 15:59 | 602M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1211..> | 2012-11-04 17:00 | 35M | |
![[SND]](/icons/sound2.gif) | inthesportsbooth_121..> | 2012-11-04 18:00 | 620M | |
![[SND]](/icons/sound2.gif) | 121104_215147_SRS001..> | 2012-11-04 20:51 | 1.9M | |
![[SND]](/icons/sound2.gif) | 121104_215206_SRS001..> | 2012-11-04 20:52 | 745M | |
![[SND]](/icons/sound2.gif) | angrydorkspodcast_12..> | 2012-11-05 18:00 | 611M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1211..> | 2012-11-05 20:01 | 557M | |
![[SND]](/icons/sound2.gif) | 121106_200955_SRS001..> | 2012-11-06 19:09 | 133M | |
![[SND]](/icons/sound2.gif) | 121106_210910_SRS001..> | 2012-11-06 20:09 | 222M | |
![[SND]](/icons/sound2.gif) | thehotbox_121106_215..> | 2012-11-06 20:59 | 606M | |
![[SND]](/icons/sound2.gif) | auralstimulation_121..> | 2012-11-07 21:00 | 550M | |
![[SND]](/icons/sound2.gif) | galeriaalternativa_1..> | 2012-11-08 20:00 | 598M | |
![[SND]](/icons/sound2.gif) | HoneymoonSketchWave.wav | 2012-11-08 23:17 | 29M | |
![[SND]](/icons/sound2.gif) | registeredearoffende..> | 2012-11-09 13:00 | 607M | |
![[SND]](/icons/sound2.gif) | awkwardcoversations_..> | 2012-11-10 12:00 | 561M | |
![[SND]](/icons/sound2.gif) | 121110_140231_SRS001..> | 2012-11-10 13:02 | 61M | |
![[SND]](/icons/sound2.gif) | 121110_140908_SRS001..> | 2012-11-10 13:09 | 553K | |
![[SND]](/icons/sound2.gif) | badadvice_121110_150..> | 2012-11-10 14:01 | 553M | |
![[SND]](/icons/sound2.gif) | thecallsheet_121110_..> | 2012-11-10 20:01 | 610M | |
![[SND]](/icons/sound2.gif) | toofatfucks_121111_1..> | 2012-11-11 13:00 | 316M | |
![[SND]](/icons/sound2.gif) | thelovebite_121111_1..> | 2012-11-11 15:00 | 565M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1211..> | 2012-11-11 16:00 | 607M | |
![[SND]](/icons/sound2.gif) | inthesportsbooth_121..> | 2012-11-11 18:17 | 595M | |
![[SND]](/icons/sound2.gif) | angrydorkspodcast_12..> | 2012-11-12 18:00 | 559M | |
![[SND]](/icons/sound2.gif) | 121112_200224_SRS001..> | 2012-11-12 19:02 | 70M | |
![[SND]](/icons/sound2.gif) | 121112_200935_SRS001..> | 2012-11-12 19:09 | 313K | |
![[SND]](/icons/sound2.gif) | thequmranreport_1211..> | 2012-11-12 20:00 | 558M | |
![[SND]](/icons/sound2.gif) | losanagelesnista_121..> | 2012-11-12 21:04 | 573M | |
![[SND]](/icons/sound2.gif) | 121113_010622_SRS001..> | 2012-11-13 00:06 | 697K | |
![[SND]](/icons/sound2.gif) | 121113_010814_SRS001..> | 2012-11-13 00:08 | 1.2M | |
![[SND]](/icons/sound2.gif) | 121113_010846_SRS001..> | 2012-11-13 00:08 | 457K | |
![[SND]](/icons/sound2.gif) | 121113_204906_SRS001..> | 2012-11-13 19:49 | 13M | |
![[SND]](/icons/sound2.gif) | 121113_205145_SRS001..> | 2012-11-13 19:51 | 4.3M | |
![[SND]](/icons/sound2.gif) | thehotbox_121113_220..> | 2012-11-13 21:00 | 596M | |
![[SND]](/icons/sound2.gif) | 121114_153438_SRS001..> | 2012-11-14 14:34 | 745K | |
![[SND]](/icons/sound2.gif) | auralstimulation_121..> | 2012-11-14 21:03 | 527M | |
![[SND]](/icons/sound2.gif) | galeriaalternativa_1..> | 2012-11-15 20:00 | 662M | |
![[SND]](/icons/sound2.gif) | 121116_014735_SRS001..> | 2012-11-16 00:47 | 25M | |
![[SND]](/icons/sound2.gif) | 121116_015342_SRS001..> | 2012-11-16 00:53 | 577K | |
![[SND]](/icons/sound2.gif) | 1 ConfessionsIntro.wav | 2012-11-16 01:50 | 2.0M | |
![[SND]](/icons/sound2.gif) | 1 Confessions Intro ..> | 2012-11-16 01:50 | 2.0M | |
![[SND]](/icons/sound2.gif) | 5 ConfessionsIntro.wav | 2012-11-16 01:50 | 2.0M | |
![[SND]](/icons/sound2.gif) | ConfessionsIntro.wav | 2012-11-16 01:50 | 2.0M | |
![[SND]](/icons/sound2.gif) | registeredearoffende..> | 2012-11-16 13:07 | 582M | |
![[SND]](/icons/sound2.gif) | awkwardcoversations_..> | 2012-11-17 12:00 | 611M | |
![[SND]](/icons/sound2.gif) | thelovebite_121118_1..> | 2012-11-18 15:00 | 575M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1211..> | 2012-11-18 16:00 | 609M | |
![[SND]](/icons/sound2.gif) | inthesportsbooth_121..> | 2012-11-18 18:00 | 614M | |
![[SND]](/icons/sound2.gif) | angrydorkspodcast_12..> | 2012-11-19 18:00 | 611M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1211..> | 2012-11-19 20:00 | 553M | |
![[SND]](/icons/sound2.gif) | 121120_214001_SRS001..> | 2012-11-20 20:40 | 241K | |
![[SND]](/icons/sound2.gif) | thehotbox_121120_220..> | 2012-11-20 21:04 | 575M | |
![[SND]](/icons/sound2.gif) | (1)GremlinsSketch.wav | 2012-11-22 14:40 | 36M | |
![[SND]](/icons/sound2.gif) | (4)AuralStimulation.wav | 2012-11-22 18:02 | 12M | |
![[SND]](/icons/sound2.gif) | (1)GuestIntroMusic.wav | 2012-11-22 18:22 | 2.0M | |
![[SND]](/icons/sound2.gif) | (3)GuestIntroMusic.wav | 2012-11-22 18:22 | 2.0M | |
![[SND]](/icons/sound2.gif) | 3 GuestIntroMusic.wav | 2012-11-22 18:22 | 2.0M | |
![[SND]](/icons/sound2.gif) | 3 Guest Intro Music ..> | 2012-11-22 18:22 | 2.0M | |
![[SND]](/icons/sound2.gif) | 4 Guest Intro Music.wav | 2012-11-22 18:22 | 2.0M | |
![[SND]](/icons/sound2.gif) | 4 GuestIntroMusic.wav | 2012-11-22 18:22 | 2.0M | |
![[SND]](/icons/sound2.gif) | 5 Guest Intro Music.wav | 2012-11-22 18:22 | 2.0M | |
![[SND]](/icons/sound2.gif) | GuestIntroMusic.wav | 2012-11-22 18:22 | 2.0M | |
![[SND]](/icons/sound2.gif) | registeredearoffende..> | 2012-11-23 13:00 | 609M | |
![[SND]](/icons/sound2.gif) | awkwardcoversations_..> | 2012-11-24 12:00 | 610M | |
![[SND]](/icons/sound2.gif) | badadvice_121124_150..> | 2012-11-24 14:00 | 559M | |
![[SND]](/icons/sound2.gif) | thecallsheet_121124_..> | 2012-11-24 20:00 | 606M | |
![[SND]](/icons/sound2.gif) | thelovebite_121125_1..> | 2012-11-25 15:02 | 562M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1211..> | 2012-11-25 16:03 | 554M | |
![[SND]](/icons/sound2.gif) | inthesportsbooth_121..> | 2012-11-25 18:01 | 630M | |
![[SND]](/icons/sound2.gif) | 121125_222028_SRS001..> | 2012-11-25 21:20 | 80M | |
![[SND]](/icons/sound2.gif) | angrydorkspodcast_12..> | 2012-11-26 18:00 | 560M | |
![[SND]](/icons/sound2.gif) | OUTRO.wav | 2012-11-26 18:20 | 9.6M | |
![[SND]](/icons/sound2.gif) | INTRO.wav | 2012-11-26 18:21 | 51M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1211..> | 2012-11-26 20:00 | 551M | |
![[SND]](/icons/sound2.gif) | losanagelesnista_121..> | 2012-11-26 21:08 | 633M | |
![[SND]](/icons/sound2.gif) | 121126_232908_SRS001..> | 2012-11-26 22:29 | 942M | |
![[SND]](/icons/sound2.gif) | thehotbox_121127_215..> | 2012-11-27 20:59 | 23M | |
![[SND]](/icons/sound2.gif) | thehotbox_121127_220..> | 2012-11-27 21:04 | 571M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_121..> | 2012-11-27 22:06 | 826M | |
![[SND]](/icons/sound2.gif) | TWWU2minclip.wav | 2012-11-28 11:39 | 20M | |
![[SND]](/icons/sound2.gif) | 121128_212306_SRS001..> | 2012-11-28 20:23 | 5.1M | |
![[SND]](/icons/sound2.gif) | auralstimulation_121..> | 2012-11-28 21:02 | 528M | |
![[SND]](/icons/sound2.gif) | 121129_130440_SRS001..> | 2012-11-29 12:04 | 640M | |
![[SND]](/icons/sound2.gif) | 121129_151258_SRS001..> | 2012-11-29 14:12 | 1.9M | |
![[SND]](/icons/sound2.gif) | 121129_224148_SRS001..> | 2012-11-29 21:41 | 1.0M | |
![[SND]](/icons/sound2.gif) | registeredearoffende..> | 2012-11-30 13:16 | 623M | |
![[SND]](/icons/sound2.gif) | 1palestine41.wav | 2012-11-30 14:25 | 8.6M | |
![[SND]](/icons/sound2.gif) | 2egyptitution41.wav | 2012-11-30 14:50 | 8.8M | |
![[SND]](/icons/sound2.gif) | 3rice41.wav | 2012-11-30 15:21 | 2.8M | |
![[SND]](/icons/sound2.gif) | 4condasleeza41.wav | 2012-11-30 15:33 | 8.0M | |
![[SND]](/icons/sound2.gif) | 5fiscalcliff41.wav | 2012-11-30 15:55 | 8.6M | |
![[SND]](/icons/sound2.gif) | 6walmartfire41.wav | 2012-11-30 16:03 | 3.9M | |
![[SND]](/icons/sound2.gif) | 7steroidsbad41.wav | 2012-11-30 16:31 | 6.0M | |
![[SND]](/icons/sound2.gif) | awkwardcoversations_..> | 2012-12-01 12:02 | 771M | |
![[SND]](/icons/sound2.gif) | badadvice_121201_150..> | 2012-12-01 14:00 | 559M | |
![[SND]](/icons/sound2.gif) | 121201_211024_SRS001..> | 2012-12-01 20:10 | 609M | |
![[SND]](/icons/sound2.gif) | thelovebite_121202_1..> | 2012-12-02 15:00 | 557M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1212..> | 2012-12-02 16:00 | 608M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1212..> | 2012-12-03 20:00 | 556M | |
![[SND]](/icons/sound2.gif) | 01 Wiped Out (FINAL ..> | 2012-12-03 21:08 | 12M | |
![[SND]](/icons/sound2.gif) | losanagelesnista_121..> | 2012-12-03 21:11 | 770M | |
![[SND]](/icons/sound2.gif) | 01 Black Thoughts v2..> | 2012-12-03 21:12 | 10M | |
![[SND]](/icons/sound2.gif) | 02 I Got News For Yo..> | 2012-12-03 21:14 | 7.0M | |
![[SND]](/icons/sound2.gif) | 11 Blast V2 (Mastere..> | 2012-12-03 21:16 | 12M | |
![[SND]](/icons/sound2.gif) | 05 Wrong (FINAL Mast..> | 2012-12-03 21:17 | 8.3M | |
![[SND]](/icons/sound2.gif) | 09 Panic Attack V2 (..> | 2012-12-03 21:19 | 10M | |
![[SND]](/icons/sound2.gif) | angrydorkspodcast_12..> | 2012-12-04 16:25 | 580M | |
![[SND]](/icons/sound2.gif) | thehotbox_121204_220..> | 2012-12-04 21:00 | 635M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_121..> | 2012-12-04 22:05 | 751M | |
![[SND]](/icons/sound2.gif) | auralstimulation_121..> | 2012-12-05 21:03 | 560M | |
![[SND]](/icons/sound2.gif) | 121206_130236_SRS001..> | 2012-12-06 12:02 | 624M | |
![[SND]](/icons/sound2.gif) | 121207_132913_SRS001..> | 2012-12-07 12:29 | 162M | |
![[SND]](/icons/sound2.gif) | registeredearoffende..> | 2012-12-07 13:00 | 561M | |
![[SND]](/icons/sound2.gif) | registeredearoffende..> | 2012-12-07 14:12 | 607M | |
![[SND]](/icons/sound2.gif) | thedevilsinthedetail..> | 2012-12-07 15:32 | 554M | |
![[SND]](/icons/sound2.gif) | auralstimulation_121..> | 2012-12-07 21:06 | 606M | |
![[SND]](/icons/sound2.gif) | awkwardcoversations_..> | 2012-12-08 12:00 | 613M | |
![[SND]](/icons/sound2.gif) | badadvice_121208_150..> | 2012-12-08 14:00 | 609M | |
![[SND]](/icons/sound2.gif) | thecallsheet_121208_..> | 2012-12-08 20:01 | 598M | |
![[SND]](/icons/sound2.gif) | thelovebite_121209_1..> | 2012-12-09 15:00 | 559M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1212..> | 2012-12-09 16:00 | 607M | |
![[SND]](/icons/sound2.gif) | angrydorkspodcast_12..> | 2012-12-10 18:00 | 611M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1212..> | 2012-12-10 20:00 | 556M | |
![[SND]](/icons/sound2.gif) | baldwinupdate.wav | 2012-12-11 11:44 | 2.6M | |
![[SND]](/icons/sound2.gif) | 121211_205756_SRS001..> | 2012-12-11 19:57 | 29M | |
![[SND]](/icons/sound2.gif) | 121211_211111_SRS001..> | 2012-12-11 20:11 | 23M | |
![[SND]](/icons/sound2.gif) | 121211_212223_SRS001..> | 2012-12-11 20:22 | 11M | |
![[SND]](/icons/sound2.gif) | thehotbox_121211_220..> | 2012-12-11 21:02 | 560M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_121..> | 2012-12-11 22:03 | 737M | |
![[SND]](/icons/sound2.gif) | 121212_205133_SRS001..> | 2012-12-12 19:51 | 32M | |
![[SND]](/icons/sound2.gif) | 121212_205444_SRS001..> | 2012-12-12 19:54 | 5.3M | |
![[SND]](/icons/sound2.gif) | 121212_205523_SRS001..> | 2012-12-12 19:55 | 6.1M | |
![[SND]](/icons/sound2.gif) | 121212_210006_SRS001..> | 2012-12-12 20:00 | 101M | |
![[SND]](/icons/sound2.gif) | auralstimulation_121..> | 2012-12-12 21:01 | 605M | |
![[SND]](/icons/sound2.gif) | 121214_134050_SRS001..> | 2012-12-14 12:40 | 126M | |
![[SND]](/icons/sound2.gif) | registeredearoffende..> | 2012-12-14 13:00 | 556M | |
![[SND]](/icons/sound2.gif) | registeredearoffende..> | 2012-12-14 14:04 | 606M | |
![[SND]](/icons/sound2.gif) | thedevilsinthedetail..> | 2012-12-14 15:07 | 569M | |
![[SND]](/icons/sound2.gif) | awkwardcoversations_..> | 2012-12-15 12:00 | 613M | |
![[SND]](/icons/sound2.gif) | badadvice_121215_150..> | 2012-12-15 14:00 | 606M | |
![[SND]](/icons/sound2.gif) | thecallsheet_121215_..> | 2012-12-15 20:12 | 478M | |
![[SND]](/icons/sound2.gif) | thelovebite_121216_1..> | 2012-12-16 15:00 | 564M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1212..> | 2012-12-16 16:02 | 606M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1212..> | 2012-12-17 12:47 | 817K | |
![[SND]](/icons/sound2.gif) | angrydorkspodcast_12..> | 2012-12-17 18:00 | 560M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1212..> | 2012-12-17 20:00 | 3.9M | |
![[SND]](/icons/sound2.gif) | 121217_210038_SRS001..> | 2012-12-17 20:00 | 551M | |
![[SND]](/icons/sound2.gif) | thehotbox_121218_220..> | 2012-12-18 21:00 | 560M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_121..> | 2012-12-18 22:01 | 620M | |
![[SND]](/icons/sound2.gif) | auralstimulation_121..> | 2012-12-19 21:02 | 594M | |
![[SND]](/icons/sound2.gif) | galeriaalternativa_1..> | 2012-12-20 12:00 | 632M | |
![[SND]](/icons/sound2.gif) | 121221_014707_SRS001..> | 2012-12-21 00:47 | 30M | |
![[SND]](/icons/sound2.gif) | thedevilsinthedetail..> | 2012-12-21 14:00 | 614M | |
![[SND]](/icons/sound2.gif) | awkwardcoversations_..> | 2012-12-22 12:00 | 622M | |
![[SND]](/icons/sound2.gif) | badadvice_121222_150..> | 2012-12-22 14:00 | 606M | |
![[SND]](/icons/sound2.gif) | SRS background jazz.wav | 2012-12-23 14:11 | 19M | |
![[SND]](/icons/sound2.gif) | SRS is the place to ..> | 2012-12-23 14:11 | 4.1M | |
![[SND]](/icons/sound2.gif) | thelovebite_121223_1..> | 2012-12-23 15:00 | 605M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_121..> | 2012-12-25 22:06 | 563M | |
![[SND]](/icons/sound2.gif) | auralstimulation_121..> | 2012-12-26 21:04 | 606M | |
![[SND]](/icons/sound2.gif) | auralstimulation_121..> | 2012-12-26 22:43 | 606M | |
![[SND]](/icons/sound2.gif) | mormusicradiopod_121..> | 2012-12-27 22:05 | 622M | |
![[SND]](/icons/sound2.gif) | thedevilsinthedetail..> | 2012-12-28 14:00 | 551M | |
![[SND]](/icons/sound2.gif) | skidrowstudios_12122..> | 2012-12-28 17:50 | 35M | |
![[SND]](/icons/sound2.gif) | skidrowstudios_12122..> | 2012-12-28 17:55 | 345M | |
![[SND]](/icons/sound2.gif) | 121228_193339_SRS001..> | 2012-12-28 18:33 | 577K | |
![[SND]](/icons/sound2.gif) | skidrowstudios_12122..> | 2012-12-28 18:35 | 525M | |
![[SND]](/icons/sound2.gif) | awkwardcoversations_..> | 2012-12-29 12:33 | 563M | |
![[SND]](/icons/sound2.gif) | badadvice_121229_145..> | 2012-12-29 13:59 | 606M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1212..> | 2012-12-30 16:00 | 606M | |
![[SND]](/icons/sound2.gif) | 121231_222220_SRS001..> | 2012-12-31 21:22 | 348M | |
![[SND]](/icons/sound2.gif) | 121231_225641_SRS001..> | 2012-12-31 21:56 | 745K | |
![[SND]](/icons/sound2.gif) | 130101_015148_SRS001..> | 2013-01-01 00:51 | 515M | |
![[SND]](/icons/sound2.gif) | thehotbox_130101_215..> | 2013-01-01 20:59 | 559M | |
![[SND]](/icons/sound2.gif) | 6TWWU.wav | 2013-01-02 17:27 | 5.0M | |
![[SND]](/icons/sound2.gif) | firstTWWUpromo.wav | 2013-01-02 21:46 | 5.0M | |
![[SND]](/icons/sound2.gif) | firstTWWUpromo12ï..> | 2013-01-03 10:29 | 5.0M | |
![[SND]](/icons/sound2.gif) | mormusicradiopod_130..> | 2013-01-03 22:33 | 14M | |
![[SND]](/icons/sound2.gif) | thedevilsinthedetail..> | 2013-01-04 14:14 | 548M | |
![[SND]](/icons/sound2.gif) | 130104_171218_SRS001..> | 2013-01-04 16:12 | 889K | |
![[SND]](/icons/sound2.gif) | registeredearoffende..> | 2013-01-04 21:15 | 606M | |
![[SND]](/icons/sound2.gif) | awkwardcoversations_..> | 2013-01-05 11:59 | 651M | |
![[SND]](/icons/sound2.gif) | thecallsheet_130105_..> | 2013-01-05 20:11 | 490M | |
![[SND]](/icons/sound2.gif) | thelovebite_130106_1..> | 2013-01-06 14:59 | 560M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1301..> | 2013-01-06 16:00 | 606M | |
![[SND]](/icons/sound2.gif) | TWWUgenpromo.wav | 2013-01-07 09:32 | 5.0M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1301..> | 2013-01-07 10:13 | 1.1M | |
![[SND]](/icons/sound2.gif) | 1TWWU.wav | 2013-01-07 17:49 | 5.0M | |
![[SND]](/icons/sound2.gif) | newgenpromo17.wav | 2013-01-07 17:53 | 5.0M | |
![[SND]](/icons/sound2.gif) | 130107_190006_SRS001..> | 2013-01-07 18:00 | 559M | |
![[SND]](/icons/sound2.gif) | 130107_210001_SRS001..> | 2013-01-07 20:00 | 559M | |
![[SND]](/icons/sound2.gif) | thehotbox_130108_220..> | 2013-01-08 21:02 | 532M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_130..> | 2013-01-08 22:08 | 567M | |
![[SND]](/icons/sound2.gif) | Anesthetic Frank - H..> | 2013-01-09 09:58 | 47M | |
![[SND]](/icons/sound2.gif) | Barbara's Runnin Her..> | 2013-01-09 10:48 | 46M | |
![[SND]](/icons/sound2.gif) | He Is Risen 16COMP.wav | 2013-01-09 10:58 | 47M | |
![[SND]](/icons/sound2.gif) | The Weekly Wrap Up s..> | 2013-01-09 16:44 | 20M | |
![[SND]](/icons/sound2.gif) | 130109_201644_SRS001..> | 2013-01-09 19:16 | 32M | |
![[SND]](/icons/sound2.gif) | blastoff_130109_2100..> | 2013-01-09 20:00 | 600M | |
![[SND]](/icons/sound2.gif) | 130109_220030_SRS001..> | 2013-01-09 21:00 | 144M | |
![[SND]](/icons/sound2.gif) | thelovebite_130109_2..> | 2013-01-09 21:56 | 555M | |
![[SND]](/icons/sound2.gif) | galeriaalternativa_1..> | 2013-01-10 12:00 | 624M | |
![[SND]](/icons/sound2.gif) | 130110_174741_SRS001..> | 2013-01-10 16:47 | 6.8M | |
![[SND]](/icons/sound2.gif) | 130110_174944_SRS001..> | 2013-01-10 16:49 | 5.3M | |
![[SND]](/icons/sound2.gif) | 130110_175500_SRS001..> | 2013-01-10 16:55 | 3.7M | |
![[SND]](/icons/sound2.gif) | 130111_132615_SRS001..> | 2013-01-11 12:26 | 55M | |
![[SND]](/icons/sound2.gif) | 130111_133139_SRS001..> | 2013-01-11 12:31 | 20M | |
![[SND]](/icons/sound2.gif) | 130111_133342_SRS001..> | 2013-01-11 12:33 | 109M | |
![[SND]](/icons/sound2.gif) | registeredearoffende..> | 2013-01-11 13:00 | 607M | |
![[SND]](/icons/sound2.gif) | thedevilsinthedetail..> | 2013-01-11 14:10 | 613M | |
![[SND]](/icons/sound2.gif) | awkwardcoversations_..> | 2013-01-12 12:11 | 629M | |
![[SND]](/icons/sound2.gif) | thecallsheet_130112_..> | 2013-01-12 20:03 | 573M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1301..> | 2013-01-13 15:59 | 606M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1301..> | 2013-01-13 20:00 | 559M | |
![[SND]](/icons/sound2.gif) | anexposedtruth_13011..> | 2013-01-14 00:23 | 559M | |
![[SND]](/icons/sound2.gif) | angrydorkspodcast_13..> | 2013-01-14 17:59 | 557M | |
![[SND]](/icons/sound2.gif) | My War (single) 02-0..> | 2013-01-14 18:13 | 40M | |
![[SND]](/icons/sound2.gif) | 130114_205949_SRS001..> | 2013-01-14 19:59 | 556M | |
![[SND]](/icons/sound2.gif) | 2TWWU.wav | 2013-01-15 10:10 | 5.0M | |
![[SND]](/icons/sound2.gif) | thehotbox_130115_220..> | 2013-01-15 21:03 | 558M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_130..> | 2013-01-15 22:06 | 552M | |
![[SND]](/icons/sound2.gif) | 3badadvice.wav | 2013-01-16 18:45 | 5.0M | |
![[SND]](/icons/sound2.gif) | blastoff_130116_2100..> | 2013-01-16 20:00 | 559M | |
![[SND]](/icons/sound2.gif) | BADADVICE2MINCLIP.wav | 2013-01-16 20:23 | 24M | |
![[SND]](/icons/sound2.gif) | 130116_220236_SRS001..> | 2013-01-16 21:02 | 608M | |
![[SND]](/icons/sound2.gif) | 130116_230249_SRS001..> | 2013-01-16 22:02 | 337K | |
![[SND]](/icons/sound2.gif) | 130117_025254_SRS001..> | 2013-01-17 01:52 | 841K | |
![[SND]](/icons/sound2.gif) | TWWUpromo11513..> | 2013-01-17 11:24 | 5.0M | |
![[SND]](/icons/sound2.gif) | galeriaalternativa_1..> | 2013-01-17 12:00 | 643M | |
![[SND]](/icons/sound2.gif) | auralstimulation_130..> | 2013-01-17 16:54 | 608M | |
![[SND]](/icons/sound2.gif) | mormusicradiopod_130..> | 2013-01-17 22:08 | 4.9M | |
![[SND]](/icons/sound2.gif) | registeredearoffende..> | 2013-01-18 13:00 | 607M | |
![[SND]](/icons/sound2.gif) | thedevilsinthedetail..> | 2013-01-18 14:05 | 557M | |
![[SND]](/icons/sound2.gif) | awkwardcoversations_..> | 2013-01-19 12:00 | 681M | |
![[SND]](/icons/sound2.gif) | skidrowstudios_13011..> | 2013-01-19 13:32 | 1.7M | |
![[SND]](/icons/sound2.gif) | Silence Track - 2.5 ..> | 2013-01-19 13:42 | 431K | |
![[SND]](/icons/sound2.gif) | skidrowstudios_13011..> | 2013-01-19 13:53 | 769K | |
![[SND]](/icons/sound2.gif) | badadvice_130119_150..> | 2013-01-19 14:00 | 606M | |
![[SND]](/icons/sound2.gif) | thecallsheet_130119_..> | 2013-01-19 20:00 | 558M | |
![[SND]](/icons/sound2.gif) | thecallsheet_130119_..> | 2013-01-19 21:00 | 555M | |
![[SND]](/icons/sound2.gif) | thelovebite_130120_1..> | 2013-01-20 15:00 | 555M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1301..> | 2013-01-20 16:00 | 606M | |
![[SND]](/icons/sound2.gif) | anexposedtruth_13012..> | 2013-01-20 20:00 | 555M | |
![[SND]](/icons/sound2.gif) | johnnyscottgramercy_..> | 2013-01-20 20:59 | 560M | |
![[SND]](/icons/sound2.gif) | badadvice_BADADVICE2..> | 2013-01-21 02:13 | 24M | |
![[SND]](/icons/sound2.gif) | angrydorkspodcast_13..> | 2013-01-21 18:00 | 561M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1301..> | 2013-01-21 19:59 | 563M | |
![[SND]](/icons/sound2.gif) | 130122_002008_SRS001..> | 2013-01-21 23:20 | 601K | |
![[SND]](/icons/sound2.gif) | Silence Track - 3 se..> | 2013-01-22 04:29 | 517K | |
![[SND]](/icons/sound2.gif) | 7TWWU.wav | 2013-01-22 16:32 | 5.0M | |
![[SND]](/icons/sound2.gif) | thehotbox_130122_220..> | 2013-01-22 21:02 | 563M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_130..> | 2013-01-22 22:21 | 565M | |
![[SND]](/icons/sound2.gif) | blastoff_130123_2100..> | 2013-01-23 20:00 | 560M | |
![[SND]](/icons/sound2.gif) | auralstimulation_130..> | 2013-01-23 21:01 | 606M | |
![[SND]](/icons/sound2.gif) | auralstimulation_130..> | 2013-01-23 22:05 | 606M | |
![[SND]](/icons/sound2.gif) | dearabbyclip.wav | 2013-01-24 00:38 | 2.0M | |
![[SND]](/icons/sound2.gif) | Nube2.wav | 2013-01-24 11:58 | 40M | |
![[SND]](/icons/sound2.gif) | galeriaalternativa_1..> | 2013-01-24 12:00 | 600M | |
![[SND]](/icons/sound2.gif) | galeriaalternativa_1..> | 2013-01-24 12:59 | 5.9M | |
![[SND]](/icons/sound2.gif) | 130125_012658_SRS001..> | 2013-01-25 00:26 | 42M | |
![[SND]](/icons/sound2.gif) | 130125_132448_SRS001..> | 2013-01-25 12:24 | 118M | |
![[SND]](/icons/sound2.gif) | registeredearoffende..> | 2013-01-25 12:59 | 606M | |
![[SND]](/icons/sound2.gif) | thedevilsinthedetail..> | 2013-01-25 14:03 | 555M | |
![[SND]](/icons/sound2.gif) | 130125_160353_SRS001..> | 2013-01-25 15:03 | 28M | |
![[SND]](/icons/sound2.gif) | 130125_160702_SRS001..> | 2013-01-25 15:07 | 529K | |
![[SND]](/icons/sound2.gif) | 18 Tangled Up In Blu..> | 2013-01-26 02:34 | 58M | |
![[SND]](/icons/sound2.gif) | 12 Lily, Rosemary An..> | 2013-01-26 02:34 | 90M | |
![[SND]](/icons/sound2.gif) | awkwardcoversations_..> | 2013-01-26 12:00 | 587M | |
![[SND]](/icons/sound2.gif) | badadvice_130126_150..> | 2013-01-26 14:00 | 606M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1301..> | 2013-01-26 15:06 | 606M | |
![[SND]](/icons/sound2.gif) | 130126_171958_SRS001..> | 2013-01-26 16:19 | 9.9M | |
![[SND]](/icons/sound2.gif) | 130126_172429_SRS001..> | 2013-01-26 16:24 | 29M | |
![[SND]](/icons/sound2.gif) | anexposedsecret_1301..> | 2013-01-26 21:12 | 556M | |
![[SND]](/icons/sound2.gif) | 130126_231557_SRS001..> | 2013-01-26 22:15 | 4.9M | |
![[SND]](/icons/sound2.gif) | 130126_231702_SRS001..> | 2013-01-26 22:17 | 16M | |
![[SND]](/icons/sound2.gif) | 1028.WAV | 2013-01-27 13:09 | 313K | |
![[SND]](/icons/sound2.gif) | 1029.WAV | 2013-01-27 13:44 | 118M | |
![[SND]](/icons/sound2.gif) | 1030.WAV | 2013-01-27 14:37 | 57M | |
![[SND]](/icons/sound2.gif) | 1031.WAV | 2013-01-27 15:16 | 95M | |
![[SND]](/icons/sound2.gif) | 1032.WAV | 2013-01-27 16:04 | 90M | |
![[SND]](/icons/sound2.gif) | 1033.WAV | 2013-01-27 17:21 | 26M | |
![[SND]](/icons/sound2.gif) | johnnyscottgramercy_..> | 2013-01-27 20:59 | 566M | |
![[SND]](/icons/sound2.gif) | angrydorkspodcast_13..> | 2013-01-28 18:00 | 561M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1301..> | 2013-01-28 20:00 | 597M | |
![[SND]](/icons/sound2.gif) | 130129_000046_SRS001..> | 2013-01-28 23:00 | 505K | |
![[SND]](/icons/sound2.gif) | 4TWWU.wav | 2013-01-29 12:08 | 5.0M | |
![[SND]](/icons/sound2.gif) | TWWUpromo12913..> | 2013-01-29 12:35 | 5.0M | |
![[SND]](/icons/sound2.gif) | thehotbox_130129_220..> | 2013-01-29 21:00 | 557M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_130..> | 2013-01-29 22:16 | 812M | |
![[SND]](/icons/sound2.gif) | orthodoxcreep.wav | 2013-01-30 00:20 | 6.0M | |
![[SND]](/icons/sound2.gif) | 130130_182617_SRS001..> | 2013-01-30 17:26 | 57M | |
![[SND]](/icons/sound2.gif) | blastoff_130130_2100..> | 2013-01-30 20:00 | 43M | |
![[SND]](/icons/sound2.gif) | 130131_120308_SRS001..> | 2013-01-31 11:03 | 721K | |
![[SND]](/icons/sound2.gif) | badadvice_130204_pro..> | 2013-01-31 11:24 | 5.1M | |
![[SND]](/icons/sound2.gif) | galeriaalternativa_1..> | 2013-01-31 12:00 | 605M | |
![[SND]](/icons/sound2.gif) | galeriaalternativa_1..> | 2013-01-31 12:59 | 5.6M | |
![[SND]](/icons/sound2.gif) | mormusicradiopod_130..> | 2013-01-31 22:26 | 13M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1302..> | 2013-01-31 22:32 | 5.0M | |
![[SND]](/icons/sound2.gif) | 4 SchmoesKnowClip.wav | 2013-01-31 22:37 | 7.8M | |
![[SND]](/icons/sound2.gif) | 6 SchmoesKnowTheme.wav | 2013-02-01 11:14 | 851K | |
![[SND]](/icons/sound2.gif) | 5 JustinCaseSketch.wav | 2013-02-01 11:21 | 41M | |
![[SND]](/icons/sound2.gif) | registeredearoffende..> | 2013-02-01 13:05 | 606M | |
![[SND]](/icons/sound2.gif) | thedevilsinthedetail..> | 2013-02-01 14:09 | 555M | |
![[SND]](/icons/sound2.gif) | 130202_130017_SRS001..> | 2013-02-02 12:00 | 646M | |
![[SND]](/icons/sound2.gif) | badadvice_130202_150..> | 2013-02-02 14:00 | 606M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1302..> | 2013-02-02 15:07 | 605M | |
![[SND]](/icons/sound2.gif) | 130202_180307_SRS001..> | 2013-02-02 17:03 | 241K | |
![[SND]](/icons/sound2.gif) | 130202_180309_SRS001..> | 2013-02-02 17:03 | 10M | |
![[SND]](/icons/sound2.gif) | 130202_180409_SRS001..> | 2013-02-02 17:04 | 10M | |
![[SND]](/icons/sound2.gif) | 130202_180509_SRS001..> | 2013-02-02 17:05 | 337K | |
![[SND]](/icons/sound2.gif) | 130203_160007_SRS001..> | 2013-02-03 15:00 | 559M | |
![[SND]](/icons/sound2.gif) | anexposedsecret_1302..> | 2013-02-03 20:00 | 564M | |
![[SND]](/icons/sound2.gif) | 130203_221128_SRS001..> | 2013-02-03 21:11 | 456M | |
![[SND]](/icons/sound2.gif) | angrydorkspodcast_13..> | 2013-02-04 18:00 | 561M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1302..> | 2013-02-04 20:00 | 1.5M | |
![[SND]](/icons/sound2.gif) | 130204_210019_SRS001..> | 2013-02-04 20:00 | 561M | |
![[SND]](/icons/sound2.gif) | 5TWWU.wav | 2013-02-05 19:59 | 5.0M | |
![[SND]](/icons/sound2.gif) | 130205_210147_SRS001..> | 2013-02-05 20:01 | 571M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1302..> | 2013-02-05 20:13 | 5.0M | |
![[SND]](/icons/sound2.gif) | ronjeremy.wav | 2013-02-05 20:59 | 7.4M | |
![[SND]](/icons/sound2.gif) | thehotbox_130205_221..> | 2013-02-05 21:10 | 563M | |
![[SND]](/icons/sound2.gif) | registeredearoffende..> | 2013-02-05 21:59 | 5.0M | |
![[SND]](/icons/sound2.gif) | badadvice_130902_pro..> | 2013-02-06 15:18 | 5.1M | |
![[SND]](/icons/sound2.gif) | blastoff_130206_2100..> | 2013-02-06 20:00 | 559M | |
![[SND]](/icons/sound2.gif) | auralstimulation_130..> | 2013-02-06 20:59 | 606M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_130..> | 2013-02-06 22:04 | 557M | |
![[SND]](/icons/sound2.gif) | galeriaalternativa_1..> | 2013-02-07 12:00 | 609M | |
![[SND]](/icons/sound2.gif) | registeredearoffende..> | 2013-02-08 13:00 | 606M | |
![[SND]](/icons/sound2.gif) | thedevilsinthedetail..> | 2013-02-08 14:05 | 559M | |
![[SND]](/icons/sound2.gif) | awkwardcoversations_..> | 2013-02-09 12:00 | 606M | |
![[SND]](/icons/sound2.gif) | badadvice_130209_150..> | 2013-02-09 14:00 | 606M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1302..> | 2013-02-09 15:04 | 606M | |
![[SND]](/icons/sound2.gif) | thecallsheet_130209_..> | 2013-02-09 20:02 | 561M | |
![[SND]](/icons/sound2.gif) | anexposedsecret_1302..> | 2013-02-10 20:00 | 558M | |
![[SND]](/icons/sound2.gif) | johnnyscottgramercy_..> | 2013-02-10 21:01 | 593M | |
![[SND]](/icons/sound2.gif) | auralstimulation_130..> | 2013-02-10 23:10 | 2.5M | |
![[SND]](/icons/sound2.gif) | angrydorkspodcast_13..> | 2013-02-11 18:00 | 563M | |
![[SND]](/icons/sound2.gif) | 8badadvice.wav | 2013-02-11 19:15 | 5.1M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1302..> | 2013-02-11 20:00 | 604M | |
![[SND]](/icons/sound2.gif) | 130212_002656_SRS001..> | 2013-02-11 23:26 | 12M | |
![[SND]](/icons/sound2.gif) | thekenaugustshow_130..> | 2013-02-12 12:20 | 157M | |
![[SND]](/icons/sound2.gif) | thekenaugustshow_130..> | 2013-02-12 12:36 | 418M | |
![[SND]](/icons/sound2.gif) | thekenaugustshow_130..> | 2013-02-12 13:20 | 527M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1302..> | 2013-02-12 16:49 | 5.0M | |
![[SND]](/icons/sound2.gif) | thekenaugustshow_130..> | 2013-02-12 17:50 | 457K | |
![[SND]](/icons/sound2.gif) | thehotbox_130212_220..> | 2013-02-12 21:00 | 562M | |
![[SND]](/icons/sound2.gif) | badadvice_130209_pro..> | 2013-02-13 19:18 | 5.6M | |
![[SND]](/icons/sound2.gif) | registeredearoffende..> | 2013-02-13 19:20 | 5.0M | |
![[SND]](/icons/sound2.gif) | blastoff_130213_2100..> | 2013-02-13 20:00 | 560M | |
![[SND]](/icons/sound2.gif) | auralstimulation_130..> | 2013-02-13 21:00 | 606M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_130..> | 2013-02-13 22:00 | 1.3M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_130..> | 2013-02-13 22:05 | 556M | |
![[SND]](/icons/sound2.gif) | galeriaalternativa_1..> | 2013-02-14 12:00 | 619M | |
![[SND]](/icons/sound2.gif) | 130214_181408_SRS001..> | 2013-02-14 17:14 | 6.0M | |
![[SND]](/icons/sound2.gif) | 130214_181445_SRS001..> | 2013-02-14 17:14 | 6.3M | |
![[SND]](/icons/sound2.gif) | 130214_181553_SRS001..> | 2013-02-14 17:15 | 4.4M | |
![[SND]](/icons/sound2.gif) | 130214_182130_SRS001..> | 2013-02-14 17:21 | 2.5M | |
![[SND]](/icons/sound2.gif) | 130214_182144_SRS001..> | 2013-02-14 17:21 | 4.3M | |
![[SND]](/icons/sound2.gif) | 130214_182226_SRS001..> | 2013-02-14 17:22 | 3.5M | |
![[SND]](/icons/sound2.gif) | 130214_182247_SRS001..> | 2013-02-14 17:22 | 4.9M | |
![[SND]](/icons/sound2.gif) | 130214_182523_SRS001..> | 2013-02-14 17:25 | 4.3M | |
![[SND]](/icons/sound2.gif) | 130214_182549_SRS001..> | 2013-02-14 17:25 | 5.2M | |
![[SND]](/icons/sound2.gif) | 130214_182806_SRS001..> | 2013-02-14 17:28 | 2.3M | |
![[SND]](/icons/sound2.gif) | 130214_182820_SRS001..> | 2013-02-14 17:28 | 4.9M | |
![[SND]](/icons/sound2.gif) | 130214_182849_SRS001..> | 2013-02-14 17:28 | 4.1M | |
![[SND]](/icons/sound2.gif) | 130214_182913_SRS001..> | 2013-02-14 17:29 | 4.8M | |
![[SND]](/icons/sound2.gif) | 130214_183111_SRS001..> | 2013-02-14 17:31 | 4.2M | |
![[SND]](/icons/sound2.gif) | jellybelly-ad.wav | 2013-02-14 17:35 | 3.5M | |
![[SND]](/icons/sound2.gif) | islandsurf-ad.wav | 2013-02-14 17:36 | 4.0M | |
![[SND]](/icons/sound2.gif) | inetvideo-ad.wav | 2013-02-14 17:39 | 4.1M | |
![[SND]](/icons/sound2.gif) | findlegalforms-ad.wav | 2013-02-14 17:40 | 3.6M | |
![[SND]](/icons/sound2.gif) | discoverychannel-ad.wav | 2013-02-14 17:42 | 3.3M | |
![[SND]](/icons/sound2.gif) | 1800clothes-ad.wav | 2013-02-14 17:43 | 3.8M | |
![[SND]](/icons/sound2.gif) | bestbuyglasses-ad.wav | 2013-02-14 17:45 | 4.7M | |
![[SND]](/icons/sound2.gif) | 130214_184614_SRS001..> | 2013-02-14 17:46 | 5.8M | |
![[SND]](/icons/sound2.gif) | 130214_184718_SRS001..> | 2013-02-14 17:47 | 3.0M | |
![[SND]](/icons/sound2.gif) | 130214_184736_SRS001..> | 2013-02-14 17:47 | 3.3M | |
![[SND]](/icons/sound2.gif) | 130214_184756_SRS001..> | 2013-02-14 17:47 | 5.3M | |
![[SND]](/icons/sound2.gif) | 130214_184827_SRS001..> | 2013-02-14 17:48 | 337K | |
![[SND]](/icons/sound2.gif) | 130214_184832_SRS001..> | 2013-02-14 17:48 | 5.2M | |
![[SND]](/icons/sound2.gif) | 130214_185210_SRS001..> | 2013-02-14 17:52 | 4.7M | |
![[SND]](/icons/sound2.gif) | 130214_185237_SRS001..> | 2013-02-14 17:52 | 5.5M | |
![[SND]](/icons/sound2.gif) | southbeachsmoke.com-..> | 2013-02-14 17:56 | 4.8M | |
![[SND]](/icons/sound2.gif) | oldtimecandy-ad.wav | 2013-02-14 17:58 | 5.0M | |
![[SND]](/icons/sound2.gif) | 130214_190006_SRS001..> | 2013-02-14 18:00 | 1.6M | |
![[SND]](/icons/sound2.gif) | 130214_190016_SRS001..> | 2013-02-14 18:00 | 5.0M | |
![[SND]](/icons/sound2.gif) | mrbeer-ad.wav | 2013-02-14 18:01 | 4.3M | |
![[SND]](/icons/sound2.gif) | thekenaugustshow_130..> | 2013-02-14 18:15 | 598M | |
![[SND]](/icons/sound2.gif) | registeredearoffende..> | 2013-02-15 13:04 | 606M | |
![[SND]](/icons/sound2.gif) | cypresshill-killaman..> | 2013-02-15 13:27 | 3.5M | |
![[SND]](/icons/sound2.gif) | thedevilsinthedetail..> | 2013-02-15 14:08 | 555M | |
![[SND]](/icons/sound2.gif) | awkwardcoversations_..> | 2013-02-16 12:00 | 648M | |
![[SND]](/icons/sound2.gif) | badadvice_130216_150..> | 2013-02-16 14:00 | 606M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1302..> | 2013-02-16 15:05 | 604M | |
![[SND]](/icons/sound2.gif) | thecallsheet_130217_..> | 2013-02-16 23:40 | 178M | |
![[SND]](/icons/sound2.gif) | thelovebite_130217_1..> | 2013-02-17 15:01 | 558M | |
![[SND]](/icons/sound2.gif) | anexposedsecret_1302..> | 2013-02-17 20:00 | 569M | |
![[SND]](/icons/sound2.gif) | 130217_220426_SRS001..> | 2013-02-17 21:04 | 566M | |
![[SND]](/icons/sound2.gif) | theestaticage_130217..> | 2013-02-17 22:07 | 567M | |
![[SND]](/icons/sound2.gif) | thekenaugustshow_130..> | 2013-02-18 12:42 | 606M | |
![[SND]](/icons/sound2.gif) | thekenaugustshow_130..> | 2013-02-18 13:42 | 605M | |
![[SND]](/icons/sound2.gif) | thekenaugustshow_130..> | 2013-02-18 14:42 | 611M | |
![[SND]](/icons/sound2.gif) | angrydorks_130218_19..> | 2013-02-18 18:02 | 557M | |
![[SND]](/icons/sound2.gif) | auralstimulation_130..> | 2013-02-18 18:06 | 5.0M | |
![[SND]](/icons/sound2.gif) | thekenaugustshow_130..> | 2013-02-18 18:50 | 572M | |
![[SND]](/icons/sound2.gif) | Aural Love or Lust.wav | 2013-02-18 19:10 | 1.6M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1302..> | 2013-02-18 20:00 | 560M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1302..> | 2013-02-18 22:41 | 5.0M | |
![[SND]](/icons/sound2.gif) | thehotbox_130219_221..> | 2013-02-19 21:13 | 561M | |
![[SND]](/icons/sound2.gif) | registeredearoffende..> | 2013-02-19 21:52 | 5.0M | |
![[SND]](/icons/sound2.gif) | 09 PsychicEveryday.R..> | 2013-02-20 17:54 | 3.1M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1302..> | 2013-02-20 18:59 | 556M | |
![[SND]](/icons/sound2.gif) | blastoff_130220_2103..> | 2013-02-20 20:03 | 558M | |
![[SND]](/icons/sound2.gif) | badadvice_130223_pro..> | 2013-02-20 20:15 | 5.1M | |
![[SND]](/icons/sound2.gif) | auralstimulation_130..> | 2013-02-20 21:04 | 606M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_130..> | 2013-02-20 22:13 | 592M | |
![[SND]](/icons/sound2.gif) | galeriaalternativa_1..> | 2013-02-21 15:26 | 288M | |
![[SND]](/icons/sound2.gif) | 130221_210543_SRS001..> | 2013-02-21 20:05 | 7.2M | |
![[SND]](/icons/sound2.gif) | 130221_210644_SRS001..> | 2013-02-21 20:06 | 7.1M | |
![[SND]](/icons/sound2.gif) | 130221_225241_SRS001..> | 2013-02-21 21:52 | 271M | |
![[SND]](/icons/sound2.gif) | registeredearoffende..> | 2013-02-22 13:05 | 606M | |
![[SND]](/icons/sound2.gif) | thedevilsinthedetail..> | 2013-02-22 14:25 | 50M | |
![[SND]](/icons/sound2.gif) | thedevilsinthedetail..> | 2013-02-22 14:30 | 556M | |
![[SND]](/icons/sound2.gif) | awkwardcoversations_..> | 2013-02-23 12:00 | 620M | |
![[SND]](/icons/sound2.gif) | badadvice_130223_152..> | 2013-02-23 14:20 | 607M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1302..> | 2013-02-23 15:34 | 607M | |
![[SND]](/icons/sound2.gif) | thecallsheet_130223_..> | 2013-02-23 20:05 | 560M | |
![[SND]](/icons/sound2.gif) | thelovebite_130224_1..> | 2013-02-24 15:00 | 562M | |
![[SND]](/icons/sound2.gif) | anexposedsecret_1302..> | 2013-02-24 20:00 | 600M | |
![[SND]](/icons/sound2.gif) | anexposedsecret_1302..> | 2013-02-24 21:04 | 557M | |
![[SND]](/icons/sound2.gif) | theestaticage_130224..> | 2013-02-24 22:13 | 552M | |
![[SND]](/icons/sound2.gif) | angrydorks_130225_19..> | 2013-02-25 18:00 | 271M | |
![[SND]](/icons/sound2.gif) | angrydorks_130225_19..> | 2013-02-25 18:29 | 562M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1302..> | 2013-02-25 20:00 | 567M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1303..> | 2013-02-25 20:02 | 5.0M | |
![[SND]](/icons/sound2.gif) | thehotbox_130226_220..> | 2013-02-26 21:02 | 560M | |
![[SND]](/icons/sound2.gif) | 130226_230017_SRS001..> | 2013-02-26 22:00 | 7.4M | |
![[SND]](/icons/sound2.gif) | 130226_230256_SRS001..> | 2013-02-26 22:02 | 361K | |
![[SND]](/icons/sound2.gif) | auralstimulation_130..> | 2013-02-26 22:51 | 5.0M | |
![[SND]](/icons/sound2.gif) | registeredearoffende..> | 2013-02-27 17:35 | 5.0M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1302..> | 2013-02-27 19:00 | 573M | |
![[SND]](/icons/sound2.gif) | auralstimulation_130..> | 2013-02-27 21:04 | 606M | |
![[SND]](/icons/sound2.gif) | badadvice_130302_pro..> | 2013-02-27 21:18 | 5.4M | |
![[SND]](/icons/sound2.gif) | 130227_231750_SRS001..> | 2013-02-27 22:17 | 558M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_130..> | 2013-02-28 11:29 | 560M | |
![[SND]](/icons/sound2.gif) | registeredearoffende..> | 2013-03-01 13:00 | 606M | |
![[SND]](/icons/sound2.gif) | thedevilsinthedetail..> | 2013-03-01 14:08 | 662M | |
![[SND]](/icons/sound2.gif) | awkwardcoversations_..> | 2013-03-02 11:59 | 614M | |
![[SND]](/icons/sound2.gif) | awkwardcoversations_..> | 2013-03-02 13:04 | 507M | |
![[SND]](/icons/sound2.gif) | 130302_150154_SRS001..> | 2013-03-02 14:01 | 607M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1303..> | 2013-03-02 15:07 | 606M | |
![[SND]](/icons/sound2.gif) | thecallsheet_130302_..> | 2013-03-02 19:59 | 561M | |
![[SND]](/icons/sound2.gif) | thelovebite_130303_1..> | 2013-03-03 15:00 | 559M | |
![[SND]](/icons/sound2.gif) | anexposedsecret_1303..> | 2013-03-03 20:00 | 568M | |
![[SND]](/icons/sound2.gif) | anexposedsecret_1303..> | 2013-03-03 21:03 | 573M | |
![[SND]](/icons/sound2.gif) | angrydorks_130304_19..> | 2013-03-04 18:00 | 561M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1303..> | 2013-03-04 20:00 | 572M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1303..> | 2013-03-05 10:26 | 5.0M | |
![[SND]](/icons/sound2.gif) | registeredearoffende..> | 2013-03-05 20:27 | 5.0M | |
![[SND]](/icons/sound2.gif) | thehotbox_130305_220..> | 2013-03-05 21:02 | 565M | |
![[SND]](/icons/sound2.gif) | auralstimulation_130..> | 2013-03-05 22:06 | 567M | |
![[SND]](/icons/sound2.gif) | johnnyscottgramercy_..> | 2013-03-06 10:52 | 573M | |
![[SND]](/icons/sound2.gif) | badadvice_130309_pro..> | 2013-03-06 18:18 | 5.3M | |
![[SND]](/icons/sound2.gif) | 130306_200325_SRS001..> | 2013-03-06 19:03 | 530M | |
![[SND]](/icons/sound2.gif) | 130306_205557_SRS001..> | 2013-03-06 19:55 | 2.4M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_130..> | 2013-03-06 22:12 | 559M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1303..> | 2013-03-07 20:10 | 556M | |
![[SND]](/icons/sound2.gif) | thelovebite_130307_2..> | 2013-03-07 20:34 | 559M | |
![[SND]](/icons/sound2.gif) | 1 Inhuman Resources ..> | 2013-03-07 23:44 | 2.3M | |
![[SND]](/icons/sound2.gif) | 5 Inhuman Resources ..> | 2013-03-07 23:44 | 2.3M | |
![[SND]](/icons/sound2.gif) | 130308_133406_SRS001..> | 2013-03-08 12:34 | 111M | |
![[SND]](/icons/sound2.gif) | registeredearoffende..> | 2013-03-08 13:00 | 606M | |
![[SND]](/icons/sound2.gif) | thedevilsinthedetail..> | 2013-03-08 14:05 | 556M | |
![[SND]](/icons/sound2.gif) | 130308_193005_SRS001..> | 2013-03-08 18:30 | 51M | |
![[SND]](/icons/sound2.gif) | 130308_193744_SRS001..> | 2013-03-08 18:37 | 38M | |
![[SND]](/icons/sound2.gif) | 130308_195306_SRS001..> | 2013-03-08 18:53 | 57M | |
![[SND]](/icons/sound2.gif) | 130308_201157_SRS001..> | 2013-03-08 19:11 | 19M | |
![[SND]](/icons/sound2.gif) | johnnyscottgramercy_..> | 2013-03-08 19:54 | 588M | |
![[SND]](/icons/sound2.gif) | awkwardcoversations_..> | 2013-03-09 11:59 | 593M | |
![[SND]](/icons/sound2.gif) | badadvice_130309_150..> | 2013-03-09 14:00 | 606M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1303..> | 2013-03-09 15:06 | 606M | |
![[SND]](/icons/sound2.gif) | thecallsheet_130309_..> | 2013-03-09 20:00 | 560M | |
![[SND]](/icons/sound2.gif) | angrydorks_130311_18..> | 2013-03-11 18:00 | 561M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1303..> | 2013-03-11 19:32 | 5.0M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1303..> | 2013-03-11 20:00 | 563M | |
![[SND]](/icons/sound2.gif) | 130312_210845_SRS001..> | 2013-03-12 21:08 | 546M | |
![[SND]](/icons/sound2.gif) | registeredearoffende..> | 2013-03-13 16:52 | 5.0M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1303..> | 2013-03-13 18:59 | 556M | |
![[SND]](/icons/sound2.gif) | badadvice_130316_pro..> | 2013-03-13 20:13 | 5.3M | |
![[SND]](/icons/sound2.gif) | auralstimulation_130..> | 2013-03-13 21:00 | 606M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_130..> | 2013-03-13 22:11 | 559M | |
![[SND]](/icons/sound2.gif) | 1 SketchyCharacters.wav | 2013-03-14 12:00 | 39M | |
![[SND]](/icons/sound2.gif) | thelovebite_130314_2..> | 2013-03-14 21:15 | 560M | |
![[SND]](/icons/sound2.gif) | registeredearoffende..> | 2013-03-15 13:00 | 606M | |
![[SND]](/icons/sound2.gif) | thedevilsinthedetail..> | 2013-03-15 14:08 | 559M | |
![[SND]](/icons/sound2.gif) | badadvice_130316_140..> | 2013-03-16 14:00 | 606M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1303..> | 2013-03-16 15:07 | 606M | |
![[SND]](/icons/sound2.gif) | thecallsheet_130316_..> | 2013-03-16 20:00 | 559M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_130..> | 2013-03-17 14:07 | 559M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_130..> | 2013-03-17 14:07 | 559M | |
![[SND]](/icons/sound2.gif) | anexposedsecret_1303..> | 2013-03-17 20:00 | 631M | |
![[SND]](/icons/sound2.gif) | johnnyscottgramercy_..> | 2013-03-17 21:08 | 566M | |
![[SND]](/icons/sound2.gif) | angrydorks_130318_18..> | 2013-03-18 18:03 | 565M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1303..> | 2013-03-18 20:00 | 582M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1303..> | 2013-03-18 20:34 | 5.0M | |
![[SND]](/icons/sound2.gif) | 130319_162716_SRS001..> | 2013-03-19 16:27 | 45M | |
![[SND]](/icons/sound2.gif) | 130319_163141_SRS001..> | 2013-03-19 16:31 | 47M | |
![[SND]](/icons/sound2.gif) | thehotbox_130319_210..> | 2013-03-19 21:02 | 568M | |
![[SND]](/icons/sound2.gif) | badadvice_130323_pro..> | 2013-03-20 18:04 | 5.1M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1303..> | 2013-03-20 18:59 | 558M | |
![[SND]](/icons/sound2.gif) | registeredearoffende..> | 2013-03-20 20:34 | 5.0M | |
![[SND]](/icons/sound2.gif) | auralstimulation_130..> | 2013-03-20 21:02 | 606M | |
![[SND]](/icons/sound2.gif) | 3 Guest Intro Music.wav | 2013-03-22 01:22 | 4.1M | |
![[SND]](/icons/sound2.gif) | registeredearoffende..> | 2013-03-22 12:59 | 605M | |
![[SND]](/icons/sound2.gif) | thedevilsinthedetail..> | 2013-03-22 14:06 | 565M | |
![[SND]](/icons/sound2.gif) | 130323_115305_SRS001..> | 2013-03-23 11:53 | 8.9M | |
![[SND]](/icons/sound2.gif) | awkwardcoversations_..> | 2013-03-23 12:04 | 594M | |
![[SND]](/icons/sound2.gif) | 130323_131631_SRS001..> | 2013-03-23 13:16 | 25M | |
![[SND]](/icons/sound2.gif) | badadvice_130323_140..> | 2013-03-23 14:01 | 606M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1303..> | 2013-03-23 15:09 | 606M | |
![[SND]](/icons/sound2.gif) | thecallsheet_130323_..> | 2013-03-23 20:02 | 559M | |
![[SND]](/icons/sound2.gif) | thelovebite_130324_1..> | 2013-03-24 15:00 | 556M | |
![[SND]](/icons/sound2.gif) | anexposedsecret_1303..> | 2013-03-24 20:00 | 574M | |
![[SND]](/icons/sound2.gif) | johnnyscottgramercy_..> | 2013-03-24 21:05 | 570M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1303..> | 2013-03-25 16:46 | 5.0M | |
![[SND]](/icons/sound2.gif) | angrydorks_130325_18..> | 2013-03-25 18:01 | 563M | |
![[SND]](/icons/sound2.gif) | 130325_200024_SRS001..> | 2013-03-25 20:00 | 567M | |
![[SND]](/icons/sound2.gif) | thehotbox_130326_210..> | 2013-03-26 21:02 | 556M | |
![[SND]](/icons/sound2.gif) | auralstimulation_130..> | 2013-03-27 07:34 | 5.0M | |
![[SND]](/icons/sound2.gif) | lindsaylohanclip.wav | 2013-03-27 10:21 | 2.9M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1303..> | 2013-03-27 18:59 | 555M | |
![[SND]](/icons/sound2.gif) | auralstimulation_130..> | 2013-03-27 21:03 | 606M | |
![[SND]](/icons/sound2.gif) | registeredearoffende..> | 2013-03-27 21:31 | 5.0M | |
![[SND]](/icons/sound2.gif) | 1. Kids Itz Kinetic ..> | 2013-03-27 23:33 | 69M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1303..> | 2013-03-28 14:59 | 1.8M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1303..> | 2013-03-28 15:19 | 556M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1303..> | 2013-03-28 16:29 | 550M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1303..> | 2013-03-28 19:01 | 832M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1303..> | 2013-03-28 21:00 | 594M | |
![[SND]](/icons/sound2.gif) | bbclip.wav | 2013-03-28 23:20 | 5.7M | |
![[SND]](/icons/sound2.gif) | portman.wav | 2013-03-29 12:24 | 12M | |
![[SND]](/icons/sound2.gif) | registeredearoffende..> | 2013-03-29 13:04 | 606M | |
![[SND]](/icons/sound2.gif) | thedevilsinthedetail..> | 2013-03-29 14:08 | 557M | |
![[SND]](/icons/sound2.gif) | awkwardcoversations_..> | 2013-03-30 12:00 | 124M | |
![[SND]](/icons/sound2.gif) | badadvice_130330_140..> | 2013-03-30 14:00 | 150M | |
![[SND]](/icons/sound2.gif) | Heartattackackack.wav | 2013-03-30 14:19 | 11M | |
![[SND]](/icons/sound2.gif) | thecallsheet_130330_..> | 2013-03-30 20:01 | 559M | |
![[SND]](/icons/sound2.gif) | thelovebite_130331_1..> | 2013-03-31 15:00 | 564M | |
![[SND]](/icons/sound2.gif) | anexposedsecret_1303..> | 2013-03-31 20:00 | 593M | |
![[SND]](/icons/sound2.gif) | USvSanta.wav | 2013-04-01 14:38 | 8.3M | |
![[SND]](/icons/sound2.gif) | angrydorks_130401_18..> | 2013-04-01 18:29 | 562M | |
![[SND]](/icons/sound2.gif) | 130401_200044_SRS001..> | 2013-04-01 20:00 | 556M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1304..> | 2013-04-03 10:18 | 5.0M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1304..> | 2013-04-03 18:59 | 555M | |
![[SND]](/icons/sound2.gif) | registeredearoffende..> | 2013-04-03 20:33 | 5.0M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_130..> | 2013-04-03 22:00 | 559M | |
![[SND]](/icons/sound2.gif) | sarcasticnews_130404..> | 2013-04-04 19:29 | 560M | |
![[SND]](/icons/sound2.gif) | 5 Guest Intro Music ..> | 2013-04-04 22:47 | 5.3M | |
![[SND]](/icons/sound2.gif) | 2 Road Rage Intro Mu..> | 2013-04-05 00:40 | 5.9M | |
![[SND]](/icons/sound2.gif) | 6 Under the Influenc..> | 2013-04-05 00:45 | 3.2M | |
![[SND]](/icons/sound2.gif) | registeredearoffende..> | 2013-04-05 12:59 | 606M | |
![[SND]](/icons/sound2.gif) | 130406_135046_SRS001..> | 2013-04-06 13:50 | 37M | |
![[SND]](/icons/sound2.gif) | 130406_135457_SRS001..> | 2013-04-06 13:54 | 337K | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1304..> | 2013-04-06 15:01 | 606M | |
![[SND]](/icons/sound2.gif) | thecallsheet_130406_..> | 2013-04-06 20:00 | 558M | |
![[SND]](/icons/sound2.gif) | 130406_210136_SRS001..> | 2013-04-06 21:01 | 65M | |
![[SND]](/icons/sound2.gif) | ncaaclip.wav | 2013-04-07 09:56 | 1.4M | |
![[SND]](/icons/sound2.gif) | fathermethcahy.wav | 2013-04-08 11:30 | 8.2M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1304..> | 2013-04-08 14:23 | 5.0M | |
![[SND]](/icons/sound2.gif) | Whoframedrogerebert.wav | 2013-04-08 15:30 | 1.6M | |
![[SND]](/icons/sound2.gif) | psych1on1_130408_185..> | 2013-04-08 18:59 | 552M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1304..> | 2013-04-08 20:00 | 574M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1304..> | 2013-04-08 21:08 | 786M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1304..> | 2013-04-08 22:26 | 233M | |
![[SND]](/icons/sound2.gif) | magicson.wav | 2013-04-09 11:02 | 6.0M | |
![[SND]](/icons/sound2.gif) | Magic.wav | 2013-04-09 14:40 | 6.4M | |
![[SND]](/icons/sound2.gif) | registeredearoffende..> | 2013-04-10 12:10 | 5.0M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1304..> | 2013-04-10 18:59 | 868M | |
![[SND]](/icons/sound2.gif) | auralstimulation_130..> | 2013-04-10 21:01 | 606M | |
![[SND]](/icons/sound2.gif) | hedgehog lives.wav | 2013-04-10 22:03 | 7.5M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_130..> | 2013-04-10 22:10 | 559M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1304..> | 2013-04-11 17:59 | 599M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1304..> | 2013-04-11 19:04 | 194M | |
![[SND]](/icons/sound2.gif) | sarcasticnews_130411..> | 2013-04-11 19:28 | 560M | |
![[SND]](/icons/sound2.gif) | registeredearoffende..> | 2013-04-12 13:00 | 606M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1304..> | 2013-04-13 12:07 | 920M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_130..> | 2013-04-13 14:08 | 545M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1304..> | 2013-04-13 15:09 | 606M | |
![[SND]](/icons/sound2.gif) | thewrapparty_130413_..> | 2013-04-13 19:59 | 549M | |
![[SND]](/icons/sound2.gif) | nlr_130414_210010_SR..> | 2013-04-14 21:00 | 566M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1304..> | 2013-04-15 10:55 | 5.0M | |
![[SND]](/icons/sound2.gif) | saudiclip.wav | 2013-04-15 11:51 | 8.4M | |
![[SND]](/icons/sound2.gif) | Lifeless.wav | 2013-04-15 18:08 | 39M | |
![[SND]](/icons/sound2.gif) | psych1on1_130415_190..> | 2013-04-15 19:00 | 569M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1304..> | 2013-04-15 20:04 | 566M | |
![[SND]](/icons/sound2.gif) | auralstimulation_130..> | 2013-04-16 00:26 | 5.0M | |
![[SND]](/icons/sound2.gif) | 130416_205643_SRS001..> | 2013-04-16 20:56 | 18M | |
![[SND]](/icons/sound2.gif) | funiclipo.wav | 2013-04-17 12:02 | 3.6M | |
![[SND]](/icons/sound2.gif) | npr_130411_205937_SR..> | 2013-04-17 12:51 | 570M | |
![[SND]](/icons/sound2.gif) | la_mascota_bakery.wav | 2013-04-17 13:18 | 2.7M | |
![[SND]](/icons/sound2.gif) | michele_la_mascota_b..> | 2013-04-17 13:32 | 1.4M | |
![[SND]](/icons/sound2.gif) | ignocio_la_mascota_b..> | 2013-04-17 13:33 | 1.6M | |
![[SND]](/icons/sound2.gif) | eddie_la_nista.wav | 2013-04-17 13:35 | 826K | |
![[SND]](/icons/sound2.gif) | auralstimulation_130..> | 2013-04-17 20:58 | 48M | |
![[SND]](/icons/sound2.gif) | auralstimulation_130..> | 2013-04-17 21:13 | 607M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_130..> | 2013-04-17 22:23 | 560M | |
![[SND]](/icons/sound2.gif) | sns_clips-04182013.wav | 2013-04-18 02:38 | 19M | |
![[SND]](/icons/sound2.gif) | sarcasticnews_130418..> | 2013-04-18 19:29 | 564M | |
![[SND]](/icons/sound2.gif) | npr_130418_210007_SR..> | 2013-04-18 21:00 | 609M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1304..> | 2013-04-20 15:00 | 607M | |
![[SND]](/icons/sound2.gif) | thewrapparty_130420_..> | 2013-04-20 20:05 | 559M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1304..> | 2013-04-20 22:02 | 917M | |
![[SND]](/icons/sound2.gif) | naskill.wav | 2013-04-21 09:42 | 1.5M | |
![[SND]](/icons/sound2.gif) | nlr_130421_210050_SR..> | 2013-04-21 21:00 | 579M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1304..> | 2013-04-22 09:17 | 5.0M | |
![[SND]](/icons/sound2.gif) | scoutsclip2.wav | 2013-04-23 11:04 | 2.6M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1304..> | 2013-04-23 14:27 | 561M | |
![[SND]](/icons/sound2.gif) | psych1on1_130422_190..> | 2013-04-23 14:28 | 565M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1304..> | 2013-04-23 14:28 | 296M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1304..> | 2013-04-23 14:28 | 781M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1304..> | 2013-04-23 14:52 | 1.0G | |
![[SND]](/icons/sound2.gif) | auralstimulation_130..> | 2013-04-23 22:31 | 7.6M | |
![[SND]](/icons/sound2.gif) | Never Be One.wav | 2013-04-24 12:00 | 41M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1304..> | 2013-04-24 19:00 | 553M | |
![[SND]](/icons/sound2.gif) | auralstimulation_130..> | 2013-04-24 21:00 | 606M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_130..> | 2013-04-24 22:05 | 606M | |
![[SND]](/icons/sound2.gif) | sarcasticnews_130425..> | 2013-04-25 19:30 | 564M | |
![[SND]](/icons/sound2.gif) | npr_130425_210017_SR..> | 2013-04-25 21:00 | 609M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1304..> | 2013-04-27 15:00 | 98M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1304..> | 2013-04-27 15:10 | 607M | |
![[SND]](/icons/sound2.gif) | thewrapparty_130427_..> | 2013-04-27 19:59 | 552M | |
![[SND]](/icons/sound2.gif) | 130427_210507_SRS001..> | 2013-04-27 21:05 | 8.5M | |
![[SND]](/icons/sound2.gif) | 130427_210616_SRS001..> | 2013-04-27 21:06 | 8.8M | |
![[SND]](/icons/sound2.gif) | 130427_221750_SRS001..> | 2013-04-27 22:17 | 625K | |
![[SND]](/icons/sound2.gif) | nlr_130428_210002_SR..> | 2013-04-28 21:00 | 585M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1305..> | 2013-04-29 09:23 | 5.0M | |
![[SND]](/icons/sound2.gif) | whengoodactressesgob..> | 2013-04-29 09:48 | 5.0M | |
![[SND]](/icons/sound2.gif) | psych1on1_130429_190..> | 2013-04-29 19:00 | 568M | |
![[SND]](/icons/sound2.gif) | hackers.wav | 2013-04-30 11:14 | 5.8M | |
![[SND]](/icons/sound2.gif) | knivesclip.wav | 2013-05-01 10:59 | 4.7M | |
![[SND]](/icons/sound2.gif) | warfestcore10_130428..> | 2013-05-01 11:06 | 1.5M | |
![[SND]](/icons/sound2.gif) | warfeststaroffmachin..> | 2013-05-01 11:06 | 1.6M | |
![[SND]](/icons/sound2.gif) | warfestsunflowerdead..> | 2013-05-01 11:06 | 1.2M | |
![[SND]](/icons/sound2.gif) | warfesttaproot_13042..> | 2013-05-01 11:06 | 2.3M | |
![[SND]](/icons/sound2.gif) | warfestboyhitscar_13..> | 2013-05-01 11:06 | 2.4M | |
![[SND]](/icons/sound2.gif) | warfestequinoxx_1304..> | 2013-05-01 11:06 | 743K | |
![[SND]](/icons/sound2.gif) | warfestxfactor1_1304..> | 2013-05-01 11:06 | 1.4M | |
![[SND]](/icons/sound2.gif) | warfestxfactorjoebob..> | 2013-05-01 11:06 | 2.0M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1305..> | 2013-05-01 19:00 | 553M | |
![[SND]](/icons/sound2.gif) | auralstimulation_130..> | 2013-05-01 21:04 | 606M | |
![[SND]](/icons/sound2.gif) | sarcasticnews_130502..> | 2013-05-02 19:29 | 609M | |
![[SND]](/icons/sound2.gif) | npr_130502_210814_SR..> | 2013-05-02 21:08 | 643M | |
![[SND]](/icons/sound2.gif) | 130504_015459_SRS001..> | 2013-05-04 01:54 | 337M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1305..> | 2013-05-04 15:00 | 608M | |
![[SND]](/icons/sound2.gif) | thewrapparty_130504_..> | 2013-05-04 20:03 | 29M | |
![[SND]](/icons/sound2.gif) | 130504_200641_SRS001..> | 2013-05-04 20:06 | 545M | |
![[SND]](/icons/sound2.gif) | nlr_130505_210015_SR..> | 2013-05-05 21:00 | 567M | |
![[SND]](/icons/sound2.gif) | thewrapparty_130504_..> | 2013-05-06 04:41 | 574M | |
![[SND]](/icons/sound2.gif) | theweeklywrapup_1305..> | 2013-05-06 16:55 | 5.0M | |
![[SND]](/icons/sound2.gif) | psych1on1_130506_190..> | 2013-05-06 19:00 | 572M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1305..> | 2013-05-06 20:00 | 566M | |
![[SND]](/icons/sound2.gif) | pd2.wav | 2013-05-07 09:21 | 8.0M | |
![[SND]](/icons/sound2.gif) | npr_130507_130007_SR..> | 2013-05-07 13:00 | 600M | |
![[SND]](/icons/sound2.gif) | npr_130507_141008_SR..> | 2013-05-07 14:10 | 669M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1305..> | 2013-05-08 19:00 | 554M | |
![[SND]](/icons/sound2.gif) | auralstimulation_130..> | 2013-05-08 21:00 | 606M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_130..> | 2013-05-08 22:06 | 560M | |
![[SND]](/icons/sound2.gif) | sarcasticnews_130509..> | 2013-05-09 19:29 | 640M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1305..> | 2013-05-10 15:50 | 671M | |
![[SND]](/icons/sound2.gif) | thewrapparty_130511_..> | 2013-05-11 20:00 | 564M | |
![[SND]](/icons/sound2.gif) | nlr_130512_204010_SR..> | 2013-05-12 20:40 | 12M | |
![[SND]](/icons/sound2.gif) | nlr_130512_210041_SR..> | 2013-05-12 21:00 | 555M | |
![[SND]](/icons/sound2.gif) | 130513_184818_SRS001..> | 2013-05-13 18:48 | 24M | |
![[SND]](/icons/sound2.gif) | psych1on1_130513_190..> | 2013-05-13 19:00 | 568M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1305..> | 2013-05-13 20:00 | 558M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1305..> | 2013-05-13 21:06 | 964M | |
![[SND]](/icons/sound2.gif) | Psych 1 On 1 Promo 1..> | 2013-05-15 15:11 | 12M | |
![[SND]](/icons/sound2.gif) | psych1on1-promo1.wav | 2013-05-15 15:11 | 12M | |
![[SND]](/icons/sound2.gif) | 130515_185252_SRS001..> | 2013-05-15 18:52 | 44M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1305..> | 2013-05-15 19:01 | 557M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_130..> | 2013-05-15 22:00 | 559M | |
![[SND]](/icons/sound2.gif) | Psychic Everyday Pro..> | 2013-05-16 02:15 | 5.9M | |
![[SND]](/icons/sound2.gif) | psychiceveryday-prom..> | 2013-05-16 02:15 | 5.9M | |
![[SND]](/icons/sound2.gif) | sarcasticnews_130516..> | 2013-05-16 19:31 | 562M | |
![[SND]](/icons/sound2.gif) | 130516_203323_SRS001..> | 2013-05-16 20:33 | 52M | |
![[SND]](/icons/sound2.gif) | 130516_204128_SRS001..> | 2013-05-16 20:41 | 14M | |
![[SND]](/icons/sound2.gif) | npr_130516_210020_SR..> | 2013-05-16 21:00 | 646M | |
![[SND]](/icons/sound2.gif) | 130516_221200_SRS001..> | 2013-05-16 22:12 | 80M | |
![[SND]](/icons/sound2.gif) | 130516_222026_SRS001..> | 2013-05-16 22:20 | 51M | |
![[SND]](/icons/sound2.gif) | 130516_222556_SRS001..> | 2013-05-16 22:25 | 89M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1305..> | 2013-05-17 13:05 | 656M | |
![[SND]](/icons/sound2.gif) | psych1on1_130517_150..> | 2013-05-17 15:00 | 569M | |
![[SND]](/icons/sound2.gif) | thewrapparty_130518_..> | 2013-05-18 20:02 | 556M | |
![[SND]](/icons/sound2.gif) | The Sarcastic News S..> | 2013-05-20 15:41 | 13M | |
![[SND]](/icons/sound2.gif) | sarcasticnews-promo-..> | 2013-05-20 15:41 | 13M | |
![[SND]](/icons/sound2.gif) | Nestorious_Public_Ra..> | 2013-05-20 16:02 | 11M | |
![[SND]](/icons/sound2.gif) | Psychic Everyday Pro..> | 2013-05-20 16:02 | 11M | |
![[SND]](/icons/sound2.gif) | npr-promo-1.wav | 2013-05-20 16:02 | 11M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1305..> | 2013-05-20 16:09 | 682M | |
![[SND]](/icons/sound2.gif) | nlr_130519_205955_SR..> | 2013-05-20 16:09 | 556M | |
![[SND]](/icons/sound2.gif) | psych1on1_130520_190..> | 2013-05-20 19:00 | 568M | |
![[SND]](/icons/sound2.gif) | thewrapparty_130518_..> | 2013-05-20 19:52 | 556M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1305..> | 2013-05-20 20:01 | 568M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1305..> | 2013-05-20 21:07 | 945M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1305..> | 2013-05-20 22:45 | 195M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_130..> | 2013-05-20 23:34 | 555M | |
![[SND]](/icons/sound2.gif) | 01 And The Healing H..> | 2013-05-21 18:15 | 81M | |
![[SND]](/icons/sound2.gif) | 02 Blue, Red And Gre..> | 2013-05-21 18:15 | 31M | |
![[SND]](/icons/sound2.gif) | 12. Blue, Red And Gr..> | 2013-05-21 18:15 | 31M | |
![[SND]](/icons/sound2.gif) | 03 Heaven Is 10 Zill..> | 2013-05-21 18:15 | 51M | |
![[SND]](/icons/sound2.gif) | 04 Pink Elephants.wav | 2013-05-21 18:15 | 26M | |
![[SND]](/icons/sound2.gif) | 05 That's The Way Go..> | 2013-05-21 18:15 | 45M | |
![[SND]](/icons/sound2.gif) | 1 That's The Way God..> | 2013-05-21 18:15 | 45M | |
![[SND]](/icons/sound2.gif) | That's The Way God P..> | 2013-05-21 18:15 | 45M | |
![[SND]](/icons/sound2.gif) | 06 Love & Communicat..> | 2013-05-21 18:15 | 46M | |
![[SND]](/icons/sound2.gif) | 07 Jesus, Etc..wav | 2013-05-21 18:15 | 43M | |
![[SND]](/icons/sound2.gif) | 08 Starfish And Coff..> | 2013-05-21 18:15 | 29M | |
![[SND]](/icons/sound2.gif) | 09 What Do You Want ..> | 2013-05-21 18:15 | 31M | |
![[SND]](/icons/sound2.gif) | 10 Unfinished Sympat..> | 2013-05-21 18:15 | 52M | |
![[SND]](/icons/sound2.gif) | 11 My Ever Changing ..> | 2013-05-21 18:15 | 36M | |
![[SND]](/icons/sound2.gif) | 12 Sail Across The W..> | 2013-05-21 18:15 | 55M | |
![[SND]](/icons/sound2.gif) | 12 Always With Me, A..> | 2013-05-21 18:15 | 34M | |
![[SND]](/icons/sound2.gif) | 13 Always With Me, A..> | 2013-05-21 18:15 | 34M | |
![[SND]](/icons/sound2.gif) | 14. Always With Me, ..> | 2013-05-21 18:15 | 34M | |
![[SND]](/icons/sound2.gif) | 36 Always With Me, A..> | 2013-05-21 18:15 | 34M | |
![[SND]](/icons/sound2.gif) | 46 Always With Me, A..> | 2013-05-21 18:15 | 34M | |
![[SND]](/icons/sound2.gif) | 53 Always With Me, A..> | 2013-05-21 18:15 | 34M | |
![[SND]](/icons/sound2.gif) | 14 (What's So Funny ..> | 2013-05-21 18:15 | 36M | |
![[SND]](/icons/sound2.gif) | 29 (What's So Funny ..> | 2013-05-21 18:15 | 36M | |
![[SND]](/icons/sound2.gif) | 35. (What's So Funny..> | 2013-05-21 18:15 | 36M | |
![[SND]](/icons/sound2.gif) | 15 The Day Brings.wav | 2013-05-21 18:15 | 41M | |
![[SND]](/icons/sound2.gif) | 16 Harvest.wav | 2013-05-21 18:15 | 36M | |
![[SND]](/icons/sound2.gif) | 13 I Am The Light Of..> | 2013-05-21 18:15 | 42M | |
![[SND]](/icons/sound2.gif) | 17 I Am The Light Of..> | 2013-05-21 18:15 | 42M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1305..> | 2013-05-21 18:26 | 1.1G | |
![[SND]](/icons/sound2.gif) | 130521_201049_SRS001..> | 2013-05-21 20:10 | 27M | |
![[SND]](/icons/sound2.gif) | thehealinghour_13052..> | 2013-05-22 11:31 | 578M | |
![[SND]](/icons/sound2.gif) | 130522_210013_SRS001..> | 2013-05-22 21:00 | 1.4M | |
![[SND]](/icons/sound2.gif) | 130522_210022_SRS001..> | 2013-05-22 21:00 | 4.6M | |
![[SND]](/icons/sound2.gif) | 130522_210107_SRS001..> | 2013-05-22 21:01 | 550M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_130..> | 2013-05-22 22:01 | 560M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_130..> | 2013-05-22 23:33 | 481K | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1305..> | 2013-05-23 11:53 | 552M | |
![[SND]](/icons/sound2.gif) | intelkink_130522_210..> | 2013-05-23 12:05 | 558M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_130..> | 2013-05-23 12:12 | 560M | |
![[SND]](/icons/sound2.gif) | Lost in LA MSTR.wav | 2013-05-23 14:41 | 36M | |
![[SND]](/icons/sound2.gif) | sarcasticnews_130523..> | 2013-05-23 19:30 | 568M | |
![[SND]](/icons/sound2.gif) | npr_130523_205947_SR..> | 2013-05-23 20:59 | 617M | |
![[SND]](/icons/sound2.gif) | 130524_220759_SRS001..> | 2013-05-24 22:07 | 18M | |
![[SND]](/icons/sound2.gif) | 130525_193546_SRS001..> | 2013-05-25 19:35 | 601K | |
![[SND]](/icons/sound2.gif) | 25 The Blower's Daug..> | 2013-05-26 15:56 | 48M | |
![[SND]](/icons/sound2.gif) | 224 The Blower's Dau..> | 2013-05-26 15:56 | 48M | |
![[SND]](/icons/sound2.gif) | The Blower's Daughte..> | 2013-05-26 15:56 | 48M | |
![[SND]](/icons/sound2.gif) | 21. Johnny Met June.wav | 2013-05-26 16:04 | 31M | |
![[SND]](/icons/sound2.gif) | nlr_130526_210515_SR..> | 2013-05-26 21:05 | 561M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1305..> | 2013-05-27 19:59 | 566M | |
![[SND]](/icons/sound2.gif) | 130528_023330_SRS001..> | 2013-05-28 02:33 | 385K | |
![[SND]](/icons/sound2.gif) | 6. Gazebo Tree.wav | 2013-05-28 08:54 | 37M | |
![[SND]](/icons/sound2.gif) | Skidrow Studios Muth..> | 2013-05-29 15:58 | 6.7M | |
![[SND]](/icons/sound2.gif) | Skidrow Studios Muth..> | 2013-05-29 16:00 | 6.8M | |
![[SND]](/icons/sound2.gif) | Skidrow Studios Muth..> | 2013-05-29 16:02 | 6.8M | |
![[SND]](/icons/sound2.gif) | Skidrow Studios Muth..> | 2013-05-29 16:03 | 6.7M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1305..> | 2013-05-29 19:00 | 556M | |
![[SND]](/icons/sound2.gif) | intelkink_130529_210..> | 2013-05-29 21:00 | 557M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_130..> | 2013-05-29 22:05 | 568M | |
![[SND]](/icons/sound2.gif) | psych1on1_130530_161..> | 2013-05-30 16:16 | 559M | |
![[SND]](/icons/sound2.gif) | sarcasticnews_130530..> | 2013-05-30 19:33 | 610M | |
![[SND]](/icons/sound2.gif) | npr_130530_205939_SR..> | 2013-05-30 20:59 | 617M | |
![[SND]](/icons/sound2.gif) | 2. Be My Lover.wav | 2013-05-31 11:03 | 34M | |
![[SND]](/icons/sound2.gif) | 5. Epilepsy Is Danci..> | 2013-05-31 11:03 | 30M | |
![[SND]](/icons/sound2.gif) | 26. Give Me Back My ..> | 2013-05-31 11:03 | 41M | |
![[SND]](/icons/sound2.gif) | 47 Give Me Back My M..> | 2013-05-31 11:03 | 41M | |
![[SND]](/icons/sound2.gif) | 50. Give Me Back My ..> | 2013-05-31 11:03 | 41M | |
![[SND]](/icons/sound2.gif) | Give Me Back My Man ..> | 2013-05-31 11:03 | 41M | |
![[SND]](/icons/sound2.gif) | 6. Don't Let Me Down..> | 2013-05-31 11:03 | 36M | |
![[SND]](/icons/sound2.gif) | 15. Let Love Rule.wav | 2013-05-31 11:03 | 58M | |
![[SND]](/icons/sound2.gif) | 12 I'm In Love With ..> | 2013-05-31 11:03 | 20M | |
![[SND]](/icons/sound2.gif) | 19 Love Hate 01.wav | 2013-05-31 11:03 | 27M | |
![[SND]](/icons/sound2.gif) | 21 Love Hate 01.wav | 2013-05-31 11:03 | 27M | |
![[SND]](/icons/sound2.gif) | 24 Love Hate 01.wav | 2013-05-31 11:03 | 27M | |
![[SND]](/icons/sound2.gif) | 218 Love Hate 01.wav | 2013-05-31 11:03 | 27M | |
![[SND]](/icons/sound2.gif) | 16. I'm Shakin'.wav | 2013-05-31 11:03 | 24M | |
![[SND]](/icons/sound2.gif) | 17. I'm Shakin'.wav | 2013-05-31 11:03 | 24M | |
![[SND]](/icons/sound2.gif) | 19. Until The Night.wav | 2013-05-31 11:03 | 67M | |
![[SND]](/icons/sound2.gif) | 25. Until The Night.wav | 2013-05-31 11:03 | 67M | |
![[SND]](/icons/sound2.gif) | 1. I Love You More T..> | 2013-05-31 11:03 | 60M | |
![[SND]](/icons/sound2.gif) | 3. Simple Twist Of F..> | 2013-05-31 11:03 | 43M | |
![[SND]](/icons/sound2.gif) | 13. Do You Love Me N..> | 2013-05-31 11:03 | 33M | |
![[SND]](/icons/sound2.gif) | 16. Do You Love Me N..> | 2013-05-31 11:03 | 33M | |
![[SND]](/icons/sound2.gif) | 24. Drive All Night.wav | 2013-05-31 11:03 | 86M | |
![[SND]](/icons/sound2.gif) | 26. Drive All Night.wav | 2013-05-31 11:03 | 86M | |
![[SND]](/icons/sound2.gif) | 30. She's Tight.wav | 2013-05-31 11:03 | 30M | |
![[SND]](/icons/sound2.gif) | She's Tight.wav | 2013-05-31 11:03 | 30M | |
![[SND]](/icons/sound2.gif) | She's Tight 82.wav | 2013-05-31 11:03 | 30M | |
![[SND]](/icons/sound2.gif) | 15 Warning Sign 03.wav | 2013-05-31 11:04 | 56M | |
![[SND]](/icons/sound2.gif) | 214 Warning Sign 03.wav | 2013-05-31 11:04 | 56M | |
![[SND]](/icons/sound2.gif) | 18. Nails In My Feet..> | 2013-05-31 11:04 | 37M | |
![[SND]](/icons/sound2.gif) | 11. Crash Into Me.wav | 2013-05-31 11:04 | 53M | |
![[SND]](/icons/sound2.gif) | 13. Crash Into Me.wav | 2013-05-31 11:04 | 53M | |
![[SND]](/icons/sound2.gif) | 14. Ruby Baby.wav | 2013-05-31 11:04 | 26M | |
![[SND]](/icons/sound2.gif) | 25. Ruby Baby.wav | 2013-05-31 11:04 | 26M | |
![[SND]](/icons/sound2.gif) | 03 Romeo & Juliet 80..> | 2013-05-31 11:04 | 66M | |
![[SND]](/icons/sound2.gif) | 28. Romeo & Juliet.wav | 2013-05-31 11:04 | 66M | |
![[SND]](/icons/sound2.gif) | 41 Romeo & Juliet 80..> | 2013-05-31 11:04 | 66M | |
![[SND]](/icons/sound2.gif) | 7. Ma Ma Ma Belle.wav | 2013-05-31 11:04 | 39M | |
![[SND]](/icons/sound2.gif) | 10. Anything We Want..> | 2013-05-31 11:04 | 47M | |
![[SND]](/icons/sound2.gif) | 8. The Origin Of Lov..> | 2013-05-31 11:04 | 67M | |
![[SND]](/icons/sound2.gif) | 29. Misunderstanding..> | 2013-05-31 17:17 | 33M | |
![[SND]](/icons/sound2.gif) | Misunderstanding.wav | 2013-05-31 17:17 | 33M | |
![[SND]](/icons/sound2.gif) | Misunderstanding 80.wav | 2013-05-31 17:17 | 33M | |
![[SND]](/icons/sound2.gif) | 22 Hotel Chambermaid..> | 2013-05-31 17:20 | 30M | |
![[SND]](/icons/sound2.gif) | 27. Hotel Chambermai..> | 2013-05-31 17:20 | 30M | |
![[SND]](/icons/sound2.gif) | 11. Little Suicides.wav | 2013-05-31 17:20 | 48M | |
![[SND]](/icons/sound2.gif) | 8. Feel It.wav | 2013-05-31 17:24 | 31M | |
![[SND]](/icons/sound2.gif) | 22. Feel It.wav | 2013-05-31 17:24 | 31M | |
![[SND]](/icons/sound2.gif) | 4. You Possess Me.wav | 2013-05-31 17:25 | 32M | |
![[SND]](/icons/sound2.gif) | 26 The Way You Make ..> | 2013-05-31 17:25 | 55M | |
![[SND]](/icons/sound2.gif) | 31. The Way You Make..> | 2013-05-31 17:25 | 55M | |
![[SND]](/icons/sound2.gif) | 37 The Way You Make ..> | 2013-05-31 17:25 | 55M | |
![[SND]](/icons/sound2.gif) | The Way You Make Me ..> | 2013-05-31 17:25 | 55M | |
![[SND]](/icons/sound2.gif) | 3. Maybe Tomorrow.wav | 2013-05-31 19:27 | 30M | |
![[SND]](/icons/sound2.gif) | 20. Maybe Tomorrow.wav | 2013-05-31 19:27 | 30M | |
![[SND]](/icons/sound2.gif) | 130531_215449_SRS001..> | 2013-05-31 21:54 | 20M | |
![[SND]](/icons/sound2.gif) | 20. Diamonds Are A G..> | 2013-06-01 09:26 | 31M | |
![[SND]](/icons/sound2.gif) | 21. Diamonds Are A G..> | 2013-06-01 09:26 | 31M | |
![[SND]](/icons/sound2.gif) | 23. Sara.wav | 2013-06-01 12:10 | 43M | |
![[SND]](/icons/sound2.gif) | thewrapparty_130601_..> | 2013-06-01 20:00 | 553M | |
![[SND]](/icons/sound2.gif) | thehealinghour_13060..> | 2013-06-01 21:09 | 565M | |
![[SND]](/icons/sound2.gif) | 130601_221402_SRS001..> | 2013-06-01 22:14 | 29M | |
![[SND]](/icons/sound2.gif) | 130602_120459_SRS001..> | 2013-06-02 12:04 | 433K | |
![[SND]](/icons/sound2.gif) | nlr_130602_205923_SR..> | 2013-06-02 20:59 | 571M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1306..> | 2013-06-03 19:59 | 579M | |
![[SND]](/icons/sound2.gif) | 33. The Crystal Ship..> | 2013-06-04 07:07 | 26M | |
![[SND]](/icons/sound2.gif) | The Crystal Ship.wav | 2013-06-04 07:07 | 26M | |
![[SND]](/icons/sound2.gif) | The Crystal Ship 67.wav | 2013-06-04 07:07 | 26M | |
![[SND]](/icons/sound2.gif) | 7. I Am Yours.wav | 2013-06-04 07:15 | 36M | |
![[SND]](/icons/sound2.gif) | Nancy Promo.wav | 2013-06-04 17:56 | 4.9M | |
![[SND]](/icons/sound2.gif) | 34. It's A Motherfuc..> | 2013-06-04 18:30 | 23M | |
![[SND]](/icons/sound2.gif) | 44 It's A Motherfuck..> | 2013-06-04 18:30 | 23M | |
![[SND]](/icons/sound2.gif) | 1. Long Way Down (Lo..> | 2013-06-04 18:31 | 39M | |
![[SND]](/icons/sound2.gif) | 7 Take My Hand 90.wav | 2013-06-04 18:32 | 48M | |
![[SND]](/icons/sound2.gif) | 23 Take My Hand 90.wav | 2013-06-04 18:32 | 48M | |
![[SND]](/icons/sound2.gif) | Take My Hand.wav | 2013-06-04 18:32 | 48M | |
![[SND]](/icons/sound2.gif) | 11 Say No More 73.wav | 2013-06-04 18:33 | 20M | |
![[SND]](/icons/sound2.gif) | Say No More.wav | 2013-06-04 18:33 | 20M | |
![[SND]](/icons/sound2.gif) | 32. She Don't Use Je..> | 2013-06-04 18:36 | 37M | |
![[SND]](/icons/sound2.gif) | She Don't Use Jelly.wav | 2013-06-04 18:36 | 37M | |
![[SND]](/icons/sound2.gif) | She Don't Use Jelly ..> | 2013-06-04 18:36 | 37M | |
![[SND]](/icons/sound2.gif) | Ethylene.wav | 2013-06-04 18:39 | 41M | |
![[SND]](/icons/sound2.gif) | Ethylene 95.wav | 2013-06-04 18:39 | 41M | |
![[SND]](/icons/sound2.gif) | 51. Cry Love.wav | 2013-06-04 18:40 | 44M | |
![[SND]](/icons/sound2.gif) | 2 Right Hand Man 95.wav | 2013-06-04 18:40 | 51M | |
![[SND]](/icons/sound2.gif) | 52. Right Hand Man.wav | 2013-06-04 18:40 | 51M | |
![[SND]](/icons/sound2.gif) | Right Hand Man.wav | 2013-06-04 18:40 | 51M | |
![[SND]](/icons/sound2.gif) | Right Hand Man 95.wav | 2013-06-04 18:40 | 51M | |
![[SND]](/icons/sound2.gif) | 24. Turn Out The Lig..> | 2013-06-04 18:41 | 44M | |
![[SND]](/icons/sound2.gif) | 9. Even Tho.wav | 2013-06-04 18:44 | 53M | |
![[SND]](/icons/sound2.gif) | 6 Genesis 74.wav | 2013-06-04 21:16 | 48M | |
![[SND]](/icons/sound2.gif) | 16 Genesis 74.wav | 2013-06-04 21:16 | 48M | |
![[SND]](/icons/sound2.gif) | 36. Genesis.wav | 2013-06-04 21:16 | 48M | |
![[SND]](/icons/sound2.gif) | Genesis 74.wav | 2013-06-04 21:16 | 48M | |
![[SND]](/icons/sound2.gif) | 15. Untouchable Face..> | 2013-06-05 06:52 | 68M | |
![[SND]](/icons/sound2.gif) | 20 Long Distance Lov..> | 2013-06-05 07:37 | 27M | |
![[SND]](/icons/sound2.gif) | 39. Long Distance Lo..> | 2013-06-05 07:37 | 27M | |
![[SND]](/icons/sound2.gif) | Long Distance Love 7..> | 2013-06-05 07:37 | 27M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1306..> | 2013-06-05 18:59 | 555M | |
![[SND]](/icons/sound2.gif) | intelkink_130605_210..> | 2013-06-05 21:00 | 558M | |
![[SND]](/icons/sound2.gif) | 25 My Baby Just Care..> | 2013-06-06 08:21 | 37M | |
![[SND]](/icons/sound2.gif) | 41. My Baby Just Car..> | 2013-06-06 08:21 | 37M | |
![[SND]](/icons/sound2.gif) | My Baby Just Cares f..> | 2013-06-06 08:21 | 37M | |
![[SND]](/icons/sound2.gif) | My Baby Just Cares f..> | 2013-06-06 08:21 | 37M | |
![[SND]](/icons/sound2.gif) | 22. Born For Me.wav | 2013-06-06 08:51 | 44M | |
![[SND]](/icons/sound2.gif) | 19. You And Me Baby.wav | 2013-06-06 11:22 | 25M | |
![[SND]](/icons/sound2.gif) | 17. I Need Love.wav | 2013-06-06 12:02 | 37M | |
![[SND]](/icons/sound2.gif) | 10. Mad Mission.wav | 2013-06-06 15:12 | 29M | |
![[SND]](/icons/sound2.gif) | sarcasticnews_130606..> | 2013-06-06 19:29 | 589M | |
![[SND]](/icons/sound2.gif) | npr_130606_210200_SR..> | 2013-06-06 21:02 | 706M | |
![[SND]](/icons/sound2.gif) | npr_130606_223242_SR..> | 2013-06-06 22:32 | 668M | |
![[SND]](/icons/sound2.gif) | 130607_220241_SRS001..> | 2013-06-07 22:02 | 17M | |
![[SND]](/icons/sound2.gif) | 14 Why'd You Make Me..> | 2013-06-08 12:04 | 37M | |
![[SND]](/icons/sound2.gif) | 130608_171618_SRS001..> | 2013-06-08 17:16 | 505K | |
![[SND]](/icons/sound2.gif) | nlr_130609_205935_SR..> | 2013-06-09 20:59 | 564M | |
![[SND]](/icons/sound2.gif) | thehealinghour_13060..> | 2013-06-10 12:47 | 1.3M | |
![[SND]](/icons/sound2.gif) | thehealinghourintro-..> | 2013-06-10 15:29 | 9.8M | |
![[SND]](/icons/sound2.gif) | psych1on1_130610_185..> | 2013-06-10 18:59 | 570M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1306..> | 2013-06-10 20:03 | 568M | |
![[SND]](/icons/sound2.gif) | 15 Play On 74.wav | 2013-06-12 14:57 | 31M | |
![[SND]](/icons/sound2.gif) | 22 Play On 74.wav | 2013-06-12 14:57 | 31M | |
![[SND]](/icons/sound2.gif) | Play On 74.wav | 2013-06-12 14:57 | 31M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1306..> | 2013-06-12 19:00 | 556M | |
![[SND]](/icons/sound2.gif) | intelkink_130612_210..> | 2013-06-12 21:00 | 557M | |
![[SND]](/icons/sound2.gif) | sarcasticnews_130613..> | 2013-06-13 19:30 | 605M | |
![[SND]](/icons/sound2.gif) | npr_130613_215657_SR..> | 2013-06-13 21:56 | 816M | |
![[SND]](/icons/sound2.gif) | 30 Blind Willie McTe..> | 2013-06-14 16:30 | 59M | |
![[SND]](/icons/sound2.gif) | 12 Graveyard 11.wav | 2013-06-14 16:32 | 43M | |
![[SND]](/icons/sound2.gif) | 43 Graveyard 11.wav | 2013-06-14 16:32 | 43M | |
![[SND]](/icons/sound2.gif) | 40 Days Of Rain 05.wav | 2013-06-14 16:33 | 51M | |
![[SND]](/icons/sound2.gif) | Days Of Rain 05.wav | 2013-06-14 16:33 | 51M | |
![[SND]](/icons/sound2.gif) | 04 Candy 98.wav | 2013-06-14 16:35 | 47M | |
![[SND]](/icons/sound2.gif) | 42 Candy 98.wav | 2013-06-14 16:35 | 47M | |
![[SND]](/icons/sound2.gif) | 05 Terrible Angels 0..> | 2013-06-14 16:38 | 42M | |
![[SND]](/icons/sound2.gif) | 35 Terrible Angels 0..> | 2013-06-14 16:38 | 42M | |
![[SND]](/icons/sound2.gif) | 17 Lonelier Than Thi..> | 2013-06-14 16:40 | 32M | |
![[SND]](/icons/sound2.gif) | 34 Lonelier Than Thi..> | 2013-06-14 16:40 | 32M | |
![[SND]](/icons/sound2.gif) | 18 Rebellion (Lies) ..> | 2013-06-14 16:41 | 57M | |
![[SND]](/icons/sound2.gif) | 33 Rebellion (Lies) ..> | 2013-06-14 16:41 | 57M | |
![[SND]](/icons/sound2.gif) | 36 The Snow Leopard ..> | 2013-06-14 16:42 | 52M | |
![[SND]](/icons/sound2.gif) | The Snow Leopard 08.wav | 2013-06-14 16:42 | 52M | |
![[SND]](/icons/sound2.gif) | 1 No Matter What 70.wav | 2013-06-14 16:42 | 30M | |
![[SND]](/icons/sound2.gif) | 6 Zebra 09.wav | 2013-06-14 16:44 | 49M | |
![[SND]](/icons/sound2.gif) | 21 Zebra 09.wav | 2013-06-14 16:44 | 49M | |
![[SND]](/icons/sound2.gif) | 39 Zebra 09.wav | 2013-06-14 16:44 | 49M | |
![[SND]](/icons/sound2.gif) | Zebra 09.wav | 2013-06-14 16:44 | 49M | |
![[SND]](/icons/sound2.gif) | 11 Come Pick Me Up 2..> | 2013-06-14 16:45 | 54M | |
![[SND]](/icons/sound2.gif) | 32 Come Pick Me Up 2..> | 2013-06-14 16:45 | 54M | |
![[SND]](/icons/sound2.gif) | 14 Louisiana 1927 74..> | 2013-06-14 16:45 | 30M | |
![[SND]](/icons/sound2.gif) | 23 Year Of The Cat 7..> | 2013-06-14 16:51 | 67M | |
![[SND]](/icons/sound2.gif) | 230 Year Of The Cat ..> | 2013-06-14 16:51 | 67M | |
![[SND]](/icons/sound2.gif) | Year Of The Cat 76.wav | 2013-06-14 16:51 | 67M | |
![[SND]](/icons/sound2.gif) | 21 Jump Street 76.wav | 2013-06-14 17:15 | 53M | |
![[SND]](/icons/sound2.gif) | 38 Yoga Means Union ..> | 2013-06-14 18:18 | 50M | |
![[SND]](/icons/sound2.gif) | Yoga Means Union 04.wav | 2013-06-14 18:18 | 50M | |
![[SND]](/icons/sound2.gif) | 17 Sun C 79 74.wav | 2013-06-14 18:20 | 46M | |
![[SND]](/icons/sound2.gif) | Sun C 79 74.wav | 2013-06-14 18:20 | 46M | |
![[SND]](/icons/sound2.gif) | 26 On The Radio 78.wav | 2013-06-14 18:22 | 46M | |
![[SND]](/icons/sound2.gif) | 25 Janie Jones 77.wav | 2013-06-14 18:22 | 21M | |
![[SND]](/icons/sound2.gif) | 7 Moonage Daydream 7..> | 2013-06-14 18:24 | 47M | |
![[SND]](/icons/sound2.gif) | 2 Lay Down (Candles ..> | 2013-06-14 18:28 | 39M | |
![[SND]](/icons/sound2.gif) | 28 It's All I Can Do..> | 2013-06-14 18:31 | 38M | |
![[SND]](/icons/sound2.gif) | The Last Resort 76.wav | 2013-06-14 18:36 | 75M | |
![[SND]](/icons/sound2.gif) | I Know I'm Not Wrong..> | 2013-06-14 18:49 | 68M | |
![[SND]](/icons/sound2.gif) | 6 Down 71.wav | 2013-06-14 18:54 | 35M | |
![[SND]](/icons/sound2.gif) | Who Do You Love 75.wav | 2013-06-14 18:55 | 39M | |
![[SND]](/icons/sound2.gif) | 21 The Pretender 76.wav | 2013-06-14 18:57 | 53M | |
![[SND]](/icons/sound2.gif) | 24 The Pretender 76.wav | 2013-06-14 18:57 | 53M | |
![[SND]](/icons/sound2.gif) | The Pretender 76.wav | 2013-06-14 18:57 | 53M | |
![[SND]](/icons/sound2.gif) | 19 Fast Buck Freddie..> | 2013-06-14 18:58 | 35M | |
![[SND]](/icons/sound2.gif) | 4 What's Going On 71..> | 2013-06-14 19:16 | 39M | |
![[SND]](/icons/sound2.gif) | 13 The Golden Age Of..> | 2013-06-14 19:18 | 35M | |
![[SND]](/icons/sound2.gif) | 3 Only Love Can Brea..> | 2013-06-14 19:19 | 32M | |
![[SND]](/icons/sound2.gif) | 9 Bodhisattva 73.wav | 2013-06-14 19:34 | 54M | |
![[SND]](/icons/sound2.gif) | 15 Bodhisattva 73.wav | 2013-06-14 19:34 | 54M | |
![[SND]](/icons/sound2.gif) | Bodhisattva 73.wav | 2013-06-14 19:34 | 54M | |
![[SND]](/icons/sound2.gif) | 27 I'm In Love With ..> | 2013-06-14 19:42 | 48M | |
![[SND]](/icons/sound2.gif) | 10 Don't You Worry '..> | 2013-06-14 19:43 | 48M | |
![[SND]](/icons/sound2.gif) | Don't You Worry 'Bou..> | 2013-06-14 19:43 | 48M | |
![[SND]](/icons/sound2.gif) | 8 Which Will 72.wav | 2013-06-14 20:00 | 30M | |
![[SND]](/icons/sound2.gif) | Which Will 72.wav | 2013-06-14 20:00 | 30M | |
![[SND]](/icons/sound2.gif) | 05 Cry Wolf 1.wav | 2013-06-15 09:38 | 55M | |
![[SND]](/icons/sound2.gif) | Cry Wolf 94.wav | 2013-06-15 09:38 | 55M | |
![[SND]](/icons/sound2.gif) | 09 Cancer Of Everyth..> | 2013-06-15 09:40 | 44M | |
![[SND]](/icons/sound2.gif) | Cancer Of Everything..> | 2013-06-15 09:40 | 44M | |
![[SND]](/icons/sound2.gif) | 07 From A Shell.wav | 2013-06-15 09:41 | 30M | |
![[SND]](/icons/sound2.gif) | psych1on1_130615_123..> | 2013-06-15 12:32 | 569M | |
![[SND]](/icons/sound2.gif) | thewrapparty_130615_..> | 2013-06-15 20:00 | 557M | |
![[SND]](/icons/sound2.gif) | nlr_130616_210105_SR..> | 2013-06-16 21:01 | 554M | |
![[SND]](/icons/sound2.gif) | thehealinghour_13061..> | 2013-06-16 22:51 | 950M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1306..> | 2013-06-17 20:00 | 558M | |
![[SND]](/icons/sound2.gif) | 01 A Day In The Life..> | 2013-06-18 01:57 | 52M | |
![[SND]](/icons/sound2.gif) | 06 Lost 12.wav | 2013-06-18 02:21 | 46M | |
![[SND]](/icons/sound2.gif) | 26 Sunny Afternoon 6..> | 2013-06-18 02:31 | 39M | |
![[SND]](/icons/sound2.gif) | Sunny Afternoon 66.wav | 2013-06-18 02:31 | 39M | |
![[SND]](/icons/sound2.gif) | 07 Madame George 68.wav | 2013-06-18 02:39 | 98M | |
![[SND]](/icons/sound2.gif) | 08 Living For The Ci..> | 2013-06-18 02:42 | 75M | |
![[SND]](/icons/sound2.gif) | A Matter Of Pride 81..> | 2013-06-18 02:46 | 33M | |
![[SND]](/icons/sound2.gif) | 43 Scarecrow People ..> | 2013-06-18 03:04 | 46M | |
![[SND]](/icons/sound2.gif) | 09 Dear God 86.wav | 2013-06-18 03:11 | 36M | |
![[SND]](/icons/sound2.gif) | 10 Black Boys On Mop..> | 2013-06-18 03:18 | 39M | |
![[SND]](/icons/sound2.gif) | 7 Loan Me A Dime 69.wav | 2013-06-18 03:24 | 143M | |
![[SND]](/icons/sound2.gif) | 13 Loan Me A Dime 69..> | 2013-06-18 03:24 | 143M | |
![[SND]](/icons/sound2.gif) | Loan Me A Dime 69.wav | 2013-06-18 03:24 | 143M | |
![[SND]](/icons/sound2.gif) | 14 The Great Gig In ..> | 2013-06-18 03:35 | 52M | |
![[SND]](/icons/sound2.gif) | 15 Keep It Dark 81.wav | 2013-06-18 04:11 | 46M | |
![[SND]](/icons/sound2.gif) | 39 All This Time 91.wav | 2013-06-18 04:17 | 50M | |
![[SND]](/icons/sound2.gif) | 16 The Soul Cages 91..> | 2013-06-18 04:56 | 59M | |
![[SND]](/icons/sound2.gif) | 19 Cosmic Concerto (..> | 2013-06-18 05:19 | 80M | |
![[SND]](/icons/sound2.gif) | 22 My Ever Changing ..> | 2013-06-18 05:38 | 36M | |
![[SND]](/icons/sound2.gif) | My Ever Changing Moo..> | 2013-06-18 05:38 | 36M | |
![[SND]](/icons/sound2.gif) | Ballad Of Dwight Fry..> | 2013-06-18 13:18 | 66M | |
![[SND]](/icons/sound2.gif) | Under My Wheels 71.wav | 2013-06-18 13:20 | 29M | |
![[SND]](/icons/sound2.gif) | Alma Mater 72.wav | 2013-06-18 13:24 | 45M | |
![[SND]](/icons/sound2.gif) | Inmates (We're All C..> | 2013-06-18 13:27 | 51M | |
![[SND]](/icons/sound2.gif) | Clones (We're All) 8..> | 2013-06-18 13:29 | 31M | |
![[SND]](/icons/sound2.gif) | 17 Glassellalia 13.wav | 2013-06-18 13:31 | 82M | |
![[SND]](/icons/sound2.gif) | Glassellalia 13.wav | 2013-06-18 13:31 | 82M | |
![[SND]](/icons/sound2.gif) | 28 See How We Are (D..> | 2013-06-18 13:39 | 36M | |
![[SND]](/icons/sound2.gif) | See How We Are (Demo..> | 2013-06-18 13:39 | 36M | |
![[SND]](/icons/sound2.gif) | 6 The Face Of Love 9..> | 2013-06-18 14:01 | 111M | |
![[SND]](/icons/sound2.gif) | 206 The Face Of Love..> | 2013-06-18 14:01 | 111M | |
![[SND]](/icons/sound2.gif) | The Face Of Love 96.wav | 2013-06-18 14:01 | 111M | |
![[SND]](/icons/sound2.gif) | Tom Traubert's Blues..> | 2013-06-18 14:26 | 71M | |
![[SND]](/icons/sound2.gif) | 13 Amateur - Opening..> | 2013-06-18 15:21 | 27M | |
![[SND]](/icons/sound2.gif) | 213 Amateur - Openin..> | 2013-06-18 15:21 | 27M | |
![[SND]](/icons/sound2.gif) | Desperados Under The..> | 2013-06-18 15:25 | 53M | |
![[SND]](/icons/sound2.gif) | 1 If I Had A Boat 87..> | 2013-06-18 16:37 | 32M | |
![[SND]](/icons/sound2.gif) | 29 If I Had A Boat 8..> | 2013-06-18 16:37 | 32M | |
![[SND]](/icons/sound2.gif) | 50 She's No Lady 87.wav | 2013-06-18 16:39 | 33M | |
![[SND]](/icons/sound2.gif) | 48 Cupid's Got A Bra..> | 2013-06-18 16:48 | 35M | |
![[SND]](/icons/sound2.gif) | 15 How Will You Go 9..> | 2013-06-18 16:59 | 32M | |
![[SND]](/icons/sound2.gif) | 44 How Will You Go 9..> | 2013-06-18 16:59 | 32M | |
![[SND]](/icons/sound2.gif) | 8 Dead 90.wav | 2013-06-18 17:09 | 30M | |
![[SND]](/icons/sound2.gif) | 46 Dead 90.wav | 2013-06-18 17:09 | 30M | |
![[SND]](/icons/sound2.gif) | 2 Tired Of Sleeping ..> | 2013-06-18 17:15 | 49M | |
![[SND]](/icons/sound2.gif) | 31 Tired Of Sleeping..> | 2013-06-18 17:15 | 49M | |
![[SND]](/icons/sound2.gif) | 14 Letter From Home ..> | 2013-06-18 17:26 | 56M | |
![[SND]](/icons/sound2.gif) | 41 Letter From Home ..> | 2013-06-18 17:26 | 56M | |
![[SND]](/icons/sound2.gif) | 49 Let Him Dangle 89..> | 2013-06-18 17:40 | 48M | |
![[SND]](/icons/sound2.gif) | 13 Celtic Ray 82.wav | 2013-06-18 17:54 | 46M | |
![[SND]](/icons/sound2.gif) | 38 Celtic Ray.wav | 2013-06-18 17:54 | 46M | |
![[SND]](/icons/sound2.gif) | The Heart Of The Mat..> | 2013-06-18 18:00 | 54M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1306..> | 2013-06-19 18:59 | 553M | |
![[SND]](/icons/sound2.gif) | intelkink_130619_210..> | 2013-06-19 21:00 | 558M | |
![[SND]](/icons/sound2.gif) | 32 Saturday Night 89..> | 2013-06-20 13:05 | 71M | |
![[SND]](/icons/sound2.gif) | 51 Then She Did 90.wav | 2013-06-20 13:21 | 84M | |
![[SND]](/icons/sound2.gif) | Then She Did 90.wav | 2013-06-20 13:21 | 84M | |
![[SND]](/icons/sound2.gif) | Always With Me, Alwa..> | 2013-06-20 13:32 | 34M | |
![[SND]](/icons/sound2.gif) | 6 Come In From The C..> | 2013-06-20 13:36 | 76M | |
![[SND]](/icons/sound2.gif) | 40 Come In From The ..> | 2013-06-20 13:36 | 76M | |
![[SND]](/icons/sound2.gif) | Pullin' Back The Rei..> | 2013-06-20 13:40 | 45M | |
![[SND]](/icons/sound2.gif) | Luck In My Eyes 89.wav | 2013-06-20 13:41 | 41M | |
![[SND]](/icons/sound2.gif) | This Woman's Work 89..> | 2013-06-20 13:44 | 37M | |
![[SND]](/icons/sound2.gif) | 37 All I Ever Wanted..> | 2013-06-20 13:50 | 39M | |
![[SND]](/icons/sound2.gif) | Someday 89.wav | 2013-06-20 13:58 | 58M | |
![[SND]](/icons/sound2.gif) | 4 Country Feedback 9..> | 2013-06-20 14:08 | 46M | |
![[SND]](/icons/sound2.gif) | 30 Country Feedback ..> | 2013-06-20 14:08 | 46M | |
![[SND]](/icons/sound2.gif) | 33 Walk A Straight L..> | 2013-06-20 14:12 | 42M | |
![[SND]](/icons/sound2.gif) | 21 And The Healing H..> | 2013-06-20 14:16 | 81M | |
![[SND]](/icons/sound2.gif) | 35 And The Healing H..> | 2013-06-20 14:16 | 81M | |
![[SND]](/icons/sound2.gif) | 9 A Life of Sundays ..> | 2013-06-20 14:20 | 63M | |
![[SND]](/icons/sound2.gif) | 34 A Life of Sundays..> | 2013-06-20 14:20 | 63M | |
![[SND]](/icons/sound2.gif) | sarcasticnews_130620..> | 2013-06-20 19:32 | 565M | |
![[SND]](/icons/sound2.gif) | Rain 66.wav | 2013-06-21 12:26 | 31M | |
![[SND]](/icons/sound2.gif) | nlr_130623_210709_SR..> | 2013-06-23 21:07 | 554M | |
![[SND]](/icons/sound2.gif) | 130623_220436_SRS001..> | 2013-06-23 22:04 | 34M | |
![[SND]](/icons/sound2.gif) | 130623_220817_SRS001..> | 2013-06-23 22:08 | 745K | |
![[SND]](/icons/sound2.gif) | 17 If I Should Fall ..> | 2013-06-24 15:52 | 30M | |
![[SND]](/icons/sound2.gif) | 19 Spiritual 96.wav | 2013-06-24 16:00 | 84M | |
![[SND]](/icons/sound2.gif) | 11 Johnny Appleseed ..> | 2013-06-24 16:35 | 41M | |
![[SND]](/icons/sound2.gif) | 210 Johnny Appleseed..> | 2013-06-24 16:35 | 41M | |
![[SND]](/icons/sound2.gif) | Johnny Appleseed 01.wav | 2013-06-24 16:35 | 41M | |
![[SND]](/icons/sound2.gif) | psych1on1_130624_185..> | 2013-06-24 18:59 | 567M | |
![[SND]](/icons/sound2.gif) | nlr-promo-1.wav | 2013-06-24 19:28 | 7.1M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1306..> | 2013-06-24 20:00 | 560M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1306..> | 2013-06-24 21:02 | 792M | |
![[SND]](/icons/sound2.gif) | 18 Flyswatter Ice Wa..> | 2013-06-24 21:47 | 38M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1306..> | 2013-06-24 22:25 | 329M | |
![[SND]](/icons/sound2.gif) | 5 Perpetuum Mobile 8..> | 2013-06-25 02:45 | 45M | |
![[SND]](/icons/sound2.gif) | 130625_144634_SRS001..> | 2013-06-25 14:46 | 525M | |
![[SND]](/icons/sound2.gif) | 130625_174930_SRS001..> | 2013-06-25 17:49 | 83M | |
![[SND]](/icons/sound2.gif) | Revelator 01.wav | 2013-06-25 18:05 | 64M | |
![[SND]](/icons/sound2.gif) | 20 Revolution 98.wav | 2013-06-25 18:12 | 51M | |
![[SND]](/icons/sound2.gif) | 16 One 91.wav | 2013-06-25 18:41 | 46M | |
![[SND]](/icons/sound2.gif) | The Healing Hour Int..> | 2013-06-25 19:11 | 11M | |
![[SND]](/icons/sound2.gif) | 22 Danaan for Radio ..> | 2013-06-25 19:15 | 34M | |
![[SND]](/icons/sound2.gif) | Silence Track - 6 se..> | 2013-06-25 20:15 | 1.0M | |
![[SND]](/icons/sound2.gif) | Silence Track - 6 se..> | 2013-06-25 20:15 | 1.0M | |
![[SND]](/icons/sound2.gif) | thehealinghour_13062..> | 2013-06-25 20:17 | 12M | |
![[SND]](/icons/sound2.gif) | thehealinghour_13062..> | 2013-06-25 20:18 | 313K | |
![[SND]](/icons/sound2.gif) | The Healing Hour Int..> | 2013-06-25 20:23 | 10M | |
![[SND]](/icons/sound2.gif) | The Healing Hour Int..> | 2013-06-25 20:23 | 10M | |
![[SND]](/icons/sound2.gif) | thehealinghour_13062..> | 2013-06-25 20:25 | 40M | |
![[SND]](/icons/sound2.gif) | thehealinghour_13062..> | 2013-06-25 20:29 | 15M | |
![[SND]](/icons/sound2.gif) | 130626_173054_SRS001..> | 2013-06-26 17:30 | 449M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1306..> | 2013-06-26 19:00 | 556M | |
![[SND]](/icons/sound2.gif) | intelkink_130626_210..> | 2013-06-26 21:00 | 560M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_130..> | 2013-06-26 22:03 | 568M | |
![[SND]](/icons/sound2.gif) | sarcasticnews_130627..> | 2013-06-27 19:33 | 610M | |
![[SND]](/icons/sound2.gif) | 9 Isn't It A Pity 70..> | 2013-06-30 01:19 | 73M | |
![[SND]](/icons/sound2.gif) | 3 There is a Valley ..> | 2013-06-30 01:24 | 43M | |
![[SND]](/icons/sound2.gif) | 14 Presence Of The L..> | 2013-06-30 01:25 | 49M | |
![[SND]](/icons/sound2.gif) | 2 The Maker 89.wav | 2013-06-30 01:28 | 43M | |
![[SND]](/icons/sound2.gif) | 18 Dirge 99.wav | 2013-06-30 01:30 | 63M | |
![[SND]](/icons/sound2.gif) | 26 Dirge 99.wav | 2013-06-30 01:30 | 63M | |
![[SND]](/icons/sound2.gif) | Dirge 99.wav | 2013-06-30 01:30 | 63M | |
![[SND]](/icons/sound2.gif) | 18 Personal Jesus 90..> | 2013-06-30 01:30 | 108M | |
![[SND]](/icons/sound2.gif) | 5 Calling All Angels..> | 2013-06-30 01:31 | 54M | |
![[SND]](/icons/sound2.gif) | 16 Hallelujah 94.wav | 2013-06-30 01:35 | 76M | |
![[SND]](/icons/sound2.gif) | 21 God's Song (That'..> | 2013-06-30 01:37 | 38M | |
![[SND]](/icons/sound2.gif) | God's Song (That's W..> | 2013-06-30 01:37 | 38M | |
![[SND]](/icons/sound2.gif) | 12 God 70.wav | 2013-06-30 01:40 | 42M | |
![[SND]](/icons/sound2.gif) | 10 Wind-Up 71.wav | 2013-06-30 01:47 | 61M | |
![[SND]](/icons/sound2.gif) | 7 Soldiers Of Christ..> | 2013-06-30 01:48 | 32M | |
![[SND]](/icons/sound2.gif) | 17 One Of Us 95.wav | 2013-06-30 01:52 | 54M | |
![[SND]](/icons/sound2.gif) | 22 You've Been Loved..> | 2013-06-30 01:59 | 46M | |
![[SND]](/icons/sound2.gif) | 24 You've Been Loved..> | 2013-06-30 01:59 | 46M | |
![[SND]](/icons/sound2.gif) | You've Been Loved 02..> | 2013-06-30 01:59 | 46M | |
![[SND]](/icons/sound2.gif) | 0 Home 98.wav | 2013-06-30 02:01 | 33M | |
![[SND]](/icons/sound2.gif) | 8 The Cross 87.wav | 2013-06-30 02:02 | 49M | |
![[SND]](/icons/sound2.gif) | 20 Can't Come Down 0..> | 2013-06-30 02:05 | 22M | |
![[SND]](/icons/sound2.gif) | 25 Passing By 01.wav | 2013-06-30 02:07 | 67M | |
![[SND]](/icons/sound2.gif) | Passing By 01.wav | 2013-06-30 02:07 | 67M | |
![[SND]](/icons/sound2.gif) | 19 Into The Mystic 7..> | 2013-06-30 02:09 | 35M | |
![[SND]](/icons/sound2.gif) | 11 Jesus Mentioned 8..> | 2013-06-30 02:17 | 28M | |
![[SND]](/icons/sound2.gif) | 4 Too Close To Heave..> | 2013-06-30 02:19 | 126M | |
![[SND]](/icons/sound2.gif) | 23 When Will I Ever ..> | 2013-06-30 02:21 | 57M | |
![[SND]](/icons/sound2.gif) | nlr_130630_205938_SR..> | 2013-06-30 20:59 | 552M | |
![[SND]](/icons/sound2.gif) | 6 Shine 03.wav | 2013-07-01 16:37 | 35M | |
![[SND]](/icons/sound2.gif) | psych1on1_130701_185..> | 2013-07-01 18:59 | 565M | |
![[SND]](/icons/sound2.gif) | 3 Not Goin' Home Any..> | 2013-07-02 01:13 | 11M | |
![[SND]](/icons/sound2.gif) | 203 Not Goin' Home A..> | 2013-07-02 01:13 | 11M | |
![[SND]](/icons/sound2.gif) | 26 Dead Man Walkin' ..> | 2013-07-02 01:16 | 28M | |
![[SND]](/icons/sound2.gif) | 225 Dead Man Walkin'..> | 2013-07-02 01:16 | 28M | |
![[SND]](/icons/sound2.gif) | Dead Man Walkin' 96.wav | 2013-07-02 01:16 | 28M | |
![[SND]](/icons/sound2.gif) | 9 Heroes 77.wav | 2013-07-02 01:22 | 62M | |
![[SND]](/icons/sound2.gif) | 208 Heroes 77.wav | 2013-07-02 01:22 | 62M | |
![[SND]](/icons/sound2.gif) | 24 Cat People [Putti..> | 2013-07-02 01:24 | 68M | |
![[SND]](/icons/sound2.gif) | 223 Cat People [Putt..> | 2013-07-02 01:24 | 68M | |
![[SND]](/icons/sound2.gif) | Cat People [Putting ..> | 2013-07-02 01:24 | 68M | |
![[SND]](/icons/sound2.gif) | 4 Tom Traubert's Blu..> | 2013-07-02 01:29 | 71M | |
![[SND]](/icons/sound2.gif) | 204 Tom Traubert's B..> | 2013-07-02 01:29 | 71M | |
![[SND]](/icons/sound2.gif) | 5 My One True Love 0..> | 2013-07-02 01:37 | 37M | |
![[SND]](/icons/sound2.gif) | 205 My One True Love..> | 2013-07-02 01:37 | 37M | |
![[SND]](/icons/sound2.gif) | 21 God Moving Over T..> | 2013-07-02 01:40 | 74M | |
![[SND]](/icons/sound2.gif) | 220 God Moving Over ..> | 2013-07-02 01:40 | 74M | |
![[SND]](/icons/sound2.gif) | 2 Porpoise Song.wav | 2013-07-02 01:42 | 46M | |
![[SND]](/icons/sound2.gif) | 202 Porpoise Song.wav | 2013-07-02 01:42 | 46M | |
![[SND]](/icons/sound2.gif) | 1 All The Way From M..> | 2013-07-02 01:43 | 51M | |
![[SND]](/icons/sound2.gif) | 201 All The Way From..> | 2013-07-02 01:43 | 51M | |
![[SND]](/icons/sound2.gif) | 222 Exit Music (For ..> | 2013-07-02 01:49 | 45M | |
![[SND]](/icons/sound2.gif) | Exit Music (For A Fi..> | 2013-07-02 01:49 | 45M | |
![[SND]](/icons/sound2.gif) | 22 You Can't Always ..> | 2013-07-02 01:51 | 75M | |
![[SND]](/icons/sound2.gif) | 221 You Can't Always..> | 2013-07-02 01:51 | 75M | |
![[SND]](/icons/sound2.gif) | You Can't Always Get..> | 2013-07-02 01:51 | 75M | |
![[SND]](/icons/sound2.gif) | 16 Must I Paint You ..> | 2013-07-02 01:53 | 56M | |
![[SND]](/icons/sound2.gif) | 215 Must I Paint You..> | 2013-07-02 01:53 | 56M | |
![[SND]](/icons/sound2.gif) | 7 Just Like U Said I..> | 2013-07-02 01:55 | 46M | |
![[SND]](/icons/sound2.gif) | 207 Just Like U Said..> | 2013-07-02 01:55 | 46M | |
![[SND]](/icons/sound2.gif) | 14 I Am The Walrus 6..> | 2013-07-02 01:57 | 46M | |
![[SND]](/icons/sound2.gif) | 212 I Am The Walrus ..> | 2013-07-02 01:57 | 46M | |
![[SND]](/icons/sound2.gif) | 5a Jack One Taste Sp..> | 2013-07-02 16:59 | 6.7M | |
![[SND]](/icons/sound2.gif) | 6a Jack One Taste Sp..> | 2013-07-02 16:59 | 6.7M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1307..> | 2013-07-03 18:59 | 556M | |
![[SND]](/icons/sound2.gif) | intelkink_130703_210..> | 2013-07-03 21:00 | 557M | |
![[SND]](/icons/sound2.gif) | psych1on1_130706_132..> | 2013-07-06 13:27 | 563M | |
![[SND]](/icons/sound2.gif) | nlr_130707_205911_SR..> | 2013-07-07 20:59 | 558M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1307..> | 2013-07-08 19:59 | 566M | |
![[SND]](/icons/sound2.gif) | 10a Shapeshift Promo..> | 2013-07-09 15:58 | 20M | |
![[SND]](/icons/sound2.gif) | 16a Shapeshift Promo..> | 2013-07-09 15:58 | 20M | |
![[SND]](/icons/sound2.gif) | 23 Everything In Its..> | 2013-07-09 17:26 | 42M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1307..> | 2013-07-10 19:01 | 555M | |
![[SND]](/icons/sound2.gif) | intelkink_130710_210..> | 2013-07-10 21:00 | 560M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_130..> | 2013-07-10 22:11 | 570M | |
![[SND]](/icons/sound2.gif) | sarcasticnews_130711..> | 2013-07-11 19:33 | 457K | |
![[SND]](/icons/sound2.gif) | 130711_193850_SRS001..> | 2013-07-11 19:38 | 577M | |
![[SND]](/icons/sound2.gif) | 130711_211052_SRS001..> | 2013-07-11 21:10 | 900M | |
![[SND]](/icons/sound2.gif) | 1 Radio Nowhere 07.wav | 2013-07-13 01:41 | 33M | |
![[SND]](/icons/sound2.gif) | Radio Nowhere 07.wav | 2013-07-13 01:41 | 33M | |
![[SND]](/icons/sound2.gif) | Highway One 05.wav | 2013-07-13 01:44 | 33M | |
![[SND]](/icons/sound2.gif) | 8 Red Red Red 05.wav | 2013-07-13 01:45 | 45M | |
![[SND]](/icons/sound2.gif) | Red Red Red 05.wav | 2013-07-13 01:45 | 45M | |
![[SND]](/icons/sound2.gif) | 16 Ramblin' Man 06.wav | 2013-07-13 01:47 | 35M | |
![[SND]](/icons/sound2.gif) | 18 I Want You Back 7..> | 2013-07-13 01:52 | 36M | |
![[SND]](/icons/sound2.gif) | I Want You Back 79.wav | 2013-07-13 01:52 | 36M | |
![[SND]](/icons/sound2.gif) | Hot Tuna - True Reli..> | 2013-07-13 01:54 | 48M | |
![[SND]](/icons/sound2.gif) | True Religion 72.wav | 2013-07-13 01:54 | 48M | |
![[SND]](/icons/sound2.gif) | 9 The Wind Cries Mar..> | 2013-07-13 01:57 | 37M | |
![[SND]](/icons/sound2.gif) | The Wind Cries Mary ..> | 2013-07-13 01:57 | 37M | |
![[SND]](/icons/sound2.gif) | 10 Castles Made Of S..> | 2013-07-13 01:58 | 28M | |
![[SND]](/icons/sound2.gif) | Castles Made Of Sand..> | 2013-07-13 01:58 | 28M | |
![[SND]](/icons/sound2.gif) | The Big Sky 85.wav | 2013-07-13 02:02 | 102M | |
![[SND]](/icons/sound2.gif) | 6 My Wife 71.wav | 2013-07-13 02:04 | 79M | |
![[SND]](/icons/sound2.gif) | 23 Surprise, AZ 05.wav | 2013-07-13 19:13 | 37M | |
![[SND]](/icons/sound2.gif) | Surprise, AZ 05.wav | 2013-07-13 19:13 | 37M | |
![[SND]](/icons/sound2.gif) | 19 See How We Are (D..> | 2013-07-13 19:19 | 36M | |
![[SND]](/icons/sound2.gif) | 5 Bucket of Blood 03..> | 2013-07-13 19:20 | 37M | |
![[SND]](/icons/sound2.gif) | 27 Expresso Love 80.wav | 2013-07-13 19:23 | 57M | |
![[SND]](/icons/sound2.gif) | 207 Expresso Love 80..> | 2013-07-13 19:23 | 57M | |
![[SND]](/icons/sound2.gif) | Expresso Love 80.wav | 2013-07-13 19:23 | 57M | |
![[SND]](/icons/sound2.gif) | 12 Trash City 88.wav | 2013-07-13 19:25 | 42M | |
![[SND]](/icons/sound2.gif) | Trash City 88.wav | 2013-07-13 19:25 | 42M | |
![[SND]](/icons/sound2.gif) | 10 Please Please Me ..> | 2013-07-13 19:31 | 41M | |
![[SND]](/icons/sound2.gif) | 4 Doctor Blind 06.wav | 2013-07-13 19:32 | 40M | |
![[SND]](/icons/sound2.gif) | Doctor Blind 06.wav | 2013-07-13 19:32 | 40M | |
![[SND]](/icons/sound2.gif) | 2 Desperados Under T..> | 2013-07-13 19:36 | 53M | |
![[SND]](/icons/sound2.gif) | 20 The Healer 89.wav | 2013-07-13 20:03 | 57M | |
![[SND]](/icons/sound2.gif) | 3 Birds 70.wav | 2013-07-13 20:16 | 26M | |
![[SND]](/icons/sound2.gif) | Birds 70.wav | 2013-07-13 20:16 | 26M | |
![[SND]](/icons/sound2.gif) | I Believe In You 70.wav | 2013-07-13 20:16 | 35M | |
![[SND]](/icons/sound2.gif) | Perfect Circle 83.wav | 2013-07-13 20:23 | 35M | |
![[SND]](/icons/sound2.gif) | 30 Videotape 07.wav | 2013-07-13 20:26 | 47M | |
![[SND]](/icons/sound2.gif) | Videotape 07.wav | 2013-07-13 20:26 | 47M | |
![[SND]](/icons/sound2.gif) | Political Science 72..> | 2013-07-13 20:28 | 20M | |
![[SND]](/icons/sound2.gif) | 20 Heart 81.wav | 2013-07-13 20:31 | 29M | |
![[SND]](/icons/sound2.gif) | 26 Heart 81.wav | 2013-07-13 20:31 | 29M | |
![[SND]](/icons/sound2.gif) | 28 Heart 81.wav | 2013-07-13 20:31 | 29M | |
![[SND]](/icons/sound2.gif) | Heart 81.wav | 2013-07-13 20:31 | 29M | |
![[SND]](/icons/sound2.gif) | 1 Every Picture Tell..> | 2013-07-13 20:36 | 133M | |
![[SND]](/icons/sound2.gif) | 17 Revelator 01.wav | 2013-07-13 20:39 | 64M | |
![[SND]](/icons/sound2.gif) | 4 Lipstick Traces 80..> | 2013-07-13 20:44 | 28M | |
![[SND]](/icons/sound2.gif) | 5 Going To My Home T..> | 2013-07-13 21:03 | 58M | |
![[SND]](/icons/sound2.gif) | Going To My Home Tow..> | 2013-07-13 21:03 | 58M | |
![[SND]](/icons/sound2.gif) | 9 Dry My Tears and M..> | 2013-07-13 21:18 | 38M | |
![[SND]](/icons/sound2.gif) | 11 Cigarettes and Ch..> | 2013-07-13 21:37 | 47M | |
![[SND]](/icons/sound2.gif) | 19 Where I'm From 00..> | 2013-07-13 21:41 | 39M | |
![[SND]](/icons/sound2.gif) | Where I'm From 00.wav | 2013-07-13 21:41 | 39M | |
![[SND]](/icons/sound2.gif) | nlr_130714_205955_SR..> | 2013-07-14 20:59 | 563M | |
![[SND]](/icons/sound2.gif) | downtowncrossroads_1..> | 2013-07-15 12:00 | 558M | |
![[SND]](/icons/sound2.gif) | psych1on1_130715_190..> | 2013-07-15 19:00 | 568M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1307..> | 2013-07-15 20:03 | 575M | |
![[SND]](/icons/sound2.gif) | 7 A Salty Dog 69.wav | 2013-07-16 01:06 | 47M | |
![[SND]](/icons/sound2.gif) | A Salty Dog 69.wav | 2013-07-16 01:06 | 47M | |
![[SND]](/icons/sound2.gif) | sarcasticnews_130717..> | 2013-07-17 20:02 | 571M | |
![[SND]](/icons/sound2.gif) | intelkink_130717_210..> | 2013-07-17 21:04 | 556M | |
![[SND]](/icons/sound2.gif) | 130717_220511_SRS001..> | 2013-07-17 22:05 | 574M | |
![[SND]](/icons/sound2.gif) | 130718_210014_SRS001..> | 2013-07-18 21:00 | 698M | |
![[SND]](/icons/sound2.gif) | klubkushradio_130720..> | 2013-07-20 02:44 | 556M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_130..> | 2013-07-21 13:00 | 566M | |
![[SND]](/icons/sound2.gif) | 16 Where Do The Chil..> | 2013-07-21 18:51 | 39M | |
![[SND]](/icons/sound2.gif) | skidrowstudios_13072..> | 2013-07-21 20:19 | 214M | |
![[SND]](/icons/sound2.gif) | nlr_130721_210019_SR..> | 2013-07-21 21:00 | 561M | |
![[SND]](/icons/sound2.gif) | Living Proof 92.wav | 2013-07-21 23:08 | 49M | |
![[SND]](/icons/sound2.gif) | 8 That's All You Nee..> | 2013-07-21 23:46 | 51M | |
![[SND]](/icons/sound2.gif) | 226 That's All You N..> | 2013-07-21 23:46 | 51M | |
![[SND]](/icons/sound2.gif) | That's All You Need ..> | 2013-07-21 23:46 | 51M | |
![[SND]](/icons/sound2.gif) | 4 Three Speed 98.wav | 2013-07-21 23:51 | 28M | |
![[SND]](/icons/sound2.gif) | Three Speed 98.wav | 2013-07-21 23:51 | 28M | |
![[SND]](/icons/sound2.gif) | 14 Numbered Days 03.wav | 2013-07-21 23:52 | 38M | |
![[SND]](/icons/sound2.gif) | 6 Then She Did 90.wav | 2013-07-21 23:54 | 84M | |
![[SND]](/icons/sound2.gif) | 17 That's Entertainm..> | 2013-07-21 23:56 | 37M | |
![[SND]](/icons/sound2.gif) | 203 That's Entertain..> | 2013-07-21 23:56 | 37M | |
![[SND]](/icons/sound2.gif) | That's Entertainment..> | 2013-07-21 23:56 | 37M | |
![[SND]](/icons/sound2.gif) | 27 Running The World..> | 2013-07-21 23:58 | 48M | |
![[SND]](/icons/sound2.gif) | 29 Running The World..> | 2013-07-21 23:58 | 48M | |
![[SND]](/icons/sound2.gif) | 221 Running The Worl..> | 2013-07-21 23:58 | 48M | |
![[SND]](/icons/sound2.gif) | Running The World 07..> | 2013-07-21 23:58 | 48M | |
![[SND]](/icons/sound2.gif) | 2 Coma Girl 03.wav | 2013-07-22 00:01 | 38M | |
![[SND]](/icons/sound2.gif) | Coma Girl 03.wav | 2013-07-22 00:01 | 38M | |
![[SND]](/icons/sound2.gif) | 24 Thing Called Love..> | 2013-07-22 00:13 | 42M | |
![[SND]](/icons/sound2.gif) | 11 Leave It Open 82.wav | 2013-07-22 00:19 | 34M | |
![[SND]](/icons/sound2.gif) | 13 Shitloads Of Mone..> | 2013-07-22 00:24 | 37M | |
![[SND]](/icons/sound2.gif) | Two Janes 92.wav | 2013-07-22 00:25 | 39M | |
![[SND]](/icons/sound2.gif) | Alone Again Or 67.wav | 2013-07-22 00:28 | 33M | |
![[SND]](/icons/sound2.gif) | 14 Wake Up 94.wav | 2013-07-22 00:30 | 41M | |
![[SND]](/icons/sound2.gif) | Wake Up 94.wav | 2013-07-22 00:30 | 41M | |
![[SND]](/icons/sound2.gif) | 15 Song Beneath The ..> | 2013-07-22 00:32 | 40M | |
![[SND]](/icons/sound2.gif) | downtowncrossroads_1..> | 2013-07-22 12:00 | 609M | |
![[SND]](/icons/sound2.gif) | psych1on1_130722_190..> | 2013-07-22 19:00 | 565M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1307..> | 2013-07-22 20:03 | 591M | |
![[SND]](/icons/sound2.gif) | 1 Strawberry Fields ..> | 2013-07-23 01:03 | 42M | |
![[SND]](/icons/sound2.gif) | 201 Strawberry Field..> | 2013-07-23 01:03 | 42M | |
![[SND]](/icons/sound2.gif) | Strawberry Fields Fo..> | 2013-07-23 01:03 | 42M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1307..> | 2013-07-24 18:59 | 557M | |
![[SND]](/icons/sound2.gif) | sarcasticnews_130724..> | 2013-07-24 20:06 | 555M | |
![[SND]](/icons/sound2.gif) | intelkink_130724_210..> | 2013-07-24 21:04 | 556M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_130..> | 2013-07-24 22:09 | 582M | |
![[SND]](/icons/sound2.gif) | npr_130725_210011_SR..> | 2013-07-25 21:00 | 772M | |
![[SND]](/icons/sound2.gif) | 28 Mona Lisas & Mad ..> | 2013-07-25 23:56 | 51M | |
![[SND]](/icons/sound2.gif) | 18 Watching The Whee..> | 2013-07-26 00:07 | 40M | |
![[SND]](/icons/sound2.gif) | 229 Watching The Whe..> | 2013-07-26 00:07 | 40M | |
![[SND]](/icons/sound2.gif) | 13 Life On The Road ..> | 2013-07-26 00:08 | 51M | |
![[SND]](/icons/sound2.gif) | 17 Life On The Road ..> | 2013-07-26 00:08 | 51M | |
![[SND]](/icons/sound2.gif) | 20 Sleep Song 71.wav | 2013-07-26 00:19 | 31M | |
![[SND]](/icons/sound2.gif) | 116 Hurt 94.wav | 2013-07-26 00:24 | 63M | |
![[SND]](/icons/sound2.gif) | Hurt 94.wav | 2013-07-26 00:24 | 63M | |
![[SND]](/icons/sound2.gif) | 124 Sweet Virginia 7..> | 2013-07-26 00:30 | 45M | |
![[SND]](/icons/sound2.gif) | Sweet Virginia 72.wav | 2013-07-26 00:30 | 45M | |
![[SND]](/icons/sound2.gif) | Erie Canal 06.wav | 2013-07-26 00:36 | 41M | |
![[SND]](/icons/sound2.gif) | 107 How Can I Tell Y..> | 2013-07-26 00:46 | 45M | |
![[SND]](/icons/sound2.gif) | 24 Tramp The Dirt Do..> | 2013-07-26 00:47 | 58M | |
![[SND]](/icons/sound2.gif) | 228 Tramp The Dirt D..> | 2013-07-26 00:47 | 58M | |
![[SND]](/icons/sound2.gif) | 8 Born Under Punches..> | 2013-07-26 00:52 | 59M | |
![[SND]](/icons/sound2.gif) | 2 The Low Spark Of H..> | 2013-07-26 00:55 | 119M | |
![[SND]](/icons/sound2.gif) | 10 The Low Spark Of ..> | 2013-07-26 00:55 | 119M | |
![[SND]](/icons/sound2.gif) | 202 The Low Spark Of..> | 2013-07-26 00:55 | 119M | |
![[SND]](/icons/sound2.gif) | Don't Leave 96.wav | 2013-07-26 01:08 | 40M | |
![[SND]](/icons/sound2.gif) | 18 Like It Or Not 81..> | 2013-07-26 01:13 | 50M | |
![[SND]](/icons/sound2.gif) | 19 Like It Or Not 81..> | 2013-07-26 01:13 | 50M | |
![[SND]](/icons/sound2.gif) | Blame Game 10.wav | 2013-07-26 01:31 | 79M | |
![[SND]](/icons/sound2.gif) | 9 Matte Kudasai 81.wav | 2013-07-26 01:33 | 38M | |
![[SND]](/icons/sound2.gif) | Matte Kudasai 81.wav | 2013-07-26 01:33 | 38M | |
![[SND]](/icons/sound2.gif) | 5 Beestung 94.wav | 2013-07-26 01:36 | 32M | |
![[SND]](/icons/sound2.gif) | 11 All My Friends 06..> | 2013-07-26 01:39 | 84M | |
![[SND]](/icons/sound2.gif) | 18 Over The Hills An..> | 2013-07-26 01:41 | 49M | |
![[SND]](/icons/sound2.gif) | 219 Over The Hills A..> | 2013-07-26 01:41 | 49M | |
![[SND]](/icons/sound2.gif) | Over The Hills And F..> | 2013-07-26 01:41 | 49M | |
![[SND]](/icons/sound2.gif) | 23 Somebody's Leavin..> | 2013-07-26 01:44 | 52M | |
![[SND]](/icons/sound2.gif) | 24 Somebody's Leavin..> | 2013-07-26 01:44 | 52M | |
![[SND]](/icons/sound2.gif) | Somebody's Leavin' 7..> | 2013-07-26 01:44 | 52M | |
![[SND]](/icons/sound2.gif) | 11 Johnny Sunshine 9..> | 2013-07-26 01:46 | 35M | |
![[SND]](/icons/sound2.gif) | Johnny Sunshine 93.wav | 2013-07-26 01:46 | 35M | |
![[SND]](/icons/sound2.gif) | 26 Go 04.wav | 2013-07-26 01:49 | 38M | |
![[SND]](/icons/sound2.gif) | Go 04.wav | 2013-07-26 01:49 | 38M | |
![[SND]](/icons/sound2.gif) | Loveless - Go 04.wav | 2013-07-26 01:49 | 38M | |
![[SND]](/icons/sound2.gif) | Candy 96.wav | 2013-07-26 01:54 | 51M | |
![[SND]](/icons/sound2.gif) | 3 Inner City Blues (..> | 2013-07-26 01:55 | 55M | |
![[SND]](/icons/sound2.gif) | 29 Teardrop 98.wav | 2013-07-26 01:57 | 56M | |
![[SND]](/icons/sound2.gif) | 122 Teardrop 98.wav | 2013-07-26 01:57 | 56M | |
![[SND]](/icons/sound2.gif) | 225 Teardrop 98.wav | 2013-07-26 01:57 | 56M | |
![[SND]](/icons/sound2.gif) | Teardrop 98.wav | 2013-07-26 01:57 | 56M | |
![[SND]](/icons/sound2.gif) | Girlfriend 91.wav | 2013-07-26 01:59 | 37M | |
![[SND]](/icons/sound2.gif) | 9 Don't Let Me Go 00..> | 2013-07-26 02:00 | 47M | |
![[SND]](/icons/sound2.gif) | 4 Out Of My Hands 97..> | 2013-07-26 02:01 | 37M | |
![[SND]](/icons/sound2.gif) | Out Of My Hands 97.wav | 2013-07-26 02:01 | 37M | |
![[SND]](/icons/sound2.gif) | 11 Mink Deville - Sa..> | 2013-07-26 02:03 | 32M | |
![[SND]](/icons/sound2.gif) | Savoir Faire 80.wav | 2013-07-26 02:03 | 32M | |
![[SND]](/icons/sound2.gif) | 19 Shot In The Back ..> | 2013-07-26 02:06 | 36M | |
![[SND]](/icons/sound2.gif) | 10 Goin' Down 67.wav | 2013-07-26 02:12 | 48M | |
![[SND]](/icons/sound2.gif) | 214 I Will See You I..> | 2013-07-26 02:17 | 43M | |
![[SND]](/icons/sound2.gif) | I Will See You In Fa..> | 2013-07-26 02:17 | 43M | |
![[SND]](/icons/sound2.gif) | 215 I Wish I Was You..> | 2013-07-26 02:17 | 48M | |
![[SND]](/icons/sound2.gif) | I Wish I Was Your Mo..> | 2013-07-26 02:17 | 48M | |
![[SND]](/icons/sound2.gif) | 14 So It Goes 78.wav | 2013-07-26 02:29 | 26M | |
![[SND]](/icons/sound2.gif) | 222 So It Goes 78.wav | 2013-07-26 02:29 | 26M | |
![[SND]](/icons/sound2.gif) | So It Goes 78.wav | 2013-07-26 02:29 | 26M | |
![[SND]](/icons/sound2.gif) | 11 Let Me Roll It 74..> | 2013-07-26 02:39 | 106M | |
![[SND]](/icons/sound2.gif) | 218 Let Me Roll It 7..> | 2013-07-26 02:39 | 106M | |
![[SND]](/icons/sound2.gif) | 18 Run That Body Dow..> | 2013-07-26 02:40 | 39M | |
![[SND]](/icons/sound2.gif) | 20 Run That Body Dow..> | 2013-07-26 02:40 | 39M | |
![[SND]](/icons/sound2.gif) | Run That Body Down 7..> | 2013-07-26 02:40 | 39M | |
![[SND]](/icons/sound2.gif) | 25 Hung Up 93.wav | 2013-07-26 02:41 | 27M | |
![[SND]](/icons/sound2.gif) | 210 Hung Up 93.wav | 2013-07-26 02:41 | 27M | |
![[SND]](/icons/sound2.gif) | 9 Good Day 96.wav | 2013-07-26 02:42 | 44M | |
![[SND]](/icons/sound2.gif) | Good Day 96.wav | 2013-07-26 02:42 | 44M | |
![[SND]](/icons/sound2.gif) | 16 Not For You 96.wav | 2013-07-26 02:43 | 59M | |
![[SND]](/icons/sound2.gif) | 17 Not For You 96.wav | 2013-07-26 02:43 | 59M | |
![[SND]](/icons/sound2.gif) | Not For You 96.wav | 2013-07-26 02:43 | 59M | |
![[SND]](/icons/sound2.gif) | Where Did You Sleep ..> | 2013-07-26 02:46 | 51M | |
![[SND]](/icons/sound2.gif) | 21 Stop Hurting Peop..> | 2013-07-26 03:04 | 40M | |
![[SND]](/icons/sound2.gif) | 223 Stop Hurting Peo..> | 2013-07-26 03:04 | 40M | |
![[SND]](/icons/sound2.gif) | 2 Where Is My Mind 8..> | 2013-07-26 03:09 | 40M | |
![[SND]](/icons/sound2.gif) | Where Is My Mind 88.wav | 2013-07-26 03:09 | 40M | |
![[SND]](/icons/sound2.gif) | 26 Dry 93.wav | 2013-07-26 03:13 | 37M | |
![[SND]](/icons/sound2.gif) | 206 Dry 93.wav | 2013-07-26 03:13 | 37M | |
![[SND]](/icons/sound2.gif) | Dry 93.wav | 2013-07-26 03:13 | 37M | |
![[SND]](/icons/sound2.gif) | 29 Nightswimming 92.wav | 2013-07-26 03:17 | 43M | |
![[SND]](/icons/sound2.gif) | 28 Karma Police 97.wav | 2013-07-26 03:19 | 44M | |
![[SND]](/icons/sound2.gif) | 204 Karma Police 97.wav | 2013-07-26 03:19 | 44M | |
![[SND]](/icons/sound2.gif) | 1 A Girl Like You 67..> | 2013-07-26 03:21 | 29M | |
![[SND]](/icons/sound2.gif) | 202 Both Ends Burnin..> | 2013-07-26 03:25 | 53M | |
![[SND]](/icons/sound2.gif) | Both Ends Burning 75..> | 2013-07-26 03:25 | 53M | |
![[SND]](/icons/sound2.gif) | 19 Shakedown On 9th ..> | 2013-07-26 03:26 | 29M | |
![[SND]](/icons/sound2.gif) | 21 Shakedown On 9th ..> | 2013-07-26 03:26 | 29M | |
![[SND]](/icons/sound2.gif) | Shakedown On 9th Str..> | 2013-07-26 03:26 | 29M | |
![[SND]](/icons/sound2.gif) | 19 One Day Late 04.wav | 2013-07-26 03:27 | 32M | |
![[SND]](/icons/sound2.gif) | One Day Late 04.wav | 2013-07-26 03:27 | 32M | |
![[SND]](/icons/sound2.gif) | 21 The Snow Leopard ..> | 2013-07-26 03:31 | 52M | |
![[SND]](/icons/sound2.gif) | Safe And Sound 02.wav | 2013-07-26 03:33 | 50M | |
![[SND]](/icons/sound2.gif) | 26 At The Zoo 68.wav | 2013-07-26 03:36 | 26M | |
![[SND]](/icons/sound2.gif) | At The Zoo 68.wav | 2013-07-26 03:36 | 26M | |
![[SND]](/icons/sound2.gif) | 12 She Doesn't Have ..> | 2013-07-26 03:39 | 38M | |
![[SND]](/icons/sound2.gif) | The Day I Tried To L..> | 2013-07-26 03:40 | 54M | |
![[SND]](/icons/sound2.gif) | 18 N.Y.C. 97.wav | 2013-07-26 03:42 | 37M | |
![[SND]](/icons/sound2.gif) | N.Y.C. 97.wav | 2013-07-26 03:42 | 37M | |
![[SND]](/icons/sound2.gif) | 7 One More Night (Yo..> | 2013-07-26 03:43 | 54M | |
![[SND]](/icons/sound2.gif) | One More Night (Your..> | 2013-07-26 03:43 | 54M | |
![[SND]](/icons/sound2.gif) | 16 Joy Inside My Tea..> | 2013-07-26 03:47 | 66M | |
![[SND]](/icons/sound2.gif) | 13 Big Empty 94.wav | 2013-07-26 03:49 | 50M | |
![[SND]](/icons/sound2.gif) | Big Empty 94.wav | 2013-07-26 03:49 | 50M | |
![[SND]](/icons/sound2.gif) | 12 A Good Idea 92.wav | 2013-07-26 03:50 | 38M | |
![[SND]](/icons/sound2.gif) | A Good Idea 92.wav | 2013-07-26 03:50 | 38M | |
![[SND]](/icons/sound2.gif) | 16 Marry Me 08.wav | 2013-07-26 03:53 | 38M | |
![[SND]](/icons/sound2.gif) | Marry Me 08.wav | 2013-07-26 03:53 | 38M | |
![[SND]](/icons/sound2.gif) | 24 Stunned 83.wav | 2013-07-26 03:54 | 39M | |
![[SND]](/icons/sound2.gif) | 25 Stunned 83.wav | 2013-07-26 03:54 | 39M | |
![[SND]](/icons/sound2.gif) | Stunned 83.wav | 2013-07-26 03:54 | 39M | |
![[SND]](/icons/sound2.gif) | 13 House Of Mirrors ..> | 2013-07-26 03:56 | 36M | |
![[SND]](/icons/sound2.gif) | 22 Spaceball Ricoche..> | 2013-07-26 04:03 | 36M | |
![[SND]](/icons/sound2.gif) | Matter Of Pride 81.wav | 2013-07-26 04:10 | 33M | |
![[SND]](/icons/sound2.gif) | The Master's Eyes 85..> | 2013-07-26 04:18 | 41M | |
![[SND]](/icons/sound2.gif) | 10 Six Underground 9..> | 2013-07-26 04:19 | 39M | |
![[SND]](/icons/sound2.gif) | 16 Six Underground 9..> | 2013-07-26 04:19 | 39M | |
![[SND]](/icons/sound2.gif) | Six Underground 96.wav | 2013-07-26 04:19 | 39M | |
![[SND]](/icons/sound2.gif) | 14 I Must Not Think ..> | 2013-07-26 04:29 | 42M | |
![[SND]](/icons/sound2.gif) | I Must Not Think Bad..> | 2013-07-26 04:29 | 42M | |
![[SND]](/icons/sound2.gif) | I Ain't Going To Dra..> | 2013-07-26 04:34 | 44M | |
![[SND]](/icons/sound2.gif) | 22 Tear-Stained Lett..> | 2013-07-26 04:35 | 47M | |
![[SND]](/icons/sound2.gif) | 224 Tear-Stained Let..> | 2013-07-26 04:35 | 47M | |
![[SND]](/icons/sound2.gif) | 11 One Step Up 87.wav | 2013-07-26 04:41 | 48M | |
![[SND]](/icons/sound2.gif) | One Step Up 87.wav | 2013-07-26 04:41 | 48M | |
![[SND]](/icons/sound2.gif) | Victim Of Love 81.wav | 2013-07-26 04:44 | 44M | |
![[SND]](/icons/sound2.gif) | 12 Sister Madly 88.wav | 2013-07-26 04:48 | 32M | |
![[SND]](/icons/sound2.gif) | Sister Madly 88.wav | 2013-07-26 04:48 | 32M | |
![[SND]](/icons/sound2.gif) | Jolie Louise 89.wav | 2013-07-26 04:51 | 27M | |
![[SND]](/icons/sound2.gif) | 10 Swallowed By The ..> | 2013-07-26 04:53 | 43M | |
![[SND]](/icons/sound2.gif) | Swallowed By The Cra..> | 2013-07-26 04:53 | 43M | |
![[SND]](/icons/sound2.gif) | 216 Kingdom Come 80.wav | 2013-07-26 04:56 | 41M | |
![[SND]](/icons/sound2.gif) | Kingdom Come 80.wav | 2013-07-26 04:56 | 41M | |
![[SND]](/icons/sound2.gif) | Lonely is [As Lonely..> | 2013-07-26 04:57 | 41M | |
![[SND]](/icons/sound2.gif) | Lonely is [As Lonely..> | 2013-07-26 04:57 | 41M | |
![[SND]](/icons/sound2.gif) | No Self Control 80.wav | 2013-07-26 13:51 | 40M | |
![[SND]](/icons/sound2.gif) | 15 Start 80.wav | 2013-07-26 13:51 | 14M | |
![[SND]](/icons/sound2.gif) | 211 Start 80.wav | 2013-07-26 13:51 | 14M | |
![[SND]](/icons/sound2.gif) | 16 I Don't Remember ..> | 2013-07-26 13:52 | 47M | |
![[SND]](/icons/sound2.gif) | 212 I Don't Remember..> | 2013-07-26 13:52 | 47M | |
![[SND]](/icons/sound2.gif) | 14 Almost Magic 80.wav | 2013-07-26 14:02 | 43M | |
![[SND]](/icons/sound2.gif) | I Still Haven't Foun..> | 2013-07-26 14:06 | 47M | |
![[SND]](/icons/sound2.gif) | 23 Fisherman's Blues..> | 2013-07-26 14:25 | 45M | |
![[SND]](/icons/sound2.gif) | 27 Fisherman's Blues..> | 2013-07-26 14:25 | 45M | |
![[SND]](/icons/sound2.gif) | Fisherman's Blues 88..> | 2013-07-26 14:25 | 45M | |
![[SND]](/icons/sound2.gif) | Here To Love You 79.wav | 2013-07-26 14:36 | 41M | |
![[SND]](/icons/sound2.gif) | 7 Perfection 71.wav | 2013-07-26 15:55 | 56M | |
![[SND]](/icons/sound2.gif) | 220 Perfection 71.wav | 2013-07-26 15:55 | 56M | |
![[SND]](/icons/sound2.gif) | 7 Thirteen 72.wav | 2013-07-26 15:58 | 28M | |
![[SND]](/icons/sound2.gif) | 23 Be Not So Fearful..> | 2013-07-26 16:09 | 61M | |
![[SND]](/icons/sound2.gif) | 24 The Healing Day 1..> | 2013-07-26 16:10 | 53M | |
![[SND]](/icons/sound2.gif) | 25 The Other Side 02..> | 2013-07-26 16:13 | 45M | |
![[SND]](/icons/sound2.gif) | 18 Mudslide 96.wav | 2013-07-26 16:48 | 36M | |
![[SND]](/icons/sound2.gif) | Mudslide 96.wav | 2013-07-26 16:48 | 36M | |
![[SND]](/icons/sound2.gif) | 20 Winning 06.wav | 2013-07-26 16:51 | 52M | |
![[SND]](/icons/sound2.gif) | Winning 06.wav | 2013-07-26 16:51 | 52M | |
![[SND]](/icons/sound2.gif) | 22 You Won't Let Me ..> | 2013-07-26 17:32 | 35M | |
![[SND]](/icons/sound2.gif) | You Won't Let Me Dow..> | 2013-07-26 17:32 | 35M | |
![[SND]](/icons/sound2.gif) | 27 Laid 93.wav | 2013-07-26 17:33 | 27M | |
![[SND]](/icons/sound2.gif) | 217 Laid 93.wav | 2013-07-26 17:33 | 27M | |
![[SND]](/icons/sound2.gif) | Jesca Hoop - Seed Of..> | 2013-07-26 17:41 | 62M | |
![[SND]](/icons/sound2.gif) | Seed Of Wonder.wav | 2013-07-26 17:41 | 62M | |
![[SND]](/icons/sound2.gif) | 5 Intelligentactile ..> | 2013-07-26 17:45 | 44M | |
![[SND]](/icons/sound2.gif) | Jen Trynin - Knock M..> | 2013-07-26 18:09 | 37M | |
![[SND]](/icons/sound2.gif) | Knock Me Down.wav | 2013-07-26 18:09 | 37M | |
![[SND]](/icons/sound2.gif) | 10 I Resign 97.wav | 2013-07-26 18:14 | 37M | |
![[SND]](/icons/sound2.gif) | 3 Me And Bobby McGee..> | 2013-07-26 20:39 | 99M | |
![[SND]](/icons/sound2.gif) | Me And Bobby McGee.wav | 2013-07-26 20:39 | 99M | |
![[SND]](/icons/sound2.gif) | This Will Be Our Yea..> | 2013-07-26 20:44 | 22M | |
![[SND]](/icons/sound2.gif) | 205 Care Of Cell 44 ..> | 2013-07-26 20:45 | 40M | |
![[SND]](/icons/sound2.gif) | Care Of Cell 44 [Mon..> | 2013-07-26 20:45 | 40M | |
![[SND]](/icons/sound2.gif) | 17 Modern World 05.wav | 2013-07-26 20:58 | 29M | |
![[SND]](/icons/sound2.gif) | Modern World 05.wav | 2013-07-26 20:58 | 29M | |
![[SND]](/icons/sound2.gif) | 15 Another World 08.wav | 2013-07-26 21:08 | 44M | |
![[SND]](/icons/sound2.gif) | 23 Another World 08.wav | 2013-07-26 21:08 | 44M | |
![[SND]](/icons/sound2.gif) | Another World 08.wav | 2013-07-26 21:08 | 44M | |
![[SND]](/icons/sound2.gif) | skidrowstudios_13072..> | 2013-07-27 18:15 | 796M | |
![[SND]](/icons/sound2.gif) | skidrowstudios_13072..> | 2013-07-28 14:09 | 710M | |
![[SND]](/icons/sound2.gif) | nlr_130728_205928_SR..> | 2013-07-28 20:59 | 570M | |
![[SND]](/icons/sound2.gif) | downtowncrossroads_1..> | 2013-07-29 11:59 | 634M | |
![[SND]](/icons/sound2.gif) | dark_recess.wav | 2013-07-29 12:58 | 78M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1307..> | 2013-07-29 20:02 | 604M | |
![[SND]](/icons/sound2.gif) | izradiotime_130730_1..> | 2013-07-30 18:00 | 540M | |
![[SND]](/icons/sound2.gif) | izradiotime_130730_1..> | 2013-07-30 18:53 | 627M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1307..> | 2013-07-31 18:59 | 556M | |
![[SND]](/icons/sound2.gif) | sarcasticnews_130731..> | 2013-07-31 20:01 | 558M | |
![[SND]](/icons/sound2.gif) | intelkink_130731_210..> | 2013-07-31 21:03 | 556M | |
![[SND]](/icons/sound2.gif) | 130801_210310_SRS001..> | 2013-08-01 21:03 | 720M | |
![[SND]](/icons/sound2.gif) | 01 01. Kick Against ..> | 2013-08-04 02:36 | 24M | |
![[SND]](/icons/sound2.gif) | 02 02. Deaf, Dumb & ..> | 2013-08-04 02:36 | 18M | |
![[SND]](/icons/sound2.gif) | 03 03. Wage Slaves.wav | 2013-08-04 02:36 | 25M | |
![[SND]](/icons/sound2.gif) | 04 04. Twisted & Pis..> | 2013-08-04 02:36 | 21M | |
![[SND]](/icons/sound2.gif) | 40 Wage Slaves.wav | 2013-08-04 03:36 | 25M | |
![[SND]](/icons/sound2.gif) | 53 Wage Slaves.wav | 2013-08-04 03:36 | 25M | |
![[SND]](/icons/sound2.gif) | hardyardsla_130804_1..> | 2013-08-04 18:59 | 558M | |
![[SND]](/icons/sound2.gif) | nlr_130804_210004_SR..> | 2013-08-04 21:00 | 573M | |
![[SND]](/icons/sound2.gif) | 4 Can't Find My Way ..> | 2013-08-04 23:56 | 33M | |
![[SND]](/icons/sound2.gif) | 117 It Never Rains 8..> | 2013-08-05 00:03 | 88M | |
![[SND]](/icons/sound2.gif) | It Never Rains 82.wav | 2013-08-05 00:03 | 88M | |
![[SND]](/icons/sound2.gif) | 9 Burn Down The Miss..> | 2013-08-05 00:09 | 67M | |
![[SND]](/icons/sound2.gif) | Save It For Later 82..> | 2013-08-05 00:10 | 36M | |
![[SND]](/icons/sound2.gif) | 12 Once Bitten, Twic..> | 2013-08-05 00:13 | 48M | |
![[SND]](/icons/sound2.gif) | 5 With You There To ..> | 2013-08-05 00:16 | 64M | |
![[SND]](/icons/sound2.gif) | Just Like Honey 85.wav | 2013-08-05 00:17 | 31M | |
![[SND]](/icons/sound2.gif) | 10 Old Town 82.wav | 2013-08-05 00:25 | 35M | |
![[SND]](/icons/sound2.gif) | Old Town 82.wav | 2013-08-05 00:25 | 35M | |
![[SND]](/icons/sound2.gif) | 21 Bathsheba Smiles ..> | 2013-08-05 00:27 | 39M | |
![[SND]](/icons/sound2.gif) | Bathsheba Smiles 99.wav | 2013-08-05 00:27 | 39M | |
![[SND]](/icons/sound2.gif) | 6 I've Seen All Good..> | 2013-08-05 00:32 | 70M | |
![[SND]](/icons/sound2.gif) | 3 Time Of The Season..> | 2013-08-05 00:34 | 36M | |
![[SND]](/icons/sound2.gif) | 2 She's A Rainbow 67..> | 2013-08-05 01:01 | 43M | |
![[SND]](/icons/sound2.gif) | The Fool On The Hill..> | 2013-08-05 01:22 | 30M | |
![[SND]](/icons/sound2.gif) | 104 Flying 67.wav | 2013-08-05 01:22 | 23M | |
![[SND]](/icons/sound2.gif) | downtowncrossroads_1..> | 2013-08-05 11:59 | 568M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1308..> | 2013-08-05 19:59 | 622M | |
![[SND]](/icons/sound2.gif) | izradiotime_130806_1..> | 2013-08-06 17:59 | 603M | |
![[SND]](/icons/sound2.gif) | izradiotime_130806_1..> | 2013-08-06 18:59 | 567M | |
![[SND]](/icons/sound2.gif) | 126 Cosmic Dancer 71..> | 2013-08-06 23:11 | 45M | |
![[SND]](/icons/sound2.gif) | 127 Cosmic Dancer 71..> | 2013-08-06 23:11 | 45M | |
![[SND]](/icons/sound2.gif) | 1 Way Below The Radi..> | 2013-08-06 23:22 | 43M | |
![[SND]](/icons/sound2.gif) | 8 Lisa Germano - If ..> | 2013-08-06 23:24 | 38M | |
![[SND]](/icons/sound2.gif) | If I Think Of Love.wav | 2013-08-06 23:24 | 38M | |
![[SND]](/icons/sound2.gif) | 28 Reptile.wav | 2013-08-06 23:27 | 36M | |
![[SND]](/icons/sound2.gif) | 8 To Be Lonely.wav | 2013-08-07 00:26 | 50M | |
![[SND]](/icons/sound2.gif) | 19 Steel And Glass.wav | 2013-08-07 00:29 | 47M | |
![[SND]](/icons/sound2.gif) | 22 Steel And Glass 7..> | 2013-08-07 00:29 | 47M | |
![[SND]](/icons/sound2.gif) | Steel And Glass.wav | 2013-08-07 00:29 | 47M | |
![[SND]](/icons/sound2.gif) | 24 Longest Days.wav | 2013-08-07 00:29 | 32M | |
![[SND]](/icons/sound2.gif) | 27 Longest Days 08.wav | 2013-08-07 00:29 | 32M | |
![[SND]](/icons/sound2.gif) | 27 Longest Days 08 1..> | 2013-08-07 00:29 | 32M | |
![[SND]](/icons/sound2.gif) | Longest Days 08.wav | 2013-08-07 00:29 | 32M | |
![[SND]](/icons/sound2.gif) | 25 A Brand New Song.wav | 2013-08-07 00:32 | 40M | |
![[SND]](/icons/sound2.gif) | 3 Bird In That Cage.wav | 2013-08-07 00:33 | 39M | |
![[SND]](/icons/sound2.gif) | 6 Hemmingway's Tell.wav | 2013-08-07 00:37 | 33M | |
![[SND]](/icons/sound2.gif) | 15 Surely.wav | 2013-08-07 00:54 | 57M | |
![[SND]](/icons/sound2.gif) | 21 Before It Gets Be..> | 2013-08-07 00:57 | 49M | |
![[SND]](/icons/sound2.gif) | 6 Where's Your Analo..> | 2013-08-07 01:04 | 35M | |
![[SND]](/icons/sound2.gif) | 13 Trouble Holding B..> | 2013-08-07 01:07 | 76M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1308..> | 2013-08-07 18:59 | 555M | |
![[SND]](/icons/sound2.gif) | sarcasticnews_130807..> | 2013-08-07 20:03 | 561M | |
![[SND]](/icons/sound2.gif) | intelkink_130807_210..> | 2013-08-07 21:03 | 551M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_130..> | 2013-08-07 22:04 | 577M | |
![[SND]](/icons/sound2.gif) | npr_130808_211026_SR..> | 2013-08-08 21:10 | 688M | |
![[SND]](/icons/sound2.gif) | beast.wav | 2013-08-09 14:00 | 114K | |
![[SND]](/icons/sound2.gif) | Zimmerman Verdict.wav | 2013-08-09 14:36 | 3.0M | |
![[SND]](/icons/sound2.gif) | 21 First Strike.wav | 2013-08-09 14:44 | 704K | |
![[SND]](/icons/sound2.gif) | First Strike.wav | 2013-08-09 14:44 | 704K | |
![[SND]](/icons/sound2.gif) | Zimmerman Riot.wav | 2013-08-09 15:11 | 1.4M | |
![[SND]](/icons/sound2.gif) | Mans Downfall.wav | 2013-08-09 15:14 | 3.6M | |
![[SND]](/icons/sound2.gif) | 03 sabbath.wav | 2013-08-09 15:25 | 619K | |
![[SND]](/icons/sound2.gif) | 10 In the Name of Sa..> | 2013-08-09 16:36 | 951K | |
![[SND]](/icons/sound2.gif) | 06 Rege Satanis.wav | 2013-08-09 16:40 | 691K | |
![[SND]](/icons/sound2.gif) | 01 The Devils Bride.wav | 2013-08-09 17:03 | 2.4M | |
![[SND]](/icons/sound2.gif) | 05 The Devils Bride ..> | 2013-08-09 17:05 | 1.2M | |
![[SND]](/icons/sound2.gif) | 4 Rege Satanis.wav | 2013-08-09 17:40 | 691K | |
![[SND]](/icons/sound2.gif) | 2 The Devils Bride.wav | 2013-08-09 18:03 | 2.4M | |
![[SND]](/icons/sound2.gif) | 23 JFK Violent.wav | 2013-08-09 20:11 | 564K | |
![[SND]](/icons/sound2.gif) | Stupidity.wav | 2013-08-10 11:13 | 1.2M | |
![[SND]](/icons/sound2.gif) | hardyardsla_130811_1..> | 2013-08-11 18:59 | 560M | |
![[SND]](/icons/sound2.gif) | downtowncrossroads_1..> | 2013-08-12 12:01 | 571M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1308..> | 2013-08-12 20:00 | 637M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1308..> | 2013-08-12 21:15 | 3.9M | |
![[SND]](/icons/sound2.gif) | izradiotime_130813_1..> | 2013-08-13 18:00 | 671M | |
![[SND]](/icons/sound2.gif) | izradiotime_130813_1..> | 2013-08-13 19:06 | 508M | |
![[SND]](/icons/sound2.gif) | 123 Stay (Faraway, S..> | 2013-08-13 20:28 | 50M | |
![[SND]](/icons/sound2.gif) | Stay (Faraway, So Cl..> | 2013-08-13 20:28 | 50M | |
![[SND]](/icons/sound2.gif) | 21 Tin Angel 12.wav | 2013-08-13 21:10 | 92M | |
![[SND]](/icons/sound2.gif) | 23 Tin Angel 12.wav | 2013-08-13 21:10 | 92M | |
![[SND]](/icons/sound2.gif) | Tin Angel 12.wav | 2013-08-13 21:10 | 92M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1308..> | 2013-08-14 18:59 | 555M | |
![[SND]](/icons/sound2.gif) | sarcasticnews_130814..> | 2013-08-14 20:03 | 564M | |
![[SND]](/icons/sound2.gif) | intelkink_130814_210..> | 2013-08-14 21:04 | 556M | |
![[SND]](/icons/sound2.gif) | 130814_220154_SRS001..> | 2013-08-14 22:01 | 505K | |
![[SND]](/icons/sound2.gif) | 130814_220205_SRS001..> | 2013-08-14 22:02 | 6.5M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_130..> | 2013-08-14 22:10 | 606M | |
![[SND]](/icons/sound2.gif) | darkmark_130815_2013..> | 2013-08-15 20:13 | 542M | |
![[SND]](/icons/sound2.gif) | A Really Good Time 7..> | 2013-08-15 20:24 | 38M | |
![[SND]](/icons/sound2.gif) | And She Was 85.wav | 2013-08-15 20:24 | 37M | |
![[SND]](/icons/sound2.gif) | 24 Halloweenhead 07.wav | 2013-08-15 20:28 | 34M | |
![[SND]](/icons/sound2.gif) | 10 A Healing Codes S..> | 2013-08-15 21:08 | 5.7M | |
![[SND]](/icons/sound2.gif) | 10A Healing Codes Sp..> | 2013-08-15 21:08 | 5.7M | |
![[SND]](/icons/sound2.gif) | 109 B Healing Codes ..> | 2013-08-15 21:08 | 5.7M | |
![[SND]](/icons/sound2.gif) | Healing Codes Spot.wav | 2013-08-15 21:08 | 5.7M | |
![[SND]](/icons/sound2.gif) | npr_130815_212655_SR..> | 2013-08-15 21:26 | 565M | |
![[SND]](/icons/sound2.gif) | Heavy Duty.wav | 2013-08-17 13:15 | 749K | |
![[SND]](/icons/sound2.gif) | Held Accountable.wav | 2013-08-17 13:54 | 3.1M | |
![[SND]](/icons/sound2.gif) | hardyardsla_130818_1..> | 2013-08-18 18:59 | 589M | |
![[SND]](/icons/sound2.gif) | nlr_130818_210142_SR..> | 2013-08-18 21:01 | 565M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1308..> | 2013-08-19 20:00 | 573M | |
![[SND]](/icons/sound2.gif) | 4 Jeepster 71.wav | 2013-08-19 20:35 | 42M | |
![[SND]](/icons/sound2.gif) | Show Yourself 06.wav | 2013-08-19 20:41 | 30M | |
![[SND]](/icons/sound2.gif) | 23 A Magazine Called..> | 2013-08-19 20:45 | 27M | |
![[SND]](/icons/sound2.gif) | 20 Your Dictionary 9..> | 2013-08-19 20:47 | 36M | |
![[SND]](/icons/sound2.gif) | Our Way To Fall 00.wav | 2013-08-19 20:52 | 43M | |
![[SND]](/icons/sound2.gif) | You Can Have It All ..> | 2013-08-19 20:53 | 47M | |
![[SND]](/icons/sound2.gif) | 14 Wonderwall 95.wav | 2013-08-19 20:59 | 44M | |
![[SND]](/icons/sound2.gif) | 15 Wonderwall 95.wav | 2013-08-19 20:59 | 44M | |
![[SND]](/icons/sound2.gif) | 7 The Calvary Cross ..> | 2013-08-19 21:08 | 39M | |
![[SND]](/icons/sound2.gif) | 27 Out Of The Wardro..> | 2013-08-19 22:28 | 37M | |
![[SND]](/icons/sound2.gif) | 8 Misfits 1.wav | 2013-08-19 22:32 | 48M | |
![[SND]](/icons/sound2.gif) | izradiotime_130820_1..> | 2013-08-20 18:04 | 730M | |
![[SND]](/icons/sound2.gif) | izradiotime_130820_1..> | 2013-08-20 19:16 | 447M | |
![[SND]](/icons/sound2.gif) | 130821_164508_SRS001..> | 2013-08-21 16:45 | 11M | |
![[SND]](/icons/sound2.gif) | 130821_164626_SRS001..> | 2013-08-21 16:46 | 721K | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1308..> | 2013-08-21 19:00 | 559M | |
![[SND]](/icons/sound2.gif) | sarcasticnews_130821..> | 2013-08-21 20:03 | 564M | |
![[SND]](/icons/sound2.gif) | intelkink_130821_210..> | 2013-08-21 21:02 | 556M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_130..> | 2013-08-21 22:03 | 583M | |
![[SND]](/icons/sound2.gif) | 130822_195622_SRS001..> | 2013-08-22 19:56 | 34M | |
![[SND]](/icons/sound2.gif) | darkmark_130822_2004..> | 2013-08-22 20:04 | 741M | |
![[SND]](/icons/sound2.gif) | 12 Moonlight Mile 71..> | 2013-08-22 23:10 | 60M | |
![[SND]](/icons/sound2.gif) | 4 The Delivery Man.wav | 2013-08-22 23:16 | 47M | |
![[SND]](/icons/sound2.gif) | 4 The Delivery Man 0..> | 2013-08-22 23:16 | 47M | |
![[SND]](/icons/sound2.gif) | 8 Hunted By A Freak.wav | 2013-08-22 23:19 | 43M | |
![[SND]](/icons/sound2.gif) | 8 Hunted By A Freak ..> | 2013-08-22 23:19 | 43M | |
![[SND]](/icons/sound2.gif) | 7 Randy Scouse Git.wav | 2013-08-22 23:30 | 28M | |
![[SND]](/icons/sound2.gif) | 7 Randy Scouse Git 6..> | 2013-08-22 23:30 | 28M | |
![[SND]](/icons/sound2.gif) | 11 Misunderstanding ..> | 2013-08-22 23:33 | 33M | |
![[SND]](/icons/sound2.gif) | 11 Misunderstanding ..> | 2013-08-22 23:33 | 33M | |
![[SND]](/icons/sound2.gif) | Walk On By.wav | 2013-08-22 23:37 | 122M | |
![[SND]](/icons/sound2.gif) | 2 Take Me To The Riv..> | 2013-08-22 23:43 | 51M | |
![[SND]](/icons/sound2.gif) | 2 Take Me To The Riv..> | 2013-08-22 23:43 | 51M | |
![[SND]](/icons/sound2.gif) | 9 How Am I Different..> | 2013-08-22 23:48 | 51M | |
![[SND]](/icons/sound2.gif) | 9 How Am I Different..> | 2013-08-22 23:48 | 51M | |
![[SND]](/icons/sound2.gif) | Tupelo Honey 71.wav | 2013-08-22 23:54 | 70M | |
![[SND]](/icons/sound2.gif) | 1 Johnny Strikes Up ..> | 2013-08-22 23:55 | 29M | |
![[SND]](/icons/sound2.gif) | 13 Butterfly.wav | 2013-08-22 23:57 | 29M | |
![[SND]](/icons/sound2.gif) | 13 Butterfly 96.wav | 2013-08-22 23:57 | 29M | |
![[SND]](/icons/sound2.gif) | 5 Love Is Best.wav | 2013-08-22 23:58 | 31M | |
![[SND]](/icons/sound2.gif) | 5 Love Is Best 97.wav | 2013-08-22 23:58 | 31M | |
![[SND]](/icons/sound2.gif) | 15 Fast Food 94.wav | 2013-08-23 00:04 | 28M | |
![[SND]](/icons/sound2.gif) | Fast Food 94.wav | 2013-08-23 00:04 | 28M | |
![[SND]](/icons/sound2.gif) | 6 Farewell Reel.wav | 2013-08-23 00:06 | 39M | |
![[SND]](/icons/sound2.gif) | 6 Farewell Reel 96.wav | 2013-08-23 00:06 | 39M | |
![[SND]](/icons/sound2.gif) | 3 1979.wav | 2013-08-23 00:08 | 45M | |
![[SND]](/icons/sound2.gif) | 17 St. Pete.wav | 2013-08-23 00:20 | 32M | |
![[SND]](/icons/sound2.gif) | 17 St. Pete 07.wav | 2013-08-23 00:20 | 32M | |
![[SND]](/icons/sound2.gif) | The Killing Type.wav | 2013-08-23 00:37 | 45M | |
![[SND]](/icons/sound2.gif) | Syria Chemical.wav | 2013-08-24 22:36 | 691K | |
![[SND]](/icons/sound2.gif) | Syria Chemical 2.wav | 2013-08-24 22:38 | 1.4M | |
![[SND]](/icons/sound2.gif) | Syria Chemical 3.wav | 2013-08-24 22:41 | 3.8M | |
![[SND]](/icons/sound2.gif) | Syria Chemical 4.wav | 2013-08-24 22:46 | 1.6M | |
![[SND]](/icons/sound2.gif) | hardyardsla_130825_1..> | 2013-08-25 19:01 | 564M | |
![[SND]](/icons/sound2.gif) | nlr_130825_210018_SR..> | 2013-08-25 21:00 | 572M | |
![[SND]](/icons/sound2.gif) | downtowncrossroads_1..> | 2013-08-26 11:59 | 581M | |
![[SND]](/icons/sound2.gif) | psych1on1_130826_185..> | 2013-08-26 18:59 | 568M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1308..> | 2013-08-26 20:00 | 569M | |
![[SND]](/icons/sound2.gif) | 114 Cover Me Up 13.wav | 2013-08-27 08:09 | 49M | |
![[SND]](/icons/sound2.gif) | 102 Went to See the ..> | 2013-08-27 08:14 | 30M | |
![[SND]](/icons/sound2.gif) | thehealinghour_13082..> | 2013-08-27 20:00 | 1.4M | |
![[SND]](/icons/sound2.gif) | 130827_204726_SRS001..> | 2013-08-27 20:47 | 676M | |
![[SND]](/icons/sound2.gif) | 101 I've Been Everyw..> | 2013-08-28 00:18 | 33M | |
![[SND]](/icons/sound2.gif) | 127 Hurt 02.wav | 2013-08-28 00:19 | 37M | |
![[SND]](/icons/sound2.gif) | 129 Hurt 02.wav | 2013-08-28 00:19 | 37M | |
![[SND]](/icons/sound2.gif) | Seven Nation Army 03..> | 2013-08-28 00:24 | 39M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1308..> | 2013-08-28 19:00 | 557M | |
![[SND]](/icons/sound2.gif) | intelkink_130828_210..> | 2013-08-28 21:00 | 556M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_130..> | 2013-08-28 22:02 | 563M | |
![[SND]](/icons/sound2.gif) | darkmark_130829_2014..> | 2013-08-29 20:14 | 568M | |
![[SND]](/icons/sound2.gif) | npr_130829_211728_SR..> | 2013-08-29 21:17 | 2.6M | |
![[SND]](/icons/sound2.gif) | npr_130829_212309_SR..> | 2013-08-29 21:23 | 895M | |
![[SND]](/icons/sound2.gif) | thehealinghour_13082..> | 2013-08-31 11:57 | 1.1G | |
![[SND]](/icons/sound2.gif) | 103 The Shining 00.wav | 2013-09-01 14:12 | 58M | |
![[SND]](/icons/sound2.gif) | 105 She's Leaving Ho..> | 2013-09-01 14:20 | 38M | |
![[SND]](/icons/sound2.gif) | 106 Wake Up 04.wav | 2013-09-01 14:23 | 61M | |
![[SND]](/icons/sound2.gif) | Redemption Song 80.wav | 2013-09-01 14:26 | 39M | |
![[SND]](/icons/sound2.gif) | 108 I Dont Blame You..> | 2013-09-01 14:33 | 34M | |
![[SND]](/icons/sound2.gif) | I Dont Blame You 03.wav | 2013-09-01 14:33 | 34M | |
![[SND]](/icons/sound2.gif) | 109 Anna Begins 93.wav | 2013-09-01 14:38 | 50M | |
![[SND]](/icons/sound2.gif) | 110 9 Crimes 06.wav | 2013-09-01 14:40 | 40M | |
![[SND]](/icons/sound2.gif) | 111 Last Stop This T..> | 2013-09-01 14:48 | 35M | |
![[SND]](/icons/sound2.gif) | 112 You're My Friend..> | 2013-09-01 14:50 | 38M | |
![[SND]](/icons/sound2.gif) | 113 Silly Thing 76.wav | 2013-09-01 14:57 | 29M | |
![[SND]](/icons/sound2.gif) | Silly Thing 76.wav | 2013-09-01 14:57 | 29M | |
![[SND]](/icons/sound2.gif) | 115 Cosmia 06.wav | 2013-09-01 15:02 | 74M | |
![[SND]](/icons/sound2.gif) | Cosmia 06.wav | 2013-09-01 15:02 | 74M | |
![[SND]](/icons/sound2.gif) | 119 Stood Up 87.wav | 2013-09-01 15:06 | 60M | |
![[SND]](/icons/sound2.gif) | 118 Pink Rabbits 13.wav | 2013-09-01 15:26 | 46M | |
![[SND]](/icons/sound2.gif) | Maybe I'm Amazed 70.wav | 2013-09-01 15:29 | 39M | |
![[SND]](/icons/sound2.gif) | hardyardsla_130901_1..> | 2013-09-01 19:00 | 571M | |
![[SND]](/icons/sound2.gif) | nlr_130901_205952_SR..> | 2013-09-01 20:59 | 575M | |
![[SND]](/icons/sound2.gif) | 120 Sunflower 93.wav | 2013-09-01 21:58 | 41M | |
![[SND]](/icons/sound2.gif) | 121 Wish You Were He..> | 2013-09-01 22:00 | 122M | |
![[SND]](/icons/sound2.gif) | Everybody Hurts 93.wav | 2013-09-01 22:06 | 54M | |
![[SND]](/icons/sound2.gif) | 25 Simon Smith And T..> | 2013-09-01 22:09 | 21M | |
![[SND]](/icons/sound2.gif) | Small Town Moon 12.wav | 2013-09-01 22:10 | 33M | |
![[SND]](/icons/sound2.gif) | The Ghost Of You Wal..> | 2013-09-01 22:13 | 37M | |
![[SND]](/icons/sound2.gif) | 122 Waltzing's For D..> | 2013-09-01 22:15 | 41M | |
![[SND]](/icons/sound2.gif) | 123 Waltzing's For D..> | 2013-09-01 22:15 | 41M | |
![[SND]](/icons/sound2.gif) | Black Hole Sun 94.wav | 2013-09-01 22:23 | 54M | |
![[SND]](/icons/sound2.gif) | 125 The Beast And Dr..> | 2013-09-01 22:26 | 44M | |
![[SND]](/icons/sound2.gif) | The Beast And Dragon..> | 2013-09-01 22:26 | 44M | |
![[SND]](/icons/sound2.gif) | 125 All I Do 80.wav | 2013-09-01 22:31 | 113M | |
![[SND]](/icons/sound2.gif) | 126 All I Do 80.wav | 2013-09-01 22:31 | 113M | |
![[SND]](/icons/sound2.gif) | losangelesnista_cave..> | 2013-09-02 13:54 | 18M | |
![[SND]](/icons/sound2.gif) | losangelesnista_itsc..> | 2013-09-02 13:56 | 34M | |
![[SND]](/icons/sound2.gif) | losangelesnista_reco..> | 2013-09-02 14:01 | 12M | |
![[SND]](/icons/sound2.gif) | losangelesnista_twof..> | 2013-09-02 14:03 | 3.5M | |
![[SND]](/icons/sound2.gif) | losangelesnista_musi..> | 2013-09-02 14:06 | 48M | |
![[SND]](/icons/sound2.gif) | losangelesnista_musi..> | 2013-09-02 14:11 | 5.1M | |
![[SND]](/icons/sound2.gif) | losangelesnista_lani..> | 2013-09-02 14:12 | 2.9M | |
![[SND]](/icons/sound2.gif) | losangelesnista_lani..> | 2013-09-02 14:12 | 11M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1309..> | 2013-09-02 20:01 | 609M | |
![[SND]](/icons/sound2.gif) | 15 Wallflower 82.wav | 2013-09-03 00:49 | 67M | |
![[SND]](/icons/sound2.gif) | thehealinghour_13090..> | 2013-09-03 19:59 | 6.0M | |
![[SND]](/icons/sound2.gif) | thehealinghourintro_..> | 2013-09-03 20:01 | 2.7M | |
![[SND]](/icons/sound2.gif) | thehealinghourintro_..> | 2013-09-03 20:01 | 2.9M | |
![[SND]](/icons/sound2.gif) | The Healing Hour Int..> | 2013-09-03 20:06 | 2.1M | |
![[SND]](/icons/sound2.gif) | thehealinghour_13090..> | 2013-09-03 20:11 | 39M | |
![[SND]](/icons/sound2.gif) | thehealinghourintro-..> | 2013-09-03 20:14 | 2.7M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1309..> | 2013-09-04 19:00 | 556M | |
![[SND]](/icons/sound2.gif) | sarcasticnews_130904..> | 2013-09-04 20:05 | 558M | |
![[SND]](/icons/sound2.gif) | intelkink_130904_210..> | 2013-09-04 21:04 | 556M | |
![[SND]](/icons/sound2.gif) | darkmark_130905_2022..> | 2013-09-05 20:22 | 742M | |
![[SND]](/icons/sound2.gif) | gonna_die_bigtime.wav | 2013-09-06 09:53 | 279K | |
![[SND]](/icons/sound2.gif) | 30 tony_t.wav | 2013-09-06 10:53 | 139K | |
![[SND]](/icons/sound2.gif) | Allah.wav | 2013-09-06 11:49 | 439K | |
![[SND]](/icons/sound2.gif) | Ariel Death 2.wav | 2013-09-06 11:57 | 1.3M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1309..> | 2013-09-06 12:59 | 785M | |
![[SND]](/icons/sound2.gif) | Kerry 1.wav | 2013-09-06 17:43 | 2.0M | |
![[SND]](/icons/sound2.gif) | Kerry 2.wav | 2013-09-06 17:46 | 2.6M | |
![[SND]](/icons/sound2.gif) | Kerry 3.wav | 2013-09-06 17:55 | 2.6M | |
![[SND]](/icons/sound2.gif) | Kerry 4.wav | 2013-09-06 18:34 | 2.2M | |
![[SND]](/icons/sound2.gif) | Nigga Payout.wav | 2013-09-06 18:37 | 3.6M | |
![[SND]](/icons/sound2.gif) | Israel 1.wav | 2013-09-06 18:51 | 3.3M | |
![[SND]](/icons/sound2.gif) | 23 Israel 1.wav | 2013-09-06 19:51 | 3.3M | |
![[SND]](/icons/sound2.gif) | Obama 1.wav | 2013-09-06 19:58 | 4.3M | |
![[SND]](/icons/sound2.gif) | 108 Falling Slowly.wav | 2013-09-07 08:22 | 36M | |
![[SND]](/icons/sound2.gif) | Syria Baseless.wav | 2013-09-07 10:41 | 2.6M | |
![[SND]](/icons/sound2.gif) | Network The Whole Wo..> | 2013-09-07 12:25 | 2.6M | |
![[SND]](/icons/sound2.gif) | Network Truth 1.wav | 2013-09-07 13:00 | 2.9M | |
![[SND]](/icons/sound2.gif) | MarathonM Discomfort..> | 2013-09-07 13:13 | 917K | |
![[SND]](/icons/sound2.gif) | Los Angeles Nista Pr..> | 2013-09-08 12:50 | 2.9M | |
![[SND]](/icons/sound2.gif) | losangelesnista-prom..> | 2013-09-08 12:50 | 2.9M | |
![[SND]](/icons/sound2.gif) | hardyardsla_130908_1..> | 2013-09-08 18:59 | 576M | |
![[SND]](/icons/sound2.gif) | hardyardsla_promo_13..> | 2013-09-08 20:03 | 265K | |
![[SND]](/icons/sound2.gif) | nlr_130908_205905_SR..> | 2013-09-08 20:59 | 575M | |
![[SND]](/icons/sound2.gif) | nlr_promo_130908_215..> | 2013-09-08 21:57 | 9.2M | |
![[SND]](/icons/sound2.gif) | nlr_promo_130908_215..> | 2013-09-08 21:59 | 745K | |
![[SND]](/icons/sound2.gif) | The Very Manic Jimmy..> | 2013-09-09 18:58 | 5.8M | |
![[SND]](/icons/sound2.gif) | verymanic_promo_1309..> | 2013-09-09 18:58 | 5.8M | |
![[SND]](/icons/sound2.gif) | Hard Yards LA - Prom..> | 2013-09-09 19:10 | 5.0M | |
![[SND]](/icons/sound2.gif) | hardyardsla_promo_13..> | 2013-09-09 19:10 | 5.0M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1309..> | 2013-09-09 20:01 | 597M | |
![[SND]](/icons/sound2.gif) | Lucy In The Sky With..> | 2013-09-09 23:21 | 35M | |
![[SND]](/icons/sound2.gif) | 113 While My Guitar ..> | 2013-09-09 23:21 | 48M | |
![[SND]](/icons/sound2.gif) | Dear Prudence.wav | 2013-09-09 23:35 | 39M | |
![[SND]](/icons/sound2.gif) | 115 I'm So Tired.wav | 2013-09-09 23:36 | 21M | |
![[SND]](/icons/sound2.gif) | I'm So Tired.wav | 2013-09-09 23:36 | 21M | |
![[SND]](/icons/sound2.gif) | Blackbird.wav | 2013-09-09 23:37 | 23M | |
![[SND]](/icons/sound2.gif) | I Will.wav | 2013-09-09 23:37 | 18M | |
![[SND]](/icons/sound2.gif) | 124 Julia.wav | 2013-09-09 23:38 | 29M | |
![[SND]](/icons/sound2.gif) | Cry Baby Cry.wav | 2013-09-09 23:41 | 31M | |
![[SND]](/icons/sound2.gif) | 2-13 Across The Univ..> | 2013-09-10 08:36 | 39M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1309..> | 2013-09-11 19:00 | 557M | |
![[SND]](/icons/sound2.gif) | sarcasticnews_130911..> | 2013-09-11 20:03 | 558M | |
![[SND]](/icons/sound2.gif) | intelkink_130911_210..> | 2013-09-11 21:06 | 557M | |
![[SND]](/icons/sound2.gif) | darkmark_130912_2000..> | 2013-09-12 20:00 | 1.9M | |
![[SND]](/icons/sound2.gif) | darkmark_130912_2009..> | 2013-09-12 20:09 | 564M | |
![[SND]](/icons/sound2.gif) | npr_130912_210916_SR..> | 2013-09-12 21:09 | 756M | |
![[SND]](/icons/sound2.gif) | Expect Everything As..> | 2013-09-12 23:07 | 2.4M | |
![[SND]](/icons/sound2.gif) | Syria Move Chemical.wav | 2013-09-12 23:18 | 647K | |
![[SND]](/icons/sound2.gif) | Cal Worthington.wav | 2013-09-12 23:22 | 1.4M | |
![[SND]](/icons/sound2.gif) | 13 One Country.wav | 2013-09-13 23:42 | 59M | |
![[SND]](/icons/sound2.gif) | Witchfinder Movie.wav | 2013-09-14 11:01 | 1.9M | |
![[SND]](/icons/sound2.gif) | nlr_130914_122845_SR..> | 2013-09-14 12:28 | 91M | |
![[SND]](/icons/sound2.gif) | nlr_130914_124122_SR..> | 2013-09-14 12:41 | 588M | |
![[SND]](/icons/sound2.gif) | hardyardsla_130915_1..> | 2013-09-15 18:59 | 575M | |
![[SND]](/icons/sound2.gif) | psych1on1_130916_185..> | 2013-09-16 18:59 | 593M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1309..> | 2013-09-16 20:03 | 579M | |
![[SND]](/icons/sound2.gif) | 130917_003226_SRS001..> | 2013-09-17 00:32 | 206M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1309..> | 2013-09-18 18:59 | 557M | |
![[SND]](/icons/sound2.gif) | sarcasticnews_130918..> | 2013-09-18 20:01 | 558M | |
![[SND]](/icons/sound2.gif) | intelkink_130918_210..> | 2013-09-18 21:01 | 556M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_130..> | 2013-09-18 22:02 | 633M | |
![[SND]](/icons/sound2.gif) | 130919_191414_SRS001..> | 2013-09-19 19:14 | 37M | |
![[SND]](/icons/sound2.gif) | darkmark_130919_2005..> | 2013-09-19 20:05 | 623M | |
![[SND]](/icons/sound2.gif) | npr_130919_211409_SR..> | 2013-09-19 21:14 | 704M | |
![[SND]](/icons/sound2.gif) | psych1on1_promo_1309..> | 2013-09-20 12:13 | 16M | |
![[SND]](/icons/sound2.gif) | psych1on1_promo_1309..> | 2013-09-20 12:15 | 24M | |
![[SND]](/icons/sound2.gif) | psych1on1_promo_1309..> | 2013-09-20 12:17 | 13M | |
![[SND]](/icons/sound2.gif) | psych1on1_promo_1309..> | 2013-09-20 12:27 | 16M | |
![[SND]](/icons/sound2.gif) | psych1on1_promo_1309..> | 2013-09-20 12:29 | 12M | |
![[SND]](/icons/sound2.gif) | psych1on1_promo_1309..> | 2013-09-20 12:30 | 2.1M | |
![[SND]](/icons/sound2.gif) | psych1on1_promo_1309..> | 2013-09-20 12:33 | 8.6M | |
![[SND]](/icons/sound2.gif) | Chicago School of Ps..> | 2013-09-20 12:46 | 7.7M | |
![[SND]](/icons/sound2.gif) | Psych 1 On 1 - Chica..> | 2013-09-20 12:46 | 7.7M | |
![[SND]](/icons/sound2.gif) | chicago_school_promo..> | 2013-09-20 12:46 | 7.7M | |
![[SND]](/icons/sound2.gif) | psych1on1_130920_180..> | 2013-09-20 18:02 | 562M | |
![[SND]](/icons/sound2.gif) | 30 witchfinding.wav | 2013-09-20 18:06 | 687K | |
![[SND]](/icons/sound2.gif) | 35) witchfinding.wav | 2013-09-20 18:06 | 687K | |
![[SND]](/icons/sound2.gif) | witchfinding.wav | 2013-09-20 18:06 | 687K | |
![[SND]](/icons/sound2.gif) | 130921_010203_SRS001..> | 2013-09-21 01:02 | 277M | |
![[SND]](/icons/sound2.gif) | timeout_promo_130921..> | 2013-09-21 12:59 | 93M | |
![[SND]](/icons/sound2.gif) | timeout_promo_130921..> | 2013-09-21 13:09 | 17M | |
![[SND]](/icons/sound2.gif) | timeout_promo_130921..> | 2013-09-21 13:12 | 8.2M | |
![[SND]](/icons/sound2.gif) | timeout_promo_130921..> | 2013-09-21 13:14 | 9.5M | |
![[SND]](/icons/sound2.gif) | timeout_promo_130921..> | 2013-09-21 13:17 | 35M | |
![[SND]](/icons/sound2.gif) | Medicus Graphics Cen..> | 2013-09-21 13:35 | 7.8M | |
![[SND]](/icons/sound2.gif) | medicus_promo1.wav | 2013-09-21 13:35 | 7.8M | |
![[SND]](/icons/sound2.gif) | timeout_promo_130921..> | 2013-09-21 13:43 | 262M | |
![[SND]](/icons/sound2.gif) | bumper1.wav | 2013-09-21 14:23 | 10M | |
![[SND]](/icons/sound2.gif) | bumper2.wav | 2013-09-21 14:23 | 5.5M | |
![[SND]](/icons/sound2.gif) | bumper3.wav | 2013-09-21 14:24 | 9.9M | |
![[SND]](/icons/sound2.gif) | bumper4.wav | 2013-09-21 14:24 | 7.2M | |
![[SND]](/icons/sound2.gif) | Coach Miller Rap Fou..> | 2013-09-21 14:38 | 10M | |
![[SND]](/icons/sound2.gif) | rap_outro.wav | 2013-09-21 14:38 | 10M | |
![[SND]](/icons/sound2.gif) | Coach Miller Rap Sec..> | 2013-09-21 14:41 | 4.8M | |
![[SND]](/icons/sound2.gif) | rap_mid_one.wav | 2013-09-21 14:41 | 4.8M | |
![[SND]](/icons/sound2.gif) | Coach Miller Rap Thi..> | 2013-09-21 14:42 | 9.4M | |
![[SND]](/icons/sound2.gif) | rap_mid_two.wav | 2013-09-21 14:42 | 9.4M | |
![[SND]](/icons/sound2.gif) | Coach Miller Rap Fir..> | 2013-09-21 14:48 | 6.8M | |
![[SND]](/icons/sound2.gif) | rap_first.wav | 2013-09-21 14:48 | 6.8M | |
![[SND]](/icons/sound2.gif) | Scoreboard Media Pro..> | 2013-09-21 15:16 | 8.6M | |
![[SND]](/icons/sound2.gif) | scoreboard_media.wav | 2013-09-21 15:16 | 8.6M | |
![[SND]](/icons/sound2.gif) | Jem Motors Promo 1.wav | 2013-09-21 15:41 | 9.4M | |
![[SND]](/icons/sound2.gif) | jem_motors_promo1.wav | 2013-09-21 15:41 | 9.4M | |
![[SND]](/icons/sound2.gif) | timeout_130921_15572..> | 2013-09-21 15:57 | 80M | |
![[SND]](/icons/sound2.gif) | Spotlight On Books I..> | 2013-09-21 16:17 | 6.8M | |
![[SND]](/icons/sound2.gif) | spotlight_on_books_i..> | 2013-09-21 16:17 | 6.8M | |
![[SND]](/icons/sound2.gif) | spotlight_130921_162..> | 2013-09-21 16:25 | 14M | |
![[SND]](/icons/sound2.gif) | 8 ) Skidrow Warnin..> | 2013-09-22 09:21 | 3.0M | |
![[SND]](/icons/sound2.gif) | 9 Skidrow Warning.wav | 2013-09-22 09:21 | 3.0M | |
![[SND]](/icons/sound2.gif) | 15 Skidrow Warning.wav | 2013-09-22 09:21 | 3.0M | |
![[SND]](/icons/sound2.gif) | 22 Skidrow Warning.wav | 2013-09-22 09:21 | 3.0M | |
![[SND]](/icons/sound2.gif) | Skidrow Warning.wav | 2013-09-22 09:21 | 3.0M | |
![[SND]](/icons/sound2.gif) | 03 Skidrow Warning..> | 2013-09-22 10:21 | 3.0M | |
![[SND]](/icons/sound2.gif) | 03 Skidrow Warning.wav | 2013-09-22 10:21 | 3.0M | |
![[SND]](/icons/sound2.gif) | 04 Skidrow Warning.wav | 2013-09-22 10:21 | 3.0M | |
![[SND]](/icons/sound2.gif) | 05 Skidrow Warning.wav | 2013-09-22 10:21 | 3.0M | |
![[SND]](/icons/sound2.gif) | 05 Skidrow Warning.wav | 2013-09-22 10:21 | 3.0M | |
![[SND]](/icons/sound2.gif) | 06 Skidrow Warning.wav | 2013-09-22 10:21 | 3.0M | |
![[SND]](/icons/sound2.gif) | 07 Skidrow Warning.wav | 2013-09-22 10:21 | 3.0M | |
![[SND]](/icons/sound2.gif) | 2 Skidrow Warning.wav | 2013-09-22 10:21 | 3.0M | |
![[SND]](/icons/sound2.gif) | 8 Skidrow Warning.wav | 2013-09-22 10:21 | 3.0M | |
![[SND]](/icons/sound2.gif) | 10 Skidrow Warning.wav | 2013-09-22 10:21 | 3.0M | |
![[SND]](/icons/sound2.gif) | 10 Skidrow Warning.wav | 2013-09-22 10:21 | 3.0M | |
![[SND]](/icons/sound2.gif) | 11 Skidrow Warning.wav | 2013-09-22 10:21 | 3.0M | |
![[SND]](/icons/sound2.gif) | 12 Skidrow Warning.wav | 2013-09-22 10:21 | 3.0M | |
![[SND]](/icons/sound2.gif) | 13 Skidrow Warning.wav | 2013-09-22 10:21 | 3.0M | |
![[SND]](/icons/sound2.gif) | 14 Skidrow Warning.wav | 2013-09-22 10:21 | 3.0M | |
![[SND]](/icons/sound2.gif) | 17 Skidrow Warning.wav | 2013-09-22 10:21 | 3.0M | |
![[SND]](/icons/sound2.gif) | Life_Of_An_Entrepren..> | 2013-09-22 12:51 | 1.9M | |
![[SND]](/icons/sound2.gif) | The Life Of An Entre..> | 2013-09-22 12:51 | 1.9M | |
![[SND]](/icons/sound2.gif) | manicjimmy_130922_16..> | 2013-09-22 16:26 | 55M | |
![[SND]](/icons/sound2.gif) | hardyardsla_130922_2..> | 2013-09-22 20:02 | 585M | |
![[SND]](/icons/sound2.gif) | nlr_130922_210249_SR..> | 2013-09-22 21:02 | 571M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_edi..> | 2013-09-23 13:26 | 20M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_edi..> | 2013-09-23 13:40 | 10M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_edi..> | 2013-09-23 13:41 | 5.1M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_edi..> | 2013-09-23 13:42 | 3.5M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_edi..> | 2013-09-23 13:45 | 9.5M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_edi..> | 2013-09-23 13:48 | 7.6M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_edi..> | 2013-09-23 14:14 | 2.9M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_edi..> | 2013-09-23 14:21 | 8.6M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_130..> | 2013-09-23 14:57 | 551M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1309..> | 2013-09-23 19:59 | 625M | |
![[SND]](/icons/sound2.gif) | 130923_232906_SRS001..> | 2013-09-23 23:29 | 5.4M | |
![[SND]](/icons/sound2.gif) | 130923_232957_SRS001..> | 2013-09-23 23:29 | 241K | |
![[SND]](/icons/sound2.gif) | 130924_235631_SRS001..> | 2013-09-24 23:56 | 182M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1309..> | 2013-09-25 19:00 | 556M | |
![[SND]](/icons/sound2.gif) | sarcasticnews_130925..> | 2013-09-25 20:06 | 550M | |
![[SND]](/icons/sound2.gif) | intelkink_130925_210..> | 2013-09-25 21:04 | 571M | |
![[SND]](/icons/sound2.gif) | darkmark_130926_2011..> | 2013-09-26 20:11 | 635M | |
![[SND]](/icons/sound2.gif) | 130927_191520_SRS001..> | 2013-09-27 19:15 | 105M | |
![[SND]](/icons/sound2.gif) | Naval shooting 1.wav | 2013-09-28 17:57 | 1.4M | |
![[SND]](/icons/sound2.gif) | Chicago Gun V.wav | 2013-09-28 18:04 | 1.8M | |
![[SND]](/icons/sound2.gif) | Chicago Gun V 2.wav | 2013-09-28 18:09 | 1.6M | |
![[SND]](/icons/sound2.gif) | Naval Shoot 2.wav | 2013-09-28 18:16 | 2.2M | |
![[SND]](/icons/sound2.gif) | Electro Magnetic Wav..> | 2013-09-28 18:21 | 1.3M | |
![[SND]](/icons/sound2.gif) | Cliff Memorial.wav | 2013-09-28 18:25 | 7.5M | |
![[SND]](/icons/sound2.gif) | Kenya Shopping M Sho..> | 2013-09-28 18:47 | 549K | |
![[SND]](/icons/sound2.gif) | Soilent Green 1.wav | 2013-09-28 18:50 | 2.6M | |
![[SND]](/icons/sound2.gif) | hardyardsla_130929_1..> | 2013-09-29 19:00 | 574M | |
![[SND]](/icons/sound2.gif) | nlr_130929_205854_SR..> | 2013-09-29 20:58 | 567M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1309..> | 2013-09-30 20:01 | 585M | |
![[SND]](/icons/sound2.gif) | Zac - It's Not Impor..> | 2013-09-30 22:23 | 36M | |
![[SND]](/icons/sound2.gif) | Zac - That's Not A S..> | 2013-09-30 22:23 | 29M | |
![[SND]](/icons/sound2.gif) | 2 Zac - It's Just An..> | 2013-09-30 22:24 | 30M | |
![[SND]](/icons/sound2.gif) | 3 Zac - Hypnosis.wav | 2013-09-30 22:24 | 39M | |
![[SND]](/icons/sound2.gif) | 4 Zac - There is Fri..> | 2013-09-30 22:25 | 29M | |
![[SND]](/icons/sound2.gif) | 1 We're Hanging Out.wav | 2013-09-30 22:54 | 26M | |
![[SND]](/icons/sound2.gif) | 12 Living Like A Hob..> | 2013-09-30 23:05 | 24M | |
![[SND]](/icons/sound2.gif) | 7 Diamond In The Sky..> | 2013-09-30 23:09 | 23M | |
![[SND]](/icons/sound2.gif) | 9 Gram Revisited.wav | 2013-09-30 23:09 | 21M | |
![[SND]](/icons/sound2.gif) | Let Me Dream.wav | 2013-09-30 23:16 | 36M | |
![[SND]](/icons/sound2.gif) | Slow Girl.wav | 2013-09-30 23:17 | 37M | |
![[SND]](/icons/sound2.gif) | One Man, Ten Thousan..> | 2013-09-30 23:18 | 44M | |
![[SND]](/icons/sound2.gif) | Who Invernted Yester..> | 2013-09-30 23:18 | 29M | |
![[SND]](/icons/sound2.gif) | Anna Ballerina.wav | 2013-09-30 23:19 | 40M | |
![[SND]](/icons/sound2.gif) | Stained Glass.wav | 2013-09-30 23:19 | 31M | |
![[SND]](/icons/sound2.gif) | Drifting Apart.wav | 2013-09-30 23:19 | 34M | |
![[SND]](/icons/sound2.gif) | Autumn Valentine.wav | 2013-09-30 23:20 | 37M | |
![[SND]](/icons/sound2.gif) | I Had To Let Go.wav | 2013-09-30 23:20 | 34M | |
![[SND]](/icons/sound2.gif) | Stardust Time.wav | 2013-09-30 23:21 | 36M | |
![[SND]](/icons/sound2.gif) | Please Please Me.wav | 2013-09-30 23:23 | 41M | |
![[SND]](/icons/sound2.gif) | Sexuo - UFO CLUB (Cl..> | 2013-10-01 04:31 | 50M | |
![[SND]](/icons/sound2.gif) | Life Of An Entrepren..> | 2013-10-01 10:14 | 1.7M | |
![[SND]](/icons/sound2.gif) | Life_Of_An_Entrepren..> | 2013-10-01 10:14 | 1.7M | |
![[SND]](/icons/sound2.gif) | entrepreneur_131001_..> | 2013-10-01 10:59 | 552M | |
![[SND]](/icons/sound2.gif) | 38 HELLION RISING mi..> | 2013-10-01 13:57 | 40M | |
![[SND]](/icons/sound2.gif) | 04 HELLION RISING mi..> | 2013-10-01 14:57 | 40M | |
![[SND]](/icons/sound2.gif) | 14 HELLION RISING mi..> | 2013-10-01 14:57 | 40M | |
![[SND]](/icons/sound2.gif) | 15 HELLION RISING mi..> | 2013-10-01 14:57 | 40M | |
![[SND]](/icons/sound2.gif) | 32 HELLION RISING mi..> | 2013-10-01 14:57 | 40M | |
![[SND]](/icons/sound2.gif) | The Healing Hour Int..> | 2013-10-01 19:41 | 2.7M | |
![[SND]](/icons/sound2.gif) | thehealinghour_13100..> | 2013-10-01 20:10 | 591M | |
![[SND]](/icons/sound2.gif) | 131002_025054_SRS001..> | 2013-10-02 02:50 | 721K | |
![[SND]](/icons/sound2.gif) | 131002_025312_SRS001..> | 2013-10-02 02:53 | 1.1M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1310..> | 2013-10-02 18:59 | 555M | |
![[SND]](/icons/sound2.gif) | sarcasticnews_131002..> | 2013-10-02 20:00 | 556M | |
![[SND]](/icons/sound2.gif) | intelkink_131002_210..> | 2013-10-02 21:00 | 558M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_131..> | 2013-10-02 22:43 | 568M | |
![[SND]](/icons/sound2.gif) | 10 Conan SKid Row.wav | 2013-10-03 18:51 | 26M | |
![[SND]](/icons/sound2.gif) | 11 Conan SKid Row.wav | 2013-10-03 18:51 | 26M | |
![[SND]](/icons/sound2.gif) | 13 Conan SKid Row.wav | 2013-10-03 18:51 | 26M | |
![[SND]](/icons/sound2.gif) | 15 Conan SKid Row.wav | 2013-10-03 18:51 | 26M | |
![[SND]](/icons/sound2.gif) | 26) Conan SKid Row.wav | 2013-10-03 18:51 | 26M | |
![[SND]](/icons/sound2.gif) | Conan SKid Row (2).wav | 2013-10-03 18:51 | 26M | |
![[SND]](/icons/sound2.gif) | Conan SKid Row.wav | 2013-10-03 18:51 | 26M | |
![[SND]](/icons/sound2.gif) | 06 Conan SKid Row.wav | 2013-10-03 19:51 | 26M | |
![[SND]](/icons/sound2.gif) | 09 Conan SKid Row.wav | 2013-10-03 19:51 | 26M | |
![[SND]](/icons/sound2.gif) | 09 SKid Row.wav | 2013-10-03 19:51 | 26M | |
![[SND]](/icons/sound2.gif) | 3 Conan SKid Row.wav | 2013-10-03 19:51 | 26M | |
![[SND]](/icons/sound2.gif) | 12 Conan SKid Row.wav | 2013-10-03 19:51 | 26M | |
![[SND]](/icons/sound2.gif) | 14 Conan SKid Row.wav | 2013-10-03 19:51 | 26M | |
![[SND]](/icons/sound2.gif) | 19 Conan SKid Row.wav | 2013-10-03 19:51 | 26M | |
![[SND]](/icons/sound2.gif) | darkmark_131003_2009..> | 2013-10-03 20:09 | 693M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1310..> | 2013-10-04 12:26 | 556M | |
![[SND]](/icons/sound2.gif) | Obama Minimum Wage.wav | 2013-10-05 13:16 | 1.1M | |
![[SND]](/icons/sound2.gif) | Videodrone 1.wav | 2013-10-05 13:23 | 2.9M | |
![[SND]](/icons/sound2.gif) | Videodrone 2.wav | 2013-10-05 13:26 | 3.3M | |
![[SND]](/icons/sound2.gif) | Capital Shooting 1.wav | 2013-10-05 14:01 | 3.1M | |
![[SND]](/icons/sound2.gif) | Capital shooting 2.wav | 2013-10-05 14:09 | 1.2M | |
![[SND]](/icons/sound2.gif) | capital shooting 3.wav | 2013-10-05 14:12 | 1.1M | |
![[SND]](/icons/sound2.gif) | 39 Obama Minimum Wag..> | 2013-10-05 14:16 | 1.1M | |
![[SND]](/icons/sound2.gif) | 52 Obama Minimum Wag..> | 2013-10-05 14:16 | 1.1M | |
![[SND]](/icons/sound2.gif) | nakedkunis_131005_19..> | 2013-10-05 19:35 | 29M | |
![[SND]](/icons/sound2.gif) | nakedkunis_131005_20..> | 2013-10-05 20:37 | 413M | |
![[SND]](/icons/sound2.gif) | hardyardsla_131006_1..> | 2013-10-06 19:00 | 555M | |
![[SND]](/icons/sound2.gif) | nlr_131006_205958_SR..> | 2013-10-06 20:59 | 559M | |
![[SND]](/icons/sound2.gif) | Psych 1 On 1 Intro.wav | 2013-10-07 18:48 | 4.9M | |
![[SND]](/icons/sound2.gif) | pysch1on1-intro.wav | 2013-10-07 18:48 | 4.9M | |
![[SND]](/icons/sound2.gif) | Psych 1 On 1 Outro.wav | 2013-10-07 18:52 | 3.4M | |
![[SND]](/icons/sound2.gif) | psych1on1-outro.wav | 2013-10-07 18:52 | 3.4M | |
![[SND]](/icons/sound2.gif) | psych1on1_131007_190..> | 2013-10-07 19:00 | 450M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1310..> | 2013-10-07 20:00 | 658M | |
![[SND]](/icons/sound2.gif) | 131007_231106_SRS001..> | 2013-10-07 23:11 | 29M | |
![[SND]](/icons/sound2.gif) | entrepreneur_131008_..> | 2013-10-08 11:00 | 508M | |
![[SND]](/icons/sound2.gif) | 1.Chupacabra-M.wav | 2013-10-08 13:28 | 57M | |
![[SND]](/icons/sound2.gif) | 2.Tiger-M.wav | 2013-10-08 13:32 | 50M | |
![[SND]](/icons/sound2.gif) | 3.No Talent-M.wav | 2013-10-08 13:35 | 20M | |
![[SND]](/icons/sound2.gif) | 4. Sweep the Leg.wav | 2013-10-08 13:56 | 65M | |
![[SND]](/icons/sound2.gif) | 5.Bronco-M.wav | 2013-10-08 14:00 | 51M | |
![[SND]](/icons/sound2.gif) | 6.Cannibal-M.wav | 2013-10-08 14:04 | 60M | |
![[SND]](/icons/sound2.gif) | 7.Dont call me-M.wav | 2013-10-08 14:08 | 61M | |
![[SND]](/icons/sound2.gif) | sarcasticnews_131009..> | 2013-10-09 20:02 | 541M | |
![[SND]](/icons/sound2.gif) | intelkink_131009_210..> | 2013-10-09 21:02 | 558M | |
![[SND]](/icons/sound2.gif) | 131009_221555_SRS001..> | 2013-10-09 22:15 | 561M | |
![[SND]](/icons/sound2.gif) | darkmark_131010_2010..> | 2013-10-10 20:10 | 692M | |
![[SND]](/icons/sound2.gif) | JAP ATTACK.wav | 2013-10-12 16:26 | 2.3M | |
![[SND]](/icons/sound2.gif) | Jap attack 2.wav | 2013-10-12 16:36 | 1.3M | |
![[SND]](/icons/sound2.gif) | Orange G interview.wav | 2013-10-12 22:10 | 63M | |
![[SND]](/icons/sound2.gif) | Orange G Jimmy Cabbs..> | 2013-10-12 22:12 | 369K | |
![[SND]](/icons/sound2.gif) | 35 Billy Jack.wav | 2013-10-12 23:40 | 5.2M | |
![[SND]](/icons/sound2.gif) | hardyardsla_131013_1..> | 2013-10-13 18:44 | 1.4M | |
![[SND]](/icons/sound2.gif) | hardyardsla_131013_1..> | 2013-10-13 19:01 | 1.5M | |
![[SND]](/icons/sound2.gif) | hardyardsla_131013_1..> | 2013-10-13 19:03 | 521M | |
![[SND]](/icons/sound2.gif) | nlr_131013_205914_SR..> | 2013-10-13 20:59 | 18M | |
![[SND]](/icons/sound2.gif) | nlr_131013_210111_SR..> | 2013-10-13 21:01 | 563M | |
![[SND]](/icons/sound2.gif) | psych1on1_131014_185..> | 2013-10-14 18:59 | 563M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1310..> | 2013-10-14 20:03 | 590M | |
![[SND]](/icons/sound2.gif) | The Life Of An Entre..> | 2013-10-15 03:35 | 2.4M | |
![[SND]](/icons/sound2.gif) | tloae_outro.wav | 2013-10-15 03:35 | 2.4M | |
![[SND]](/icons/sound2.gif) | entrepreneur_131015_..> | 2013-10-15 11:00 | 555M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1310..> | 2013-10-16 19:00 | 556M | |
![[SND]](/icons/sound2.gif) | sarcasticnews_131016..> | 2013-10-16 20:09 | 495M | |
![[SND]](/icons/sound2.gif) | intelkink_131016_210..> | 2013-10-16 21:02 | 556M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_131..> | 2013-10-16 22:05 | 616M | |
![[SND]](/icons/sound2.gif) | darkmark_131017_2000..> | 2013-10-17 20:00 | 635M | |
![[SND]](/icons/sound2.gif) | npr_131017_210331_SR..> | 2013-10-17 21:03 | 785M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_edi..> | 2013-10-18 14:16 | 2.6M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_131..> | 2013-10-18 15:15 | 541M | |
![[SND]](/icons/sound2.gif) | Vince Scully.wav | 2013-10-19 12:49 | 1.3M | |
![[SND]](/icons/sound2.gif) | Vince Scully 2.wav | 2013-10-19 12:51 | 738K | |
![[SND]](/icons/sound2.gif) | Footlose Serpent of ..> | 2013-10-19 12:54 | 3.5M | |
![[SND]](/icons/sound2.gif) | Obama Gov Shut Down.wav | 2013-10-19 13:04 | 3.2M | |
![[SND]](/icons/sound2.gif) | Exorcist The Demon.wav | 2013-10-19 13:25 | 2.7M | |
![[SND]](/icons/sound2.gif) | 37 Footlose Serpent ..> | 2013-10-19 13:54 | 3.5M | |
![[SND]](/icons/sound2.gif) | 05 Exorcist The Demo..> | 2013-10-19 14:25 | 2.7M | |
![[SND]](/icons/sound2.gif) | 15 Exorcist The Demo..> | 2013-10-19 14:25 | 2.7M | |
![[SND]](/icons/sound2.gif) | The Whip Appeal Talk..> | 2013-10-19 14:37 | 25M | |
![[SND]](/icons/sound2.gif) | mistressc_intro_1310..> | 2013-10-19 14:37 | 25M | |
![[SND]](/icons/sound2.gif) | hardyardsla_131020_1..> | 2013-10-20 19:00 | 562M | |
![[SND]](/icons/sound2.gif) | nlr_131020_210003_SR..> | 2013-10-20 21:00 | 565M | |
![[SND]](/icons/sound2.gif) | psych1on1_131021_190..> | 2013-10-21 19:00 | 552M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1310..> | 2013-10-21 20:02 | 594M | |
![[SND]](/icons/sound2.gif) | entrepreneur_131022_..> | 2013-10-22 11:00 | 556M | |
![[SND]](/icons/sound2.gif) | thewhipappeal_131022..> | 2013-10-22 11:57 | 313K | |
![[SND]](/icons/sound2.gif) | MistressC-1.wav | 2013-10-22 12:38 | 2.5M | |
![[SND]](/icons/sound2.gif) | MistressC-2-old1.wav | 2013-10-22 12:39 | 2.6M | |
![[SND]](/icons/sound2.gif) | MistressC-3-old1.wav | 2013-10-22 12:39 | 2.6M | |
![[SND]](/icons/sound2.gif) | MistressC-4-old1.wav | 2013-10-22 12:39 | 2.4M | |
![[SND]](/icons/sound2.gif) | MistressC-2.wav | 2013-10-22 14:09 | 2.6M | |
![[SND]](/icons/sound2.gif) | MistressC-3.wav | 2013-10-22 14:10 | 2.6M | |
![[SND]](/icons/sound2.gif) | MistressC-4.wav | 2013-10-22 14:10 | 2.4M | |
![[SND]](/icons/sound2.gif) | MistressC-bumper1.wav | 2013-10-22 14:29 | 2.5M | |
![[SND]](/icons/sound2.gif) | MistressC-bumper2.wav | 2013-10-22 14:29 | 2.6M | |
![[SND]](/icons/sound2.gif) | MistressC-bumper3.wav | 2013-10-22 14:29 | 2.6M | |
![[SND]](/icons/sound2.gif) | MistressC-bumper4.wav | 2013-10-22 14:30 | 2.4M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1310..> | 2013-10-23 18:59 | 558M | |
![[SND]](/icons/sound2.gif) | sarcasticnews_131023..> | 2013-10-23 20:00 | 557M | |
![[SND]](/icons/sound2.gif) | intelkink_131023_210..> | 2013-10-23 21:05 | 558M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_131..> | 2013-10-23 22:04 | 619M | |
![[SND]](/icons/sound2.gif) | 2) Kerry Farwell.wav | 2013-10-24 16:10 | 1.0M | |
![[SND]](/icons/sound2.gif) | 6) Jeff H Sorry Go..> | 2013-10-24 16:15 | 769K | |
![[SND]](/icons/sound2.gif) | 1 ) Jeff H Slayer ..> | 2013-10-24 16:22 | 883K | |
![[SND]](/icons/sound2.gif) | 4) Kerry K Too la..> | 2013-10-24 16:26 | 630K | |
![[SND]](/icons/sound2.gif) | 16) Beware the beast..> | 2013-10-24 17:55 | 2.8M | |
![[SND]](/icons/sound2.gif) | 17 ) New Orleans lo..> | 2013-10-24 18:11 | 727K | |
![[SND]](/icons/sound2.gif) | 31 New Orleans loote..> | 2013-10-24 19:11 | 727K | |
![[SND]](/icons/sound2.gif) | 42 New Orleans loote..> | 2013-10-24 19:11 | 727K | |
![[SND]](/icons/sound2.gif) | vortexradio_131025_1..> | 2013-10-25 17:59 | 466M | |
![[SND]](/icons/sound2.gif) | 40 Witches Sabbath.wav | 2013-10-25 23:47 | 1.2M | |
![[SND]](/icons/sound2.gif) | 43) Witches Sabbath.wav | 2013-10-25 23:47 | 1.2M | |
![[SND]](/icons/sound2.gif) | 31 Witches.wav | 2013-10-25 23:51 | 1.2M | |
![[SND]](/icons/sound2.gif) | 34 Witches.wav | 2013-10-25 23:51 | 1.2M | |
![[SND]](/icons/sound2.gif) | 37) Witches.wav | 2013-10-25 23:51 | 1.2M | |
![[SND]](/icons/sound2.gif) | cocktailspromos_1310..> | 2013-10-26 15:35 | 7.4M | |
![[SND]](/icons/sound2.gif) | cocktailspromos_1310..> | 2013-10-26 15:36 | 7.8M | |
![[SND]](/icons/sound2.gif) | cocktailspromos_1310..> | 2013-10-26 15:45 | 6.3M | |
![[SND]](/icons/sound2.gif) | cocktailspromos_1310..> | 2013-10-26 15:46 | 9.4M | |
![[SND]](/icons/sound2.gif) | cocktailsintro_13102..> | 2013-10-26 15:49 | 4.9M | |
![[SND]](/icons/sound2.gif) | CocktailIntro.wav | 2013-10-26 15:55 | 4.9M | |
![[SND]](/icons/sound2.gif) | Cocktails with Kimbe..> | 2013-10-26 15:55 | 4.9M | |
![[SND]](/icons/sound2.gif) | The Rub PR Commercia..> | 2013-10-26 16:02 | 4.8M | |
![[SND]](/icons/sound2.gif) | The Rub PR Commercia..> | 2013-10-26 16:17 | 6.7M | |
![[SND]](/icons/sound2.gif) | rubpr_131026.wav | 2013-10-26 16:17 | 6.7M | |
![[SND]](/icons/sound2.gif) | 131026_195656_SRS001..> | 2013-10-26 19:56 | 746M | |
![[SND]](/icons/sound2.gif) | nlr_131027_210034_SR..> | 2013-10-27 21:00 | 575M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1310..> | 2013-10-28 20:00 | 658M | |
![[SND]](/icons/sound2.gif) | entrepreneur_131029_..> | 2013-10-29 11:00 | 554M | |
![[SND]](/icons/sound2.gif) | 08 3 Another Ordinar..> | 2013-10-30 15:14 | 39M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1310..> | 2013-10-30 18:59 | 557M | |
![[SND]](/icons/sound2.gif) | sarcasticnews_131030..> | 2013-10-30 20:04 | 563M | |
![[SND]](/icons/sound2.gif) | intellectualkink_131..> | 2013-10-30 21:03 | 557M | |
![[SND]](/icons/sound2.gif) | darkmark_131031_1959..> | 2013-10-31 19:59 | 601M | |
![[SND]](/icons/sound2.gif) | npr_131031_210817_SR..> | 2013-10-31 21:08 | 694M | |
![[SND]](/icons/sound2.gif) | 23 Tribulation Inter..> | 2013-10-31 22:55 | 47M | |
![[SND]](/icons/sound2.gif) | 24 Tribulation Int 2..> | 2013-10-31 23:07 | 265K | |
![[SND]](/icons/sound2.gif) | vortexradio_131101_1..> | 2013-11-01 17:59 | 480M | |
![[SND]](/icons/sound2.gif) | 07 Repo Bus.wav | 2013-11-03 09:38 | 1.4M | |
![[SND]](/icons/sound2.gif) | hardyardsla_131103_2..> | 2013-11-03 19:00 | 565M | |
![[SND]](/icons/sound2.gif) | nlr_131103_220007_SR..> | 2013-11-03 21:00 | 553M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1311..> | 2013-11-03 22:29 | 595M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1311..> | 2013-11-04 15:00 | 543M | |
![[SND]](/icons/sound2.gif) | psych1on1_131104_200..> | 2013-11-04 19:00 | 553M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1311..> | 2013-11-04 20:03 | 575M | |
![[SND]](/icons/sound2.gif) | entrepreneur_131105_..> | 2013-11-05 11:03 | 559M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1311..> | 2013-11-05 16:00 | 626M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1311..> | 2013-11-06 19:00 | 577M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_131..> | 2013-11-06 22:00 | 616M | |
![[SND]](/icons/sound2.gif) | soundcloud_131107_21..> | 2013-11-07 20:02 | 3.7M | |
![[SND]](/icons/sound2.gif) | soundcloud_131107_21..> | 2013-11-07 20:02 | 385K | |
![[SND]](/icons/sound2.gif) | darkmark_131107_2110..> | 2013-11-07 20:10 | 575M | |
![[SND]](/icons/sound2.gif) | soundcloud_131107_21..> | 2013-11-07 20:16 | 47M | |
![[SND]](/icons/sound2.gif) | npr_131107_222921_SR..> | 2013-11-07 21:29 | 634M | |
![[SND]](/icons/sound2.gif) | vortexradio_131108_1..> | 2013-11-08 17:59 | 506M | |
![[SND]](/icons/sound2.gif) | 11 Samothrace Int 1.wav | 2013-11-09 17:34 | 51M | |
![[SND]](/icons/sound2.gif) | hardyardsla_131110_2..> | 2013-11-10 19:00 | 579M | |
![[SND]](/icons/sound2.gif) | nlr_131110_220022_SR..> | 2013-11-10 21:00 | 557M | |
![[SND]](/icons/sound2.gif) | psych1on1_131111_200..> | 2013-11-11 19:00 | 562M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1311..> | 2013-11-11 20:01 | 603M | |
![[SND]](/icons/sound2.gif) | entrepreneur_131112_..> | 2013-11-12 11:00 | 537M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1311..> | 2013-11-12 12:00 | 605M | |
![[SND]](/icons/sound2.gif) | 131112_184944_SRS001..> | 2013-11-12 17:49 | 529K | |
![[SND]](/icons/sound2.gif) | sarcasticnews_131113..> | 2013-11-13 20:00 | 561M | |
![[SND]](/icons/sound2.gif) | 131113_220015_SRS001..> | 2013-11-13 21:00 | 560M | |
![[SND]](/icons/sound2.gif) | darkmark_131114_2101..> | 2013-11-14 20:01 | 598M | |
![[SND]](/icons/sound2.gif) | npr_131114_221951_SR..> | 2013-11-14 21:19 | 794M | |
![[SND]](/icons/sound2.gif) | psych1on1_131115_142..> | 2013-11-15 13:20 | 565M | |
![[SND]](/icons/sound2.gif) | vortexradio_131115_1..> | 2013-11-15 18:00 | 711M | |
![[SND]](/icons/sound2.gif) | coachmiller_shorelin..> | 2013-11-15 21:32 | 8.8M | |
![[SND]](/icons/sound2.gif) | coachmiller_shorelin..> | 2013-11-15 21:33 | 9.7M | |
![[SND]](/icons/sound2.gif) | coachmiller_shorelin..> | 2013-11-15 21:34 | 9.4M | |
![[SND]](/icons/sound2.gif) | coachmiller_shorelin..> | 2013-11-15 21:35 | 673K | |
![[SND]](/icons/sound2.gif) | coachmiller_shorelin..> | 2013-11-15 21:35 | 8.4M | |
![[SND]](/icons/sound2.gif) | coachmiller_shorelin..> | 2013-11-15 21:36 | 9.6M | |
![[SND]](/icons/sound2.gif) | hardyardsla_131117_2..> | 2013-11-17 19:00 | 561M | |
![[SND]](/icons/sound2.gif) | nlr_131117_220113_SR..> | 2013-11-17 21:01 | 555M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1311..> | 2013-11-18 20:00 | 616M | |
![[SND]](/icons/sound2.gif) | entrepreneur_131119_..> | 2013-11-19 11:00 | 554M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1311..> | 2013-11-20 14:26 | 305M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1311..> | 2013-11-20 15:11 | 335M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1311..> | 2013-11-20 16:00 | 541M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1311..> | 2013-11-20 19:00 | 561M | |
![[SND]](/icons/sound2.gif) | sarcasticnews_131120..> | 2013-11-20 20:00 | 560M | |
![[SND]](/icons/sound2.gif) | intellectualkink_131..> | 2013-11-20 21:00 | 560M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_131..> | 2013-11-20 22:09 | 613M | |
![[SND]](/icons/sound2.gif) | darkmark_131121_2106..> | 2013-11-21 20:06 | 622M | |
![[SND]](/icons/sound2.gif) | npr_131121_221604_SR..> | 2013-11-21 21:16 | 664M | |
![[SND]](/icons/sound2.gif) | Criminal Hygiene - S..> | 2013-11-22 02:26 | 21M | |
![[SND]](/icons/sound2.gif) | Criminal Hygiene - B..> | 2013-11-22 02:27 | 36M | |
![[SND]](/icons/sound2.gif) | Criminal Hygiene - W..> | 2013-11-22 02:27 | 39M | |
![[SND]](/icons/sound2.gif) | vortexradio_131122_1..> | 2013-11-22 18:07 | 527M | |
![[SND]](/icons/sound2.gif) | 29 JFK Violent Revol..> | 2013-11-22 20:41 | 524K | |
![[SND]](/icons/sound2.gif) | 10 JFK Violent Revol..> | 2013-11-22 21:41 | 524K | |
![[SND]](/icons/sound2.gif) | 05 Kennedy Walter C.wav | 2013-11-22 21:48 | 5.0M | |
![[SND]](/icons/sound2.gif) | 08 JFK Death A Walte..> | 2013-11-22 22:06 | 3.3M | |
![[SND]](/icons/sound2.gif) | 07 JFK NBC Death.wav | 2013-11-22 22:10 | 3.9M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1311..> | 2013-11-23 11:00 | 636M | |
![[SND]](/icons/sound2.gif) | 49 Little Big Man I ..> | 2013-11-23 15:37 | 4.9M | |
![[SND]](/icons/sound2.gif) | 46 Lil Big Man White..> | 2013-11-23 15:43 | 1.8M | |
![[SND]](/icons/sound2.gif) | 38 Lil Big Man Limit..> | 2013-11-23 15:56 | 755K | |
![[SND]](/icons/sound2.gif) | 35 JFK Violent 2.wav | 2013-11-23 16:05 | 791K | |
![[SND]](/icons/sound2.gif) | 131123_190448_SRS001..> | 2013-11-23 18:04 | 4.4M | |
![[SND]](/icons/sound2.gif) | nlr_131124_220050_SR..> | 2013-11-24 21:00 | 555M | |
![[SND]](/icons/sound2.gif) | hardyardsla_131125_1..> | 2013-11-25 18:00 | 589M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1311..> | 2013-11-25 20:00 | 604M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1311..> | 2013-11-27 19:00 | 556M | |
![[SND]](/icons/sound2.gif) | sarcasticnews_131127..> | 2013-11-27 21:29 | 192M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_131..> | 2013-11-27 22:00 | 590M | |
![[SND]](/icons/sound2.gif) | intellectualkink_131..> | 2013-11-29 12:32 | 105M | |
![[SND]](/icons/sound2.gif) | vortexradio_131129_1..> | 2013-11-29 18:03 | 587M | |
![[SND]](/icons/sound2.gif) | 01 Heavy Metal Parki..> | 2013-11-30 19:26 | 2.4M | |
![[SND]](/icons/sound2.gif) | 05 Heavy Metal 2.wav | 2013-11-30 19:29 | 2.6M | |
![[SND]](/icons/sound2.gif) | 16Jimmy Carter Crisi..> | 2013-11-30 19:36 | 5.2M | |
![[SND]](/icons/sound2.gif) | 21 Jimmy Carter Gree..> | 2013-11-30 19:56 | 2.6M | |
![[SND]](/icons/sound2.gif) | 19 Toronto Mayor Cra..> | 2013-11-30 20:04 | 1.3M | |
![[SND]](/icons/sound2.gif) | 18 Coke Congressman.wav | 2013-11-30 20:09 | 1.6M | |
![[SND]](/icons/sound2.gif) | 25 Toronto Mayor Yes..> | 2013-11-30 20:17 | 197K | |
![[SND]](/icons/sound2.gif) | 35 Pilgrim interview..> | 2013-11-30 22:10 | 79M | |
![[SND]](/icons/sound2.gif) | 10 Rachet Ho Baby.wav | 2013-11-30 23:44 | 1.5M | |
![[SND]](/icons/sound2.gif) | 09 Rachet Ho theme.wav | 2013-11-30 23:46 | 458K | |
![[SND]](/icons/sound2.gif) | 14 Rachet Ho theme.wav | 2013-11-30 23:46 | 458K | |
![[SND]](/icons/sound2.gif) | 11 Rachet Ho More Bl..> | 2013-11-30 23:52 | 522K | |
![[SND]](/icons/sound2.gif) | 12 Rachet Ho Hepatit..> | 2013-11-30 23:56 | 672K | |
![[SND]](/icons/sound2.gif) | 13 Rachet Ho Port A ..> | 2013-11-30 23:59 | 1.2M | |
![[SND]](/icons/sound2.gif) | 23 The Howling Man D..> | 2013-12-01 00:10 | 1.8M | |
![[SND]](/icons/sound2.gif) | 38 The Howling Man D..> | 2013-12-01 00:10 | 1.8M | |
![[SND]](/icons/sound2.gif) | hardyardsla_131201_2..> | 2013-12-01 19:00 | 559M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1312..> | 2013-12-02 15:10 | 561M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1312..> | 2013-12-02 16:11 | 576M | |
![[SND]](/icons/sound2.gif) | psych1on1_131202_200..> | 2013-12-02 19:00 | 562M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1312..> | 2013-12-02 20:01 | 581M | |
![[SND]](/icons/sound2.gif) | entrepreneur_131203_..> | 2013-12-03 11:00 | 562M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1312..> | 2013-12-04 03:38 | 15M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1312..> | 2013-12-04 15:27 | 7.5M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1312..> | 2013-12-04 15:29 | 3.6M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1312..> | 2013-12-04 15:34 | 3.1M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1312..> | 2013-12-04 15:48 | 15M | |
![[SND]](/icons/sound2.gif) | sarcasticnews_131204..> | 2013-12-04 20:00 | 555M | |
![[SND]](/icons/sound2.gif) | intellectualkink_131..> | 2013-12-04 21:00 | 555M | |
![[SND]](/icons/sound2.gif) | 131205_004513_SRS001..> | 2013-12-04 23:45 | 577K | |
![[SND]](/icons/sound2.gif) | darkmark_131205_2100..> | 2013-12-05 20:00 | 608M | |
![[SND]](/icons/sound2.gif) | npr_131205_221253_SR..> | 2013-12-05 21:12 | 613M | |
![[SND]](/icons/sound2.gif) | 1 Mandela Death News..> | 2013-12-07 18:18 | 2.9M | |
![[SND]](/icons/sound2.gif) | 7 Mandela Death.wav | 2013-12-07 18:26 | 6.4M | |
![[SND]](/icons/sound2.gif) | 08 The Originators.wav | 2013-12-07 18:53 | 1.9M | |
![[SND]](/icons/sound2.gif) | 13 The Originators.wav | 2013-12-07 18:53 | 1.9M | |
![[SND]](/icons/sound2.gif) | 9 Obama Mandela.wav | 2013-12-07 19:23 | 5.3M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1312..> | 2013-12-08 15:56 | 33M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1312..> | 2013-12-08 16:00 | 297M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1312..> | 2013-12-08 16:30 | 266M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1312..> | 2013-12-08 16:57 | 323M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1312..> | 2013-12-08 17:31 | 265M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1312..> | 2013-12-08 17:59 | 310M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1312..> | 2013-12-08 18:30 | 315M | |
![[SND]](/icons/sound2.gif) | hardyardsla_131208_2..> | 2013-12-08 19:05 | 560M | |
![[SND]](/icons/sound2.gif) | nlr_131208_215959_SR..> | 2013-12-08 20:59 | 560M | |
![[SND]](/icons/sound2.gif) | psych1on1_131209_200..> | 2013-12-09 19:00 | 563M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1312..> | 2013-12-09 20:03 | 597M | |
![[SND]](/icons/sound2.gif) | entrepreneur_131210_..> | 2013-12-10 10:59 | 559M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1312..> | 2013-12-11 18:59 | 556M | |
![[SND]](/icons/sound2.gif) | sarcasticnews_131211..> | 2013-12-11 20:00 | 558M | |
![[SND]](/icons/sound2.gif) | intellectualkink_131..> | 2013-12-11 21:09 | 555M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_131..> | 2013-12-11 22:11 | 8.5M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_131..> | 2013-12-11 22:16 | 573M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1312..> | 2013-12-12 13:00 | 565M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1312..> | 2013-12-12 13:57 | 822M | |
![[SND]](/icons/sound2.gif) | nlr_131212_200038_SR..> | 2013-12-12 19:00 | 574M | |
![[SND]](/icons/sound2.gif) | darkmark_131212_2100..> | 2013-12-12 20:00 | 573M | |
![[SND]](/icons/sound2.gif) | npr_131212_215818_SR..> | 2013-12-12 20:58 | 8.8M | |
![[SND]](/icons/sound2.gif) | npr_131212_220036_SR..> | 2013-12-12 21:00 | 569M | |
![[SND]](/icons/sound2.gif) | itsburger_131212_230..> | 2013-12-12 22:00 | 561M | |
![[SND]](/icons/sound2.gif) | 01 Antartica.wav | 2013-12-14 11:18 | 2.6M | |
![[SND]](/icons/sound2.gif) | 03 Antartica 2.wav | 2013-12-14 11:22 | 2.9M | |
![[SND]](/icons/sound2.gif) | 04 Lars Antartica.wav | 2013-12-14 11:27 | 854K | |
![[SND]](/icons/sound2.gif) | 12 Lars Antartica.wav | 2013-12-14 11:27 | 854K | |
![[SND]](/icons/sound2.gif) | 11 Space 2001.wav | 2013-12-14 14:27 | 15M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1312..> | 2013-12-15 15:59 | 292M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1312..> | 2013-12-15 16:30 | 285M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1312..> | 2013-12-15 16:59 | 287M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1312..> | 2013-12-15 17:30 | 310M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1312..> | 2013-12-15 18:01 | 297M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1312..> | 2013-12-15 18:32 | 337M | |
![[SND]](/icons/sound2.gif) | hardyardsla_131216_1..> | 2013-12-16 18:00 | 561M | |
![[SND]](/icons/sound2.gif) | psych1on1_131216_200..> | 2013-12-16 19:00 | 572M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1312..> | 2013-12-16 20:01 | 590M | |
![[SND]](/icons/sound2.gif) | entrepreneur_131217_..> | 2013-12-17 11:00 | 580M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1312..> | 2013-12-18 19:00 | 557M | |
![[SND]](/icons/sound2.gif) | sarcasticnews_131218..> | 2013-12-18 20:00 | 555M | |
![[SND]](/icons/sound2.gif) | intellectualkink_131..> | 2013-12-18 21:00 | 555M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_131..> | 2013-12-18 22:05 | 607M | |
![[SND]](/icons/sound2.gif) | 10 Revised Originato..> | 2013-12-19 18:35 | 1.8M | |
![[SND]](/icons/sound2.gif) | 12 Revised Originato..> | 2013-12-19 18:35 | 1.8M | |
![[SND]](/icons/sound2.gif) | 16 Revised Originato..> | 2013-12-19 18:35 | 1.8M | |
![[SND]](/icons/sound2.gif) | 23 Revised Originato..> | 2013-12-19 18:35 | 1.8M | |
![[SND]](/icons/sound2.gif) | nlr_131219_190009_SR..> | 2013-12-19 19:00 | 559M | |
![[SND]](/icons/sound2.gif) | 04 Show intro Revise..> | 2013-12-19 19:35 | 1.8M | |
![[SND]](/icons/sound2.gif) | 05 Revised Originato..> | 2013-12-19 19:35 | 1.8M | |
![[SND]](/icons/sound2.gif) | 06 Revised Origina..> | 2013-12-19 19:35 | 1.8M | |
![[SND]](/icons/sound2.gif) | 07 Revised Originato..> | 2013-12-19 19:35 | 1.8M | |
![[SND]](/icons/sound2.gif) | 08 Revised Originato..> | 2013-12-19 19:35 | 1.8M | |
![[SND]](/icons/sound2.gif) | 9 Revised Originator..> | 2013-12-19 19:35 | 1.8M | |
![[SND]](/icons/sound2.gif) | 11 -Show intro Revis..> | 2013-12-19 19:35 | 1.8M | |
![[SND]](/icons/sound2.gif) | 11 Revised Originato..> | 2013-12-19 19:35 | 1.8M | |
![[SND]](/icons/sound2.gif) | 14 Revised Originato..> | 2013-12-19 19:35 | 1.8M | |
![[SND]](/icons/sound2.gif) | 15 Revised Originato..> | 2013-12-19 19:35 | 1.8M | |
![[SND]](/icons/sound2.gif) | 18 Revised Originato..> | 2013-12-19 19:35 | 1.8M | |
![[SND]](/icons/sound2.gif) | darkmark_131219_2010..> | 2013-12-19 20:10 | 605M | |
![[SND]](/icons/sound2.gif) | 131219_211651_SRS001..> | 2013-12-19 21:40 | 24M | |
![[SND]](/icons/sound2.gif) | imburger_131219_2200..> | 2013-12-19 22:00 | 569M | |
![[SND]](/icons/sound2.gif) | 02 Ted Nugent Kill P..> | 2013-12-19 22:40 | 835K | |
![[SND]](/icons/sound2.gif) | 03 Ted Nugent Dead O..> | 2013-12-19 22:43 | 303K | |
![[SND]](/icons/sound2.gif) | 05 Dexter Lion & Jac..> | 2013-12-19 22:47 | 430K | |
![[SND]](/icons/sound2.gif) | 01 Ian Watkins plead..> | 2013-12-19 22:51 | 5.0M | |
![[SND]](/icons/sound2.gif) | 12 Ian Watkins 2.wav | 2013-12-19 23:22 | 6.0M | |
![[SND]](/icons/sound2.gif) | 16 Ian Watkins 3.wav | 2013-12-20 11:08 | 1.2M | |
![[SND]](/icons/sound2.gif) | 11Santa List.wav | 2013-12-20 17:52 | 641K | |
![[SND]](/icons/sound2.gif) | vortexradio_131220_1..> | 2013-12-20 18:00 | 585M | |
![[SND]](/icons/sound2.gif) | 19 Dexter Pedofile.wav | 2013-12-20 18:00 | 4.6M | |
![[SND]](/icons/sound2.gif) | 10 Ian Watkins New.wav | 2013-12-20 18:33 | 5.0M | |
![[SND]](/icons/sound2.gif) | 38 Ian Watkins the b..> | 2013-12-20 18:38 | 2.5M | |
![[SND]](/icons/sound2.gif) | The Dark Mark Show P..> | 2013-12-21 16:53 | 4.0M | |
![[SND]](/icons/sound2.gif) | dark_mark-promo-1.wav | 2013-12-21 16:53 | 4.0M | |
![[SND]](/icons/sound2.gif) | 25 Yob Int 1.wav | 2013-12-21 20:33 | 54M | |
![[SND]](/icons/sound2.gif) | 29 Yob Int 2.wav | 2013-12-21 20:38 | 34M | |
![[SND]](/icons/sound2.gif) | psych1on1_131222_003..> | 2013-12-22 00:30 | 16M | |
![[SND]](/icons/sound2.gif) | psych1on1_131222_003..> | 2013-12-22 00:33 | 7.5M | |
![[SND]](/icons/sound2.gif) | psych1on1_131222_004..> | 2013-12-22 00:45 | 3.4M | |
![[SND]](/icons/sound2.gif) | nlr_131224_123226_SR..> | 2013-12-24 12:32 | 251M | |
![[SND]](/icons/sound2.gif) | nlr_131226_190649_SR..> | 2013-12-26 19:06 | 11M | |
![[SND]](/icons/sound2.gif) | nlr_131226_192137_SR..> | 2013-12-26 19:21 | 559M | |
![[SND]](/icons/sound2.gif) | 131226_202449_SRS001..> | 2013-12-26 20:27 | 6.5M | |
![[SND]](/icons/sound2.gif) | Neighborhood Love Ra..> | 2013-12-26 21:24 | 5.4M | |
![[SND]](/icons/sound2.gif) | nlr-promo-2.wav | 2013-12-26 21:24 | 5.4M | |
![[SND]](/icons/sound2.gif) | imburger_131226_2200..> | 2013-12-26 22:00 | 579M | |
![[SND]](/icons/sound2.gif) | vortexradio_131227_1..> | 2013-12-27 18:00 | 558M | |
![[SND]](/icons/sound2.gif) | 09 Deliverance Panit..> | 2013-12-28 10:27 | 7.6M | |
![[SND]](/icons/sound2.gif) | 13 Deliverance Pray.wav | 2013-12-28 10:40 | 1.9M | |
![[SND]](/icons/sound2.gif) | 25 Blast Interview.wav | 2013-12-28 11:45 | 89M | |
![[SND]](/icons/sound2.gif) | 11 Deliverance Sque..> | 2013-12-28 14:33 | 4.2M | |
![[SND]](/icons/sound2.gif) | 45 Deliverance Sque..> | 2013-12-28 14:33 | 4.2M | |
![[SND]](/icons/sound2.gif) | psych1on1_131230_190..> | 2013-12-30 19:00 | 563M | |
![[SND]](/icons/sound2.gif) | 131230_205613_SRS001..> | 2013-12-30 20:56 | 99M | |
![[SND]](/icons/sound2.gif) | nlr_140102_190007_SR..> | 2014-01-02 19:00 | 548M | |
![[SND]](/icons/sound2.gif) | darkmark_140102_2001..> | 2014-01-02 20:01 | 613M | |
![[SND]](/icons/sound2.gif) | imburger_140102_2202..> | 2014-01-02 22:02 | 569M | |
![[SND]](/icons/sound2.gif) | THE FUCKIN INTRO.wav | 2014-01-02 23:46 | 67M | |
![[SND]](/icons/sound2.gif) | RETOX ID.wav | 2014-01-03 20:53 | 1.1M | |
![[SND]](/icons/sound2.gif) | RETOX ID GOOF.wav | 2014-01-03 20:53 | 1.7M | |
![[SND]](/icons/sound2.gif) | MELT BANANA HERE'S D..> | 2014-01-03 20:54 | 648K | |
![[SND]](/icons/sound2.gif) | 400 BLOWS ID.wav | 2014-01-03 20:54 | 2.7M | |
![[SND]](/icons/sound2.gif) | DAN'S BALLS.wav | 2014-01-03 20:57 | 373K | |
![[SND]](/icons/sound2.gif) | THERE'S NOTHING BETT..> | 2014-01-03 20:58 | 511K | |
![[SND]](/icons/sound2.gif) | SO SORE I CAN BARELY..> | 2014-01-03 20:59 | 787K | |
![[SND]](/icons/sound2.gif) | PLAY IT AGAIN DAN.wav | 2014-01-03 21:00 | 207K | |
![[SND]](/icons/sound2.gif) | OH THAT WAS HARD.wav | 2014-01-03 21:00 | 264K | |
![[SND]](/icons/sound2.gif) | NOTHIN SENDS ME OFF ..> | 2014-01-03 21:01 | 747K | |
![[SND]](/icons/sound2.gif) | MMM, BALLS.wav | 2014-01-03 21:02 | 253K | |
![[SND]](/icons/sound2.gif) | I LIKE THE WAY THAT ..> | 2014-01-03 21:02 | 494K | |
![[SND]](/icons/sound2.gif) | I LIKE A BIG POC.wav | 2014-01-03 21:03 | 494K | |
![[SND]](/icons/sound2.gif) | DAN WHY DON'T YOU LO..> | 2014-01-03 21:04 | 448K | |
![[SND]](/icons/sound2.gif) | BETTER GET SOME MAYO..> | 2014-01-03 21:04 | 505K | |
![[SND]](/icons/sound2.gif) | TIME TO PLUG IN CURL..> | 2014-01-03 21:05 | 597K | |
![[SND]](/icons/sound2.gif) | TAKING MY BRA OFF.wav | 2014-01-03 21:06 | 597K | |
![[SND]](/icons/sound2.gif) | TURNED WINE INTO FRI..> | 2014-01-03 21:08 | 930K | |
![[SND]](/icons/sound2.gif) | MOSES WAS GOOD AT SP..> | 2014-01-03 21:09 | 810K | |
![[SND]](/icons/sound2.gif) | DAN FACT - PANDAS.wav | 2014-01-03 21:11 | 1.4M | |
![[SND]](/icons/sound2.gif) | DAN FACT - BASS PLAY..> | 2014-01-03 21:12 | 856K | |
![[SND]](/icons/sound2.gif) | DAN FACT - CLINT EAS..> | 2014-01-03 21:13 | 1.4M | |
![[SND]](/icons/sound2.gif) | DAN FACT - NICKLES.wav | 2014-01-03 21:14 | 649K | |
![[SND]](/icons/sound2.gif) | 21 Nausea Int 2014.wav | 2014-01-04 13:19 | 51M | |
![[SND]](/icons/sound2.gif) | 24 Nausea Int 2.wav | 2014-01-04 13:29 | 66M | |
![[SND]](/icons/sound2.gif) | 29 eye interview 1.wav | 2014-01-04 17:08 | 41M | |
![[SND]](/icons/sound2.gif) | 34 eye 2.wav | 2014-01-04 17:14 | 47M | |
![[SND]](/icons/sound2.gif) | The Matador and The ..> | 2014-01-04 19:07 | 70M | |
![[SND]](/icons/sound2.gif) | Cool Water_9412.wav | 2014-01-04 19:12 | 32M | |
![[SND]](/icons/sound2.gif) | 1) Hellbound (Theme ..> | 2014-01-04 19:13 | 25M | |
![[SND]](/icons/sound2.gif) | hardyardsla_140105_1..> | 2014-01-05 19:00 | 561M | |
![[SND]](/icons/sound2.gif) | sexendipity_140105_2..> | 2014-01-05 20:03 | 516M | |
![[SND]](/icons/sound2.gif) | 18 MAKES ME JAILBAIT..> | 2014-01-06 14:11 | 448K | |
![[SND]](/icons/sound2.gif) | EXCELLENT.wav | 2014-01-06 14:11 | 373K | |
![[SND]](/icons/sound2.gif) | CMON DANIEL ROLL THE..> | 2014-01-06 14:12 | 287K | |
![[SND]](/icons/sound2.gif) | GOD LED ZEPPELIN.wav | 2014-01-06 14:12 | 1.6M | |
![[SND]](/icons/sound2.gif) | HEY DANIEL D AND D.wav | 2014-01-06 14:13 | 454K | |
![[SND]](/icons/sound2.gif) | HOT JAMBALAYA.wav | 2014-01-06 14:13 | 213K | |
![[SND]](/icons/sound2.gif) | I SAW HER SUCKIN ON ..> | 2014-01-06 14:16 | 620K | |
![[SND]](/icons/sound2.gif) | INCREDIBLE SEX DEATH..> | 2014-01-06 14:17 | 2.0M | |
![[SND]](/icons/sound2.gif) | MAYBE YOULL GET LUCK..> | 2014-01-06 14:19 | 442K | |
![[SND]](/icons/sound2.gif) | NO I AM NOT HIGH.wav | 2014-01-06 14:19 | 287K | |
![[SND]](/icons/sound2.gif) | NO NO NO.wav | 2014-01-06 14:20 | 270K | |
![[SND]](/icons/sound2.gif) | NO STEVE CARELL.wav | 2014-01-06 14:21 | 500K | |
![[SND]](/icons/sound2.gif) | NOOO.wav | 2014-01-06 14:22 | 218K | |
![[SND]](/icons/sound2.gif) | I'M NOT GONNA BE IGN..> | 2014-01-06 14:23 | 362K | |
![[SND]](/icons/sound2.gif) | SANTANA BAND NAME.wav | 2014-01-06 14:24 | 2.6M | |
![[SND]](/icons/sound2.gif) | DANIEL THE WHOLE TIM..> | 2014-01-06 14:25 | 1.5M | |
![[SND]](/icons/sound2.gif) | THEY'RE ALL GONNA LA..> | 2014-01-06 14:27 | 879K | |
![[SND]](/icons/sound2.gif) | TOURETTES DICKS.wav | 2014-01-06 14:27 | 339K | |
![[SND]](/icons/sound2.gif) | TOURETTES PIECE OF S..> | 2014-01-06 14:28 | 540K | |
![[SND]](/icons/sound2.gif) | TOURETTES ASSHOLE.wav | 2014-01-06 14:31 | 178K | |
![[SND]](/icons/sound2.gif) | TOURETTES BITCH I LO..> | 2014-01-06 14:31 | 523K | |
![[SND]](/icons/sound2.gif) | TOURETTES CHEWBACCA.wav | 2014-01-06 14:32 | 637K | |
![[SND]](/icons/sound2.gif) | TOURETTES TALK ABOUT..> | 2014-01-06 14:34 | 925K | |
![[SND]](/icons/sound2.gif) | TOURETTES FUCK YOU.wav | 2014-01-06 14:35 | 132K | |
![[SND]](/icons/sound2.gif) | ANSWER THE PHONE.wav | 2014-01-06 14:36 | 660K | |
![[SND]](/icons/sound2.gif) | TOURETTES FUCKED IN ..> | 2014-01-06 14:37 | 442K | |
![[SND]](/icons/sound2.gif) | I DONT HAVE A DICK Y..> | 2014-01-06 14:37 | 345K | |
![[SND]](/icons/sound2.gif) | I GOTTA TAKE A PISS.wav | 2014-01-06 14:37 | 195K | |
![[SND]](/icons/sound2.gif) | I'll KICK YOU IN THE..> | 2014-01-06 14:38 | 362K | |
![[SND]](/icons/sound2.gif) | TOURETTES BOB SAGET.wav | 2014-01-06 14:39 | 276K | |
![[SND]](/icons/sound2.gif) | TOURETTES OH SHIT.wav | 2014-01-06 14:39 | 218K | |
![[SND]](/icons/sound2.gif) | TOURETTES BIGFOOT.wav | 2014-01-06 14:41 | 391K | |
![[SND]](/icons/sound2.gif) | DANIEL WATCH OUT HE'..> | 2014-01-06 14:42 | 620K | |
![[SND]](/icons/sound2.gif) | WHY ARE YOU DRESSED ..> | 2014-01-06 14:42 | 500K | |
![[SND]](/icons/sound2.gif) | Savages - Part 1_Mix..> | 2014-01-06 17:27 | 31M | |
![[SND]](/icons/sound2.gif) | psych1on1_140106_190..> | 2014-01-06 19:00 | 564M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1401..> | 2014-01-06 20:00 | 613M | |
![[SND]](/icons/sound2.gif) | apintofcacophony_140..> | 2014-01-06 22:59 | 643M | |
![[SND]](/icons/sound2.gif) | entrepreneur_140107_..> | 2014-01-07 11:00 | 559M | |
![[SND]](/icons/sound2.gif) | 16 Behold! The Monol..> | 2014-01-08 08:35 | 82M | |
![[SND]](/icons/sound2.gif) | 33 Behold! The Monol..> | 2014-01-08 08:35 | 82M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1401..> | 2014-01-08 19:00 | 575M | |
![[SND]](/icons/sound2.gif) | House of Wolves - Ro..> | 2014-01-08 19:49 | 36M | |
![[SND]](/icons/sound2.gif) | Royal_Blood_Mix_01.wav | 2014-01-08 20:49 | 36M | |
![[SND]](/icons/sound2.gif) | intellectualkink_140..> | 2014-01-08 21:00 | 556M | |
![[SND]](/icons/sound2.gif) | nlr_140109_185956_SR..> | 2014-01-09 18:59 | 557M | |
![[SND]](/icons/sound2.gif) | darkmark_140109_2003..> | 2014-01-09 20:03 | 574M | |
![[SND]](/icons/sound2.gif) | npr_140109_210843_SR..> | 2014-01-09 21:08 | 570M | |
![[SND]](/icons/sound2.gif) | imburger_140109_2209..> | 2014-01-09 22:09 | 566M | |
![[SND]](/icons/sound2.gif) | 22 Lose a Homebody.wav | 2014-01-11 12:48 | 1.8M | |
![[SND]](/icons/sound2.gif) | 19 History of El Bar..> | 2014-01-11 12:53 | 465K | |
![[SND]](/icons/sound2.gif) | 35 History of El Bar..> | 2014-01-11 12:53 | 465K | |
![[SND]](/icons/sound2.gif) | 25 Neighboorhood Fuc..> | 2014-01-11 13:51 | 774K | |
![[SND]](/icons/sound2.gif) | Neighboorhood Fuck Y..> | 2014-01-11 13:51 | 774K | |
![[SND]](/icons/sound2.gif) | 24 Entety - Cadaveri..> | 2014-01-11 14:19 | 29M | |
![[SND]](/icons/sound2.gif) | 30 Corrections House..> | 2014-01-11 14:39 | 50M | |
![[SND]](/icons/sound2.gif) | 34 Corrections House..> | 2014-01-11 15:07 | 40M | |
![[SND]](/icons/sound2.gif) | hardyardsla_140112_1..> | 2014-01-12 19:00 | 551M | |
![[SND]](/icons/sound2.gif) | sexendipity_140112_2..> | 2014-01-12 20:01 | 559M | |
![[SND]](/icons/sound2.gif) | psych1on1_140113_190..> | 2014-01-13 19:00 | 562M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1401..> | 2014-01-13 20:01 | 589M | |
![[SND]](/icons/sound2.gif) | apintofcacophony_140..> | 2014-01-13 23:05 | 560M | |
![[SND]](/icons/sound2.gif) | entrepreneur_140114_..> | 2014-01-14 11:00 | 561M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1401..> | 2014-01-14 19:29 | 592M | |
![[SND]](/icons/sound2.gif) | Skating Polly - Dead..> | 2014-01-15 14:10 | 37M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1401..> | 2014-01-15 18:59 | 555M | |
![[SND]](/icons/sound2.gif) | sarcasticnews_140115..> | 2014-01-15 20:00 | 557M | |
![[SND]](/icons/sound2.gif) | intellectualkink_140..> | 2014-01-15 21:00 | 556M | |
![[SND]](/icons/sound2.gif) | nlr_140116_185959_SR..> | 2014-01-16 18:59 | 554M | |
![[SND]](/icons/sound2.gif) | darkmark_140116_2007..> | 2014-01-16 20:07 | 545M | |
![[SND]](/icons/sound2.gif) | 5 Kelly Mom and Dad.wav | 2014-01-16 20:58 | 3.2M | |
![[SND]](/icons/sound2.gif) | 46 Kelly Mom and Dad..> | 2014-01-16 20:58 | 3.2M | |
![[SND]](/icons/sound2.gif) | npr_140116_210634_SR..> | 2014-01-16 21:06 | 585M | |
![[SND]](/icons/sound2.gif) | 3 Peace Officers Wor..> | 2014-01-16 21:08 | 946K | |
![[SND]](/icons/sound2.gif) | 2 Kelly T News 2.wav | 2014-01-16 21:12 | 1.3M | |
![[SND]](/icons/sound2.gif) | 4 Kelly T Beating.wav | 2014-01-16 21:19 | 1.4M | |
![[SND]](/icons/sound2.gif) | 01 Warning Graphic V..> | 2014-01-16 21:21 | 375K | |
![[SND]](/icons/sound2.gif) | 1 Warning Graphic V.wav | 2014-01-16 21:21 | 375K | |
![[SND]](/icons/sound2.gif) | 1Warning Graphic V.wav | 2014-01-16 21:21 | 375K | |
![[SND]](/icons/sound2.gif) | 10 Kelly Mom Beat to..> | 2014-01-16 21:29 | 787K | |
![[SND]](/icons/sound2.gif) | 12 Kelly dad save hi..> | 2014-01-16 21:32 | 1.4M | |
![[SND]](/icons/sound2.gif) | 15 Kelly Witness Mur..> | 2014-01-16 21:47 | 933K | |
![[SND]](/icons/sound2.gif) | 26 Kelly dad beat to..> | 2014-01-16 21:53 | 480K | |
![[SND]](/icons/sound2.gif) | imburger_140116_2211..> | 2014-01-16 22:11 | 566M | |
![[SND]](/icons/sound2.gif) | 28 Kelly they will g..> | 2014-01-16 22:24 | 2.2M | |
![[SND]](/icons/sound2.gif) | 56 Kill your boss.wav | 2014-01-16 22:32 | 3.2M | |
![[SND]](/icons/sound2.gif) | 21 Kelly Thoma Jury..> | 2014-01-18 21:02 | 3.5M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1401..> | 2014-01-19 18:00 | 478M | |
![[SND]](/icons/sound2.gif) | sexendipity_140119_2..> | 2014-01-19 20:00 | 576M | |
![[SND]](/icons/sound2.gif) | Well Hung Heart - Bl..> | 2014-01-20 01:44 | 31M | |
![[SND]](/icons/sound2.gif) | Well Hung Heart - Co..> | 2014-01-20 01:44 | 37M | |
![[SND]](/icons/sound2.gif) | Well Hung Heart - I ..> | 2014-01-20 02:44 | 26M | |
![[SND]](/icons/sound2.gif) | hardyardsla_140120_1..> | 2014-01-20 17:00 | 446M | |
![[SND]](/icons/sound2.gif) | psych1on1_140120_190..> | 2014-01-20 19:00 | 559M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1401..> | 2014-01-20 20:03 | 583M | |
![[SND]](/icons/sound2.gif) | apintofcacophony_140..> | 2014-01-20 23:04 | 614M | |
![[SND]](/icons/sound2.gif) | thesweetrelease_prom..> | 2014-01-21 19:39 | 35M | |
![[SND]](/icons/sound2.gif) | thesweetrelease_prom..> | 2014-01-21 19:48 | 214M | |
![[SND]](/icons/sound2.gif) | sexendipity_140121_2..> | 2014-01-21 20:42 | 6.7M | |
![[SND]](/icons/sound2.gif) | sexendipity_140121_2..> | 2014-01-21 20:43 | 9.0M | |
![[SND]](/icons/sound2.gif) | sexendipity_140121_2..> | 2014-01-21 20:46 | 5.5M | |
![[SND]](/icons/sound2.gif) | sexendipity_140121_2..> | 2014-01-21 20:47 | 8.1M | |
![[SND]](/icons/sound2.gif) | sexendipity_140121_2..> | 2014-01-21 20:49 | 9.4M | |
![[SND]](/icons/sound2.gif) | sexendipity_140121_2..> | 2014-01-21 20:50 | 7.2M | |
![[SND]](/icons/sound2.gif) | sweetrelease_140121_..> | 2014-01-21 20:55 | 5.2M | |
![[SND]](/icons/sound2.gif) | sweetrelease_140121_..> | 2014-01-21 20:56 | 3.7M | |
![[SND]](/icons/sound2.gif) | sweetrelease_140121_..> | 2014-01-21 20:57 | 7.5M | |
![[SND]](/icons/sound2.gif) | sweetrelease_140121_..> | 2014-01-21 20:59 | 7.7M | |
![[SND]](/icons/sound2.gif) | 01 Aids Tax.wav | 2014-01-22 18:45 | 27M | |
![[SND]](/icons/sound2.gif) | 02 Communist Picnic.wav | 2014-01-22 18:45 | 27M | |
![[SND]](/icons/sound2.gif) | 03 Green Powered Ene..> | 2014-01-22 18:46 | 27M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1401..> | 2014-01-22 19:00 | 555M | |
![[SND]](/icons/sound2.gif) | sarcasticnews_140122..> | 2014-01-22 20:09 | 472M | |
![[SND]](/icons/sound2.gif) | intellectualkink_140..> | 2014-01-22 21:02 | 561M | |
![[SND]](/icons/sound2.gif) | gingerauctionsmonday..> | 2014-01-23 06:47 | 6.2M | |
![[SND]](/icons/sound2.gif) | gingerauctions1_1401..> | 2014-01-23 14:40 | 13M | |
![[SND]](/icons/sound2.gif) | gingerauctions2_1401..> | 2014-01-23 14:42 | 3.6M | |
![[SND]](/icons/sound2.gif) | gingerauctionsmonday..> | 2014-01-23 14:46 | 5.9M | |
![[SND]](/icons/sound2.gif) | gingerauctionsmonday..> | 2014-01-23 14:46 | 8.3M | |
![[SND]](/icons/sound2.gif) | gingerauctionsmonday..> | 2014-01-23 14:47 | 6.8M | |
![[SND]](/icons/sound2.gif) | gingertuesday_140123..> | 2014-01-23 14:49 | 8.4M | |
![[SND]](/icons/sound2.gif) | gingerweds_140123_14..> | 2014-01-23 14:51 | 5.1M | |
![[SND]](/icons/sound2.gif) | gingerweds_140123_14..> | 2014-01-23 14:51 | 3.6M | |
![[SND]](/icons/sound2.gif) | gingerweds_140123_14..> | 2014-01-23 14:52 | 7.4M | |
![[SND]](/icons/sound2.gif) | gingerweds_140123_14..> | 2014-01-23 14:53 | 6.2M | |
![[SND]](/icons/sound2.gif) | gingerweds_140123_14..> | 2014-01-23 14:53 | 9.0M | |
![[SND]](/icons/sound2.gif) | gingertuesday_140123..> | 2014-01-23 14:55 | 7.4M | |
![[SND]](/icons/sound2.gif) | gingerthu_140123_145..> | 2014-01-23 14:56 | 2.1M | |
![[SND]](/icons/sound2.gif) | gingerthu_140123_145..> | 2014-01-23 14:57 | 8.3M | |
![[SND]](/icons/sound2.gif) | gingerfri_140123_145..> | 2014-01-23 14:58 | 8.0M | |
![[SND]](/icons/sound2.gif) | gingerpromo_140123_1..> | 2014-01-23 15:06 | 26M | |
![[SND]](/icons/sound2.gif) | gingerpromo_140123_1..> | 2014-01-23 15:09 | 6.4M | |
![[SND]](/icons/sound2.gif) | gingerpromo_140123_1..> | 2014-01-23 15:09 | 17M | |
![[SND]](/icons/sound2.gif) | ginger_promo1.wav | 2014-01-23 15:18 | 14M | |
![[SND]](/icons/sound2.gif) | ginger_weds.wav | 2014-01-23 15:24 | 8.2M | |
![[SND]](/icons/sound2.gif) | ginger_tues.wav | 2014-01-23 15:26 | 6.8M | |
![[SND]](/icons/sound2.gif) | ginger_thurs.wav | 2014-01-23 15:29 | 7.3M | |
![[SND]](/icons/sound2.gif) | ginger_fri.wav | 2014-01-23 15:31 | 6.7M | |
![[SND]](/icons/sound2.gif) | ginger_mon.wav | 2014-01-23 15:34 | 5.9M | |
![[SND]](/icons/sound2.gif) | ginger_auctions_prom..> | 2014-01-23 15:39 | 2.2M | |
![[SND]](/icons/sound2.gif) | ginger_auctions_prom..> | 2014-01-23 15:48 | 9.6M | |
![[SND]](/icons/sound2.gif) | imburger_140123_2202..> | 2014-01-23 16:00 | 566M | |
![[SND]](/icons/sound2.gif) | Blame It On Ginger A..> | 2014-01-23 16:15 | 11M | |
![[SND]](/icons/sound2.gif) | ginger_auctions_prom..> | 2014-01-23 16:15 | 11M | |
![[SND]](/icons/sound2.gif) | Blame It On Ginger A..> | 2014-01-23 16:23 | 2.6M | |
![[SND]](/icons/sound2.gif) | ginger_auctions_prom..> | 2014-01-23 16:23 | 2.6M | |
![[SND]](/icons/sound2.gif) | Blame It On Ginger W..> | 2014-01-23 16:27 | 9.9M | |
![[SND]](/icons/sound2.gif) | ginger_weds_final.wav | 2014-01-23 16:27 | 9.9M | |
![[SND]](/icons/sound2.gif) | Blame It On Ginger T..> | 2014-01-23 16:35 | 7.8M | |
![[SND]](/icons/sound2.gif) | ginger_tues_final.wav | 2014-01-23 16:35 | 7.8M | |
![[SND]](/icons/sound2.gif) | Blame It On Ginger T..> | 2014-01-23 16:38 | 7.9M | |
![[SND]](/icons/sound2.gif) | ginger_thurs_final.wav | 2014-01-23 16:38 | 7.9M | |
![[SND]](/icons/sound2.gif) | Blame It On Ginger P..> | 2014-01-23 16:54 | 16M | |
![[SND]](/icons/sound2.gif) | ginger_promo1_final.wav | 2014-01-23 16:54 | 16M | |
![[SND]](/icons/sound2.gif) | nlr_140123_190005_SR..> | 2014-01-23 19:00 | 552M | |
![[SND]](/icons/sound2.gif) | darkmark_140123_2000..> | 2014-01-23 20:00 | 561M | |
![[SND]](/icons/sound2.gif) | npr_140123_210158_SR..> | 2014-01-23 21:01 | 569M | |
![[SND]](/icons/sound2.gif) | 40 Opener Supersonic..> | 2014-01-23 23:00 | 34M | |
![[SND]](/icons/sound2.gif) | 27 Dick and B alls S..> | 2014-01-23 23:28 | 9.0M | |
![[SND]](/icons/sound2.gif) | 21 drughammer final.wav | 2014-01-24 14:11 | 80M | |
![[SND]](/icons/sound2.gif) | 51 drughammer final.wav | 2014-01-24 14:11 | 80M | |
![[SND]](/icons/sound2.gif) | 18 Japanese Nuclear ..> | 2014-01-25 12:35 | 3.4M | |
![[SND]](/icons/sound2.gif) | 09 The Sapphires Whe..> | 2014-01-25 14:29 | 12M | |
![[SND]](/icons/sound2.gif) | 02where is Johnny.wav | 2014-01-25 14:38 | 2.2M | |
![[SND]](/icons/sound2.gif) | 08 Where is Johnny 2..> | 2014-01-25 17:18 | 235K | |
![[SND]](/icons/sound2.gif) | 06 Where is Johnny 3..> | 2014-01-25 17:23 | 239K | |
![[SND]](/icons/sound2.gif) | Blame It On Ginger M..> | 2014-01-25 21:31 | 6.8M | |
![[SND]](/icons/sound2.gif) | ginger_mon_final.wav | 2014-01-25 21:31 | 6.8M | |
![[SND]](/icons/sound2.gif) | Blame It On Ginger F..> | 2014-01-25 21:33 | 7.3M | |
![[SND]](/icons/sound2.gif) | ginger_fri_final.wav | 2014-01-25 21:33 | 7.3M | |
![[SND]](/icons/sound2.gif) | Criminal Hygiene - R..> | 2014-01-26 12:08 | 21M | |
![[SND]](/icons/sound2.gif) | Dagos - Dinosaurs R ..> | 2014-01-26 12:22 | 40M | |
![[SND]](/icons/sound2.gif) | sweetrelease_140126_..> | 2014-01-26 17:33 | 15M | |
![[SND]](/icons/sound2.gif) | sweetrelease_140126_..> | 2014-01-26 17:35 | 180M | |
![[SND]](/icons/sound2.gif) | sexendipity_140126_1..> | 2014-01-26 18:02 | 572M | |
![[SND]](/icons/sound2.gif) | hardyardsla_140126_1..> | 2014-01-26 19:01 | 541M | |
![[SND]](/icons/sound2.gif) | sexendipity_140126_2..> | 2014-01-26 20:00 | 580M | |
![[SND]](/icons/sound2.gif) | psych1on1_140127_190..> | 2014-01-27 19:00 | 561M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1401..> | 2014-01-27 20:03 | 582M | |
![[SND]](/icons/sound2.gif) | apintofcacophony_140..> | 2014-01-27 23:06 | 594M | |
![[SND]](/icons/sound2.gif) | entrepreneur_140128_..> | 2014-01-28 10:59 | 558M | |
![[SND]](/icons/sound2.gif) | 140129_114809_SRS001..> | 2014-01-29 11:48 | 529K | |
![[SND]](/icons/sound2.gif) | 140129_124256_SRS001..> | 2014-01-29 12:42 | 601K | |
![[SND]](/icons/sound2.gif) | FredoOrtiz.wav | 2014-01-29 14:29 | 290M | |
![[SND]](/icons/sound2.gif) | billkelliher-mastodo..> | 2014-01-29 14:39 | 206M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1401..> | 2014-01-29 18:59 | 558M | |
![[SND]](/icons/sound2.gif) | sarcasticnews_140129..> | 2014-01-29 20:03 | 566M | |
![[SND]](/icons/sound2.gif) | intellectualkink_140..> | 2014-01-29 21:00 | 556M | |
![[SND]](/icons/sound2.gif) | nlr_140130_190026_SR..> | 2014-01-30 19:00 | 552M | |
![[SND]](/icons/sound2.gif) | npr_140130_210013_SR..> | 2014-01-30 21:00 | 599M | |
![[SND]](/icons/sound2.gif) | Blaak Heat Shujaa Li..> | 2014-01-31 11:27 | 2.1M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1401..> | 2014-01-31 14:31 | 860M | |
![[SND]](/icons/sound2.gif) | sweetrelease_140202_..> | 2014-02-02 18:01 | 548M | |
![[SND]](/icons/sound2.gif) | sexendipity_140202_1..> | 2014-02-02 19:59 | 592M | |
![[SND]](/icons/sound2.gif) | No Small Children - ..> | 2014-02-03 18:51 | 38M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1402..> | 2014-02-03 20:00 | 597M | |
![[SND]](/icons/sound2.gif) | apintofcacophony_140..> | 2014-02-03 23:05 | 603M | |
![[SND]](/icons/sound2.gif) | 140204_160105_SRS001..> | 2014-02-04 16:01 | 433K | |
![[SND]](/icons/sound2.gif) | 02 What Would Ginger..> | 2014-02-04 16:20 | 33M | |
![[SND]](/icons/sound2.gif) | blameginger_140205_1..> | 2014-02-05 16:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1402..> | 2014-02-05 18:59 | 558M | |
![[SND]](/icons/sound2.gif) | sarcasticnews_140205..> | 2014-02-05 20:01 | 556M | |
![[SND]](/icons/sound2.gif) | intellectualkink_140..> | 2014-02-05 21:01 | 556M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_140..> | 2014-02-05 22:06 | 586M | |
![[SND]](/icons/sound2.gif) | 140205_231429_SRS001..> | 2014-02-05 23:14 | 505K | |
![[SND]](/icons/sound2.gif) | blameginger_140206_1..> | 2014-02-06 15:59 | 1.1G | |
![[SND]](/icons/sound2.gif) | nlr_140206_190004_SR..> | 2014-02-06 19:00 | 550M | |
![[SND]](/icons/sound2.gif) | darkmark_140206_2001..> | 2014-02-06 20:01 | 557M | |
![[SND]](/icons/sound2.gif) | npr_140206_210414_SR..> | 2014-02-06 21:04 | 578M | |
![[SND]](/icons/sound2.gif) | imburger_140206_2204..> | 2014-02-06 22:04 | 593M | |
![[SND]](/icons/sound2.gif) | blameginger_140207_1..> | 2014-02-07 15:59 | 1.1G | |
![[SND]](/icons/sound2.gif) | timeoutcoach_140207_..> | 2014-02-07 21:59 | 1.2G | |
![[SND]](/icons/sound2.gif) | 02 The Oscars Philli..> | 2014-02-08 20:19 | 789K | |
![[SND]](/icons/sound2.gif) | 03 I just Sharted Ph..> | 2014-02-08 20:23 | 1.3M | |
![[SND]](/icons/sound2.gif) | 06 Sex Call 2 Philli..> | 2014-02-08 20:29 | 5.2M | |
![[SND]](/icons/sound2.gif) | 05 Sex Call Phillip..> | 2014-02-08 20:32 | 2.4M | |
![[SND]](/icons/sound2.gif) | 12 - Shallow Ground.wav | 2014-02-08 20:51 | 23M | |
![[SND]](/icons/sound2.gif) | 04 Can I Kiss You Ph..> | 2014-02-08 21:13 | 3.4M | |
![[SND]](/icons/sound2.gif) | 17 Od Phillip.wav | 2014-02-08 21:24 | 1.2M | |
![[SND]](/icons/sound2.gif) | 34 Od Phillip.wav | 2014-02-08 21:24 | 1.2M | |
![[SND]](/icons/sound2.gif) | 10 overdose P.wav | 2014-02-08 21:32 | 1.4M | |
![[SND]](/icons/sound2.gif) | 09 od 3.wav | 2014-02-08 21:45 | 1.8M | |
![[SND]](/icons/sound2.gif) | 23 Cum Squirts Phill..> | 2014-02-08 22:01 | 3.8M | |
![[SND]](/icons/sound2.gif) | 24 Cum Squirts Phill..> | 2014-02-08 22:01 | 3.8M | |
![[SND]](/icons/sound2.gif) | 22 Shut The Fuck Up.wav | 2014-02-08 22:51 | 1.3M | |
![[SND]](/icons/sound2.gif) | 42 Shut The Fuck Up..> | 2014-02-08 22:51 | 1.3M | |
![[SND]](/icons/sound2.gif) | 09 Boring.wav | 2014-02-08 22:57 | 2.3M | |
![[SND]](/icons/sound2.gif) | 27 Boring.wav | 2014-02-08 22:57 | 2.3M | |
![[SND]](/icons/sound2.gif) | 37 Boring.wav | 2014-02-08 22:57 | 2.3M | |
![[SND]](/icons/sound2.gif) | verymanic_140209_130..> | 2014-02-09 13:00 | 1.8G | |
![[SND]](/icons/sound2.gif) | sweetrelease_140209_..> | 2014-02-09 18:00 | 595M | |
![[SND]](/icons/sound2.gif) | Cutty Flam - Sugga S..> | 2014-02-09 18:47 | 61M | |
![[SND]](/icons/sound2.gif) | Cutty Flam -Do You W..> | 2014-02-09 18:47 | 36M | |
![[SND]](/icons/sound2.gif) | Cutty Flam - Holy No..> | 2014-02-09 18:48 | 52M | |
![[SND]](/icons/sound2.gif) | Cutty Flam - Robot H..> | 2014-02-09 18:48 | 55M | |
![[SND]](/icons/sound2.gif) | hardyardsla_140209_1..> | 2014-02-09 19:00 | 537M | |
![[SND]](/icons/sound2.gif) | 1_SuggaSugga.wav | 2014-02-09 19:47 | 61M | |
![[SND]](/icons/sound2.gif) | 7_Do You Wanna_v2.wav | 2014-02-09 19:47 | 36M | |
![[SND]](/icons/sound2.gif) | Cutty Flam - See Me ..> | 2014-02-09 19:47 | 36M | |
![[SND]](/icons/sound2.gif) | 2_ Holy Nothing.wav | 2014-02-09 19:48 | 52M | |
![[SND]](/icons/sound2.gif) | 6_Robot Heart.wav | 2014-02-09 19:48 | 55M | |
![[SND]](/icons/sound2.gif) | 5_Hubba Bubba_v2.wav | 2014-02-09 19:48 | 51M | |
![[SND]](/icons/sound2.gif) | Cutty Flam - Hubba B..> | 2014-02-09 19:48 | 51M | |
![[SND]](/icons/sound2.gif) | sexendipity_140209_2..> | 2014-02-09 20:00 | 580M | |
![[SND]](/icons/sound2.gif) | Blame It On Ginger -..> | 2014-02-10 15:50 | 10M | |
![[SND]](/icons/sound2.gif) | biog_suzysdelights_1..> | 2014-02-10 15:50 | 10M | |
![[SND]](/icons/sound2.gif) | blameginger_140210_1..> | 2014-02-10 16:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | psych1on1_140210_190..> | 2014-02-10 19:00 | 532M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1402..> | 2014-02-10 21:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | apintofcacophony_140..> | 2014-02-10 23:06 | 596M | |
![[SND]](/icons/sound2.gif) | entrepreneur_140211_..> | 2014-02-11 11:00 | 571M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_140..> | 2014-02-11 12:29 | 579M | |
![[SND]](/icons/sound2.gif) | biog_suzysdelights_2..> | 2014-02-11 15:32 | 5.4M | |
![[SND]](/icons/sound2.gif) | biog_suzysdelights_2..> | 2014-02-11 15:36 | 12M | |
![[SND]](/icons/sound2.gif) | Blame It On Ginger -..> | 2014-02-11 15:41 | 12M | |
![[SND]](/icons/sound2.gif) | biog_suzysdelights_2..> | 2014-02-11 15:41 | 12M | |
![[SND]](/icons/sound2.gif) | blameginger_140211_1..> | 2014-02-11 16:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | losangelesnista_1402..> | 2014-02-11 19:30 | 1.1G | |
![[SND]](/icons/sound2.gif) | blameginger_140212_1..> | 2014-02-12 16:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1402..> | 2014-02-12 18:59 | 556M | |
![[SND]](/icons/sound2.gif) | sarcasticnews_140212..> | 2014-02-12 20:02 | 492M | |
![[SND]](/icons/sound2.gif) | 140212_205121_SRS001..> | 2014-02-12 20:51 | 39M | |
![[SND]](/icons/sound2.gif) | intellectualkink_140..> | 2014-02-12 20:59 | 557M | |
![[SND]](/icons/sound2.gif) | verymanic_140213_081..> | 2014-02-13 08:10 | 2.7M | |
![[SND]](/icons/sound2.gif) | verymanic_140213_083..> | 2014-02-13 08:31 | 3.4M | |
![[SND]](/icons/sound2.gif) | blameginger_140213_1..> | 2014-02-13 16:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | nlr_140213_190034_SR..> | 2014-02-13 19:00 | 547M | |
![[SND]](/icons/sound2.gif) | darkmark_140213_2016..> | 2014-02-13 20:16 | 422M | |
![[SND]](/icons/sound2.gif) | npr_140213_210336_SR..> | 2014-02-13 21:03 | 560M | |
![[SND]](/icons/sound2.gif) | imburger_140213_2208..> | 2014-02-13 22:08 | 584M | |
![[SND]](/icons/sound2.gif) | blameginger_140214_1..> | 2014-02-14 16:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | timeoutcoach_140214_..> | 2014-02-14 22:03 | 1.2G | |
![[SND]](/icons/sound2.gif) | 8 Ike Turner.wav | 2014-02-15 19:25 | 3.8M | |
![[SND]](/icons/sound2.gif) | 3 Ghost Love.wav | 2014-02-15 19:34 | 5.5M | |
![[SND]](/icons/sound2.gif) | 32 Captives in Afgan..> | 2014-02-15 20:14 | 5.1M | |
![[SND]](/icons/sound2.gif) | verymanic_140216_130..> | 2014-02-16 13:00 | 1.8G | |
![[SND]](/icons/sound2.gif) | sweetrelease_140216_..> | 2014-02-16 18:01 | 531M | |
![[SND]](/icons/sound2.gif) | blameginger_140217_1..> | 2014-02-17 16:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | psych1on1_140217_190..> | 2014-02-17 19:03 | 537M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1402..> | 2014-02-17 20:01 | 582M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1402..> | 2014-02-17 21:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | entrepreneur_140218_..> | 2014-02-18 11:00 | 557M | |
![[SND]](/icons/sound2.gif) | blameginger_140218_1..> | 2014-02-18 14:00 | 336M | |
![[SND]](/icons/sound2.gif) | blameginger_140218_1..> | 2014-02-18 16:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | losangelesnista_1402..> | 2014-02-18 19:30 | 1.1G | |
![[SND]](/icons/sound2.gif) | blameginger_140219_1..> | 2014-02-19 16:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1402..> | 2014-02-19 19:00 | 557M | |
![[SND]](/icons/sound2.gif) | sarcasticnews_140219..> | 2014-02-19 20:02 | 556M | |
![[SND]](/icons/sound2.gif) | intellectualkink_140..> | 2014-02-19 21:00 | 559M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_140..> | 2014-02-19 22:05 | 594M | |
![[SND]](/icons/sound2.gif) | sarcasticnews_140219..> | 2014-02-19 23:32 | 143M | |
![[SND]](/icons/sound2.gif) | blameginger_140220_1..> | 2014-02-20 16:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | nlr_140220_190004_SR..> | 2014-02-20 19:00 | 560M | |
![[SND]](/icons/sound2.gif) | darkmark_140220_2000..> | 2014-02-20 20:00 | 7.2M | |
![[SND]](/icons/sound2.gif) | darkmark_140220_2003..> | 2014-02-20 20:03 | 564M | |
![[SND]](/icons/sound2.gif) | npr_140220_210625_SR..> | 2014-02-20 21:06 | 568M | |
![[SND]](/icons/sound2.gif) | imburger_140220_2205..> | 2014-02-20 22:05 | 566M | |
![[SND]](/icons/sound2.gif) | 22 Tidal New Mix w_b..> | 2014-02-21 09:56 | 49M | |
![[SND]](/icons/sound2.gif) | 40 Tidal New Mix w_b..> | 2014-02-21 09:56 | 49M | |
![[SND]](/icons/sound2.gif) | blameginger_140221_1..> | 2014-02-21 16:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | timeoutcoach_140221_..> | 2014-02-21 22:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | 3 Satanic Cult.wav | 2014-02-22 16:01 | 1.2M | |
![[SND]](/icons/sound2.gif) | Satanic Cult.wav | 2014-02-22 16:01 | 1.2M | |
![[SND]](/icons/sound2.gif) | Satanic I had to kil..> | 2014-02-22 16:03 | 651K | |
![[SND]](/icons/sound2.gif) | 14 Satanic She did n..> | 2014-02-22 16:05 | 1.9M | |
![[SND]](/icons/sound2.gif) | 25 Satanic Killed.wav | 2014-02-22 16:06 | 1.5M | |
![[SND]](/icons/sound2.gif) | Satanic Killed.wav | 2014-02-22 16:06 | 1.5M | |
![[SND]](/icons/sound2.gif) | 12 Satanic Confess.wav | 2014-02-22 16:13 | 1.6M | |
![[SND]](/icons/sound2.gif) | 10 Arizona Gays 1.wav | 2014-02-22 16:22 | 3.5M | |
![[SND]](/icons/sound2.gif) | 11_Lost Bride The Wo..> | 2014-02-22 16:43 | 61M | |
![[SND]](/icons/sound2.gif) | 6 Chapo Capture.wav | 2014-02-22 20:20 | 2.8M | |
![[SND]](/icons/sound2.gif) | 3 Satanic Serial Kil..> | 2014-02-22 22:43 | 1.5M | |
![[SND]](/icons/sound2.gif) | 10 Serial Killer Cra..> | 2014-02-23 09:23 | 5.0M | |
![[SND]](/icons/sound2.gif) | 10 Dodger Beating.wav | 2014-02-23 10:01 | 5.7M | |
![[SND]](/icons/sound2.gif) | verymanic_140223_125..> | 2014-02-23 12:59 | 1.9G | |
![[SND]](/icons/sound2.gif) | hardyardsla_140223_1..> | 2014-02-23 19:00 | 559M | |
![[SND]](/icons/sound2.gif) | sexendipity_140223_2..> | 2014-02-23 20:00 | 591M | |
![[SND]](/icons/sound2.gif) | blameginger_140224_1..> | 2014-02-24 15:59 | 1.1G | |
![[SND]](/icons/sound2.gif) | psych1on1_140224_190..> | 2014-02-24 19:00 | 562M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1402..> | 2014-02-24 20:00 | 581M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1402..> | 2014-02-24 21:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | apintofcacophony_140..> | 2014-02-24 23:09 | 655M | |
![[SND]](/icons/sound2.gif) | entrepreneur_140225_..> | 2014-02-25 11:00 | 556M | |
![[SND]](/icons/sound2.gif) | blameginger_140225_1..> | 2014-02-25 16:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | 140225_181009_SRS001..> | 2014-02-25 18:10 | 2.3M | |
![[SND]](/icons/sound2.gif) | 140225_181030_SRS001..> | 2014-02-25 18:10 | 2.1M | |
![[SND]](/icons/sound2.gif) | 140225_181119_SRS001..> | 2014-02-25 18:11 | 1.8M | |
![[SND]](/icons/sound2.gif) | 140225_181208_SRS001..> | 2014-02-25 18:12 | 745K | |
![[SND]](/icons/sound2.gif) | 140225_181228_SRS001..> | 2014-02-25 18:12 | 3.4M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1402..> | 2014-02-25 19:30 | 1.1G | |
![[SND]](/icons/sound2.gif) | losangelesnista_1402..> | 2014-02-26 13:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | blameginger_140226_1..> | 2014-02-26 16:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | 39 FCDN Tormentor li..> | 2014-02-26 18:37 | 24M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1402..> | 2014-02-26 19:00 | 576M | |
![[SND]](/icons/sound2.gif) | sarcasticnews_140226..> | 2014-02-26 20:02 | 555M | |
![[SND]](/icons/sound2.gif) | intellectualkink_140..> | 2014-02-26 21:00 | 554M | |
![[SND]](/icons/sound2.gif) | blameginger_140227_1..> | 2014-02-27 16:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | 140227_180528_SRS001..> | 2014-02-27 18:05 | 2.2M | |
![[SND]](/icons/sound2.gif) | 140227_180555_SRS001..> | 2014-02-27 18:05 | 3.0M | |
![[SND]](/icons/sound2.gif) | 140227_182651_SRS001..> | 2014-02-27 18:26 | 3.0M | |
![[SND]](/icons/sound2.gif) | 140227_182712_SRS001..> | 2014-02-27 18:27 | 2.1M | |
![[SND]](/icons/sound2.gif) | nlr_140227_190017_SR..> | 2014-02-27 19:00 | 556M | |
![[SND]](/icons/sound2.gif) | darkmark_140227_2002..> | 2014-02-27 20:02 | 551M | |
![[SND]](/icons/sound2.gif) | npr_140227_210221_SR..> | 2014-02-27 21:02 | 563M | |
![[SND]](/icons/sound2.gif) | imburger_140227_2204..> | 2014-02-27 22:04 | 636M | |
![[SND]](/icons/sound2.gif) | blameginger_140228_1..> | 2014-02-28 16:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | masters_140228_18011..> | 2014-02-28 18:01 | 575M | |
![[SND]](/icons/sound2.gif) | timeoutcoach_140228_..> | 2014-02-28 22:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | 02 Obama Ukraine.wav | 2014-03-01 20:21 | 9.9M | |
![[SND]](/icons/sound2.gif) | 16 Reagan Evil Empir..> | 2014-03-01 20:21 | 353K | |
![[SND]](/icons/sound2.gif) | 17 reagan total elim..> | 2014-03-01 20:23 | 360K | |
![[SND]](/icons/sound2.gif) | 07 Ukraine Histroy b..> | 2014-03-01 20:29 | 1.2M | |
![[SND]](/icons/sound2.gif) | 04 CBS Ukraine.wav | 2014-03-01 20:32 | 3.0M | |
![[SND]](/icons/sound2.gif) | 44 Obama Military Uk..> | 2014-03-01 20:54 | 736K | |
![[SND]](/icons/sound2.gif) | 09 Ukraine Invasion.wav | 2014-03-01 20:57 | 2.2M | |
![[SND]](/icons/sound2.gif) | 06 Fox Ukraine.wav | 2014-03-01 21:08 | 1.4M | |
![[SND]](/icons/sound2.gif) | 11 Reagan Evil Empir..> | 2014-03-01 21:21 | 353K | |
![[SND]](/icons/sound2.gif) | 12 reagan total elim..> | 2014-03-01 21:23 | 360K | |
![[SND]](/icons/sound2.gif) | 28 Indian Interview ..> | 2014-03-01 21:55 | 53M | |
![[SND]](/icons/sound2.gif) | 31 Indian Interview ..> | 2014-03-01 22:22 | 29M | |
![[SND]](/icons/sound2.gif) | 19 The Dating game.wav | 2014-03-01 22:36 | 3.0M | |
![[SND]](/icons/sound2.gif) | 38 FCDN Tormentor li..> | 2014-03-01 22:53 | 23M | |
![[SND]](/icons/sound2.gif) | 17 Jack Stephen Adee..> | 2014-03-02 09:57 | 2.6M | |
![[SND]](/icons/sound2.gif) | 41 Adee Doo.wav | 2014-03-02 10:16 | 121K | |
![[SND]](/icons/sound2.gif) | verymanic_140302_130..> | 2014-03-02 13:00 | 1.8G | |
![[SND]](/icons/sound2.gif) | sweetrelease_140302_..> | 2014-03-02 18:00 | 520M | |
![[SND]](/icons/sound2.gif) | hardyardsla_140302_1..> | 2014-03-02 19:00 | 567M | |
![[SND]](/icons/sound2.gif) | sexendipity_140302_2..> | 2014-03-02 20:00 | 584M | |
![[SND]](/icons/sound2.gif) | blameginger_140303_1..> | 2014-03-03 16:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | 140303_175604_SRS001..> | 2014-03-03 17:56 | 8.9M | |
![[SND]](/icons/sound2.gif) | psych1on1_140303_190..> | 2014-03-03 19:00 | 554M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1403..> | 2014-03-03 20:00 | 595M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1403..> | 2014-03-03 21:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | apintofcacophony_140..> | 2014-03-03 23:09 | 381M | |
![[SND]](/icons/sound2.gif) | blameginger_140304_1..> | 2014-03-04 16:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | 140304_181747_SRS001..> | 2014-03-04 18:17 | 4.8M | |
![[SND]](/icons/sound2.gif) | blameginger_140305_1..> | 2014-03-05 16:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | 140305_180429_SRS001..> | 2014-03-05 18:04 | 1.9M | |
![[SND]](/icons/sound2.gif) | 140305_180450_SRS001..> | 2014-03-05 18:04 | 1.4M | |
![[SND]](/icons/sound2.gif) | 140305_180503_SRS001..> | 2014-03-05 18:05 | 3.0M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1403..> | 2014-03-05 19:00 | 559M | |
![[SND]](/icons/sound2.gif) | sarcasticnews_140305..> | 2014-03-05 20:02 | 559M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_140..> | 2014-03-05 21:59 | 592M | |
![[SND]](/icons/sound2.gif) | blameginger_140306_1..> | 2014-03-06 16:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | nlr_140306_190001_SR..> | 2014-03-06 19:00 | 557M | |
![[SND]](/icons/sound2.gif) | darkmark_140306_1959..> | 2014-03-06 19:59 | 555M | |
![[SND]](/icons/sound2.gif) | npr_140306_210236_SR..> | 2014-03-06 21:02 | 591M | |
![[SND]](/icons/sound2.gif) | imburger_140306_2205..> | 2014-03-06 22:05 | 615M | |
![[SND]](/icons/sound2.gif) | sexendipity_140307_1..> | 2014-03-07 11:01 | 567M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1403..> | 2014-03-07 12:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | blameginger30_140307..> | 2014-03-07 16:01 | 318M | |
![[SND]](/icons/sound2.gif) | blameginger_140307_1..> | 2014-03-07 16:36 | 876M | |
![[SND]](/icons/sound2.gif) | masters_140307_18095..> | 2014-03-07 18:09 | 572M | |
![[SND]](/icons/sound2.gif) | timeoutcoach_140307_..> | 2014-03-07 21:59 | 1.2G | |
![[SND]](/icons/sound2.gif) | 3 United Nations Rus..> | 2014-03-08 12:08 | 5.4M | |
![[SND]](/icons/sound2.gif) | 6 Confrontation.wav | 2014-03-08 12:14 | 1.8M | |
![[SND]](/icons/sound2.gif) | 8 Ukraine Tear Down ..> | 2014-03-08 12:33 | 1.6M | |
![[SND]](/icons/sound2.gif) | 14 US Leading Ukrain..> | 2014-03-08 12:47 | 1.8M | |
![[SND]](/icons/sound2.gif) | 19 Rod Serling Ear D..> | 2014-03-08 12:54 | 752K | |
![[SND]](/icons/sound2.gif) | 28 Venezuela revolut..> | 2014-03-08 13:01 | 1.1M | |
![[SND]](/icons/sound2.gif) | 32 Andy Deciever.wav | 2014-03-08 13:34 | 70M | |
![[SND]](/icons/sound2.gif) | varietytalk_140308_1..> | 2014-03-08 13:40 | 21M | |
![[SND]](/icons/sound2.gif) | 18 Rod Serling Ear D..> | 2014-03-08 13:54 | 752K | |
![[SND]](/icons/sound2.gif) | 49 Rod Serling Ear D..> | 2014-03-08 13:54 | 752K | |
![[SND]](/icons/sound2.gif) | varietytalk_140308_1..> | 2014-03-08 14:07 | 582M | |
![[SND]](/icons/sound2.gif) | 13 Romper Room.wav | 2014-03-08 14:10 | 2.8M | |
![[SND]](/icons/sound2.gif) | 13 Romper Room Mirro..> | 2014-03-08 14:13 | 803K | |
![[SND]](/icons/sound2.gif) | verymanic_140309_120..> | 2014-03-09 13:00 | 1.8G | |
![[SND]](/icons/sound2.gif) | deliasdarkside_14030..> | 2014-03-09 16:06 | 523M | |
![[SND]](/icons/sound2.gif) | sexendipity_140309_1..> | 2014-03-09 17:00 | 697K | |
![[SND]](/icons/sound2.gif) | sexendipity_140309_1..> | 2014-03-09 17:01 | 575M | |
![[SND]](/icons/sound2.gif) | hardyardsla_140309_1..> | 2014-03-09 19:00 | 563M | |
![[SND]](/icons/sound2.gif) | blameginger30_140310..> | 2014-03-10 16:01 | 326M | |
![[SND]](/icons/sound2.gif) | blameginger_140310_1..> | 2014-03-10 16:36 | 874M | |
![[SND]](/icons/sound2.gif) | 140310_171747_SRS001..> | 2014-03-10 18:17 | 3.9M | |
![[SND]](/icons/sound2.gif) | 140310_171830_SRS001..> | 2014-03-10 18:18 | 1.5M | |
![[SND]](/icons/sound2.gif) | 140310_171938_SRS001..> | 2014-03-10 18:19 | 3.8M | |
![[SND]](/icons/sound2.gif) | psych1on1_140310_180..> | 2014-03-10 19:00 | 560M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1403..> | 2014-03-10 20:00 | 571M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1403..> | 2014-03-10 21:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | apintofcacophony_140..> | 2014-03-10 23:05 | 770M | |
![[SND]](/icons/sound2.gif) | entrepreneur_140311_..> | 2014-03-11 11:00 | 571M | |
![[SND]](/icons/sound2.gif) | blameginger30_140311..> | 2014-03-11 16:00 | 325M | |
![[SND]](/icons/sound2.gif) | blameginger_140311_1..> | 2014-03-11 16:35 | 887M | |
![[SND]](/icons/sound2.gif) | 140311_171423_SRS001..> | 2014-03-11 18:14 | 5.2M | |
![[SND]](/icons/sound2.gif) | 140311_223324_SRS001..> | 2014-03-11 23:33 | 625K | |
![[SND]](/icons/sound2.gif) | blameginger30_140312..> | 2014-03-12 16:00 | 322M | |
![[SND]](/icons/sound2.gif) | blameginger_140312_1..> | 2014-03-12 16:36 | 870M | |
![[SND]](/icons/sound2.gif) | 140312_171002_SRS001..> | 2014-03-12 18:10 | 1.7M | |
![[SND]](/icons/sound2.gif) | 140312_171023_SRS001..> | 2014-03-12 18:10 | 2.0M | |
![[SND]](/icons/sound2.gif) | 140312_171048_SRS001..> | 2014-03-12 18:10 | 4.9M | |
![[SND]](/icons/sound2.gif) | 140312_171123_SRS001..> | 2014-03-12 18:11 | 2.3M | |
![[SND]](/icons/sound2.gif) | 140312_171155_SRS001..> | 2014-03-12 18:11 | 1.9M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1403..> | 2014-03-12 19:00 | 570M | |
![[SND]](/icons/sound2.gif) | sarcasticnews_140312..> | 2014-03-12 20:00 | 564M | |
![[SND]](/icons/sound2.gif) | intellectualkink_140..> | 2014-03-12 20:59 | 556M | |
![[SND]](/icons/sound2.gif) | blameginger30_140313..> | 2014-03-13 16:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | nlr_140313_180005_SR..> | 2014-03-13 19:00 | 556M | |
![[SND]](/icons/sound2.gif) | darkmark_140313_1915..> | 2014-03-13 20:15 | 402M | |
![[SND]](/icons/sound2.gif) | npr_140313_200238_SR..> | 2014-03-13 21:02 | 550M | |
![[SND]](/icons/sound2.gif) | imburger_140313_2101..> | 2014-03-13 22:01 | 566M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_140..> | 2014-03-14 14:42 | 27M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_140..> | 2014-03-14 14:46 | 4.9M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_140..> | 2014-03-14 14:47 | 70M | |
![[SND]](/icons/sound2.gif) | blameginger_140314_1..> | 2014-03-14 16:03 | 1.1G | |
![[SND]](/icons/sound2.gif) | masters_140314_17044..> | 2014-03-14 18:04 | 582M | |
![[SND]](/icons/sound2.gif) | timeoutcoach_140314_..> | 2014-03-14 21:59 | 1.2G | |
![[SND]](/icons/sound2.gif) | 4 Missing Plane News..> | 2014-03-15 18:07 | 2.2M | |
![[SND]](/icons/sound2.gif) | 3 Missing 2.wav | 2014-03-15 18:08 | 887K | |
![[SND]](/icons/sound2.gif) | 2 Missing.wav | 2014-03-15 18:10 | 1.0M | |
![[SND]](/icons/sound2.gif) | 7 Twilight.wav | 2014-03-15 18:22 | 3.5M | |
![[SND]](/icons/sound2.gif) | 9 Missing Twillight ..> | 2014-03-15 18:30 | 5.4M | |
![[SND]](/icons/sound2.gif) | 11 Missing Plane 2.wav | 2014-03-15 18:36 | 7.2M | |
![[SND]](/icons/sound2.gif) | 19 Stolen Passports.wav | 2014-03-15 19:04 | 716K | |
![[SND]](/icons/sound2.gif) | 20 Something Happene..> | 2014-03-15 19:07 | 591K | |
![[SND]](/icons/sound2.gif) | 23 Twilight Lost.wav | 2014-03-15 19:18 | 2.6M | |
![[SND]](/icons/sound2.gif) | 17 New Confrence.wav | 2014-03-15 20:18 | 3.3M | |
![[SND]](/icons/sound2.gif) | 18 A Violent Pussy.wav | 2014-03-16 10:31 | 7.7M | |
![[SND]](/icons/sound2.gif) | verymanic_140316_120..> | 2014-03-16 13:03 | 1.7G | |
![[SND]](/icons/sound2.gif) | deliasdarkside_14031..> | 2014-03-16 16:00 | 532M | |
![[SND]](/icons/sound2.gif) | sexendipity_140316_1..> | 2014-03-16 17:02 | 564M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1403..> | 2014-03-17 13:00 | 581M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1403..> | 2014-03-17 14:00 | 610M | |
![[SND]](/icons/sound2.gif) | blameginger_140317_1..> | 2014-03-17 16:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | 140317_173546_SRS001..> | 2014-03-17 18:35 | 8.2M | |
![[SND]](/icons/sound2.gif) | psych1on1_140317_180..> | 2014-03-17 19:00 | 557M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1403..> | 2014-03-17 20:00 | 586M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1403..> | 2014-03-17 21:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | apintofcacophony_140..> | 2014-03-17 23:08 | 821M | |
![[SND]](/icons/sound2.gif) | entrepreneur_140318_..> | 2014-03-18 11:07 | 562M | |
![[SND]](/icons/sound2.gif) | blameginger_140318_1..> | 2014-03-18 16:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | losangelesnista_1403..> | 2014-03-19 12:00 | 615M | |
![[SND]](/icons/sound2.gif) | blameginger_140319_1..> | 2014-03-19 16:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1403..> | 2014-03-19 19:00 | 561M | |
![[SND]](/icons/sound2.gif) | intellectualkink_140..> | 2014-03-19 21:00 | 557M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_140..> | 2014-03-19 22:01 | 580M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1403..> | 2014-03-20 10:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | blameginger_140320_1..> | 2014-03-20 16:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | 140320_170018_SRS001..> | 2014-03-20 18:00 | 2.2M | |
![[SND]](/icons/sound2.gif) | 140320_170035_SRS001..> | 2014-03-20 18:00 | 3.4M | |
![[SND]](/icons/sound2.gif) | 140320_170127_SRS001..> | 2014-03-20 18:01 | 2.1M | |
![[SND]](/icons/sound2.gif) | 140320_170144_SRS001..> | 2014-03-20 18:01 | 3.3M | |
![[SND]](/icons/sound2.gif) | nlr_140320_180101_SR..> | 2014-03-20 19:01 | 559M | |
![[SND]](/icons/sound2.gif) | Helloterrie.wav | 2014-03-20 19:25 | 9.4M | |
![[SND]](/icons/sound2.gif) | response to my quest..> | 2014-03-20 19:25 | 323K | |
![[SND]](/icons/sound2.gif) | darkmark_140320_1900..> | 2014-03-20 20:00 | 601M | |
![[SND]](/icons/sound2.gif) | imburger_140320_2100..> | 2014-03-20 22:00 | 570M | |
![[SND]](/icons/sound2.gif) | 140321_021349_SRS001..> | 2014-03-21 03:13 | 1.3M | |
![[SND]](/icons/sound2.gif) | 140321_031114_SRS001..> | 2014-03-21 04:11 | 1.1M | |
![[SND]](/icons/sound2.gif) | blameginger_140321_1..> | 2014-03-21 15:59 | 1.1G | |
![[SND]](/icons/sound2.gif) | masters_140321_17000..> | 2014-03-21 18:00 | 569M | |
![[SND]](/icons/sound2.gif) | timeoutcoach_140321_..> | 2014-03-21 21:59 | 1.2G | |
![[SND]](/icons/sound2.gif) | 6 Darkness Twilight ..> | 2014-03-22 11:45 | 7.1M | |
![[SND]](/icons/sound2.gif) | 24 1 Neil Twilight.wav | 2014-03-22 15:21 | 53M | |
![[SND]](/icons/sound2.gif) | 25 2 Neill.wav | 2014-03-22 15:59 | 17M | |
![[SND]](/icons/sound2.gif) | 34 4 Neill Human.wav | 2014-03-22 16:17 | 23M | |
![[SND]](/icons/sound2.gif) | 35 5 Neill End.wav | 2014-03-22 16:28 | 19M | |
![[SND]](/icons/sound2.gif) | 28 3 Neill Black Me..> | 2014-03-22 17:08 | 54M | |
![[SND]](/icons/sound2.gif) | 16 rape def.wav | 2014-03-22 17:29 | 4.3M | |
![[SND]](/icons/sound2.gif) | 29 I am going to kil..> | 2014-03-22 17:35 | 3.7M | |
![[SND]](/icons/sound2.gif) | 40 I am going to ki..> | 2014-03-22 17:35 | 3.7M | |
![[SND]](/icons/sound2.gif) | 44 out of Control.wav | 2014-03-22 17:44 | 2.7M | |
![[SND]](/icons/sound2.gif) | 11 News Bruno Canin..> | 2014-03-22 17:56 | 1.5M | |
![[SND]](/icons/sound2.gif) | 2 News Ukrain Russia..> | 2014-03-22 18:00 | 1.1M | |
![[SND]](/icons/sound2.gif) | 12 news Russian Aggr..> | 2014-03-22 18:03 | 2.4M | |
![[SND]](/icons/sound2.gif) | 4 Head down Ass Up.wav | 2014-03-22 18:18 | 1.1M | |
![[SND]](/icons/sound2.gif) | 3 Opening 1 Russians..> | 2014-03-22 18:23 | 2.0M | |
![[SND]](/icons/sound2.gif) | 13 News Russian Inva..> | 2014-03-22 18:28 | 7.8M | |
![[SND]](/icons/sound2.gif) | verymanic_140323_120..> | 2014-03-23 13:00 | 1.6G | |
![[SND]](/icons/sound2.gif) | deliasdarkside_14032..> | 2014-03-23 16:00 | 457M | |
![[SND]](/icons/sound2.gif) | sexendipity_140323_1..> | 2014-03-23 17:04 | 551M | |
![[SND]](/icons/sound2.gif) | hardyardsla_140323_1..> | 2014-03-23 19:00 | 563M | |
![[SND]](/icons/sound2.gif) | 140324_144735_SRS001..> | 2014-03-24 15:47 | 12M | |
![[SND]](/icons/sound2.gif) | 140324_144914_SRS001..> | 2014-03-24 15:49 | 11M | |
![[SND]](/icons/sound2.gif) | blameginger_140324_1..> | 2014-03-24 16:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | thequmranreport_1403..> | 2014-03-24 20:00 | 590M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1403..> | 2014-03-24 21:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | apintofcacophony_140..> | 2014-03-24 23:06 | 764M | |
![[SND]](/icons/sound2.gif) | 140325_004617_SRS001..> | 2014-03-25 01:46 | 337K | |
![[SND]](/icons/sound2.gif) | blameginger_140325_1..> | 2014-03-25 16:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | 140325_165922_SRS001..> | 2014-03-25 17:59 | 5.9M | |
![[SND]](/icons/sound2.gif) | 140325_170024_SRS001..> | 2014-03-25 18:00 | 1.9M | |
![[SND]](/icons/sound2.gif) | 140325_170154_SRS001..> | 2014-03-25 18:01 | 3.7M | |
![[SND]](/icons/sound2.gif) | 140325_170216_SRS001..> | 2014-03-25 18:02 | 1.4M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1403..> | 2014-03-25 20:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | blameginger_140326_1..> | 2014-03-26 16:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | 140326_170700_SRS001..> | 2014-03-26 18:07 | 1.6M | |
![[SND]](/icons/sound2.gif) | 140326_170721_SRS001..> | 2014-03-26 18:07 | 1.3M | |
![[SND]](/icons/sound2.gif) | 140326_170735_SRS001..> | 2014-03-26 18:07 | 1.7M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1403..> | 2014-03-26 19:00 | 568M | |
![[SND]](/icons/sound2.gif) | sarcasticnews_140326..> | 2014-03-26 20:00 | 561M | |
![[SND]](/icons/sound2.gif) | intellectualkink_140..> | 2014-03-26 21:00 | 556M | |
![[SND]](/icons/sound2.gif) | 140326_222931_SRS001..> | 2014-03-26 23:29 | 337K | |
![[SND]](/icons/sound2.gif) | blameginger_140327_1..> | 2014-03-27 16:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | 140327_170218_SRS001..> | 2014-03-27 18:02 | 1.8M | |
![[SND]](/icons/sound2.gif) | 140327_170236_SRS001..> | 2014-03-27 18:02 | 4.2M | |
![[SND]](/icons/sound2.gif) | nlr_140327_180002_SR..> | 2014-03-27 19:00 | 555M | |
![[SND]](/icons/sound2.gif) | darkmark_140327_1903..> | 2014-03-27 20:03 | 553M | |
![[SND]](/icons/sound2.gif) | imburger_140327_2100..> | 2014-03-27 22:00 | 566M | |
![[SND]](/icons/sound2.gif) | 140328_145420_SRS001..> | 2014-03-28 15:54 | 5.9M | |
![[SND]](/icons/sound2.gif) | blameginger_140328_1..> | 2014-03-28 16:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | masters_140328_17011..> | 2014-03-28 18:01 | 599M | |
![[SND]](/icons/sound2.gif) | coachcom1_140328_204..> | 2014-03-28 21:40 | 8.7M | |
![[SND]](/icons/sound2.gif) | coachcom2_140328_204..> | 2014-03-28 21:42 | 12M | |
![[SND]](/icons/sound2.gif) | coachcom3_140328_204..> | 2014-03-28 21:43 | 18M | |
![[SND]](/icons/sound2.gif) | coachcom4_140328_204..> | 2014-03-28 21:46 | 16M | |
![[SND]](/icons/sound2.gif) | coachcom5_140328_204..> | 2014-03-28 21:48 | 8.4M | |
![[SND]](/icons/sound2.gif) | coachcom5_140328_204..> | 2014-03-28 21:49 | 4.7M | |
![[SND]](/icons/sound2.gif) | coachcom5_140328_204..> | 2014-03-28 21:49 | 8.6M | |
![[SND]](/icons/sound2.gif) | timeoutcoach_140328_..> | 2014-03-28 22:03 | 1.2G | |
![[SND]](/icons/sound2.gif) | 29 The Oath Intervie..> | 2014-03-29 10:55 | 71M | |
![[SND]](/icons/sound2.gif) | 12 Oderus Death Anno..> | 2014-03-29 10:59 | 1.8M | |
![[SND]](/icons/sound2.gif) | 4 Odersus Asleep.wav | 2014-03-29 11:07 | 563K | |
![[SND]](/icons/sound2.gif) | 6 Gwar die.wav | 2014-03-29 11:21 | 2.4M | |
![[SND]](/icons/sound2.gif) | 13 Twilight Zone ima..> | 2014-03-29 11:30 | 1.5M | |
![[SND]](/icons/sound2.gif) | 16 Twilight Zone ima..> | 2014-03-29 11:30 | 1.5M | |
![[SND]](/icons/sound2.gif) | 26 Twilight Zone ima..> | 2014-03-29 11:30 | 1.5M | |
![[SND]](/icons/sound2.gif) | 27 Night Gallery Wit..> | 2014-03-29 11:38 | 1.8M | |
![[SND]](/icons/sound2.gif) | 34 Twilight Zone Wit..> | 2014-03-29 11:48 | 1.4M | |
![[SND]](/icons/sound2.gif) | 41 Twilight Zone the..> | 2014-03-29 11:53 | 6.4M | |
![[SND]](/icons/sound2.gif) | 37 Twilight zone Rev..> | 2014-03-29 11:58 | 2.1M | |
![[SND]](/icons/sound2.gif) | 15 Earthquake.wav | 2014-03-29 12:03 | 1.2M | |
![[SND]](/icons/sound2.gif) | 19 Earthquake 2.wav | 2014-03-29 12:10 | 4.8M | |
![[SND]](/icons/sound2.gif) | 17 Earthquake 3.wav | 2014-03-29 12:15 | 1.1M | |
![[SND]](/icons/sound2.gif) | 39 Inhuman Jimmy Cab..> | 2014-03-29 12:22 | 3.9M | |
![[SND]](/icons/sound2.gif) | 23 Oderus Lemmy.wav | 2014-03-29 12:33 | 2.0M | |
![[SND]](/icons/sound2.gif) | verymanic_140330_120..> | 2014-03-30 13:00 | 1.7G | |
![[SND]](/icons/sound2.gif) | deliasdarkside_14033..> | 2014-03-30 16:00 | 556M | |
![[SND]](/icons/sound2.gif) | sexendipity_140330_1..> | 2014-03-30 17:00 | 569M | |
![[SND]](/icons/sound2.gif) | hardyardsla_140330_1..> | 2014-03-30 19:00 | 561M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1403..> | 2014-03-31 13:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | blameginger_140331_1..> | 2014-03-31 16:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | 140331_165731_SRS001..> | 2014-03-31 17:57 | 1.8M | |
![[SND]](/icons/sound2.gif) | 140331_165752_SRS001..> | 2014-03-31 17:57 | 1.8M | |
![[SND]](/icons/sound2.gif) | 140331_165820_SRS001..> | 2014-03-31 17:58 | 3.8M | |
![[SND]](/icons/sound2.gif) | 140331_165852_SRS001..> | 2014-03-31 17:58 | 2.3M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1403..> | 2014-03-31 19:59 | 580M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1403..> | 2014-03-31 21:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | losangelesnista_1403..> | 2014-03-31 23:18 | 818M | |
![[SND]](/icons/sound2.gif) | entrepreneur_140401_..> | 2014-04-01 10:59 | 560M | |
![[SND]](/icons/sound2.gif) | blameginger_140401_1..> | 2014-04-01 16:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | 140401_165756_SRS001..> | 2014-04-01 17:57 | 1.9M | |
![[SND]](/icons/sound2.gif) | 140401_165815_SRS001..> | 2014-04-01 17:58 | 1.4M | |
![[SND]](/icons/sound2.gif) | 140401_165830_SRS001..> | 2014-04-01 17:58 | 1.5M | |
![[SND]](/icons/sound2.gif) | blameginger_140402_1..> | 2014-04-02 16:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | 140402_165751_SRS001..> | 2014-04-02 17:57 | 1.4M | |
![[SND]](/icons/sound2.gif) | 140402_165804_SRS001..> | 2014-04-02 17:58 | 1.6M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1404..> | 2014-04-02 19:00 | 559M | |
![[SND]](/icons/sound2.gif) | sarcasticnews_140402..> | 2014-04-02 20:02 | 550M | |
![[SND]](/icons/sound2.gif) | intellectualkink_140..> | 2014-04-02 21:00 | 556M | |
![[SND]](/icons/sound2.gif) | blameginger_140403_1..> | 2014-04-03 16:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | 140403_165959_SRS001..> | 2014-04-03 17:59 | 9.4M | |
![[SND]](/icons/sound2.gif) | 140403_170055_SRS001..> | 2014-04-03 18:00 | 3.3M | |
![[SND]](/icons/sound2.gif) | 140403_170126_SRS001..> | 2014-04-03 18:01 | 1.7M | |
![[SND]](/icons/sound2.gif) | 140403_170210_SRS001..> | 2014-04-03 18:02 | 5.0M | |
![[SND]](/icons/sound2.gif) | nlr_140403_180004_SR..> | 2014-04-03 19:00 | 547M | |
![[SND]](/icons/sound2.gif) | darkmark_140403_1904..> | 2014-04-03 20:04 | 632M | |
![[SND]](/icons/sound2.gif) | imburger_140403_2100..> | 2014-04-03 22:00 | 567M | |
![[SND]](/icons/sound2.gif) | blameginger_140404_1..> | 2014-04-04 16:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | masters_140404_17023..> | 2014-04-04 18:02 | 589M | |
![[SND]](/icons/sound2.gif) | timeoutcoach_140404_..> | 2014-04-04 22:01 | 1.3G | |
![[SND]](/icons/sound2.gif) | 36 Krisiun Interview..> | 2014-04-05 14:02 | 64M | |
![[SND]](/icons/sound2.gif) | 39 Krisiun Int 2.wav | 2014-04-05 14:33 | 40M | |
![[SND]](/icons/sound2.gif) | 2 Sexy Beast.wav | 2014-04-05 14:38 | 2.3M | |
![[SND]](/icons/sound2.gif) | 3 Fort Hood Shooting..> | 2014-04-05 14:41 | 1.5M | |
![[SND]](/icons/sound2.gif) | 13 Fort Hood Obama.wav | 2014-04-05 14:50 | 680K | |
![[SND]](/icons/sound2.gif) | 10 Fort Hood New C.wav | 2014-04-05 14:52 | 2.3M | |
![[SND]](/icons/sound2.gif) | 20 Ak 47.wav | 2014-04-05 15:20 | 962K | |
![[SND]](/icons/sound2.gif) | 41 Tony Iron Reagan ..> | 2014-04-06 07:21 | 43M | |
![[SND]](/icons/sound2.gif) | 31 Shooter Fort Hoo..> | 2014-04-06 07:34 | 444K | |
![[SND]](/icons/sound2.gif) | 25 A News Fort Hood.wav | 2014-04-06 07:35 | 6.0M | |
![[SND]](/icons/sound2.gif) | verymanic_140406_120..> | 2014-04-06 13:00 | 1.7G | |
![[SND]](/icons/sound2.gif) | deliasdarkside_14040..> | 2014-04-06 16:00 | 563M | |
![[SND]](/icons/sound2.gif) | sexendipity_140406_1..> | 2014-04-06 17:00 | 561M | |
![[SND]](/icons/sound2.gif) | Fuqua Law Center - e..> | 2014-04-07 02:25 | 9.1M | |
![[SND]](/icons/sound2.gif) | blameginger_140407_1..> | 2014-04-07 16:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | thequmranreport_1404..> | 2014-04-07 20:00 | 570M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1404..> | 2014-04-07 21:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | apintofcacophony_140..> | 2014-04-07 23:05 | 857M | |
![[SND]](/icons/sound2.gif) | entrepreneur_140408_..> | 2014-04-08 11:00 | 577M | |
![[SND]](/icons/sound2.gif) | blameginger_140408_1..> | 2014-04-08 16:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | 140408_170022_SRS001..> | 2014-04-08 18:00 | 2.5M | |
![[SND]](/icons/sound2.gif) | 140408_170049_SRS001..> | 2014-04-08 18:00 | 2.9M | |
![[SND]](/icons/sound2.gif) | blameginger_140409_1..> | 2014-04-09 16:06 | 1.1G | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1404..> | 2014-04-09 19:00 | 561M | |
![[SND]](/icons/sound2.gif) | sarcasticnews_140409..> | 2014-04-09 20:05 | 523M | |
![[SND]](/icons/sound2.gif) | intellectualkink_140..> | 2014-04-09 21:00 | 556M | |
![[SND]](/icons/sound2.gif) | blameginger_140410_1..> | 2014-04-10 16:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | nlr_140410_180027_SR..> | 2014-04-10 19:00 | 551M | |
![[SND]](/icons/sound2.gif) | darkmark_140410_1900..> | 2014-04-10 20:00 | 559M | |
![[SND]](/icons/sound2.gif) | npr_140410_200148_SR..> | 2014-04-10 21:01 | 529M | |
![[SND]](/icons/sound2.gif) | imburger_140410_2100..> | 2014-04-10 22:00 | 566M | |
![[SND]](/icons/sound2.gif) | blameginger_140411_1..> | 2014-04-11 16:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | masters_140411_17045..> | 2014-04-11 18:04 | 598M | |
![[SND]](/icons/sound2.gif) | coachcom7_140411_204..> | 2014-04-11 21:40 | 15M | |
![[SND]](/icons/sound2.gif) | coachcom7_140411_204..> | 2014-04-11 21:42 | 2.6M | |
![[SND]](/icons/sound2.gif) | coachcom8_140411_204..> | 2014-04-11 21:43 | 8.3M | |
![[SND]](/icons/sound2.gif) | coachcom8_140411_204..> | 2014-04-11 21:44 | 1.0M | |
![[SND]](/icons/sound2.gif) | coachcom8_140411_204..> | 2014-04-11 21:45 | 1.0M | |
![[SND]](/icons/sound2.gif) | coachcom8_140411_204..> | 2014-04-11 21:50 | 6.4M | |
![[SND]](/icons/sound2.gif) | coachcom8_140411_204..> | 2014-04-11 21:50 | 8.1M | |
![[SND]](/icons/sound2.gif) | coachcom7_140411_204..> | 2014-04-11 21:50 | 7.4M | |
![[SND]](/icons/sound2.gif) | coachcom9_140411_204..> | 2014-04-11 21:53 | 4.9M | |
![[SND]](/icons/sound2.gif) | coachcom8_140411_204..> | 2014-04-11 21:54 | 7.6M | |
![[SND]](/icons/sound2.gif) | coachcom7_140411_204..> | 2014-04-11 21:54 | 6.7M | |
![[SND]](/icons/sound2.gif) | timeoutcoach_140411_..> | 2014-04-11 22:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | 140411_231625_SRS001..> | 2014-04-11 23:16 | 6.3M | |
![[SND]](/icons/sound2.gif) | 140411_231703_SRS001..> | 2014-04-11 23:17 | 33M | |
![[SND]](/icons/sound2.gif) | 140411_232123_SRS001..> | 2014-04-11 23:21 | 15M | |
![[SND]](/icons/sound2.gif) | 140411_232303_SRS001..> | 2014-04-11 23:23 | 11M | |
![[SND]](/icons/sound2.gif) | 140411_232445_SRS001..> | 2014-04-11 23:24 | 10M | |
![[SND]](/icons/sound2.gif) | msg0090.WAV | 2014-04-11 23:53 | 420K | |
![[SND]](/icons/sound2.gif) | msg0091.WAV | 2014-04-11 23:53 | 176K | |
![[SND]](/icons/sound2.gif) | msg0092.WAV | 2014-04-11 23:53 | 119K | |
![[SND]](/icons/sound2.gif) | msg0093.WAV | 2014-04-11 23:54 | 47K | |
![[SND]](/icons/sound2.gif) | msg0094.WAV | 2014-04-11 23:54 | 47K | |
![[SND]](/icons/sound2.gif) | msg0095.WAV | 2014-04-11 23:54 | 54K | |
![[SND]](/icons/sound2.gif) | msg0096.WAV | 2014-04-11 23:54 | 105K | |
![[SND]](/icons/sound2.gif) | msg0097.WAV | 2014-04-11 23:54 | 83K | |
![[SND]](/icons/sound2.gif) | msg0098.WAV | 2014-04-11 23:54 | 89K | |
![[SND]](/icons/sound2.gif) | msg0099.WAV | 2014-04-11 23:54 | 87K | |
![[SND]](/icons/sound2.gif) | msg0027.WAV | 2014-04-11 23:55 | 66K | |
![[SND]](/icons/sound2.gif) | 5 Killer McHann.wav | 2014-04-12 16:40 | 23M | |
![[SND]](/icons/sound2.gif) | 32 King Parrot Int.wav | 2014-04-12 19:12 | 65M | |
![[SND]](/icons/sound2.gif) | 2 Stabbing news.wav | 2014-04-12 19:16 | 2.2M | |
![[SND]](/icons/sound2.gif) | 3 Stabbing Cops.wav | 2014-04-12 19:27 | 1.6M | |
![[SND]](/icons/sound2.gif) | 7 God is still Good.wav | 2014-04-12 19:31 | 449K | |
![[SND]](/icons/sound2.gif) | 6 Stabbing Students.wav | 2014-04-12 19:35 | 3.7M | |
![[SND]](/icons/sound2.gif) | 18 Rancher.wav | 2014-04-12 23:10 | 2.3M | |
![[SND]](/icons/sound2.gif) | 11 News.wav | 2014-04-13 07:51 | 7.3M | |
![[SND]](/icons/sound2.gif) | verymanic_140413_120..> | 2014-04-13 13:00 | 1.6G | |
![[SND]](/icons/sound2.gif) | deliasdarkside_14041..> | 2014-04-13 16:00 | 616M | |
![[SND]](/icons/sound2.gif) | hardyardsla_140413_1..> | 2014-04-13 18:00 | 562M | |
![[SND]](/icons/sound2.gif) | blameginger_140414_1..> | 2014-04-14 16:02 | 1.1G | |
![[SND]](/icons/sound2.gif) | psych1on1_140414_180..> | 2014-04-14 19:00 | 567M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1404..> | 2014-04-14 20:03 | 535M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1404..> | 2014-04-14 21:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | apintofcacophony_140..> | 2014-04-14 23:04 | 940M | |
![[SND]](/icons/sound2.gif) | blameginger_140415_1..> | 2014-04-15 16:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | 140415_165912_SRS001..> | 2014-04-15 17:59 | 5.2M | |
![[SND]](/icons/sound2.gif) | 140415_165943_SRS001..> | 2014-04-15 17:59 | 1.7M | |
![[SND]](/icons/sound2.gif) | 140415_170000_SRS001..> | 2014-04-15 18:00 | 2.2M | |
![[SND]](/icons/sound2.gif) | 140415_170013_SRS001..> | 2014-04-15 18:00 | 1.6M | |
![[SND]](/icons/sound2.gif) | 140416_145408_SRS001..> | 2014-04-16 15:54 | 5.6M | |
![[SND]](/icons/sound2.gif) | 140416_145524_SRS001..> | 2014-04-16 15:55 | 2.3M | |
![[SND]](/icons/sound2.gif) | blameginger_140416_1..> | 2014-04-16 16:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | 140416_170755_SRS001..> | 2014-04-16 18:07 | 2.2M | |
![[SND]](/icons/sound2.gif) | 140416_170814_SRS001..> | 2014-04-16 18:08 | 2.2M | |
![[SND]](/icons/sound2.gif) | 140416_170847_SRS001..> | 2014-04-16 18:08 | 2.7M | |
![[SND]](/icons/sound2.gif) | 140416_170914_SRS001..> | 2014-04-16 18:09 | 2.7M | |
![[SND]](/icons/sound2.gif) | intellectualkink_140..> | 2014-04-16 21:00 | 556M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_140..> | 2014-04-16 22:02 | 581M | |
![[SND]](/icons/sound2.gif) | blameginger_140417_1..> | 2014-04-17 16:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | 140417_171101_SRS001..> | 2014-04-17 18:11 | 17M | |
![[SND]](/icons/sound2.gif) | nlr_140417_175955_SR..> | 2014-04-17 18:59 | 557M | |
![[SND]](/icons/sound2.gif) | darkmark_140417_1901..> | 2014-04-17 20:01 | 558M | |
![[SND]](/icons/sound2.gif) | npr_140417_200005_SR..> | 2014-04-17 21:00 | 563M | |
![[SND]](/icons/sound2.gif) | imburger_140417_2100..> | 2014-04-17 22:00 | 558M | |
![[SND]](/icons/sound2.gif) | psychiceveryday_1404..> | 2014-04-18 12:00 | 560M | |
![[SND]](/icons/sound2.gif) | blameginger_140418_1..> | 2014-04-18 15:58 | 1.1G | |
![[SND]](/icons/sound2.gif) | masters_140418_17033..> | 2014-04-18 18:03 | 557M | |
![[SND]](/icons/sound2.gif) | coachcom_chinese_140..> | 2014-04-18 20:40 | 9.6M | |
![[SND]](/icons/sound2.gif) | coachcom_chinese_140..> | 2014-04-18 21:38 | 4.0M | |
![[SND]](/icons/sound2.gif) | coachcom_chinese_140..> | 2014-04-18 21:38 | 6.2M | |
![[SND]](/icons/sound2.gif) | coachcom_chinese_140..> | 2014-04-18 21:39 | 7.9M | |
![[SND]](/icons/sound2.gif) | timeoutcoach_140418_..> | 2014-04-18 21:59 | 1.2G | |
![[SND]](/icons/sound2.gif) | verymanic_140420_120..> | 2014-04-20 13:00 | 1.7G | |
![[SND]](/icons/sound2.gif) | sexendipity_140420_1..> | 2014-04-20 17:00 | 577M | |
![[SND]](/icons/sound2.gif) | blameginger_140421_1..> | 2014-04-21 16:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | psych1on1_140421_180..> | 2014-04-21 19:00 | 560M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1404..> | 2014-04-21 21:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | apintofcacophony_140..> | 2014-04-21 23:07 | 1.1G | |
![[SND]](/icons/sound2.gif) | entrepreneur_140422_..> | 2014-04-22 12:11 | 289K | |
![[SND]](/icons/sound2.gif) | entrepreneur_140422_..> | 2014-04-22 12:11 | 3.8M | |
![[SND]](/icons/sound2.gif) | blameginger_140422_1..> | 2014-04-22 16:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | 140422_170236_SRS001..> | 2014-04-22 18:02 | 1.9M | |
![[SND]](/icons/sound2.gif) | 140422_170255_SRS001..> | 2014-04-22 18:02 | 1.4M | |
![[SND]](/icons/sound2.gif) | 140422_170331_SRS001..> | 2014-04-22 18:03 | 2.1M | |
![[SND]](/icons/sound2.gif) | 140422_170352_SRS001..> | 2014-04-22 18:03 | 1.9M | |
![[SND]](/icons/sound2.gif) | 140422_170434_SRS001..> | 2014-04-22 18:04 | 1.0M | |
![[SND]](/icons/sound2.gif) | 140422_170518_SRS001..> | 2014-04-22 18:05 | 1.2M | |
![[SND]](/icons/sound2.gif) | blameginger_140423_1..> | 2014-04-23 16:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | sarcasticnews_140423..> | 2014-04-23 20:00 | 583M | |
![[SND]](/icons/sound2.gif) | blameginger_140424_1..> | 2014-04-24 16:03 | 1.1G | |
![[SND]](/icons/sound2.gif) | 140424_170722_SRS001..> | 2014-04-24 18:07 | 15M | |
![[SND]](/icons/sound2.gif) | 140424_170854_SRS001..> | 2014-04-24 18:08 | 1.7M | |
![[SND]](/icons/sound2.gif) | 140424_170904_SRS001..> | 2014-04-24 18:09 | 37M | |
![[SND]](/icons/sound2.gif) | nlr_140424_180030_SR..> | 2014-04-24 19:00 | 557M | |
![[SND]](/icons/sound2.gif) | darkmark_140424_1906..> | 2014-04-24 20:06 | 497M | |
![[SND]](/icons/sound2.gif) | npr_140424_200026_SR..> | 2014-04-24 21:00 | 560M | |
![[SND]](/icons/sound2.gif) | imburger_140424_2100..> | 2014-04-24 22:00 | 560M | |
![[SND]](/icons/sound2.gif) | blameginger_140425_1..> | 2014-04-25 16:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | masters_140425_17072..> | 2014-04-25 18:07 | 571M | |
![[SND]](/icons/sound2.gif) | timeoutcoach_140425_..> | 2014-04-25 21:59 | 1.3G | |
![[SND]](/icons/sound2.gif) | verymanic_140427_120..> | 2014-04-27 13:00 | 1.7G | |
![[SND]](/icons/sound2.gif) | deliasdarkside_14042..> | 2014-04-27 16:00 | 557M | |
![[SND]](/icons/sound2.gif) | sexendipity_140427_1..> | 2014-04-27 16:59 | 554M | |
![[SND]](/icons/sound2.gif) | hardyardsla_140427_1..> | 2014-04-27 19:00 | 468M | |
![[SND]](/icons/sound2.gif) | blameginger_140428_1..> | 2014-04-28 16:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | Fine Minds - Catch Y..> | 2014-04-28 16:57 | 25M | |
![[SND]](/icons/sound2.gif) | psych1on1_140428_180..> | 2014-04-28 19:00 | 550M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1404..> | 2014-04-28 20:00 | 599M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1404..> | 2014-04-28 21:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | apintofcacophony_140..> | 2014-04-28 23:06 | 1.2G | |
![[SND]](/icons/sound2.gif) | blameginger_140429_1..> | 2014-04-29 16:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | 140429_170530_SRS001..> | 2014-04-29 18:05 | 2.1M | |
![[SND]](/icons/sound2.gif) | blameginger_140430_1..> | 2014-04-30 16:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | sarcasticnews_140430..> | 2014-04-30 20:00 | 560M | |
![[SND]](/icons/sound2.gif) | intellectualkink_140..> | 2014-04-30 21:00 | 556M | |
![[SND]](/icons/sound2.gif) | blameginger_140501_1..> | 2014-05-01 15:59 | 1.1G | |
![[SND]](/icons/sound2.gif) | nlr_140501_180008_SR..> | 2014-05-01 19:00 | 561M | |
![[SND]](/icons/sound2.gif) | darkmark_140501_1900..> | 2014-05-01 20:00 | 547M | |
![[SND]](/icons/sound2.gif) | npr_140501_200036_SR..> | 2014-05-01 21:00 | 558M | |
![[SND]](/icons/sound2.gif) | imburger_140501_2100..> | 2014-05-01 22:00 | 558M | |
![[SND]](/icons/sound2.gif) | timeoutcoach_140502_..> | 2014-05-02 22:04 | 1.2G | |
![[SND]](/icons/sound2.gif) | verymanic_140504_115..> | 2014-05-04 12:59 | 1.7G | |
![[SND]](/icons/sound2.gif) | deliasdarkside_14050..> | 2014-05-04 16:00 | 556M | |
![[SND]](/icons/sound2.gif) | sexendipity_140504_1..> | 2014-05-04 17:00 | 581M | |
![[SND]](/icons/sound2.gif) | hardyardsla_140504_1..> | 2014-05-04 19:00 | 509M | |
![[SND]](/icons/sound2.gif) | psych1on1_140505_180..> | 2014-05-05 19:00 | 559M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1405..> | 2014-05-05 20:00 | 568M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1405..> | 2014-05-05 21:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | sarcasticnews_140507..> | 2014-05-07 20:00 | 560M | |
![[SND]](/icons/sound2.gif) | intellectualkink_140..> | 2014-05-07 21:00 | 556M | |
![[SND]](/icons/sound2.gif) | nlr_140508_180023_SR..> | 2014-05-08 19:00 | 555M | |
![[SND]](/icons/sound2.gif) | darkmark_140508_1900..> | 2014-05-08 20:00 | 560M | |
![[SND]](/icons/sound2.gif) | npr_140508_200129_SR..> | 2014-05-08 21:01 | 561M | |
![[SND]](/icons/sound2.gif) | imburger_140508_2100..> | 2014-05-08 22:00 | 560M | |
![[SND]](/icons/sound2.gif) | masters_140509_17002..> | 2014-05-09 18:00 | 572M | |
![[SND]](/icons/sound2.gif) | timeoutcoach_140509_..> | 2014-05-09 22:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | verymanic_140511_120..> | 2014-05-11 13:00 | 1.7G | |
![[SND]](/icons/sound2.gif) | hardyardsla_140511_1..> | 2014-05-11 16:59 | 555M | |
![[SND]](/icons/sound2.gif) | psych1on1_140512_180..> | 2014-05-12 19:00 | 555M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1405..> | 2014-05-12 20:00 | 580M | |
![[SND]](/icons/sound2.gif) | losangelesnista_1405..> | 2014-05-12 21:15 | 1.0G | |
![[SND]](/icons/sound2.gif) | apintofcacophony_140..> | 2014-05-12 23:04 | 778M | |
![[SND]](/icons/sound2.gif) | entrepreneur_140513_..> | 2014-05-13 11:00 | 570M | |
![[SND]](/icons/sound2.gif) | hardyardsla_140513_2..> | 2014-05-13 23:32 | 11M | |
![[SND]](/icons/sound2.gif) | hardyardsla_140513_2..> | 2014-05-13 23:34 | 5.9M | |
![[SND]](/icons/sound2.gif) | hardyardsla_140513_2..> | 2014-05-13 23:36 | 5.3M | |
![[SND]](/icons/sound2.gif) | mastersplayground_14..> | 2014-05-13 23:37 | 10M | |
![[SND]](/icons/sound2.gif) | nlr_140515_180016_SR..> | 2014-05-15 19:00 | 549M | |
![[SND]](/icons/sound2.gif) | darkmark_140515_1904..> | 2014-05-15 20:04 | 617M | |
![[SND]](/icons/sound2.gif) | npr_140515_200720_SR..> | 2014-05-15 21:07 | 561M | |
![[SND]](/icons/sound2.gif) | imburger_140515_2109..> | 2014-05-15 22:09 | 565M | |
![[SND]](/icons/sound2.gif) | mastersplayground_14..> | 2014-05-16 18:01 | 578M | |
![[SND]](/icons/sound2.gif) | timeoutcoach_140516_..> | 2014-05-16 21:59 | 1.2G | |
![[SND]](/icons/sound2.gif) | indieface_140517_191..> | 2014-05-17 20:17 | 20M | |
![[SND]](/icons/sound2.gif) | Skidrow Radio Spot f..> | 2014-05-18 21:10 | 4.5M | |
![[SND]](/icons/sound2.gif) | psych1on1_140519_180..> | 2014-05-19 19:00 | 571M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1405..> | 2014-05-19 20:01 | 587M | |
![[SND]](/icons/sound2.gif) | apintofcacophony_140..> | 2014-05-19 23:00 | 564M | |
![[SND]](/icons/sound2.gif) | entrepreneur_140520_..> | 2014-05-20 11:00 | 566M | |
![[SND]](/icons/sound2.gif) | sarcasticnews_140521..> | 2014-05-21 20:00 | 564M | |
![[SND]](/icons/sound2.gif) | indieface_140522_170..> | 2014-05-22 18:00 | 557M | |
![[SND]](/icons/sound2.gif) | nlr_140522_180004_SR..> | 2014-05-22 19:00 | 541M | |
![[SND]](/icons/sound2.gif) | darkmark_140522_1900..> | 2014-05-22 20:00 | 316M | |
![[SND]](/icons/sound2.gif) | 140522_193211_SRS001..> | 2014-05-22 20:32 | 243M | |
![[SND]](/icons/sound2.gif) | npr_140522_200331_SR..> | 2014-05-22 21:03 | 558M | |
![[SND]](/icons/sound2.gif) | imburger_140522_2106..> | 2014-05-22 22:06 | 566M | |
![[SND]](/icons/sound2.gif) | mastersplayground_14..> | 2014-05-23 17:59 | 600M | |
![[SND]](/icons/sound2.gif) | deliasdarkside_14052..> | 2014-05-25 16:00 | 572M | |
![[SND]](/icons/sound2.gif) | American Sharks - Ov..> | 2014-05-26 12:58 | 20M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1405..> | 2014-05-26 20:00 | 616M | |
![[SND]](/icons/sound2.gif) | apintofcacophony_140..> | 2014-05-26 23:00 | 656M | |
![[SND]](/icons/sound2.gif) | entrepreneur_140527_..> | 2014-05-27 11:00 | 558M | |
![[SND]](/icons/sound2.gif) | sarcasticnews_140528..> | 2014-05-28 20:00 | 567M | |
![[SND]](/icons/sound2.gif) | indieface_140529_170..> | 2014-05-29 18:00 | 572M | |
![[SND]](/icons/sound2.gif) | nlr_140529_180300_SR..> | 2014-05-29 19:03 | 562M | |
![[SND]](/icons/sound2.gif) | darkmark_140529_1900..> | 2014-05-29 20:00 | 564M | |
![[SND]](/icons/sound2.gif) | npr_140529_200159_SR..> | 2014-05-29 21:01 | 565M | |
![[SND]](/icons/sound2.gif) | imburger_140529_2103..> | 2014-05-29 22:03 | 566M | |
![[SND]](/icons/sound2.gif) | mastersplayground_14..> | 2014-05-30 18:01 | 12M | |
![[SND]](/icons/sound2.gif) | mastersplayground_14..> | 2014-05-30 18:03 | 11M | |
![[SND]](/icons/sound2.gif) | mastersplayground_14..> | 2014-05-30 18:04 | 5.7M | |
![[SND]](/icons/sound2.gif) | mastersplayground_14..> | 2014-05-30 18:09 | 612M | |
![[SND]](/icons/sound2.gif) | hardyardsla_140601_1..> | 2014-06-01 19:00 | 6.1M | |
![[SND]](/icons/sound2.gif) | hardyardsla_140601_1..> | 2014-06-01 19:01 | 533M | |
![[SND]](/icons/sound2.gif) | psych1on1_140602_180..> | 2014-06-02 19:00 | 552M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1406..> | 2014-06-02 20:00 | 597M | |
![[SND]](/icons/sound2.gif) | apintofcacophony_140..> | 2014-06-02 23:00 | 704M | |
![[SND]](/icons/sound2.gif) | sarcasticnews_140604..> | 2014-06-04 20:00 | 563M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_140..> | 2014-06-04 22:02 | 562M | |
![[SND]](/icons/sound2.gif) | nlr_140605_180003_SR..> | 2014-06-05 19:00 | 505M | |
![[SND]](/icons/sound2.gif) | darkmark_140605_1901..> | 2014-06-05 20:01 | 559M | |
![[SND]](/icons/sound2.gif) | npr_140605_200420_SR..> | 2014-06-05 21:04 | 569M | |
![[SND]](/icons/sound2.gif) | imburger_140605_2108..> | 2014-06-05 22:08 | 472M | |
![[SND]](/icons/sound2.gif) | hardyardsla_140606_1..> | 2014-06-06 16:08 | 11M | |
![[SND]](/icons/sound2.gif) | mastersplayground_14..> | 2014-06-06 18:00 | 611M | |
![[SND]](/icons/sound2.gif) | hardyardsla_140608_1..> | 2014-06-08 19:00 | 560M | |
![[SND]](/icons/sound2.gif) | Fever Dog - Iroquois..> | 2014-06-09 14:17 | 24M | |
![[SND]](/icons/sound2.gif) | psych1on1_140609_180..> | 2014-06-09 19:00 | 566M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1406..> | 2014-06-09 20:00 | 557M | |
![[SND]](/icons/sound2.gif) | apintofcacophony_140..> | 2014-06-09 23:00 | 606M | |
![[SND]](/icons/sound2.gif) | entrepreneur_140610_..> | 2014-06-10 11:00 | 560M | |
![[SND]](/icons/sound2.gif) | indieface_140612_160..> | 2014-06-12 17:00 | 1.2G | |
![[SND]](/icons/sound2.gif) | nlr_140612_180002_SR..> | 2014-06-12 19:00 | 553M | |
![[SND]](/icons/sound2.gif) | darkmark_140612_1900..> | 2014-06-12 20:00 | 562M | |
![[SND]](/icons/sound2.gif) | npr_140612_200311_SR..> | 2014-06-12 21:03 | 591M | |
![[SND]](/icons/sound2.gif) | imburger_140612_2108..> | 2014-06-12 22:08 | 566M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_140..> | 2014-06-13 20:00 | 597M | |
![[SND]](/icons/sound2.gif) | deliasdarkside_14061..> | 2014-06-15 16:00 | 519M | |
![[SND]](/icons/sound2.gif) | hardyardsla_140615_1..> | 2014-06-15 18:59 | 1.1G | |
![[SND]](/icons/sound2.gif) | thequmranreport_1406..> | 2014-06-16 20:00 | 576M | |
![[SND]](/icons/sound2.gif) | apintofcacophony_140..> | 2014-06-16 21:03 | 591M | |
![[SND]](/icons/sound2.gif) | nlr_140619_180006_SR..> | 2014-06-19 19:00 | 553M | |
![[SND]](/icons/sound2.gif) | darkmark_140619_1901..> | 2014-06-19 20:01 | 564M | |
![[SND]](/icons/sound2.gif) | npr_140619_200410_SR..> | 2014-06-19 21:04 | 575M | |
![[SND]](/icons/sound2.gif) | imburger_140619_2107..> | 2014-06-19 22:07 | 566M | |
![[SND]](/icons/sound2.gif) | mastersplayground_14..> | 2014-06-20 18:00 | 608M | |
![[SND]](/icons/sound2.gif) | hardyardsla_140622_1..> | 2014-06-22 19:00 | 559M | |
![[SND]](/icons/sound2.gif) | psych1on1_140623_180..> | 2014-06-23 19:04 | 525M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1406..> | 2014-06-23 20:01 | 593M | |
![[SND]](/icons/sound2.gif) | entrepreneur_140624_..> | 2014-06-24 11:00 | 547M | |
![[SND]](/icons/sound2.gif) | intelkink_140625_200..> | 2014-06-25 21:00 | 555M | |
![[SND]](/icons/sound2.gif) | itsafairquestion_140..> | 2014-06-25 22:02 | 597M | |
![[SND]](/icons/sound2.gif) | nlr_140626_180005_SR..> | 2014-06-26 19:00 | 552M | |
![[SND]](/icons/sound2.gif) | darkmark_140626_1900..> | 2014-06-26 20:00 | 562M | |
![[SND]](/icons/sound2.gif) | npr_140626_200123_SR..> | 2014-06-26 21:01 | 576M | |
![[SND]](/icons/sound2.gif) | imburger_140626_2104..> | 2014-06-26 22:04 | 568M | |
![[SND]](/icons/sound2.gif) | mastersplayground_14..> | 2014-06-27 18:02 | 66M | |
![[SND]](/icons/sound2.gif) | mastersplayground_14..> | 2014-06-27 18:11 | 618M | |
![[SND]](/icons/sound2.gif) | deliasdarkside_14062..> | 2014-06-29 16:00 | 553M | |
![[SND]](/icons/sound2.gif) | hardyardsla_140629_1..> | 2014-06-29 19:00 | 561M | |
![[SND]](/icons/sound2.gif) | occupyskidrow_140629..> | 2014-06-29 20:03 | 589M | |
![[SND]](/icons/sound2.gif) | psych1on1_140630_180..> | 2014-06-30 19:00 | 558M | |
![[SND]](/icons/sound2.gif) | thequmranreport_1406..> | 2014-06-30 20:00 | 574M | |
![[SND]](/icons/sound2.gif) | apintofcacophony_140..> | 2014-06-30 21:03 | 630M | |
![[SND]](/icons/sound2.gif) | intelkink_140702_200..> | 2014-07-02 21:00 | 2.0G | |
![[SND]](/icons/sound2.gif) | npr_140703_200009_SR..> | 2014-07-03 21:00 | 571M | |
![[SND]](/icons/sound2.gif) | imburger_140703_2103..> | 2014-07-03 22:03 | 575M | |
![[SND]](/icons/sound2.gif) | blameginger_140707_1..> | 2014-07-07 16:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | thequmranreport_1407..> | 2014-07-07 20:00 | 583M | |
![[SND]](/icons/sound2.gif) | apintofcacophony_140..> | 2014-07-07 21:02 | 652M | |
![[SND]](/icons/sound2.gif) | Therapy Cable Promo.wav | 2014-07-07 22:08 | 6.4M | |
![[SND]](/icons/sound2.gif) | TherapyCable_promo.wav | 2014-07-07 22:08 | 6.4M | |
![[SND]](/icons/sound2.gif) | blameitonginger_1407..> | 2014-07-08 16:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | intelkink_140708_200..> | 2014-07-08 21:00 | 556M | |
![[SND]](/icons/sound2.gif) | psych1on1_140709_005..> | 2014-07-09 01:56 | 8.6M | |
![[SND]](/icons/sound2.gif) | battlesex_140709_142..> | 2014-07-09 15:22 | 7.3M | |
![[SND]](/icons/sound2.gif) | battlesex_140709_142..> | 2014-07-09 15:23 | 3.5M | |
![[SND]](/icons/sound2.gif) | blameitonginger_1407..> | 2014-07-09 16:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | battlesex_140709_170..> | 2014-07-09 18:08 | 528M | |
![[SND]](/icons/sound2.gif) | blameitonginger_1407..> | 2014-07-10 16:00 | 1.1G | |
![[SND]](/icons/sound2.gif) | darkmark_140710_1901..> | 2014-07-10 20:01 | 568M | |
![[SND]](/icons/sound2.gif) | 140710_200408_SRS001..> | 2014-07-10 21:04 | 100M | |
![[SND]](/icons/sound2.gif) | npr_140710_201443_SR..> | 2014-07-10 21:14 | 585M | |
![[SND]](/icons/sound2.gif) | 140711_010229_SRS001..> | 2014-07-11 02:02 | 553K | |
![[SND]](/icons/sound2.gif) | 140711_021528_SRS001..> | 2014-07-11 03:15 | 601K | |
![[SND]](/icons/sound2.gif) | 140711_022925_SRS001..> | 2014-07-11 03:29 | 625K | |
![[SND]](/icons/sound2.gif) | nlr_140710_180019_SR..> | |